diff --git a/website_quotation_template/README.rst b/website_quotation_template/README.rst
new file mode 100755
index 000000000..564231045
--- /dev/null
+++ b/website_quotation_template/README.rst
@@ -0,0 +1,47 @@
+.. image:: https://img.shields.io/badge/license-AGPL--3-blue.svg
+ :target: https://www.gnu.org/licenses/agpl-3.0-standalone.html
+ :alt: License: AGPL-3
+
+Website Quotation Template Snippet
+==================================
+* This module allow to select quotation template in website and add products
+ directly into cart.
+
+Configuration
+=============
+* No Additional configuration is needed.
+
+License
+-------
+Affero General Public License v3.0 (AGPL v3)
+(https://www.gnu.org/licenses/agpl-3.0-standalone.html)
+
+Company
+-------
+* `Cybrosys Techno Solutions `__
diff --git a/website_quotation_template/__init__.py b/website_quotation_template/__init__.py
new file mode 100644
index 000000000..e5cd0f7ee
--- /dev/null
+++ b/website_quotation_template/__init__.py
@@ -0,0 +1,23 @@
+# -*- coding: utf-8 -*-
+###############################################################################
+#
+# Cybrosys Technologies Pvt. Ltd.
+#
+# Copyright (C) 2023-TODAY Cybrosys Technologies()
+# Author: Athira PS (odoo@cybrosys.com)
+#
+# You can modify it under the terms of the GNU AFFERO
+# GENERAL PUBLIC LICENSE (AGPL v3), Version 3.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU AFFERO GENERAL PUBLIC LICENSE (AGPL v3) for more details.
+#
+# You should have received a copy of the GNU AFFERO GENERAL PUBLIC LICENSE
+# (AGPL v3) along with this program.
+# If not, see )
+# Author: Athira PS (odoo@cybrosys.com)
+#
+# You can modify it under the terms of the GNU AFFERO
+# GENERAL PUBLIC LICENSE (AGPL v3), Version 3.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU AFFERO GENERAL PUBLIC LICENSE (AGPL v3) for more details.
+#
+# You should have received a copy of the GNU AFFERO GENERAL PUBLIC LICENSE
+# (AGPL v3) along with this program.
+# If not, see )
+# Author: Athira P S (odoo@cybrosys.com)
+#
+# You can modify it under the terms of the GNU AFFERO
+# GENERAL PUBLIC LICENSE (AGPL v3), Version 3.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU AFFERO GENERAL PUBLIC LICENSE (AGPL v3) for more details.
+#
+# You should have received a copy of the GNU AFFERO GENERAL PUBLIC LICENSE
+# (AGPL v3) along with this program.
+# If not, see )
+# Author: Athira PS (odoo@cybrosys.com)
+#
+# You can modify it under the terms of the GNU AFFERO
+# GENERAL PUBLIC LICENSE (AGPL v3), Version 3.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU AFFERO GENERAL PUBLIC LICENSE (AGPL v3) for more details.
+#
+# You should have received a copy of the GNU AFFERO GENERAL PUBLIC LICENSE
+# (AGPL v3) along with this program.
+# If not, see ',
+ '/shop/category/',
+ '/shop/category//page/',
+ ], type='http', auth="public", website=True)
+ def shop(self, page=0, category=None, search='', min_price=0.0,
+ max_price=0.0, ppg=False, **post):
+ """Perform a shopping operation.
+ Args:
+ page (int): The page number of the shop.
+ category (str): The category of products to filter.
+ search (str): The search keyword to filter products.
+ min_price (float): The minimum price of products to filter.
+ max_price (float): The maximum price of products to filter.
+ ppg (bool): Whether to paginate the results.
+ **post: Additional keyword arguments.
+ Returns:
+ A response object with updated context.
+ """
+ response = super(ProductAddToCart, self).shop(page, category, search,
+ min_price, max_price, ppg,
+ **post)
+ response.qcontext.update(
+ val=request.env['sale.order.template'].sudo().search([]))
+ return response
+
+ @http.route('/product/add_cart', type='http', auth="public",
+ methods=['POST'], website=True, csrf=False)
+ def cart_update_product(self, express=False, add_qty=1, set_qty=0,
+ product_custom_attribute_values=None,
+ no_variant_attribute_values=None, **kw):
+ """Add products inside the quotation template into cart"""
+ order_temp = request.env['sale.order.template'].sudo().browse(
+ int(kw.get('prod_id')))
+ sale_order = request.website.sale_get_order(force_create=True)
+ for products in order_temp.sale_order_template_line_ids:
+ sale_order._cart_update(
+ product_id=int(products.product_id),
+ add_qty=products.product_uom_qty,
+ set_qty=set_qty,
+ product_custom_attribute_values=product_custom_attribute_values,
+ no_variant_attribute_values=no_variant_attribute_values, **kw)
+ request.session[
+ 'website_sale_cart_quantity'] = sale_order.cart_quantity
+ if express:
+ return request.redirect("/shop/checkout?express=1")
+ return request.redirect("/shop/cart")
diff --git a/website_quotation_template/controllers/snippet.py b/website_quotation_template/controllers/snippet.py
new file mode 100644
index 000000000..85b1c6f89
--- /dev/null
+++ b/website_quotation_template/controllers/snippet.py
@@ -0,0 +1,43 @@
+# -*- coding: utf-8 -*-
+###############################################################################
+#
+# Cybrosys Technologies Pvt. Ltd.
+#
+# Copyright (C) 2023-TODAY Cybrosys Technologies()
+# Author: Athira PS (odoo@cybrosys.com)
+#
+# You can modify it under the terms of the GNU AFFERO
+# GENERAL PUBLIC LICENSE (AGPL v3), Version 3.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU AFFERO GENERAL PUBLIC LICENSE (AGPL v3) for more details.
+#
+# You should have received a copy of the GNU AFFERO GENERAL PUBLIC LICENSE
+# (AGPL v3) along with this program.
+# If not, see
+
+#### 18.11.2023
+#### Version 16.0.1.0.0
+#### ADD
+- Initial commit for Website Quotation Template Snippet
diff --git a/website_quotation_template/models/__init__.py b/website_quotation_template/models/__init__.py
new file mode 100644
index 000000000..5559d962a
--- /dev/null
+++ b/website_quotation_template/models/__init__.py
@@ -0,0 +1,22 @@
+# -*- coding: utf-8 -*-
+###############################################################################
+#
+# Cybrosys Technologies Pvt. Ltd.
+#
+# Copyright (C) 2023-TODAY Cybrosys Technologies()
+# Author: Athira PS (odoo@cybrosys.com)
+#
+# You can modify it under the terms of the GNU AFFERO
+# GENERAL PUBLIC LICENSE (AGPL v3), Version 3.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU AFFERO GENERAL PUBLIC LICENSE (AGPL v3) for more details.
+#
+# You should have received a copy of the GNU AFFERO GENERAL PUBLIC LICENSE
+# (AGPL v3) along with this program.
+# If not, see )
+# Author: Athira PS (odoo@cybrosys.com)
+#
+# You can modify it under the terms of the GNU AFFERO
+# GENERAL PUBLIC LICENSE (AGPL v3), Version 3.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
+# GNU AFFERO GENERAL PUBLIC LICENSE (AGPL v3) for more details.
+#
+# You should have received a copy of the GNU AFFERO GENERAL PUBLIC LICENSE
+# (AGPL v3) along with this program.
+# If not, see ')
+ process.exit(1)
+}
+
+extract(source, {dir: dest}, function (err, results) {
+ if (err) {
+ console.error('error!', err)
+ process.exit(1)
+ } else {
+ process.exit(0)
+ }
+})
diff --git a/website_quotation_template/node_modules/.bin/html-pdf b/website_quotation_template/node_modules/.bin/html-pdf
new file mode 100755
index 000000000..d8b766156
--- /dev/null
+++ b/website_quotation_template/node_modules/.bin/html-pdf
@@ -0,0 +1,32 @@
+#!/usr/bin/env node
+
+var fs = require('fs')
+var pdf = require('../')
+var path = require('path')
+
+var args = process.argv.slice(2)
+
+if (args.length >= 2) {
+ htmlpdf(args[0], args[1])
+} else {
+ help()
+}
+
+function help () {
+ var help = [
+ 'Usage: html-pdf ',
+ 'e.g.: html-pdf source.html destination.pdf'
+ ].join('\n')
+
+ console.log(help)
+}
+
+function htmlpdf (source, destination) {
+ var html = fs.readFileSync(source, 'utf8')
+ var options = {
+ base: 'file://' + path.resolve(source)
+ }
+ pdf.create(html, options).toFile(destination, function (err, res) {
+ if (err) throw err
+ })
+}
diff --git a/website_quotation_template/node_modules/.bin/mammoth b/website_quotation_template/node_modules/.bin/mammoth
new file mode 100755
index 000000000..a908d0743
--- /dev/null
+++ b/website_quotation_template/node_modules/.bin/mammoth
@@ -0,0 +1,38 @@
+#!/usr/bin/env node
+
+var ArgumentParser = require("argparse").ArgumentParser;
+var main = require("../lib/main");
+
+var parser = new ArgumentParser({
+ addHelp: true
+});
+
+parser.addArgument(["docx-path"], {
+ type: "string",
+ help: "Path to the .docx file to convert."
+});
+
+var outputGroup = parser.addMutuallyExclusiveGroup();
+outputGroup.addArgument(["output-path"], {
+ type: "string",
+ nargs: "?",
+ help: "Output path for the generated document. Images will be stored inline in the output document. Output is written to stdout if not set."
+});
+outputGroup.addArgument(["--output-dir"], {
+ type: "string",
+ help: "Output directory for generated HTML and images. Images will be stored in separate files. Mutually exclusive with output-path."
+});
+
+parser.addArgument(["--output-format"], {
+ defaultValue: "html",
+ choices: ["html", "markdown"],
+ help: "Output format."
+});
+
+parser.addArgument(["--style-map"], {
+ type: "string",
+ help: "File containg a style map."
+});
+
+
+main(parser.parseArgs());
diff --git a/website_quotation_template/node_modules/.bin/mkdirp b/website_quotation_template/node_modules/.bin/mkdirp
new file mode 100755
index 000000000..d95de15ae
--- /dev/null
+++ b/website_quotation_template/node_modules/.bin/mkdirp
@@ -0,0 +1,33 @@
+#!/usr/bin/env node
+
+var mkdirp = require('../');
+var minimist = require('minimist');
+var fs = require('fs');
+
+var argv = minimist(process.argv.slice(2), {
+ alias: { m: 'mode', h: 'help' },
+ string: [ 'mode' ]
+});
+if (argv.help) {
+ fs.createReadStream(__dirname + '/usage.txt').pipe(process.stdout);
+ return;
+}
+
+var paths = argv._.slice();
+var mode = argv.mode ? parseInt(argv.mode, 8) : undefined;
+
+(function next () {
+ if (paths.length === 0) return;
+ var p = paths.shift();
+
+ if (mode === undefined) mkdirp(p, cb)
+ else mkdirp(p, mode, cb)
+
+ function cb (err) {
+ if (err) {
+ console.error(err.message);
+ process.exit(1);
+ }
+ else next();
+ }
+})();
diff --git a/website_quotation_template/node_modules/.bin/phantomjs b/website_quotation_template/node_modules/.bin/phantomjs
new file mode 100755
index 000000000..637cba7f1
--- /dev/null
+++ b/website_quotation_template/node_modules/.bin/phantomjs
@@ -0,0 +1,42 @@
+#!/usr/bin/env node
+
+/**
+ * Script that will execute the downloaded phantomjs binary. stdio are
+ * forwarded to and from the child process.
+ *
+ * The following is for an ugly hack to avoid a problem where the installer
+ * finds the bin script npm creates during global installation.
+ *
+ * {NPM_INSTALL_MARKER}
+ */
+
+var path = require('path')
+var spawn = require('child_process').spawn
+
+var binPath = require(path.join(__dirname, '..', 'lib', 'phantomjs')).path
+
+var args = process.argv.slice(2)
+
+// For Node 0.6 compatibility, pipe the streams manually, instead of using
+// `{ stdio: 'inherit' }`.
+var cp = spawn(binPath, args)
+cp.stdout.pipe(process.stdout)
+cp.stderr.pipe(process.stderr)
+process.stdin.pipe(cp.stdin)
+
+cp.on('error', function (err) {
+ console.error('Error executing phantom at', binPath)
+ console.error(err.stack)
+})
+
+cp.on('exit', function(code){
+ // Wait few ms for error to be printed.
+ setTimeout(function(){
+ process.exit(code)
+ }, 20)
+});
+
+process.on('SIGTERM', function() {
+ cp.kill('SIGTERM')
+ process.exit(1)
+})
diff --git a/website_quotation_template/node_modules/.bin/sshpk-conv b/website_quotation_template/node_modules/.bin/sshpk-conv
new file mode 100755
index 000000000..e839ede5b
--- /dev/null
+++ b/website_quotation_template/node_modules/.bin/sshpk-conv
@@ -0,0 +1,243 @@
+#!/usr/bin/env node
+// -*- mode: js -*-
+// vim: set filetype=javascript :
+// Copyright 2018 Joyent, Inc. All rights reserved.
+
+var dashdash = require('dashdash');
+var sshpk = require('../lib/index');
+var fs = require('fs');
+var path = require('path');
+var tty = require('tty');
+var readline = require('readline');
+var getPassword = require('getpass').getPass;
+
+var options = [
+ {
+ names: ['outformat', 't'],
+ type: 'string',
+ help: 'Output format'
+ },
+ {
+ names: ['informat', 'T'],
+ type: 'string',
+ help: 'Input format'
+ },
+ {
+ names: ['file', 'f'],
+ type: 'string',
+ help: 'Input file name (default stdin)'
+ },
+ {
+ names: ['out', 'o'],
+ type: 'string',
+ help: 'Output file name (default stdout)'
+ },
+ {
+ names: ['private', 'p'],
+ type: 'bool',
+ help: 'Produce a private key as output'
+ },
+ {
+ names: ['derive', 'd'],
+ type: 'string',
+ help: 'Output a new key derived from this one, with given algo'
+ },
+ {
+ names: ['identify', 'i'],
+ type: 'bool',
+ help: 'Print key metadata instead of converting'
+ },
+ {
+ names: ['fingerprint', 'F'],
+ type: 'bool',
+ help: 'Output key fingerprint'
+ },
+ {
+ names: ['hash', 'H'],
+ type: 'string',
+ help: 'Hash function to use for key fingeprint with -F'
+ },
+ {
+ names: ['spki', 's'],
+ type: 'bool',
+ help: 'With -F, generates an SPKI fingerprint instead of SSH'
+ },
+ {
+ names: ['comment', 'c'],
+ type: 'string',
+ help: 'Set key comment, if output format supports'
+ },
+ {
+ names: ['help', 'h'],
+ type: 'bool',
+ help: 'Shows this help text'
+ }
+];
+
+if (require.main === module) {
+ var parser = dashdash.createParser({
+ options: options
+ });
+
+ try {
+ var opts = parser.parse(process.argv);
+ } catch (e) {
+ console.error('sshpk-conv: error: %s', e.message);
+ process.exit(1);
+ }
+
+ if (opts.help || opts._args.length > 1) {
+ var help = parser.help({}).trimRight();
+ console.error('sshpk-conv: converts between SSH key formats\n');
+ console.error(help);
+ console.error('\navailable key formats:');
+ console.error(' - pem, pkcs1 eg id_rsa');
+ console.error(' - ssh eg id_rsa.pub');
+ console.error(' - pkcs8 format you want for openssl');
+ console.error(' - openssh like output of ssh-keygen -o');
+ console.error(' - rfc4253 raw OpenSSH wire format');
+ console.error(' - dnssec dnssec-keygen format');
+ console.error(' - putty PuTTY ppk format');
+ console.error('\navailable fingerprint formats:');
+ console.error(' - hex colon-separated hex for SSH');
+ console.error(' straight hex for SPKI');
+ console.error(' - base64 SHA256:* format from OpenSSH');
+ process.exit(1);
+ }
+
+ /*
+ * Key derivation can only be done on private keys, so use of the -d
+ * option necessarily implies -p.
+ */
+ if (opts.derive)
+ opts.private = true;
+
+ var inFile = process.stdin;
+ var inFileName = 'stdin';
+
+ var inFilePath;
+ if (opts.file) {
+ inFilePath = opts.file;
+ } else if (opts._args.length === 1) {
+ inFilePath = opts._args[0];
+ }
+
+ if (inFilePath)
+ inFileName = path.basename(inFilePath);
+
+ try {
+ if (inFilePath) {
+ fs.accessSync(inFilePath, fs.R_OK);
+ inFile = fs.createReadStream(inFilePath);
+ }
+ } catch (e) {
+ ifError(e, 'error opening input file');
+ }
+
+ var outFile = process.stdout;
+
+ try {
+ if (opts.out && !opts.identify) {
+ fs.accessSync(path.dirname(opts.out), fs.W_OK);
+ outFile = fs.createWriteStream(opts.out);
+ }
+ } catch (e) {
+ ifError(e, 'error opening output file');
+ }
+
+ var bufs = [];
+ inFile.on('readable', function () {
+ var data;
+ while ((data = inFile.read()))
+ bufs.push(data);
+ });
+ var parseOpts = {};
+ parseOpts.filename = inFileName;
+ inFile.on('end', function processKey() {
+ var buf = Buffer.concat(bufs);
+ var fmt = 'auto';
+ if (opts.informat)
+ fmt = opts.informat;
+ var f = sshpk.parseKey;
+ if (opts.private)
+ f = sshpk.parsePrivateKey;
+ try {
+ var key = f(buf, fmt, parseOpts);
+ } catch (e) {
+ if (e.name === 'KeyEncryptedError') {
+ getPassword(function (err, pw) {
+ if (err)
+ ifError(err);
+ parseOpts.passphrase = pw;
+ processKey();
+ });
+ return;
+ }
+ ifError(e);
+ }
+
+ if (opts.derive)
+ key = key.derive(opts.derive);
+
+ if (opts.comment)
+ key.comment = opts.comment;
+
+ if (opts.identify) {
+ var kind = 'public';
+ if (sshpk.PrivateKey.isPrivateKey(key))
+ kind = 'private';
+ console.log('%s: a %d bit %s %s key', inFileName,
+ key.size, key.type.toUpperCase(), kind);
+ if (key.type === 'ecdsa')
+ console.log('ECDSA curve: %s', key.curve);
+ if (key.comment)
+ console.log('Comment: %s', key.comment);
+ console.log('SHA256 fingerprint: ' +
+ key.fingerprint('sha256').toString());
+ console.log('MD5 fingerprint: ' +
+ key.fingerprint('md5').toString());
+ console.log('SPKI-SHA256 fingerprint: ' +
+ key.fingerprint('sha256', 'spki').toString());
+ process.exit(0);
+ return;
+ }
+
+ if (opts.fingerprint) {
+ var hash = opts.hash;
+ var type = opts.spki ? 'spki' : 'ssh';
+ var format = opts.outformat;
+ var fp = key.fingerprint(hash, type).toString(format);
+ outFile.write(fp);
+ outFile.write('\n');
+ outFile.once('drain', function () {
+ process.exit(0);
+ });
+ return;
+ }
+
+ fmt = undefined;
+ if (opts.outformat)
+ fmt = opts.outformat;
+ outFile.write(key.toBuffer(fmt));
+ if (fmt === 'ssh' ||
+ (!opts.private && fmt === undefined))
+ outFile.write('\n');
+ outFile.once('drain', function () {
+ process.exit(0);
+ });
+ });
+}
+
+function ifError(e, txt) {
+ if (txt)
+ txt = txt + ': ';
+ else
+ txt = '';
+ console.error('sshpk-conv: ' + txt + e.name + ': ' + e.message);
+ if (process.env['DEBUG'] || process.env['V']) {
+ console.error(e.stack);
+ if (e.innerErr)
+ console.error(e.innerErr.stack);
+ }
+ process.exit(1);
+}
diff --git a/website_quotation_template/node_modules/.bin/sshpk-sign b/website_quotation_template/node_modules/.bin/sshpk-sign
new file mode 100755
index 000000000..673fc9864
--- /dev/null
+++ b/website_quotation_template/node_modules/.bin/sshpk-sign
@@ -0,0 +1,191 @@
+#!/usr/bin/env node
+// -*- mode: js -*-
+// vim: set filetype=javascript :
+// Copyright 2015 Joyent, Inc. All rights reserved.
+
+var dashdash = require('dashdash');
+var sshpk = require('../lib/index');
+var fs = require('fs');
+var path = require('path');
+var getPassword = require('getpass').getPass;
+
+var options = [
+ {
+ names: ['hash', 'H'],
+ type: 'string',
+ help: 'Hash algorithm (sha1, sha256, sha384, sha512)'
+ },
+ {
+ names: ['verbose', 'v'],
+ type: 'bool',
+ help: 'Display verbose info about key and hash used'
+ },
+ {
+ names: ['identity', 'i'],
+ type: 'string',
+ help: 'Path to key to use'
+ },
+ {
+ names: ['file', 'f'],
+ type: 'string',
+ help: 'Input filename'
+ },
+ {
+ names: ['out', 'o'],
+ type: 'string',
+ help: 'Output filename'
+ },
+ {
+ names: ['format', 't'],
+ type: 'string',
+ help: 'Signature format (asn1, ssh, raw)'
+ },
+ {
+ names: ['binary', 'b'],
+ type: 'bool',
+ help: 'Output raw binary instead of base64'
+ },
+ {
+ names: ['help', 'h'],
+ type: 'bool',
+ help: 'Shows this help text'
+ }
+];
+
+var parseOpts = {};
+
+if (require.main === module) {
+ var parser = dashdash.createParser({
+ options: options
+ });
+
+ try {
+ var opts = parser.parse(process.argv);
+ } catch (e) {
+ console.error('sshpk-sign: error: %s', e.message);
+ process.exit(1);
+ }
+
+ if (opts.help || opts._args.length > 1) {
+ var help = parser.help({}).trimRight();
+ console.error('sshpk-sign: sign data using an SSH key\n');
+ console.error(help);
+ process.exit(1);
+ }
+
+ if (!opts.identity) {
+ var help = parser.help({}).trimRight();
+ console.error('sshpk-sign: the -i or --identity option ' +
+ 'is required\n');
+ console.error(help);
+ process.exit(1);
+ }
+
+ var keyData = fs.readFileSync(opts.identity);
+ parseOpts.filename = opts.identity;
+
+ run();
+}
+
+function run() {
+ var key;
+ try {
+ key = sshpk.parsePrivateKey(keyData, 'auto', parseOpts);
+ } catch (e) {
+ if (e.name === 'KeyEncryptedError') {
+ getPassword(function (err, pw) {
+ parseOpts.passphrase = pw;
+ run();
+ });
+ return;
+ }
+ console.error('sshpk-sign: error loading private key "' +
+ opts.identity + '": ' + e.name + ': ' + e.message);
+ process.exit(1);
+ }
+
+ var hash = opts.hash || key.defaultHashAlgorithm();
+
+ var signer;
+ try {
+ signer = key.createSign(hash);
+ } catch (e) {
+ console.error('sshpk-sign: error creating signer: ' +
+ e.name + ': ' + e.message);
+ process.exit(1);
+ }
+
+ if (opts.verbose) {
+ console.error('sshpk-sign: using %s-%s with a %d bit key',
+ key.type, hash, key.size);
+ }
+
+ var inFile = process.stdin;
+ var inFileName = 'stdin';
+
+ var inFilePath;
+ if (opts.file) {
+ inFilePath = opts.file;
+ } else if (opts._args.length === 1) {
+ inFilePath = opts._args[0];
+ }
+
+ if (inFilePath)
+ inFileName = path.basename(inFilePath);
+
+ try {
+ if (inFilePath) {
+ fs.accessSync(inFilePath, fs.R_OK);
+ inFile = fs.createReadStream(inFilePath);
+ }
+ } catch (e) {
+ console.error('sshpk-sign: error opening input file' +
+ ': ' + e.name + ': ' + e.message);
+ process.exit(1);
+ }
+
+ var outFile = process.stdout;
+
+ try {
+ if (opts.out && !opts.identify) {
+ fs.accessSync(path.dirname(opts.out), fs.W_OK);
+ outFile = fs.createWriteStream(opts.out);
+ }
+ } catch (e) {
+ console.error('sshpk-sign: error opening output file' +
+ ': ' + e.name + ': ' + e.message);
+ process.exit(1);
+ }
+
+ inFile.pipe(signer);
+ inFile.on('end', function () {
+ var sig;
+ try {
+ sig = signer.sign();
+ } catch (e) {
+ console.error('sshpk-sign: error signing data: ' +
+ e.name + ': ' + e.message);
+ process.exit(1);
+ }
+
+ var fmt = opts.format || 'asn1';
+ var output;
+ try {
+ output = sig.toBuffer(fmt);
+ if (!opts.binary)
+ output = output.toString('base64');
+ } catch (e) {
+ console.error('sshpk-sign: error converting signature' +
+ ' to ' + fmt + ' format: ' + e.name + ': ' +
+ e.message);
+ process.exit(1);
+ }
+
+ outFile.write(output);
+ if (!opts.binary)
+ outFile.write('\n');
+ outFile.once('drain', function () {
+ process.exit(0);
+ });
+ });
+}
diff --git a/website_quotation_template/node_modules/.bin/sshpk-verify b/website_quotation_template/node_modules/.bin/sshpk-verify
new file mode 100755
index 000000000..fc71a82c8
--- /dev/null
+++ b/website_quotation_template/node_modules/.bin/sshpk-verify
@@ -0,0 +1,167 @@
+#!/usr/bin/env node
+// -*- mode: js -*-
+// vim: set filetype=javascript :
+// Copyright 2015 Joyent, Inc. All rights reserved.
+
+var dashdash = require('dashdash');
+var sshpk = require('../lib/index');
+var fs = require('fs');
+var path = require('path');
+var Buffer = require('safer-buffer').Buffer;
+
+var options = [
+ {
+ names: ['hash', 'H'],
+ type: 'string',
+ help: 'Hash algorithm (sha1, sha256, sha384, sha512)'
+ },
+ {
+ names: ['verbose', 'v'],
+ type: 'bool',
+ help: 'Display verbose info about key and hash used'
+ },
+ {
+ names: ['identity', 'i'],
+ type: 'string',
+ help: 'Path to (public) key to use'
+ },
+ {
+ names: ['file', 'f'],
+ type: 'string',
+ help: 'Input filename'
+ },
+ {
+ names: ['format', 't'],
+ type: 'string',
+ help: 'Signature format (asn1, ssh, raw)'
+ },
+ {
+ names: ['signature', 's'],
+ type: 'string',
+ help: 'base64-encoded signature data'
+ },
+ {
+ names: ['help', 'h'],
+ type: 'bool',
+ help: 'Shows this help text'
+ }
+];
+
+if (require.main === module) {
+ var parser = dashdash.createParser({
+ options: options
+ });
+
+ try {
+ var opts = parser.parse(process.argv);
+ } catch (e) {
+ console.error('sshpk-verify: error: %s', e.message);
+ process.exit(3);
+ }
+
+ if (opts.help || opts._args.length > 1) {
+ var help = parser.help({}).trimRight();
+ console.error('sshpk-verify: sign data using an SSH key\n');
+ console.error(help);
+ process.exit(3);
+ }
+
+ if (!opts.identity) {
+ var help = parser.help({}).trimRight();
+ console.error('sshpk-verify: the -i or --identity option ' +
+ 'is required\n');
+ console.error(help);
+ process.exit(3);
+ }
+
+ if (!opts.signature) {
+ var help = parser.help({}).trimRight();
+ console.error('sshpk-verify: the -s or --signature option ' +
+ 'is required\n');
+ console.error(help);
+ process.exit(3);
+ }
+
+ var keyData = fs.readFileSync(opts.identity);
+
+ var key;
+ try {
+ key = sshpk.parseKey(keyData);
+ } catch (e) {
+ console.error('sshpk-verify: error loading key "' +
+ opts.identity + '": ' + e.name + ': ' + e.message);
+ process.exit(2);
+ }
+
+ var fmt = opts.format || 'asn1';
+ var sigData = Buffer.from(opts.signature, 'base64');
+
+ var sig;
+ try {
+ sig = sshpk.parseSignature(sigData, key.type, fmt);
+ } catch (e) {
+ console.error('sshpk-verify: error parsing signature: ' +
+ e.name + ': ' + e.message);
+ process.exit(2);
+ }
+
+ var hash = opts.hash || key.defaultHashAlgorithm();
+
+ var verifier;
+ try {
+ verifier = key.createVerify(hash);
+ } catch (e) {
+ console.error('sshpk-verify: error creating verifier: ' +
+ e.name + ': ' + e.message);
+ process.exit(2);
+ }
+
+ if (opts.verbose) {
+ console.error('sshpk-verify: using %s-%s with a %d bit key',
+ key.type, hash, key.size);
+ }
+
+ var inFile = process.stdin;
+ var inFileName = 'stdin';
+
+ var inFilePath;
+ if (opts.file) {
+ inFilePath = opts.file;
+ } else if (opts._args.length === 1) {
+ inFilePath = opts._args[0];
+ }
+
+ if (inFilePath)
+ inFileName = path.basename(inFilePath);
+
+ try {
+ if (inFilePath) {
+ fs.accessSync(inFilePath, fs.R_OK);
+ inFile = fs.createReadStream(inFilePath);
+ }
+ } catch (e) {
+ console.error('sshpk-verify: error opening input file' +
+ ': ' + e.name + ': ' + e.message);
+ process.exit(2);
+ }
+
+ inFile.pipe(verifier);
+ inFile.on('end', function () {
+ var ret;
+ try {
+ ret = verifier.verify(sig);
+ } catch (e) {
+ console.error('sshpk-verify: error verifying data: ' +
+ e.name + ': ' + e.message);
+ process.exit(1);
+ }
+
+ if (ret) {
+ console.error('OK');
+ process.exit(0);
+ }
+
+ console.error('NOT OK');
+ process.exit(1);
+ });
+}
diff --git a/website_quotation_template/node_modules/.bin/uuid b/website_quotation_template/node_modules/.bin/uuid
new file mode 100755
index 000000000..502626e60
--- /dev/null
+++ b/website_quotation_template/node_modules/.bin/uuid
@@ -0,0 +1,65 @@
+#!/usr/bin/env node
+var assert = require('assert');
+
+function usage() {
+ console.log('Usage:');
+ console.log(' uuid');
+ console.log(' uuid v1');
+ console.log(' uuid v3 ');
+ console.log(' uuid v4');
+ console.log(' uuid v5 ');
+ console.log(' uuid --help');
+ console.log('\nNote: may be "URL" or "DNS" to use the corresponding UUIDs defined by RFC4122');
+}
+
+var args = process.argv.slice(2);
+
+if (args.indexOf('--help') >= 0) {
+ usage();
+ process.exit(0);
+}
+var version = args.shift() || 'v4';
+
+switch (version) {
+ case 'v1':
+ var uuidV1 = require('../v1');
+ console.log(uuidV1());
+ break;
+
+ case 'v3':
+ var uuidV3 = require('../v3');
+
+ var name = args.shift();
+ var namespace = args.shift();
+ assert(name != null, 'v3 name not specified');
+ assert(namespace != null, 'v3 namespace not specified');
+
+ if (namespace == 'URL') namespace = uuidV3.URL;
+ if (namespace == 'DNS') namespace = uuidV3.DNS;
+
+ console.log(uuidV3(name, namespace));
+ break;
+
+ case 'v4':
+ var uuidV4 = require('../v4');
+ console.log(uuidV4());
+ break;
+
+ case 'v5':
+ var uuidV5 = require('../v5');
+
+ var name = args.shift();
+ var namespace = args.shift();
+ assert(name != null, 'v5 name not specified');
+ assert(namespace != null, 'v5 namespace not specified');
+
+ if (namespace == 'URL') namespace = uuidV5.URL;
+ if (namespace == 'DNS') namespace = uuidV5.DNS;
+
+ console.log(uuidV5(name, namespace));
+ break;
+
+ default:
+ usage();
+ process.exit(1);
+}
diff --git a/website_quotation_template/node_modules/.bin/which b/website_quotation_template/node_modules/.bin/which
new file mode 100755
index 000000000..7cee3729e
--- /dev/null
+++ b/website_quotation_template/node_modules/.bin/which
@@ -0,0 +1,52 @@
+#!/usr/bin/env node
+var which = require("../")
+if (process.argv.length < 3)
+ usage()
+
+function usage () {
+ console.error('usage: which [-as] program ...')
+ process.exit(1)
+}
+
+var all = false
+var silent = false
+var dashdash = false
+var args = process.argv.slice(2).filter(function (arg) {
+ if (dashdash || !/^-/.test(arg))
+ return true
+
+ if (arg === '--') {
+ dashdash = true
+ return false
+ }
+
+ var flags = arg.substr(1).split('')
+ for (var f = 0; f < flags.length; f++) {
+ var flag = flags[f]
+ switch (flag) {
+ case 's':
+ silent = true
+ break
+ case 'a':
+ all = true
+ break
+ default:
+ console.error('which: illegal option -- ' + flag)
+ usage()
+ }
+ }
+ return false
+})
+
+process.exit(args.reduce(function (pv, current) {
+ try {
+ var f = which.sync(current, { all: all })
+ if (all)
+ f = f.join('\n')
+ if (!silent)
+ console.log(f)
+ return pv;
+ } catch (e) {
+ return 1;
+ }
+}, 0))
diff --git a/website_quotation_template/node_modules/ajv/.tonic_example.js b/website_quotation_template/node_modules/ajv/.tonic_example.js
new file mode 100644
index 000000000..aa11812d8
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/.tonic_example.js
@@ -0,0 +1,20 @@
+var Ajv = require('ajv');
+var ajv = new Ajv({allErrors: true});
+
+var schema = {
+ "properties": {
+ "foo": { "type": "string" },
+ "bar": { "type": "number", "maximum": 3 }
+ }
+};
+
+var validate = ajv.compile(schema);
+
+test({"foo": "abc", "bar": 2});
+test({"foo": 2, "bar": 4});
+
+function test(data) {
+ var valid = validate(data);
+ if (valid) console.log('Valid!');
+ else console.log('Invalid: ' + ajv.errorsText(validate.errors));
+}
\ No newline at end of file
diff --git a/website_quotation_template/node_modules/ajv/LICENSE b/website_quotation_template/node_modules/ajv/LICENSE
new file mode 100644
index 000000000..96ee71998
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/LICENSE
@@ -0,0 +1,22 @@
+The MIT License (MIT)
+
+Copyright (c) 2015-2017 Evgeny Poberezkin
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
+
diff --git a/website_quotation_template/node_modules/ajv/README.md b/website_quotation_template/node_modules/ajv/README.md
new file mode 100644
index 000000000..5aa2078d8
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/README.md
@@ -0,0 +1,1497 @@
+);
+
+ message: string;
+ errors: Array;
+ ajv: true;
+ validation: true;
+ }
+
+ class MissingRefError extends Error {
+ constructor(baseId: string, ref: string, message?: string);
+ static message: (baseId: string, ref: string) => string;
+
+ message: string;
+ missingRef: string;
+ missingSchema: string;
+ }
+}
+
+declare namespace ajv {
+ type ValidationError = AjvErrors.ValidationError;
+
+ type MissingRefError = AjvErrors.MissingRefError;
+
+ interface Ajv {
+ /**
+ * Validate data using schema
+ * Schema will be compiled and cached (using serialized JSON as key, [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used to serialize by default).
+ * @param {string|object|Boolean} schemaKeyRef key, ref or schema object
+ * @param {Any} data to be validated
+ * @return {Boolean} validation result. Errors from the last validation will be available in `ajv.errors` (and also in compiled schema: `schema.errors`).
+ */
+ validate(schemaKeyRef: object | string | boolean, data: any): boolean | PromiseLike;
+ /**
+ * Create validating function for passed schema.
+ * @param {object|Boolean} schema schema object
+ * @return {Function} validating function
+ */
+ compile(schema: object | boolean): ValidateFunction;
+ /**
+ * Creates validating function for passed schema with asynchronous loading of missing schemas.
+ * `loadSchema` option should be a function that accepts schema uri and node-style callback.
+ * @this Ajv
+ * @param {object|Boolean} schema schema object
+ * @param {Boolean} meta optional true to compile meta-schema; this parameter can be skipped
+ * @param {Function} callback optional node-style callback, it is always called with 2 parameters: error (or null) and validating function.
+ * @return {PromiseLike} validating function
+ */
+ compileAsync(schema: object | boolean, meta?: Boolean, callback?: (err: Error, validate: ValidateFunction) => any): PromiseLike;
+ /**
+ * Adds schema to the instance.
+ * @param {object|Array} schema schema or array of schemas. If array is passed, `key` and other parameters will be ignored.
+ * @param {string} key Optional schema key. Can be passed to `validate` method instead of schema object or id/ref. One schema per instance can have empty `id` and `key`.
+ * @return {Ajv} this for method chaining
+ */
+ addSchema(schema: Array | object, key?: string): Ajv;
+ /**
+ * Add schema that will be used to validate other schemas
+ * options in META_IGNORE_OPTIONS are alway set to false
+ * @param {object} schema schema object
+ * @param {string} key optional schema key
+ * @return {Ajv} this for method chaining
+ */
+ addMetaSchema(schema: object, key?: string): Ajv;
+ /**
+ * Validate schema
+ * @param {object|Boolean} schema schema to validate
+ * @return {Boolean} true if schema is valid
+ */
+ validateSchema(schema: object | boolean): boolean;
+ /**
+ * Get compiled schema from the instance by `key` or `ref`.
+ * @param {string} keyRef `key` that was passed to `addSchema` or full schema reference (`schema.id` or resolved id).
+ * @return {Function} schema validating function (with property `schema`). Returns undefined if keyRef can't be resolved to an existing schema.
+ */
+ getSchema(keyRef: string): ValidateFunction | undefined;
+ /**
+ * Remove cached schema(s).
+ * If no parameter is passed all schemas but meta-schemas are removed.
+ * If RegExp is passed all schemas with key/id matching pattern but meta-schemas are removed.
+ * Even if schema is referenced by other schemas it still can be removed as other schemas have local references.
+ * @param {string|object|RegExp|Boolean} schemaKeyRef key, ref, pattern to match key/ref or schema object
+ * @return {Ajv} this for method chaining
+ */
+ removeSchema(schemaKeyRef?: object | string | RegExp | boolean): Ajv;
+ /**
+ * Add custom format
+ * @param {string} name format name
+ * @param {string|RegExp|Function} format string is converted to RegExp; function should return boolean (true when valid)
+ * @return {Ajv} this for method chaining
+ */
+ addFormat(name: string, format: FormatValidator | FormatDefinition): Ajv;
+ /**
+ * Define custom keyword
+ * @this Ajv
+ * @param {string} keyword custom keyword, should be a valid identifier, should be different from all standard, custom and macro keywords.
+ * @param {object} definition keyword definition object with properties `type` (type(s) which the keyword applies to), `validate` or `compile`.
+ * @return {Ajv} this for method chaining
+ */
+ addKeyword(keyword: string, definition: KeywordDefinition): Ajv;
+ /**
+ * Get keyword definition
+ * @this Ajv
+ * @param {string} keyword pre-defined or custom keyword.
+ * @return {object|Boolean} custom keyword definition, `true` if it is a predefined keyword, `false` otherwise.
+ */
+ getKeyword(keyword: string): object | boolean;
+ /**
+ * Remove keyword
+ * @this Ajv
+ * @param {string} keyword pre-defined or custom keyword.
+ * @return {Ajv} this for method chaining
+ */
+ removeKeyword(keyword: string): Ajv;
+ /**
+ * Validate keyword
+ * @this Ajv
+ * @param {object} definition keyword definition object
+ * @param {boolean} throwError true to throw exception if definition is invalid
+ * @return {boolean} validation result
+ */
+ validateKeyword(definition: KeywordDefinition, throwError: boolean): boolean;
+ /**
+ * Convert array of error message objects to string
+ * @param {Array} errors optional array of validation errors, if not passed errors from the instance are used.
+ * @param {object} options optional options with properties `separator` and `dataVar`.
+ * @return {string} human readable string with all errors descriptions
+ */
+ errorsText(errors?: Array | null, options?: ErrorsTextOptions): string;
+ errors?: Array | null;
+ _opts: Options;
+ }
+
+ interface CustomLogger {
+ log(...args: any[]): any;
+ warn(...args: any[]): any;
+ error(...args: any[]): any;
+ }
+
+ interface ValidateFunction {
+ (
+ data: any,
+ dataPath?: string,
+ parentData?: object | Array,
+ parentDataProperty?: string | number,
+ rootData?: object | Array
+ ): boolean | PromiseLike;
+ schema?: object | boolean;
+ errors?: null | Array;
+ refs?: object;
+ refVal?: Array;
+ root?: ValidateFunction | object;
+ $async?: true;
+ source?: object;
+ }
+
+ interface Options {
+ $data?: boolean;
+ allErrors?: boolean;
+ verbose?: boolean;
+ jsonPointers?: boolean;
+ uniqueItems?: boolean;
+ unicode?: boolean;
+ format?: false | string;
+ formats?: object;
+ keywords?: object;
+ unknownFormats?: true | string[] | 'ignore';
+ schemas?: Array | object;
+ schemaId?: '$id' | 'id' | 'auto';
+ missingRefs?: true | 'ignore' | 'fail';
+ extendRefs?: true | 'ignore' | 'fail';
+ loadSchema?: (uri: string, cb?: (err: Error, schema: object) => void) => PromiseLike;
+ removeAdditional?: boolean | 'all' | 'failing';
+ useDefaults?: boolean | 'empty' | 'shared';
+ coerceTypes?: boolean | 'array';
+ strictDefaults?: boolean | 'log';
+ strictKeywords?: boolean | 'log';
+ strictNumbers?: boolean;
+ async?: boolean | string;
+ transpile?: string | ((code: string) => string);
+ meta?: boolean | object;
+ validateSchema?: boolean | 'log';
+ addUsedSchema?: boolean;
+ inlineRefs?: boolean | number;
+ passContext?: boolean;
+ loopRequired?: number;
+ ownProperties?: boolean;
+ multipleOfPrecision?: boolean | number;
+ errorDataPath?: string,
+ messages?: boolean;
+ sourceCode?: boolean;
+ processCode?: (code: string, schema: object) => string;
+ cache?: object;
+ logger?: CustomLogger | false;
+ nullable?: boolean;
+ serialize?: ((schema: object | boolean) => any) | false;
+ }
+
+ type FormatValidator = string | RegExp | ((data: string) => boolean | PromiseLike);
+ type NumberFormatValidator = ((data: number) => boolean | PromiseLike);
+
+ interface NumberFormatDefinition {
+ type: "number",
+ validate: NumberFormatValidator;
+ compare?: (data1: number, data2: number) => number;
+ async?: boolean;
+ }
+
+ interface StringFormatDefinition {
+ type?: "string",
+ validate: FormatValidator;
+ compare?: (data1: string, data2: string) => number;
+ async?: boolean;
+ }
+
+ type FormatDefinition = NumberFormatDefinition | StringFormatDefinition;
+
+ interface KeywordDefinition {
+ type?: string | Array;
+ async?: boolean;
+ $data?: boolean;
+ errors?: boolean | string;
+ metaSchema?: object;
+ // schema: false makes validate not to expect schema (ValidateFunction)
+ schema?: boolean;
+ statements?: boolean;
+ dependencies?: Array;
+ modifying?: boolean;
+ valid?: boolean;
+ // one and only one of the following properties should be present
+ validate?: SchemaValidateFunction | ValidateFunction;
+ compile?: (schema: any, parentSchema: object, it: CompilationContext) => ValidateFunction;
+ macro?: (schema: any, parentSchema: object, it: CompilationContext) => object | boolean;
+ inline?: (it: CompilationContext, keyword: string, schema: any, parentSchema: object) => string;
+ }
+
+ interface CompilationContext {
+ level: number;
+ dataLevel: number;
+ dataPathArr: string[];
+ schema: any;
+ schemaPath: string;
+ baseId: string;
+ async: boolean;
+ opts: Options;
+ formats: {
+ [index: string]: FormatDefinition | undefined;
+ };
+ keywords: {
+ [index: string]: KeywordDefinition | undefined;
+ };
+ compositeRule: boolean;
+ validate: (schema: object) => boolean;
+ util: {
+ copy(obj: any, target?: any): any;
+ toHash(source: string[]): { [index: string]: true | undefined };
+ equal(obj: any, target: any): boolean;
+ getProperty(str: string): string;
+ schemaHasRules(schema: object, rules: any): string;
+ escapeQuotes(str: string): string;
+ toQuotedString(str: string): string;
+ getData(jsonPointer: string, dataLevel: number, paths: string[]): string;
+ escapeJsonPointer(str: string): string;
+ unescapeJsonPointer(str: string): string;
+ escapeFragment(str: string): string;
+ unescapeFragment(str: string): string;
+ };
+ self: Ajv;
+ }
+
+ interface SchemaValidateFunction {
+ (
+ schema: any,
+ data: any,
+ parentSchema?: object,
+ dataPath?: string,
+ parentData?: object | Array,
+ parentDataProperty?: string | number,
+ rootData?: object | Array
+ ): boolean | PromiseLike;
+ errors?: Array;
+ }
+
+ interface ErrorsTextOptions {
+ separator?: string;
+ dataVar?: string;
+ }
+
+ interface ErrorObject {
+ keyword: string;
+ dataPath: string;
+ schemaPath: string;
+ params: ErrorParameters;
+ // Added to validation errors of propertyNames keyword schema
+ propertyName?: string;
+ // Excluded if messages set to false.
+ message?: string;
+ // These are added with the `verbose` option.
+ schema?: any;
+ parentSchema?: object;
+ data?: any;
+ }
+
+ type ErrorParameters = RefParams | LimitParams | AdditionalPropertiesParams |
+ DependenciesParams | FormatParams | ComparisonParams |
+ MultipleOfParams | PatternParams | RequiredParams |
+ TypeParams | UniqueItemsParams | CustomParams |
+ PatternRequiredParams | PropertyNamesParams |
+ IfParams | SwitchParams | NoParams | EnumParams;
+
+ interface RefParams {
+ ref: string;
+ }
+
+ interface LimitParams {
+ limit: number;
+ }
+
+ interface AdditionalPropertiesParams {
+ additionalProperty: string;
+ }
+
+ interface DependenciesParams {
+ property: string;
+ missingProperty: string;
+ depsCount: number;
+ deps: string;
+ }
+
+ interface FormatParams {
+ format: string
+ }
+
+ interface ComparisonParams {
+ comparison: string;
+ limit: number | string;
+ exclusive: boolean;
+ }
+
+ interface MultipleOfParams {
+ multipleOf: number;
+ }
+
+ interface PatternParams {
+ pattern: string;
+ }
+
+ interface RequiredParams {
+ missingProperty: string;
+ }
+
+ interface TypeParams {
+ type: string;
+ }
+
+ interface UniqueItemsParams {
+ i: number;
+ j: number;
+ }
+
+ interface CustomParams {
+ keyword: string;
+ }
+
+ interface PatternRequiredParams {
+ missingPattern: string;
+ }
+
+ interface PropertyNamesParams {
+ propertyName: string;
+ }
+
+ interface IfParams {
+ failingKeyword: string;
+ }
+
+ interface SwitchParams {
+ caseIndex: number;
+ }
+
+ interface NoParams { }
+
+ interface EnumParams {
+ allowedValues: Array;
+ }
+}
+
+export = ajv;
diff --git a/website_quotation_template/node_modules/ajv/lib/ajv.js b/website_quotation_template/node_modules/ajv/lib/ajv.js
new file mode 100644
index 000000000..06a45b650
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/ajv.js
@@ -0,0 +1,506 @@
+'use strict';
+
+var compileSchema = require('./compile')
+ , resolve = require('./compile/resolve')
+ , Cache = require('./cache')
+ , SchemaObject = require('./compile/schema_obj')
+ , stableStringify = require('fast-json-stable-stringify')
+ , formats = require('./compile/formats')
+ , rules = require('./compile/rules')
+ , $dataMetaSchema = require('./data')
+ , util = require('./compile/util');
+
+module.exports = Ajv;
+
+Ajv.prototype.validate = validate;
+Ajv.prototype.compile = compile;
+Ajv.prototype.addSchema = addSchema;
+Ajv.prototype.addMetaSchema = addMetaSchema;
+Ajv.prototype.validateSchema = validateSchema;
+Ajv.prototype.getSchema = getSchema;
+Ajv.prototype.removeSchema = removeSchema;
+Ajv.prototype.addFormat = addFormat;
+Ajv.prototype.errorsText = errorsText;
+
+Ajv.prototype._addSchema = _addSchema;
+Ajv.prototype._compile = _compile;
+
+Ajv.prototype.compileAsync = require('./compile/async');
+var customKeyword = require('./keyword');
+Ajv.prototype.addKeyword = customKeyword.add;
+Ajv.prototype.getKeyword = customKeyword.get;
+Ajv.prototype.removeKeyword = customKeyword.remove;
+Ajv.prototype.validateKeyword = customKeyword.validate;
+
+var errorClasses = require('./compile/error_classes');
+Ajv.ValidationError = errorClasses.Validation;
+Ajv.MissingRefError = errorClasses.MissingRef;
+Ajv.$dataMetaSchema = $dataMetaSchema;
+
+var META_SCHEMA_ID = 'http://json-schema.org/draft-07/schema';
+
+var META_IGNORE_OPTIONS = [ 'removeAdditional', 'useDefaults', 'coerceTypes', 'strictDefaults' ];
+var META_SUPPORT_DATA = ['/properties'];
+
+/**
+ * Creates validator instance.
+ * Usage: `Ajv(opts)`
+ * @param {Object} opts optional options
+ * @return {Object} ajv instance
+ */
+function Ajv(opts) {
+ if (!(this instanceof Ajv)) return new Ajv(opts);
+ opts = this._opts = util.copy(opts) || {};
+ setLogger(this);
+ this._schemas = {};
+ this._refs = {};
+ this._fragments = {};
+ this._formats = formats(opts.format);
+
+ this._cache = opts.cache || new Cache;
+ this._loadingSchemas = {};
+ this._compilations = [];
+ this.RULES = rules();
+ this._getId = chooseGetId(opts);
+
+ opts.loopRequired = opts.loopRequired || Infinity;
+ if (opts.errorDataPath == 'property') opts._errorDataPathProperty = true;
+ if (opts.serialize === undefined) opts.serialize = stableStringify;
+ this._metaOpts = getMetaSchemaOptions(this);
+
+ if (opts.formats) addInitialFormats(this);
+ if (opts.keywords) addInitialKeywords(this);
+ addDefaultMetaSchema(this);
+ if (typeof opts.meta == 'object') this.addMetaSchema(opts.meta);
+ if (opts.nullable) this.addKeyword('nullable', {metaSchema: {type: 'boolean'}});
+ addInitialSchemas(this);
+}
+
+
+
+/**
+ * Validate data using schema
+ * Schema will be compiled and cached (using serialized JSON as key. [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used to serialize.
+ * @this Ajv
+ * @param {String|Object} schemaKeyRef key, ref or schema object
+ * @param {Any} data to be validated
+ * @return {Boolean} validation result. Errors from the last validation will be available in `ajv.errors` (and also in compiled schema: `schema.errors`).
+ */
+function validate(schemaKeyRef, data) {
+ var v;
+ if (typeof schemaKeyRef == 'string') {
+ v = this.getSchema(schemaKeyRef);
+ if (!v) throw new Error('no schema with key or ref "' + schemaKeyRef + '"');
+ } else {
+ var schemaObj = this._addSchema(schemaKeyRef);
+ v = schemaObj.validate || this._compile(schemaObj);
+ }
+
+ var valid = v(data);
+ if (v.$async !== true) this.errors = v.errors;
+ return valid;
+}
+
+
+/**
+ * Create validating function for passed schema.
+ * @this Ajv
+ * @param {Object} schema schema object
+ * @param {Boolean} _meta true if schema is a meta-schema. Used internally to compile meta schemas of custom keywords.
+ * @return {Function} validating function
+ */
+function compile(schema, _meta) {
+ var schemaObj = this._addSchema(schema, undefined, _meta);
+ return schemaObj.validate || this._compile(schemaObj);
+}
+
+
+/**
+ * Adds schema to the instance.
+ * @this Ajv
+ * @param {Object|Array} schema schema or array of schemas. If array is passed, `key` and other parameters will be ignored.
+ * @param {String} key Optional schema key. Can be passed to `validate` method instead of schema object or id/ref. One schema per instance can have empty `id` and `key`.
+ * @param {Boolean} _skipValidation true to skip schema validation. Used internally, option validateSchema should be used instead.
+ * @param {Boolean} _meta true if schema is a meta-schema. Used internally, addMetaSchema should be used instead.
+ * @return {Ajv} this for method chaining
+ */
+function addSchema(schema, key, _skipValidation, _meta) {
+ if (Array.isArray(schema)){
+ for (var i=0; i} errors optional array of validation errors, if not passed errors from the instance are used.
+ * @param {Object} options optional options with properties `separator` and `dataVar`.
+ * @return {String} human readable string with all errors descriptions
+ */
+function errorsText(errors, options) {
+ errors = errors || this.errors;
+ if (!errors) return 'No errors';
+ options = options || {};
+ var separator = options.separator === undefined ? ', ' : options.separator;
+ var dataVar = options.dataVar === undefined ? 'data' : options.dataVar;
+
+ var text = '';
+ for (var i=0; i%\\^`{|}]|%[0-9a-f]{2})|\{[+#./;?&=,!@|]?(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?(?:,(?:[a-z0-9_]|%[0-9a-f]{2})+(?::[1-9][0-9]{0,3}|\*)?)*\})*$/i;
+// For the source: https://gist.github.com/dperini/729294
+// For test cases: https://mathiasbynens.be/demo/url-regex
+// @todo Delete current URL in favour of the commented out URL rule when this issue is fixed https://github.com/eslint/eslint/issues/7983.
+// var URL = /^(?:(?:https?|ftp):\/\/)(?:\S+(?::\S*)?@)?(?:(?!10(?:\.\d{1,3}){3})(?!127(?:\.\d{1,3}){3})(?!169\.254(?:\.\d{1,3}){2})(?!192\.168(?:\.\d{1,3}){2})(?!172\.(?:1[6-9]|2\d|3[0-1])(?:\.\d{1,3}){2})(?:[1-9]\d?|1\d\d|2[01]\d|22[0-3])(?:\.(?:1?\d{1,2}|2[0-4]\d|25[0-5])){2}(?:\.(?:[1-9]\d?|1\d\d|2[0-4]\d|25[0-4]))|(?:(?:[a-z\u{00a1}-\u{ffff}0-9]+-)*[a-z\u{00a1}-\u{ffff}0-9]+)(?:\.(?:[a-z\u{00a1}-\u{ffff}0-9]+-)*[a-z\u{00a1}-\u{ffff}0-9]+)*(?:\.(?:[a-z\u{00a1}-\u{ffff}]{2,})))(?::\d{2,5})?(?:\/[^\s]*)?$/iu;
+var URL = /^(?:(?:http[s\u017F]?|ftp):\/\/)(?:(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+(?::(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?@)?(?:(?!10(?:\.[0-9]{1,3}){3})(?!127(?:\.[0-9]{1,3}){3})(?!169\.254(?:\.[0-9]{1,3}){2})(?!192\.168(?:\.[0-9]{1,3}){2})(?!172\.(?:1[6-9]|2[0-9]|3[01])(?:\.[0-9]{1,3}){2})(?:[1-9][0-9]?|1[0-9][0-9]|2[01][0-9]|22[0-3])(?:\.(?:1?[0-9]{1,2}|2[0-4][0-9]|25[0-5])){2}(?:\.(?:[1-9][0-9]?|1[0-9][0-9]|2[0-4][0-9]|25[0-4]))|(?:(?:(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-)*(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)(?:\.(?:(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+-)*(?:[0-9a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])+)*(?:\.(?:(?:[a-z\xA1-\uD7FF\uE000-\uFFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF]){2,})))(?::[0-9]{2,5})?(?:\/(?:[\0-\x08\x0E-\x1F!-\x9F\xA1-\u167F\u1681-\u1FFF\u200B-\u2027\u202A-\u202E\u2030-\u205E\u2060-\u2FFF\u3001-\uD7FF\uE000-\uFEFE\uFF00-\uFFFF]|[\uD800-\uDBFF][\uDC00-\uDFFF]|[\uD800-\uDBFF](?![\uDC00-\uDFFF])|(?:[^\uD800-\uDBFF]|^)[\uDC00-\uDFFF])*)?$/i;
+var UUID = /^(?:urn:uuid:)?[0-9a-f]{8}-(?:[0-9a-f]{4}-){3}[0-9a-f]{12}$/i;
+var JSON_POINTER = /^(?:\/(?:[^~/]|~0|~1)*)*$/;
+var JSON_POINTER_URI_FRAGMENT = /^#(?:\/(?:[a-z0-9_\-.!$&'()*+,;:=@]|%[0-9a-f]{2}|~0|~1)*)*$/i;
+var RELATIVE_JSON_POINTER = /^(?:0|[1-9][0-9]*)(?:#|(?:\/(?:[^~/]|~0|~1)*)*)$/;
+
+
+module.exports = formats;
+
+function formats(mode) {
+ mode = mode == 'full' ? 'full' : 'fast';
+ return util.copy(formats[mode]);
+}
+
+
+formats.fast = {
+ // date: http://tools.ietf.org/html/rfc3339#section-5.6
+ date: /^\d\d\d\d-[0-1]\d-[0-3]\d$/,
+ // date-time: http://tools.ietf.org/html/rfc3339#section-5.6
+ time: /^(?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)?$/i,
+ 'date-time': /^\d\d\d\d-[0-1]\d-[0-3]\d[t\s](?:[0-2]\d:[0-5]\d:[0-5]\d|23:59:60)(?:\.\d+)?(?:z|[+-]\d\d(?::?\d\d)?)$/i,
+ // uri: https://github.com/mafintosh/is-my-json-valid/blob/master/formats.js
+ uri: /^(?:[a-z][a-z0-9+\-.]*:)(?:\/?\/)?[^\s]*$/i,
+ 'uri-reference': /^(?:(?:[a-z][a-z0-9+\-.]*:)?\/?\/)?(?:[^\\\s#][^\s#]*)?(?:#[^\\\s]*)?$/i,
+ 'uri-template': URITEMPLATE,
+ url: URL,
+ // email (sources from jsen validator):
+ // http://stackoverflow.com/questions/201323/using-a-regular-expression-to-validate-an-email-address#answer-8829363
+ // http://www.w3.org/TR/html5/forms.html#valid-e-mail-address (search for 'willful violation')
+ email: /^[a-z0-9.!#$%&'*+/=?^_`{|}~-]+@[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?(?:\.[a-z0-9](?:[a-z0-9-]{0,61}[a-z0-9])?)*$/i,
+ hostname: HOSTNAME,
+ // optimized https://www.safaribooksonline.com/library/view/regular-expressions-cookbook/9780596802837/ch07s16.html
+ ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/,
+ // optimized http://stackoverflow.com/questions/53497/regular-expression-that-matches-valid-ipv6-addresses
+ ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i,
+ regex: regex,
+ // uuid: http://tools.ietf.org/html/rfc4122
+ uuid: UUID,
+ // JSON-pointer: https://tools.ietf.org/html/rfc6901
+ // uri fragment: https://tools.ietf.org/html/rfc3986#appendix-A
+ 'json-pointer': JSON_POINTER,
+ 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT,
+ // relative JSON-pointer: http://tools.ietf.org/html/draft-luff-relative-json-pointer-00
+ 'relative-json-pointer': RELATIVE_JSON_POINTER
+};
+
+
+formats.full = {
+ date: date,
+ time: time,
+ 'date-time': date_time,
+ uri: uri,
+ 'uri-reference': URIREF,
+ 'uri-template': URITEMPLATE,
+ url: URL,
+ email: /^[a-z0-9!#$%&'*+/=?^_`{|}~-]+(?:\.[a-z0-9!#$%&'*+/=?^_`{|}~-]+)*@(?:[a-z0-9](?:[a-z0-9-]*[a-z0-9])?\.)+[a-z0-9](?:[a-z0-9-]*[a-z0-9])?$/i,
+ hostname: HOSTNAME,
+ ipv4: /^(?:(?:25[0-5]|2[0-4]\d|[01]?\d\d?)\.){3}(?:25[0-5]|2[0-4]\d|[01]?\d\d?)$/,
+ ipv6: /^\s*(?:(?:(?:[0-9a-f]{1,4}:){7}(?:[0-9a-f]{1,4}|:))|(?:(?:[0-9a-f]{1,4}:){6}(?::[0-9a-f]{1,4}|(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){5}(?:(?:(?::[0-9a-f]{1,4}){1,2})|:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3})|:))|(?:(?:[0-9a-f]{1,4}:){4}(?:(?:(?::[0-9a-f]{1,4}){1,3})|(?:(?::[0-9a-f]{1,4})?:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){3}(?:(?:(?::[0-9a-f]{1,4}){1,4})|(?:(?::[0-9a-f]{1,4}){0,2}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){2}(?:(?:(?::[0-9a-f]{1,4}){1,5})|(?:(?::[0-9a-f]{1,4}){0,3}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?:(?:[0-9a-f]{1,4}:){1}(?:(?:(?::[0-9a-f]{1,4}){1,6})|(?:(?::[0-9a-f]{1,4}){0,4}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:))|(?::(?:(?:(?::[0-9a-f]{1,4}){1,7})|(?:(?::[0-9a-f]{1,4}){0,5}:(?:(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)(?:\.(?:25[0-5]|2[0-4]\d|1\d\d|[1-9]?\d)){3}))|:)))(?:%.+)?\s*$/i,
+ regex: regex,
+ uuid: UUID,
+ 'json-pointer': JSON_POINTER,
+ 'json-pointer-uri-fragment': JSON_POINTER_URI_FRAGMENT,
+ 'relative-json-pointer': RELATIVE_JSON_POINTER
+};
+
+
+function isLeapYear(year) {
+ // https://tools.ietf.org/html/rfc3339#appendix-C
+ return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0);
+}
+
+
+function date(str) {
+ // full-date from http://tools.ietf.org/html/rfc3339#section-5.6
+ var matches = str.match(DATE);
+ if (!matches) return false;
+
+ var year = +matches[1];
+ var month = +matches[2];
+ var day = +matches[3];
+
+ return month >= 1 && month <= 12 && day >= 1 &&
+ day <= (month == 2 && isLeapYear(year) ? 29 : DAYS[month]);
+}
+
+
+function time(str, full) {
+ var matches = str.match(TIME);
+ if (!matches) return false;
+
+ var hour = matches[1];
+ var minute = matches[2];
+ var second = matches[3];
+ var timeZone = matches[5];
+ return ((hour <= 23 && minute <= 59 && second <= 59) ||
+ (hour == 23 && minute == 59 && second == 60)) &&
+ (!full || timeZone);
+}
+
+
+var DATE_TIME_SEPARATOR = /t|\s/i;
+function date_time(str) {
+ // http://tools.ietf.org/html/rfc3339#section-5.6
+ var dateTime = str.split(DATE_TIME_SEPARATOR);
+ return dateTime.length == 2 && date(dateTime[0]) && time(dateTime[1], true);
+}
+
+
+var NOT_URI_FRAGMENT = /\/|:/;
+function uri(str) {
+ // http://jmrware.com/articles/2009/uri_regexp/URI_regex.html + optional protocol + required "."
+ return NOT_URI_FRAGMENT.test(str) && URI.test(str);
+}
+
+
+var Z_ANCHOR = /[^\\]\\Z/;
+function regex(str) {
+ if (Z_ANCHOR.test(str)) return false;
+ try {
+ new RegExp(str);
+ return true;
+ } catch(e) {
+ return false;
+ }
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/compile/index.js b/website_quotation_template/node_modules/ajv/lib/compile/index.js
new file mode 100644
index 000000000..97518c424
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/compile/index.js
@@ -0,0 +1,387 @@
+'use strict';
+
+var resolve = require('./resolve')
+ , util = require('./util')
+ , errorClasses = require('./error_classes')
+ , stableStringify = require('fast-json-stable-stringify');
+
+var validateGenerator = require('../dotjs/validate');
+
+/**
+ * Functions below are used inside compiled validations function
+ */
+
+var ucs2length = util.ucs2length;
+var equal = require('fast-deep-equal');
+
+// this error is thrown by async schemas to return validation errors via exception
+var ValidationError = errorClasses.Validation;
+
+module.exports = compile;
+
+
+/**
+ * Compiles schema to validation function
+ * @this Ajv
+ * @param {Object} schema schema object
+ * @param {Object} root object with information about the root schema for this schema
+ * @param {Object} localRefs the hash of local references inside the schema (created by resolve.id), used for inline resolution
+ * @param {String} baseId base ID for IDs in the schema
+ * @return {Function} validation function
+ */
+function compile(schema, root, localRefs, baseId) {
+ /* jshint validthis: true, evil: true */
+ /* eslint no-shadow: 0 */
+ var self = this
+ , opts = this._opts
+ , refVal = [ undefined ]
+ , refs = {}
+ , patterns = []
+ , patternsHash = {}
+ , defaults = []
+ , defaultsHash = {}
+ , customRules = [];
+
+ root = root || { schema: schema, refVal: refVal, refs: refs };
+
+ var c = checkCompiling.call(this, schema, root, baseId);
+ var compilation = this._compilations[c.index];
+ if (c.compiling) return (compilation.callValidate = callValidate);
+
+ var formats = this._formats;
+ var RULES = this.RULES;
+
+ try {
+ var v = localCompile(schema, root, localRefs, baseId);
+ compilation.validate = v;
+ var cv = compilation.callValidate;
+ if (cv) {
+ cv.schema = v.schema;
+ cv.errors = null;
+ cv.refs = v.refs;
+ cv.refVal = v.refVal;
+ cv.root = v.root;
+ cv.$async = v.$async;
+ if (opts.sourceCode) cv.source = v.source;
+ }
+ return v;
+ } finally {
+ endCompiling.call(this, schema, root, baseId);
+ }
+
+ /* @this {*} - custom context, see passContext option */
+ function callValidate() {
+ /* jshint validthis: true */
+ var validate = compilation.validate;
+ var result = validate.apply(this, arguments);
+ callValidate.errors = validate.errors;
+ return result;
+ }
+
+ function localCompile(_schema, _root, localRefs, baseId) {
+ var isRoot = !_root || (_root && _root.schema == _schema);
+ if (_root.schema != root.schema)
+ return compile.call(self, _schema, _root, localRefs, baseId);
+
+ var $async = _schema.$async === true;
+
+ var sourceCode = validateGenerator({
+ isTop: true,
+ schema: _schema,
+ isRoot: isRoot,
+ baseId: baseId,
+ root: _root,
+ schemaPath: '',
+ errSchemaPath: '#',
+ errorPath: '""',
+ MissingRefError: errorClasses.MissingRef,
+ RULES: RULES,
+ validate: validateGenerator,
+ util: util,
+ resolve: resolve,
+ resolveRef: resolveRef,
+ usePattern: usePattern,
+ useDefault: useDefault,
+ useCustomRule: useCustomRule,
+ opts: opts,
+ formats: formats,
+ logger: self.logger,
+ self: self
+ });
+
+ sourceCode = vars(refVal, refValCode) + vars(patterns, patternCode)
+ + vars(defaults, defaultCode) + vars(customRules, customRuleCode)
+ + sourceCode;
+
+ if (opts.processCode) sourceCode = opts.processCode(sourceCode, _schema);
+ // console.log('\n\n\n *** \n', JSON.stringify(sourceCode));
+ var validate;
+ try {
+ var makeValidate = new Function(
+ 'self',
+ 'RULES',
+ 'formats',
+ 'root',
+ 'refVal',
+ 'defaults',
+ 'customRules',
+ 'equal',
+ 'ucs2length',
+ 'ValidationError',
+ sourceCode
+ );
+
+ validate = makeValidate(
+ self,
+ RULES,
+ formats,
+ root,
+ refVal,
+ defaults,
+ customRules,
+ equal,
+ ucs2length,
+ ValidationError
+ );
+
+ refVal[0] = validate;
+ } catch(e) {
+ self.logger.error('Error compiling schema, function code:', sourceCode);
+ throw e;
+ }
+
+ validate.schema = _schema;
+ validate.errors = null;
+ validate.refs = refs;
+ validate.refVal = refVal;
+ validate.root = isRoot ? validate : _root;
+ if ($async) validate.$async = true;
+ if (opts.sourceCode === true) {
+ validate.source = {
+ code: sourceCode,
+ patterns: patterns,
+ defaults: defaults
+ };
+ }
+
+ return validate;
+ }
+
+ function resolveRef(baseId, ref, isRoot) {
+ ref = resolve.url(baseId, ref);
+ var refIndex = refs[ref];
+ var _refVal, refCode;
+ if (refIndex !== undefined) {
+ _refVal = refVal[refIndex];
+ refCode = 'refVal[' + refIndex + ']';
+ return resolvedRef(_refVal, refCode);
+ }
+ if (!isRoot && root.refs) {
+ var rootRefId = root.refs[ref];
+ if (rootRefId !== undefined) {
+ _refVal = root.refVal[rootRefId];
+ refCode = addLocalRef(ref, _refVal);
+ return resolvedRef(_refVal, refCode);
+ }
+ }
+
+ refCode = addLocalRef(ref);
+ var v = resolve.call(self, localCompile, root, ref);
+ if (v === undefined) {
+ var localSchema = localRefs && localRefs[ref];
+ if (localSchema) {
+ v = resolve.inlineRef(localSchema, opts.inlineRefs)
+ ? localSchema
+ : compile.call(self, localSchema, root, localRefs, baseId);
+ }
+ }
+
+ if (v === undefined) {
+ removeLocalRef(ref);
+ } else {
+ replaceLocalRef(ref, v);
+ return resolvedRef(v, refCode);
+ }
+ }
+
+ function addLocalRef(ref, v) {
+ var refId = refVal.length;
+ refVal[refId] = v;
+ refs[ref] = refId;
+ return 'refVal' + refId;
+ }
+
+ function removeLocalRef(ref) {
+ delete refs[ref];
+ }
+
+ function replaceLocalRef(ref, v) {
+ var refId = refs[ref];
+ refVal[refId] = v;
+ }
+
+ function resolvedRef(refVal, code) {
+ return typeof refVal == 'object' || typeof refVal == 'boolean'
+ ? { code: code, schema: refVal, inline: true }
+ : { code: code, $async: refVal && !!refVal.$async };
+ }
+
+ function usePattern(regexStr) {
+ var index = patternsHash[regexStr];
+ if (index === undefined) {
+ index = patternsHash[regexStr] = patterns.length;
+ patterns[index] = regexStr;
+ }
+ return 'pattern' + index;
+ }
+
+ function useDefault(value) {
+ switch (typeof value) {
+ case 'boolean':
+ case 'number':
+ return '' + value;
+ case 'string':
+ return util.toQuotedString(value);
+ case 'object':
+ if (value === null) return 'null';
+ var valueStr = stableStringify(value);
+ var index = defaultsHash[valueStr];
+ if (index === undefined) {
+ index = defaultsHash[valueStr] = defaults.length;
+ defaults[index] = value;
+ }
+ return 'default' + index;
+ }
+ }
+
+ function useCustomRule(rule, schema, parentSchema, it) {
+ if (self._opts.validateSchema !== false) {
+ var deps = rule.definition.dependencies;
+ if (deps && !deps.every(function(keyword) {
+ return Object.prototype.hasOwnProperty.call(parentSchema, keyword);
+ }))
+ throw new Error('parent schema must have all required keywords: ' + deps.join(','));
+
+ var validateSchema = rule.definition.validateSchema;
+ if (validateSchema) {
+ var valid = validateSchema(schema);
+ if (!valid) {
+ var message = 'keyword schema is invalid: ' + self.errorsText(validateSchema.errors);
+ if (self._opts.validateSchema == 'log') self.logger.error(message);
+ else throw new Error(message);
+ }
+ }
+ }
+
+ var compile = rule.definition.compile
+ , inline = rule.definition.inline
+ , macro = rule.definition.macro;
+
+ var validate;
+ if (compile) {
+ validate = compile.call(self, schema, parentSchema, it);
+ } else if (macro) {
+ validate = macro.call(self, schema, parentSchema, it);
+ if (opts.validateSchema !== false) self.validateSchema(validate, true);
+ } else if (inline) {
+ validate = inline.call(self, it, rule.keyword, schema, parentSchema);
+ } else {
+ validate = rule.definition.validate;
+ if (!validate) return;
+ }
+
+ if (validate === undefined)
+ throw new Error('custom keyword "' + rule.keyword + '"failed to compile');
+
+ var index = customRules.length;
+ customRules[index] = validate;
+
+ return {
+ code: 'customRule' + index,
+ validate: validate
+ };
+ }
+}
+
+
+/**
+ * Checks if the schema is currently compiled
+ * @this Ajv
+ * @param {Object} schema schema to compile
+ * @param {Object} root root object
+ * @param {String} baseId base schema ID
+ * @return {Object} object with properties "index" (compilation index) and "compiling" (boolean)
+ */
+function checkCompiling(schema, root, baseId) {
+ /* jshint validthis: true */
+ var index = compIndex.call(this, schema, root, baseId);
+ if (index >= 0) return { index: index, compiling: true };
+ index = this._compilations.length;
+ this._compilations[index] = {
+ schema: schema,
+ root: root,
+ baseId: baseId
+ };
+ return { index: index, compiling: false };
+}
+
+
+/**
+ * Removes the schema from the currently compiled list
+ * @this Ajv
+ * @param {Object} schema schema to compile
+ * @param {Object} root root object
+ * @param {String} baseId base schema ID
+ */
+function endCompiling(schema, root, baseId) {
+ /* jshint validthis: true */
+ var i = compIndex.call(this, schema, root, baseId);
+ if (i >= 0) this._compilations.splice(i, 1);
+}
+
+
+/**
+ * Index of schema compilation in the currently compiled list
+ * @this Ajv
+ * @param {Object} schema schema to compile
+ * @param {Object} root root object
+ * @param {String} baseId base schema ID
+ * @return {Integer} compilation index
+ */
+function compIndex(schema, root, baseId) {
+ /* jshint validthis: true */
+ for (var i=0; i= 0xD800 && value <= 0xDBFF && pos < len) {
+ // high surrogate, and there is a next character
+ value = str.charCodeAt(pos);
+ if ((value & 0xFC00) == 0xDC00) pos++; // low surrogate
+ }
+ }
+ return length;
+};
diff --git a/website_quotation_template/node_modules/ajv/lib/compile/util.js b/website_quotation_template/node_modules/ajv/lib/compile/util.js
new file mode 100644
index 000000000..ef07b8c75
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/compile/util.js
@@ -0,0 +1,239 @@
+'use strict';
+
+
+module.exports = {
+ copy: copy,
+ checkDataType: checkDataType,
+ checkDataTypes: checkDataTypes,
+ coerceToTypes: coerceToTypes,
+ toHash: toHash,
+ getProperty: getProperty,
+ escapeQuotes: escapeQuotes,
+ equal: require('fast-deep-equal'),
+ ucs2length: require('./ucs2length'),
+ varOccurences: varOccurences,
+ varReplace: varReplace,
+ schemaHasRules: schemaHasRules,
+ schemaHasRulesExcept: schemaHasRulesExcept,
+ schemaUnknownRules: schemaUnknownRules,
+ toQuotedString: toQuotedString,
+ getPathExpr: getPathExpr,
+ getPath: getPath,
+ getData: getData,
+ unescapeFragment: unescapeFragment,
+ unescapeJsonPointer: unescapeJsonPointer,
+ escapeFragment: escapeFragment,
+ escapeJsonPointer: escapeJsonPointer
+};
+
+
+function copy(o, to) {
+ to = to || {};
+ for (var key in o) to[key] = o[key];
+ return to;
+}
+
+
+function checkDataType(dataType, data, strictNumbers, negate) {
+ var EQUAL = negate ? ' !== ' : ' === '
+ , AND = negate ? ' || ' : ' && '
+ , OK = negate ? '!' : ''
+ , NOT = negate ? '' : '!';
+ switch (dataType) {
+ case 'null': return data + EQUAL + 'null';
+ case 'array': return OK + 'Array.isArray(' + data + ')';
+ case 'object': return '(' + OK + data + AND +
+ 'typeof ' + data + EQUAL + '"object"' + AND +
+ NOT + 'Array.isArray(' + data + '))';
+ case 'integer': return '(typeof ' + data + EQUAL + '"number"' + AND +
+ NOT + '(' + data + ' % 1)' +
+ AND + data + EQUAL + data +
+ (strictNumbers ? (AND + OK + 'isFinite(' + data + ')') : '') + ')';
+ case 'number': return '(typeof ' + data + EQUAL + '"' + dataType + '"' +
+ (strictNumbers ? (AND + OK + 'isFinite(' + data + ')') : '') + ')';
+ default: return 'typeof ' + data + EQUAL + '"' + dataType + '"';
+ }
+}
+
+
+function checkDataTypes(dataTypes, data, strictNumbers) {
+ switch (dataTypes.length) {
+ case 1: return checkDataType(dataTypes[0], data, strictNumbers, true);
+ default:
+ var code = '';
+ var types = toHash(dataTypes);
+ if (types.array && types.object) {
+ code = types.null ? '(': '(!' + data + ' || ';
+ code += 'typeof ' + data + ' !== "object")';
+ delete types.null;
+ delete types.array;
+ delete types.object;
+ }
+ if (types.number) delete types.integer;
+ for (var t in types)
+ code += (code ? ' && ' : '' ) + checkDataType(t, data, strictNumbers, true);
+
+ return code;
+ }
+}
+
+
+var COERCE_TO_TYPES = toHash([ 'string', 'number', 'integer', 'boolean', 'null' ]);
+function coerceToTypes(optionCoerceTypes, dataTypes) {
+ if (Array.isArray(dataTypes)) {
+ var types = [];
+ for (var i=0; i= lvl) throw new Error('Cannot access property/index ' + up + ' levels up, current level is ' + lvl);
+ return paths[lvl - up];
+ }
+
+ if (up > lvl) throw new Error('Cannot access data ' + up + ' levels up, current level is ' + lvl);
+ data = 'data' + ((lvl - up) || '');
+ if (!jsonPointer) return data;
+ }
+
+ var expr = data;
+ var segments = jsonPointer.split('/');
+ for (var i=0; i'
+ , $notOp = $isMax ? '>' : '<'
+ , $errorKeyword = undefined;
+
+ if (!($isData || typeof $schema == 'number' || $schema === undefined)) {
+ throw new Error($keyword + ' must be number');
+ }
+ if (!($isDataExcl || $schemaExcl === undefined
+ || typeof $schemaExcl == 'number'
+ || typeof $schemaExcl == 'boolean')) {
+ throw new Error($exclusiveKeyword + ' must be number or boolean');
+ }
+}}
+
+{{? $isDataExcl }}
+ {{
+ var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr)
+ , $exclusive = 'exclusive' + $lvl
+ , $exclType = 'exclType' + $lvl
+ , $exclIsNumber = 'exclIsNumber' + $lvl
+ , $opExpr = 'op' + $lvl
+ , $opStr = '\' + ' + $opExpr + ' + \'';
+ }}
+ var schemaExcl{{=$lvl}} = {{=$schemaValueExcl}};
+ {{ $schemaValueExcl = 'schemaExcl' + $lvl; }}
+
+ var {{=$exclusive}};
+ var {{=$exclType}} = typeof {{=$schemaValueExcl}};
+ if ({{=$exclType}} != 'boolean' && {{=$exclType}} != 'undefined' && {{=$exclType}} != 'number') {
+ {{ var $errorKeyword = $exclusiveKeyword; }}
+ {{# def.error:'_exclusiveLimit' }}
+ } else if ({{# def.$dataNotType:'number' }}
+ {{=$exclType}} == 'number'
+ ? (
+ ({{=$exclusive}} = {{=$schemaValue}} === undefined || {{=$schemaValueExcl}} {{=$op}}= {{=$schemaValue}})
+ ? {{=$data}} {{=$notOp}}= {{=$schemaValueExcl}}
+ : {{=$data}} {{=$notOp}} {{=$schemaValue}}
+ )
+ : (
+ ({{=$exclusive}} = {{=$schemaValueExcl}} === true)
+ ? {{=$data}} {{=$notOp}}= {{=$schemaValue}}
+ : {{=$data}} {{=$notOp}} {{=$schemaValue}}
+ )
+ || {{=$data}} !== {{=$data}}) {
+ var op{{=$lvl}} = {{=$exclusive}} ? '{{=$op}}' : '{{=$op}}=';
+ {{
+ if ($schema === undefined) {
+ $errorKeyword = $exclusiveKeyword;
+ $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword;
+ $schemaValue = $schemaValueExcl;
+ $isData = $isDataExcl;
+ }
+ }}
+{{??}}
+ {{
+ var $exclIsNumber = typeof $schemaExcl == 'number'
+ , $opStr = $op; /*used in error*/
+ }}
+
+ {{? $exclIsNumber && $isData }}
+ {{ var $opExpr = '\'' + $opStr + '\''; /*used in error*/ }}
+ if ({{# def.$dataNotType:'number' }}
+ ( {{=$schemaValue}} === undefined
+ || {{=$schemaExcl}} {{=$op}}= {{=$schemaValue}}
+ ? {{=$data}} {{=$notOp}}= {{=$schemaExcl}}
+ : {{=$data}} {{=$notOp}} {{=$schemaValue}} )
+ || {{=$data}} !== {{=$data}}) {
+ {{??}}
+ {{
+ if ($exclIsNumber && $schema === undefined) {
+ {{# def.setExclusiveLimit }}
+ $schemaValue = $schemaExcl;
+ $notOp += '=';
+ } else {
+ if ($exclIsNumber)
+ $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema);
+
+ if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) {
+ {{# def.setExclusiveLimit }}
+ $notOp += '=';
+ } else {
+ $exclusive = false;
+ $opStr += '=';
+ }
+ }
+
+ var $opExpr = '\'' + $opStr + '\''; /*used in error*/
+ }}
+
+ if ({{# def.$dataNotType:'number' }}
+ {{=$data}} {{=$notOp}} {{=$schemaValue}}
+ || {{=$data}} !== {{=$data}}) {
+ {{?}}
+{{?}}
+ {{ $errorKeyword = $errorKeyword || $keyword; }}
+ {{# def.error:'_limit' }}
+ } {{? $breakOnError }} else { {{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/_limitItems.jst b/website_quotation_template/node_modules/ajv/lib/dot/_limitItems.jst
new file mode 100644
index 000000000..741329e77
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/_limitItems.jst
@@ -0,0 +1,12 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.$data }}
+
+{{# def.numberKeyword }}
+
+{{ var $op = $keyword == 'maxItems' ? '>' : '<'; }}
+if ({{# def.$dataNotType:'number' }} {{=$data}}.length {{=$op}} {{=$schemaValue}}) {
+ {{ var $errorKeyword = $keyword; }}
+ {{# def.error:'_limitItems' }}
+} {{? $breakOnError }} else { {{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/_limitLength.jst b/website_quotation_template/node_modules/ajv/lib/dot/_limitLength.jst
new file mode 100644
index 000000000..285c66bd2
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/_limitLength.jst
@@ -0,0 +1,12 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.$data }}
+
+{{# def.numberKeyword }}
+
+{{ var $op = $keyword == 'maxLength' ? '>' : '<'; }}
+if ({{# def.$dataNotType:'number' }} {{# def.strLength }} {{=$op}} {{=$schemaValue}}) {
+ {{ var $errorKeyword = $keyword; }}
+ {{# def.error:'_limitLength' }}
+} {{? $breakOnError }} else { {{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/_limitProperties.jst b/website_quotation_template/node_modules/ajv/lib/dot/_limitProperties.jst
new file mode 100644
index 000000000..c4c21551a
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/_limitProperties.jst
@@ -0,0 +1,12 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.$data }}
+
+{{# def.numberKeyword }}
+
+{{ var $op = $keyword == 'maxProperties' ? '>' : '<'; }}
+if ({{# def.$dataNotType:'number' }} Object.keys({{=$data}}).length {{=$op}} {{=$schemaValue}}) {
+ {{ var $errorKeyword = $keyword; }}
+ {{# def.error:'_limitProperties' }}
+} {{? $breakOnError }} else { {{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/allOf.jst b/website_quotation_template/node_modules/ajv/lib/dot/allOf.jst
new file mode 100644
index 000000000..0e782fe98
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/allOf.jst
@@ -0,0 +1,32 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.setupNextLevel }}
+
+{{
+ var $currentBaseId = $it.baseId
+ , $allSchemasEmpty = true;
+}}
+
+{{~ $schema:$sch:$i }}
+ {{? {{# def.nonEmptySchema:$sch }} }}
+ {{
+ $allSchemasEmpty = false;
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + '[' + $i + ']';
+ $it.errSchemaPath = $errSchemaPath + '/' + $i;
+ }}
+
+ {{# def.insertSubschemaCode }}
+
+ {{# def.ifResultValid }}
+ {{?}}
+{{~}}
+
+{{? $breakOnError }}
+ {{? $allSchemasEmpty }}
+ if (true) {
+ {{??}}
+ {{= $closingBraces.slice(0,-1) }}
+ {{?}}
+{{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/anyOf.jst b/website_quotation_template/node_modules/ajv/lib/dot/anyOf.jst
new file mode 100644
index 000000000..ea909ee62
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/anyOf.jst
@@ -0,0 +1,46 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.setupNextLevel }}
+
+{{
+ var $noEmptySchema = $schema.every(function($sch) {
+ return {{# def.nonEmptySchema:$sch }};
+ });
+}}
+{{? $noEmptySchema }}
+ {{ var $currentBaseId = $it.baseId; }}
+ var {{=$errs}} = errors;
+ var {{=$valid}} = false;
+
+ {{# def.setCompositeRule }}
+
+ {{~ $schema:$sch:$i }}
+ {{
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + '[' + $i + ']';
+ $it.errSchemaPath = $errSchemaPath + '/' + $i;
+ }}
+
+ {{# def.insertSubschemaCode }}
+
+ {{=$valid}} = {{=$valid}} || {{=$nextValid}};
+
+ if (!{{=$valid}}) {
+ {{ $closingBraces += '}'; }}
+ {{~}}
+
+ {{# def.resetCompositeRule }}
+
+ {{= $closingBraces }}
+
+ if (!{{=$valid}}) {
+ {{# def.extraError:'anyOf' }}
+ } else {
+ {{# def.resetErrors }}
+ {{? it.opts.allErrors }} } {{?}}
+{{??}}
+ {{? $breakOnError }}
+ if (true) {
+ {{?}}
+{{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/coerce.def b/website_quotation_template/node_modules/ajv/lib/dot/coerce.def
new file mode 100644
index 000000000..c947ed6af
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/coerce.def
@@ -0,0 +1,51 @@
+{{## def.coerceType:
+ {{
+ var $dataType = 'dataType' + $lvl
+ , $coerced = 'coerced' + $lvl;
+ }}
+ var {{=$dataType}} = typeof {{=$data}};
+ var {{=$coerced}} = undefined;
+
+ {{? it.opts.coerceTypes == 'array' }}
+ if ({{=$dataType}} == 'object' && Array.isArray({{=$data}}) && {{=$data}}.length == 1) {
+ {{=$data}} = {{=$data}}[0];
+ {{=$dataType}} = typeof {{=$data}};
+ if ({{=it.util.checkDataType(it.schema.type, $data, it.opts.strictNumbers)}}) {{=$coerced}} = {{=$data}};
+ }
+ {{?}}
+
+ if ({{=$coerced}} !== undefined) ;
+ {{~ $coerceToTypes:$type:$i }}
+ {{? $type == 'string' }}
+ else if ({{=$dataType}} == 'number' || {{=$dataType}} == 'boolean')
+ {{=$coerced}} = '' + {{=$data}};
+ else if ({{=$data}} === null) {{=$coerced}} = '';
+ {{?? $type == 'number' || $type == 'integer' }}
+ else if ({{=$dataType}} == 'boolean' || {{=$data}} === null
+ || ({{=$dataType}} == 'string' && {{=$data}} && {{=$data}} == +{{=$data}}
+ {{? $type == 'integer' }} && !({{=$data}} % 1){{?}}))
+ {{=$coerced}} = +{{=$data}};
+ {{?? $type == 'boolean' }}
+ else if ({{=$data}} === 'false' || {{=$data}} === 0 || {{=$data}} === null)
+ {{=$coerced}} = false;
+ else if ({{=$data}} === 'true' || {{=$data}} === 1)
+ {{=$coerced}} = true;
+ {{?? $type == 'null' }}
+ else if ({{=$data}} === '' || {{=$data}} === 0 || {{=$data}} === false)
+ {{=$coerced}} = null;
+ {{?? it.opts.coerceTypes == 'array' && $type == 'array' }}
+ else if ({{=$dataType}} == 'string' || {{=$dataType}} == 'number' || {{=$dataType}} == 'boolean' || {{=$data}} == null)
+ {{=$coerced}} = [{{=$data}}];
+ {{?}}
+ {{~}}
+ else {
+ {{# def.error:'type' }}
+ }
+
+ if ({{=$coerced}} !== undefined) {
+ {{# def.setParentData }}
+ {{=$data}} = {{=$coerced}};
+ {{? !$dataLvl }}if ({{=$parentData}} !== undefined){{?}}
+ {{=$parentData}}[{{=$parentDataProperty}}] = {{=$coerced}};
+ }
+#}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/comment.jst b/website_quotation_template/node_modules/ajv/lib/dot/comment.jst
new file mode 100644
index 000000000..f95915035
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/comment.jst
@@ -0,0 +1,9 @@
+{{# def.definitions }}
+{{# def.setupKeyword }}
+
+{{ var $comment = it.util.toQuotedString($schema); }}
+{{? it.opts.$comment === true }}
+ console.log({{=$comment}});
+{{?? typeof it.opts.$comment == 'function' }}
+ self._opts.$comment({{=$comment}}, {{=it.util.toQuotedString($errSchemaPath)}}, validate.root.schema);
+{{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/const.jst b/website_quotation_template/node_modules/ajv/lib/dot/const.jst
new file mode 100644
index 000000000..2aa22980d
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/const.jst
@@ -0,0 +1,11 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.$data }}
+
+{{? !$isData }}
+ var schema{{=$lvl}} = validate.schema{{=$schemaPath}};
+{{?}}
+var {{=$valid}} = equal({{=$data}}, schema{{=$lvl}});
+{{# def.checkError:'const' }}
+{{? $breakOnError }} else { {{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/contains.jst b/website_quotation_template/node_modules/ajv/lib/dot/contains.jst
new file mode 100644
index 000000000..4dc996741
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/contains.jst
@@ -0,0 +1,55 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.setupNextLevel }}
+
+
+{{
+ var $idx = 'i' + $lvl
+ , $dataNxt = $it.dataLevel = it.dataLevel + 1
+ , $nextData = 'data' + $dataNxt
+ , $currentBaseId = it.baseId
+ , $nonEmptySchema = {{# def.nonEmptySchema:$schema }};
+}}
+
+var {{=$errs}} = errors;
+var {{=$valid}};
+
+{{? $nonEmptySchema }}
+ {{# def.setCompositeRule }}
+
+ {{
+ $it.schema = $schema;
+ $it.schemaPath = $schemaPath;
+ $it.errSchemaPath = $errSchemaPath;
+ }}
+
+ var {{=$nextValid}} = false;
+
+ for (var {{=$idx}} = 0; {{=$idx}} < {{=$data}}.length; {{=$idx}}++) {
+ {{
+ $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true);
+ var $passData = $data + '[' + $idx + ']';
+ $it.dataPathArr[$dataNxt] = $idx;
+ }}
+
+ {{# def.generateSubschemaCode }}
+ {{# def.optimizeValidate }}
+
+ if ({{=$nextValid}}) break;
+ }
+
+ {{# def.resetCompositeRule }}
+ {{= $closingBraces }}
+
+ if (!{{=$nextValid}}) {
+{{??}}
+ if ({{=$data}}.length == 0) {
+{{?}}
+
+ {{# def.error:'contains' }}
+ } else {
+ {{? $nonEmptySchema }}
+ {{# def.resetErrors }}
+ {{?}}
+ {{? it.opts.allErrors }} } {{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/custom.jst b/website_quotation_template/node_modules/ajv/lib/dot/custom.jst
new file mode 100644
index 000000000..d30588fb0
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/custom.jst
@@ -0,0 +1,191 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.$data }}
+
+{{
+ var $rule = this
+ , $definition = 'definition' + $lvl
+ , $rDef = $rule.definition
+ , $closingBraces = '';
+ var $validate = $rDef.validate;
+ var $compile, $inline, $macro, $ruleValidate, $validateCode;
+}}
+
+{{? $isData && $rDef.$data }}
+ {{
+ $validateCode = 'keywordValidate' + $lvl;
+ var $validateSchema = $rDef.validateSchema;
+ }}
+ var {{=$definition}} = RULES.custom['{{=$keyword}}'].definition;
+ var {{=$validateCode}} = {{=$definition}}.validate;
+{{??}}
+ {{
+ $ruleValidate = it.useCustomRule($rule, $schema, it.schema, it);
+ if (!$ruleValidate) return;
+ $schemaValue = 'validate.schema' + $schemaPath;
+ $validateCode = $ruleValidate.code;
+ $compile = $rDef.compile;
+ $inline = $rDef.inline;
+ $macro = $rDef.macro;
+ }}
+{{?}}
+
+{{
+ var $ruleErrs = $validateCode + '.errors'
+ , $i = 'i' + $lvl
+ , $ruleErr = 'ruleErr' + $lvl
+ , $asyncKeyword = $rDef.async;
+
+ if ($asyncKeyword && !it.async)
+ throw new Error('async keyword in sync schema');
+}}
+
+
+{{? !($inline || $macro) }}{{=$ruleErrs}} = null;{{?}}
+var {{=$errs}} = errors;
+var {{=$valid}};
+
+{{## def.callRuleValidate:
+ {{=$validateCode}}.call(
+ {{? it.opts.passContext }}this{{??}}self{{?}}
+ {{? $compile || $rDef.schema === false }}
+ , {{=$data}}
+ {{??}}
+ , {{=$schemaValue}}
+ , {{=$data}}
+ , validate.schema{{=it.schemaPath}}
+ {{?}}
+ , {{# def.dataPath }}
+ {{# def.passParentData }}
+ , rootData
+ )
+#}}
+
+{{## def.extendErrors:_inline:
+ for (var {{=$i}}={{=$errs}}; {{=$i}} 0)
+ || _schema === false
+ : it.util.schemaHasRules(_schema, it.RULES.all))
+#}}
+
+
+{{## def.strLength:
+ {{? it.opts.unicode === false }}
+ {{=$data}}.length
+ {{??}}
+ ucs2length({{=$data}})
+ {{?}}
+#}}
+
+
+{{## def.willOptimize:
+ it.util.varOccurences($code, $nextData) < 2
+#}}
+
+
+{{## def.generateSubschemaCode:
+ {{
+ var $code = it.validate($it);
+ $it.baseId = $currentBaseId;
+ }}
+#}}
+
+
+{{## def.insertSubschemaCode:
+ {{= it.validate($it) }}
+ {{ $it.baseId = $currentBaseId; }}
+#}}
+
+
+{{## def._optimizeValidate:
+ it.util.varReplace($code, $nextData, $passData)
+#}}
+
+
+{{## def.optimizeValidate:
+ {{? {{# def.willOptimize}} }}
+ {{= {{# def._optimizeValidate }} }}
+ {{??}}
+ var {{=$nextData}} = {{=$passData}};
+ {{= $code }}
+ {{?}}
+#}}
+
+
+{{## def.$data:
+ {{
+ var $isData = it.opts.$data && $schema && $schema.$data
+ , $schemaValue;
+ }}
+ {{? $isData }}
+ var schema{{=$lvl}} = {{= it.util.getData($schema.$data, $dataLvl, it.dataPathArr) }};
+ {{ $schemaValue = 'schema' + $lvl; }}
+ {{??}}
+ {{ $schemaValue = $schema; }}
+ {{?}}
+#}}
+
+
+{{## def.$dataNotType:_type:
+ {{?$isData}} ({{=$schemaValue}} !== undefined && typeof {{=$schemaValue}} != _type) || {{?}}
+#}}
+
+
+{{## def.check$dataIsArray:
+ if (schema{{=$lvl}} === undefined) {{=$valid}} = true;
+ else if (!Array.isArray(schema{{=$lvl}})) {{=$valid}} = false;
+ else {
+#}}
+
+
+{{## def.numberKeyword:
+ {{? !($isData || typeof $schema == 'number') }}
+ {{ throw new Error($keyword + ' must be number'); }}
+ {{?}}
+#}}
+
+
+{{## def.beginDefOut:
+ {{
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = '';
+ }}
+#}}
+
+
+{{## def.storeDefOut:_variable:
+ {{
+ var _variable = out;
+ out = $$outStack.pop();
+ }}
+#}}
+
+
+{{## def.dataPath:(dataPath || ''){{? it.errorPath != '""'}} + {{= it.errorPath }}{{?}}#}}
+
+{{## def.setParentData:
+ {{
+ var $parentData = $dataLvl ? 'data' + (($dataLvl-1)||'') : 'parentData'
+ , $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty';
+ }}
+#}}
+
+{{## def.passParentData:
+ {{# def.setParentData }}
+ , {{= $parentData }}
+ , {{= $parentDataProperty }}
+#}}
+
+
+{{## def.iterateProperties:
+ {{? $ownProperties }}
+ {{=$dataProperties}} = {{=$dataProperties}} || Object.keys({{=$data}});
+ for (var {{=$idx}}=0; {{=$idx}}<{{=$dataProperties}}.length; {{=$idx}}++) {
+ var {{=$key}} = {{=$dataProperties}}[{{=$idx}}];
+ {{??}}
+ for (var {{=$key}} in {{=$data}}) {
+ {{?}}
+#}}
+
+
+{{## def.noPropertyInData:
+ {{=$useData}} === undefined
+ {{? $ownProperties }}
+ || !{{# def.isOwnProperty }}
+ {{?}}
+#}}
+
+
+{{## def.isOwnProperty:
+ Object.prototype.hasOwnProperty.call({{=$data}}, '{{=it.util.escapeQuotes($propertyKey)}}')
+#}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/dependencies.jst b/website_quotation_template/node_modules/ajv/lib/dot/dependencies.jst
new file mode 100644
index 000000000..e4bdddec8
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/dependencies.jst
@@ -0,0 +1,79 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.missing }}
+{{# def.setupKeyword }}
+{{# def.setupNextLevel }}
+
+
+{{## def.propertyInData:
+ {{=$data}}{{= it.util.getProperty($property) }} !== undefined
+ {{? $ownProperties }}
+ && Object.prototype.hasOwnProperty.call({{=$data}}, '{{=it.util.escapeQuotes($property)}}')
+ {{?}}
+#}}
+
+
+{{
+ var $schemaDeps = {}
+ , $propertyDeps = {}
+ , $ownProperties = it.opts.ownProperties;
+
+ for ($property in $schema) {
+ if ($property == '__proto__') continue;
+ var $sch = $schema[$property];
+ var $deps = Array.isArray($sch) ? $propertyDeps : $schemaDeps;
+ $deps[$property] = $sch;
+ }
+}}
+
+var {{=$errs}} = errors;
+
+{{ var $currentErrorPath = it.errorPath; }}
+
+var missing{{=$lvl}};
+{{ for (var $property in $propertyDeps) { }}
+ {{ $deps = $propertyDeps[$property]; }}
+ {{? $deps.length }}
+ if ({{# def.propertyInData }}
+ {{? $breakOnError }}
+ && ({{# def.checkMissingProperty:$deps }})) {
+ {{# def.errorMissingProperty:'dependencies' }}
+ {{??}}
+ ) {
+ {{~ $deps:$propertyKey }}
+ {{# def.allErrorsMissingProperty:'dependencies' }}
+ {{~}}
+ {{?}}
+ } {{# def.elseIfValid }}
+ {{?}}
+{{ } }}
+
+{{
+ it.errorPath = $currentErrorPath;
+ var $currentBaseId = $it.baseId;
+}}
+
+
+{{ for (var $property in $schemaDeps) { }}
+ {{ var $sch = $schemaDeps[$property]; }}
+ {{? {{# def.nonEmptySchema:$sch }} }}
+ {{=$nextValid}} = true;
+
+ if ({{# def.propertyInData }}) {
+ {{
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + it.util.getProperty($property);
+ $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($property);
+ }}
+
+ {{# def.insertSubschemaCode }}
+ }
+
+ {{# def.ifResultValid }}
+ {{?}}
+{{ } }}
+
+{{? $breakOnError }}
+ {{= $closingBraces }}
+ if ({{=$errs}} == errors) {
+{{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/enum.jst b/website_quotation_template/node_modules/ajv/lib/dot/enum.jst
new file mode 100644
index 000000000..357c2e8c0
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/enum.jst
@@ -0,0 +1,30 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.$data }}
+
+{{
+ var $i = 'i' + $lvl
+ , $vSchema = 'schema' + $lvl;
+}}
+
+{{? !$isData }}
+ var {{=$vSchema}} = validate.schema{{=$schemaPath}};
+{{?}}
+var {{=$valid}};
+
+{{?$isData}}{{# def.check$dataIsArray }}{{?}}
+
+{{=$valid}} = false;
+
+for (var {{=$i}}=0; {{=$i}}<{{=$vSchema}}.length; {{=$i}}++)
+ if (equal({{=$data}}, {{=$vSchema}}[{{=$i}}])) {
+ {{=$valid}} = true;
+ break;
+ }
+
+{{? $isData }} } {{?}}
+
+{{# def.checkError:'enum' }}
+
+{{? $breakOnError }} else { {{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/errors.def b/website_quotation_template/node_modules/ajv/lib/dot/errors.def
new file mode 100644
index 000000000..5c5752cb0
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/errors.def
@@ -0,0 +1,194 @@
+{{# def.definitions }}
+
+{{## def._error:_rule:
+ {{ 'istanbul ignore else'; }}
+ {{? it.createErrors !== false }}
+ {
+ keyword: '{{= $errorKeyword || _rule }}'
+ , dataPath: (dataPath || '') + {{= it.errorPath }}
+ , schemaPath: {{=it.util.toQuotedString($errSchemaPath)}}
+ , params: {{# def._errorParams[_rule] }}
+ {{? it.opts.messages !== false }}
+ , message: {{# def._errorMessages[_rule] }}
+ {{?}}
+ {{? it.opts.verbose }}
+ , schema: {{# def._errorSchemas[_rule] }}
+ , parentSchema: validate.schema{{=it.schemaPath}}
+ , data: {{=$data}}
+ {{?}}
+ }
+ {{??}}
+ {}
+ {{?}}
+#}}
+
+
+{{## def._addError:_rule:
+ if (vErrors === null) vErrors = [err];
+ else vErrors.push(err);
+ errors++;
+#}}
+
+
+{{## def.addError:_rule:
+ var err = {{# def._error:_rule }};
+ {{# def._addError:_rule }}
+#}}
+
+
+{{## def.error:_rule:
+ {{# def.beginDefOut}}
+ {{# def._error:_rule }}
+ {{# def.storeDefOut:__err }}
+
+ {{? !it.compositeRule && $breakOnError }}
+ {{ 'istanbul ignore if'; }}
+ {{? it.async }}
+ throw new ValidationError([{{=__err}}]);
+ {{??}}
+ validate.errors = [{{=__err}}];
+ return false;
+ {{?}}
+ {{??}}
+ var err = {{=__err}};
+ {{# def._addError:_rule }}
+ {{?}}
+#}}
+
+
+{{## def.extraError:_rule:
+ {{# def.addError:_rule}}
+ {{? !it.compositeRule && $breakOnError }}
+ {{ 'istanbul ignore if'; }}
+ {{? it.async }}
+ throw new ValidationError(vErrors);
+ {{??}}
+ validate.errors = vErrors;
+ return false;
+ {{?}}
+ {{?}}
+#}}
+
+
+{{## def.checkError:_rule:
+ if (!{{=$valid}}) {
+ {{# def.error:_rule }}
+ }
+#}}
+
+
+{{## def.resetErrors:
+ errors = {{=$errs}};
+ if (vErrors !== null) {
+ if ({{=$errs}}) vErrors.length = {{=$errs}};
+ else vErrors = null;
+ }
+#}}
+
+
+{{## def.concatSchema:{{?$isData}}' + {{=$schemaValue}} + '{{??}}{{=$schema}}{{?}}#}}
+{{## def.appendSchema:{{?$isData}}' + {{=$schemaValue}}{{??}}{{=$schemaValue}}'{{?}}#}}
+{{## def.concatSchemaEQ:{{?$isData}}' + {{=$schemaValue}} + '{{??}}{{=it.util.escapeQuotes($schema)}}{{?}}#}}
+
+{{## def._errorMessages = {
+ 'false schema': "'boolean schema is false'",
+ $ref: "'can\\\'t resolve reference {{=it.util.escapeQuotes($schema)}}'",
+ additionalItems: "'should NOT have more than {{=$schema.length}} items'",
+ additionalProperties: "'{{? it.opts._errorDataPathProperty }}is an invalid additional property{{??}}should NOT have additional properties{{?}}'",
+ anyOf: "'should match some schema in anyOf'",
+ const: "'should be equal to constant'",
+ contains: "'should contain a valid item'",
+ dependencies: "'should have {{? $deps.length == 1 }}property {{= it.util.escapeQuotes($deps[0]) }}{{??}}properties {{= it.util.escapeQuotes($deps.join(\", \")) }}{{?}} when property {{= it.util.escapeQuotes($property) }} is present'",
+ 'enum': "'should be equal to one of the allowed values'",
+ format: "'should match format \"{{#def.concatSchemaEQ}}\"'",
+ 'if': "'should match \"' + {{=$ifClause}} + '\" schema'",
+ _limit: "'should be {{=$opStr}} {{#def.appendSchema}}",
+ _exclusiveLimit: "'{{=$exclusiveKeyword}} should be boolean'",
+ _limitItems: "'should NOT have {{?$keyword=='maxItems'}}more{{??}}fewer{{?}} than {{#def.concatSchema}} items'",
+ _limitLength: "'should NOT be {{?$keyword=='maxLength'}}longer{{??}}shorter{{?}} than {{#def.concatSchema}} characters'",
+ _limitProperties:"'should NOT have {{?$keyword=='maxProperties'}}more{{??}}fewer{{?}} than {{#def.concatSchema}} properties'",
+ multipleOf: "'should be multiple of {{#def.appendSchema}}",
+ not: "'should NOT be valid'",
+ oneOf: "'should match exactly one schema in oneOf'",
+ pattern: "'should match pattern \"{{#def.concatSchemaEQ}}\"'",
+ propertyNames: "'property name \\'{{=$invalidName}}\\' is invalid'",
+ required: "'{{? it.opts._errorDataPathProperty }}is a required property{{??}}should have required property \\'{{=$missingProperty}}\\'{{?}}'",
+ type: "'should be {{? $typeIsArray }}{{= $typeSchema.join(\",\") }}{{??}}{{=$typeSchema}}{{?}}'",
+ uniqueItems: "'should NOT have duplicate items (items ## ' + j + ' and ' + i + ' are identical)'",
+ custom: "'should pass \"{{=$rule.keyword}}\" keyword validation'",
+ patternRequired: "'should have property matching pattern \\'{{=$missingPattern}}\\''",
+ switch: "'should pass \"switch\" keyword validation'",
+ _formatLimit: "'should be {{=$opStr}} \"{{#def.concatSchemaEQ}}\"'",
+ _formatExclusiveLimit: "'{{=$exclusiveKeyword}} should be boolean'"
+} #}}
+
+
+{{## def.schemaRefOrVal: {{?$isData}}validate.schema{{=$schemaPath}}{{??}}{{=$schema}}{{?}} #}}
+{{## def.schemaRefOrQS: {{?$isData}}validate.schema{{=$schemaPath}}{{??}}{{=it.util.toQuotedString($schema)}}{{?}} #}}
+
+{{## def._errorSchemas = {
+ 'false schema': "false",
+ $ref: "{{=it.util.toQuotedString($schema)}}",
+ additionalItems: "false",
+ additionalProperties: "false",
+ anyOf: "validate.schema{{=$schemaPath}}",
+ const: "validate.schema{{=$schemaPath}}",
+ contains: "validate.schema{{=$schemaPath}}",
+ dependencies: "validate.schema{{=$schemaPath}}",
+ 'enum': "validate.schema{{=$schemaPath}}",
+ format: "{{#def.schemaRefOrQS}}",
+ 'if': "validate.schema{{=$schemaPath}}",
+ _limit: "{{#def.schemaRefOrVal}}",
+ _exclusiveLimit: "validate.schema{{=$schemaPath}}",
+ _limitItems: "{{#def.schemaRefOrVal}}",
+ _limitLength: "{{#def.schemaRefOrVal}}",
+ _limitProperties:"{{#def.schemaRefOrVal}}",
+ multipleOf: "{{#def.schemaRefOrVal}}",
+ not: "validate.schema{{=$schemaPath}}",
+ oneOf: "validate.schema{{=$schemaPath}}",
+ pattern: "{{#def.schemaRefOrQS}}",
+ propertyNames: "validate.schema{{=$schemaPath}}",
+ required: "validate.schema{{=$schemaPath}}",
+ type: "validate.schema{{=$schemaPath}}",
+ uniqueItems: "{{#def.schemaRefOrVal}}",
+ custom: "validate.schema{{=$schemaPath}}",
+ patternRequired: "validate.schema{{=$schemaPath}}",
+ switch: "validate.schema{{=$schemaPath}}",
+ _formatLimit: "{{#def.schemaRefOrQS}}",
+ _formatExclusiveLimit: "validate.schema{{=$schemaPath}}"
+} #}}
+
+
+{{## def.schemaValueQS: {{?$isData}}{{=$schemaValue}}{{??}}{{=it.util.toQuotedString($schema)}}{{?}} #}}
+
+{{## def._errorParams = {
+ 'false schema': "{}",
+ $ref: "{ ref: '{{=it.util.escapeQuotes($schema)}}' }",
+ additionalItems: "{ limit: {{=$schema.length}} }",
+ additionalProperties: "{ additionalProperty: '{{=$additionalProperty}}' }",
+ anyOf: "{}",
+ const: "{ allowedValue: schema{{=$lvl}} }",
+ contains: "{}",
+ dependencies: "{ property: '{{= it.util.escapeQuotes($property) }}', missingProperty: '{{=$missingProperty}}', depsCount: {{=$deps.length}}, deps: '{{= it.util.escapeQuotes($deps.length==1 ? $deps[0] : $deps.join(\", \")) }}' }",
+ 'enum': "{ allowedValues: schema{{=$lvl}} }",
+ format: "{ format: {{#def.schemaValueQS}} }",
+ 'if': "{ failingKeyword: {{=$ifClause}} }",
+ _limit: "{ comparison: {{=$opExpr}}, limit: {{=$schemaValue}}, exclusive: {{=$exclusive}} }",
+ _exclusiveLimit: "{}",
+ _limitItems: "{ limit: {{=$schemaValue}} }",
+ _limitLength: "{ limit: {{=$schemaValue}} }",
+ _limitProperties:"{ limit: {{=$schemaValue}} }",
+ multipleOf: "{ multipleOf: {{=$schemaValue}} }",
+ not: "{}",
+ oneOf: "{ passingSchemas: {{=$passingSchemas}} }",
+ pattern: "{ pattern: {{#def.schemaValueQS}} }",
+ propertyNames: "{ propertyName: '{{=$invalidName}}' }",
+ required: "{ missingProperty: '{{=$missingProperty}}' }",
+ type: "{ type: '{{? $typeIsArray }}{{= $typeSchema.join(\",\") }}{{??}}{{=$typeSchema}}{{?}}' }",
+ uniqueItems: "{ i: i, j: j }",
+ custom: "{ keyword: '{{=$rule.keyword}}' }",
+ patternRequired: "{ missingPattern: '{{=$missingPattern}}' }",
+ switch: "{ caseIndex: {{=$caseIndex}} }",
+ _formatLimit: "{ comparison: {{=$opExpr}}, limit: {{#def.schemaValueQS}}, exclusive: {{=$exclusive}} }",
+ _formatExclusiveLimit: "{}"
+} #}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/format.jst b/website_quotation_template/node_modules/ajv/lib/dot/format.jst
new file mode 100644
index 000000000..37f14da80
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/format.jst
@@ -0,0 +1,106 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+
+{{## def.skipFormat:
+ {{? $breakOnError }} if (true) { {{?}}
+ {{ return out; }}
+#}}
+
+{{? it.opts.format === false }}{{# def.skipFormat }}{{?}}
+
+
+{{# def.$data }}
+
+
+{{## def.$dataCheckFormat:
+ {{# def.$dataNotType:'string' }}
+ ({{? $unknownFormats != 'ignore' }}
+ ({{=$schemaValue}} && !{{=$format}}
+ {{? $allowUnknown }}
+ && self._opts.unknownFormats.indexOf({{=$schemaValue}}) == -1
+ {{?}}) ||
+ {{?}}
+ ({{=$format}} && {{=$formatType}} == '{{=$ruleType}}'
+ && !(typeof {{=$format}} == 'function'
+ ? {{? it.async}}
+ (async{{=$lvl}} ? await {{=$format}}({{=$data}}) : {{=$format}}({{=$data}}))
+ {{??}}
+ {{=$format}}({{=$data}})
+ {{?}}
+ : {{=$format}}.test({{=$data}}))))
+#}}
+
+{{## def.checkFormat:
+ {{
+ var $formatRef = 'formats' + it.util.getProperty($schema);
+ if ($isObject) $formatRef += '.validate';
+ }}
+ {{? typeof $format == 'function' }}
+ {{=$formatRef}}({{=$data}})
+ {{??}}
+ {{=$formatRef}}.test({{=$data}})
+ {{?}}
+#}}
+
+
+{{
+ var $unknownFormats = it.opts.unknownFormats
+ , $allowUnknown = Array.isArray($unknownFormats);
+}}
+
+{{? $isData }}
+ {{
+ var $format = 'format' + $lvl
+ , $isObject = 'isObject' + $lvl
+ , $formatType = 'formatType' + $lvl;
+ }}
+ var {{=$format}} = formats[{{=$schemaValue}}];
+ var {{=$isObject}} = typeof {{=$format}} == 'object'
+ && !({{=$format}} instanceof RegExp)
+ && {{=$format}}.validate;
+ var {{=$formatType}} = {{=$isObject}} && {{=$format}}.type || 'string';
+ if ({{=$isObject}}) {
+ {{? it.async}}
+ var async{{=$lvl}} = {{=$format}}.async;
+ {{?}}
+ {{=$format}} = {{=$format}}.validate;
+ }
+ if ({{# def.$dataCheckFormat }}) {
+{{??}}
+ {{ var $format = it.formats[$schema]; }}
+ {{? !$format }}
+ {{? $unknownFormats == 'ignore' }}
+ {{ it.logger.warn('unknown format "' + $schema + '" ignored in schema at path "' + it.errSchemaPath + '"'); }}
+ {{# def.skipFormat }}
+ {{?? $allowUnknown && $unknownFormats.indexOf($schema) >= 0 }}
+ {{# def.skipFormat }}
+ {{??}}
+ {{ throw new Error('unknown format "' + $schema + '" is used in schema at path "' + it.errSchemaPath + '"'); }}
+ {{?}}
+ {{?}}
+ {{
+ var $isObject = typeof $format == 'object'
+ && !($format instanceof RegExp)
+ && $format.validate;
+ var $formatType = $isObject && $format.type || 'string';
+ if ($isObject) {
+ var $async = $format.async === true;
+ $format = $format.validate;
+ }
+ }}
+ {{? $formatType != $ruleType }}
+ {{# def.skipFormat }}
+ {{?}}
+ {{? $async }}
+ {{
+ if (!it.async) throw new Error('async format in sync schema');
+ var $formatRef = 'formats' + it.util.getProperty($schema) + '.validate';
+ }}
+ if (!(await {{=$formatRef}}({{=$data}}))) {
+ {{??}}
+ if (!{{# def.checkFormat }}) {
+ {{?}}
+{{?}}
+ {{# def.error:'format' }}
+ } {{? $breakOnError }} else { {{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/if.jst b/website_quotation_template/node_modules/ajv/lib/dot/if.jst
new file mode 100644
index 000000000..adb503612
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/if.jst
@@ -0,0 +1,73 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.setupNextLevel }}
+
+
+{{## def.validateIfClause:_clause:
+ {{
+ $it.schema = it.schema['_clause'];
+ $it.schemaPath = it.schemaPath + '._clause';
+ $it.errSchemaPath = it.errSchemaPath + '/_clause';
+ }}
+ {{# def.insertSubschemaCode }}
+ {{=$valid}} = {{=$nextValid}};
+ {{? $thenPresent && $elsePresent }}
+ {{ $ifClause = 'ifClause' + $lvl; }}
+ var {{=$ifClause}} = '_clause';
+ {{??}}
+ {{ $ifClause = '\'_clause\''; }}
+ {{?}}
+#}}
+
+{{
+ var $thenSch = it.schema['then']
+ , $elseSch = it.schema['else']
+ , $thenPresent = $thenSch !== undefined && {{# def.nonEmptySchema:$thenSch }}
+ , $elsePresent = $elseSch !== undefined && {{# def.nonEmptySchema:$elseSch }}
+ , $currentBaseId = $it.baseId;
+}}
+
+{{? $thenPresent || $elsePresent }}
+ {{
+ var $ifClause;
+ $it.createErrors = false;
+ $it.schema = $schema;
+ $it.schemaPath = $schemaPath;
+ $it.errSchemaPath = $errSchemaPath;
+ }}
+ var {{=$errs}} = errors;
+ var {{=$valid}} = true;
+
+ {{# def.setCompositeRule }}
+ {{# def.insertSubschemaCode }}
+ {{ $it.createErrors = true; }}
+ {{# def.resetErrors }}
+ {{# def.resetCompositeRule }}
+
+ {{? $thenPresent }}
+ if ({{=$nextValid}}) {
+ {{# def.validateIfClause:then }}
+ }
+ {{? $elsePresent }}
+ else {
+ {{?}}
+ {{??}}
+ if (!{{=$nextValid}}) {
+ {{?}}
+
+ {{? $elsePresent }}
+ {{# def.validateIfClause:else }}
+ }
+ {{?}}
+
+ if (!{{=$valid}}) {
+ {{# def.extraError:'if' }}
+ }
+ {{? $breakOnError }} else { {{?}}
+{{??}}
+ {{? $breakOnError }}
+ if (true) {
+ {{?}}
+{{?}}
+
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/items.jst b/website_quotation_template/node_modules/ajv/lib/dot/items.jst
new file mode 100644
index 000000000..acc932a26
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/items.jst
@@ -0,0 +1,98 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.setupNextLevel }}
+
+
+{{## def.validateItems:startFrom:
+ for (var {{=$idx}} = {{=startFrom}}; {{=$idx}} < {{=$data}}.length; {{=$idx}}++) {
+ {{
+ $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true);
+ var $passData = $data + '[' + $idx + ']';
+ $it.dataPathArr[$dataNxt] = $idx;
+ }}
+
+ {{# def.generateSubschemaCode }}
+ {{# def.optimizeValidate }}
+
+ {{? $breakOnError }}
+ if (!{{=$nextValid}}) break;
+ {{?}}
+ }
+#}}
+
+{{
+ var $idx = 'i' + $lvl
+ , $dataNxt = $it.dataLevel = it.dataLevel + 1
+ , $nextData = 'data' + $dataNxt
+ , $currentBaseId = it.baseId;
+}}
+
+var {{=$errs}} = errors;
+var {{=$valid}};
+
+{{? Array.isArray($schema) }}
+ {{ /* 'items' is an array of schemas */}}
+ {{ var $additionalItems = it.schema.additionalItems; }}
+ {{? $additionalItems === false }}
+ {{=$valid}} = {{=$data}}.length <= {{= $schema.length }};
+ {{
+ var $currErrSchemaPath = $errSchemaPath;
+ $errSchemaPath = it.errSchemaPath + '/additionalItems';
+ }}
+ {{# def.checkError:'additionalItems' }}
+ {{ $errSchemaPath = $currErrSchemaPath; }}
+ {{# def.elseIfValid}}
+ {{?}}
+
+ {{~ $schema:$sch:$i }}
+ {{? {{# def.nonEmptySchema:$sch }} }}
+ {{=$nextValid}} = true;
+
+ if ({{=$data}}.length > {{=$i}}) {
+ {{
+ var $passData = $data + '[' + $i + ']';
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + '[' + $i + ']';
+ $it.errSchemaPath = $errSchemaPath + '/' + $i;
+ $it.errorPath = it.util.getPathExpr(it.errorPath, $i, it.opts.jsonPointers, true);
+ $it.dataPathArr[$dataNxt] = $i;
+ }}
+
+ {{# def.generateSubschemaCode }}
+ {{# def.optimizeValidate }}
+ }
+
+ {{# def.ifResultValid }}
+ {{?}}
+ {{~}}
+
+ {{? typeof $additionalItems == 'object' && {{# def.nonEmptySchema:$additionalItems }} }}
+ {{
+ $it.schema = $additionalItems;
+ $it.schemaPath = it.schemaPath + '.additionalItems';
+ $it.errSchemaPath = it.errSchemaPath + '/additionalItems';
+ }}
+ {{=$nextValid}} = true;
+
+ if ({{=$data}}.length > {{= $schema.length }}) {
+ {{# def.validateItems: $schema.length }}
+ }
+
+ {{# def.ifResultValid }}
+ {{?}}
+
+{{?? {{# def.nonEmptySchema:$schema }} }}
+ {{ /* 'items' is a single schema */}}
+ {{
+ $it.schema = $schema;
+ $it.schemaPath = $schemaPath;
+ $it.errSchemaPath = $errSchemaPath;
+ }}
+ {{# def.validateItems: 0 }}
+{{?}}
+
+{{? $breakOnError }}
+ {{= $closingBraces }}
+ if ({{=$errs}} == errors) {
+{{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/missing.def b/website_quotation_template/node_modules/ajv/lib/dot/missing.def
new file mode 100644
index 000000000..a73b9f966
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/missing.def
@@ -0,0 +1,39 @@
+{{## def.checkMissingProperty:_properties:
+ {{~ _properties:$propertyKey:$i }}
+ {{?$i}} || {{?}}
+ {{
+ var $prop = it.util.getProperty($propertyKey)
+ , $useData = $data + $prop;
+ }}
+ ( ({{# def.noPropertyInData }}) && (missing{{=$lvl}} = {{= it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop) }}) )
+ {{~}}
+#}}
+
+
+{{## def.errorMissingProperty:_error:
+ {{
+ var $propertyPath = 'missing' + $lvl
+ , $missingProperty = '\' + ' + $propertyPath + ' + \'';
+ if (it.opts._errorDataPathProperty) {
+ it.errorPath = it.opts.jsonPointers
+ ? it.util.getPathExpr($currentErrorPath, $propertyPath, true)
+ : $currentErrorPath + ' + ' + $propertyPath;
+ }
+ }}
+ {{# def.error:_error }}
+#}}
+
+
+{{## def.allErrorsMissingProperty:_error:
+ {{
+ var $prop = it.util.getProperty($propertyKey)
+ , $missingProperty = it.util.escapeQuotes($propertyKey)
+ , $useData = $data + $prop;
+ if (it.opts._errorDataPathProperty) {
+ it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers);
+ }
+ }}
+ if ({{# def.noPropertyInData }}) {
+ {{# def.addError:_error }}
+ }
+#}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/multipleOf.jst b/website_quotation_template/node_modules/ajv/lib/dot/multipleOf.jst
new file mode 100644
index 000000000..6d88a456f
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/multipleOf.jst
@@ -0,0 +1,22 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.$data }}
+
+{{# def.numberKeyword }}
+
+var division{{=$lvl}};
+if ({{?$isData}}
+ {{=$schemaValue}} !== undefined && (
+ typeof {{=$schemaValue}} != 'number' ||
+ {{?}}
+ (division{{=$lvl}} = {{=$data}} / {{=$schemaValue}},
+ {{? it.opts.multipleOfPrecision }}
+ Math.abs(Math.round(division{{=$lvl}}) - division{{=$lvl}}) > 1e-{{=it.opts.multipleOfPrecision}}
+ {{??}}
+ division{{=$lvl}} !== parseInt(division{{=$lvl}})
+ {{?}}
+ )
+ {{?$isData}} ) {{?}} ) {
+ {{# def.error:'multipleOf' }}
+} {{? $breakOnError }} else { {{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/not.jst b/website_quotation_template/node_modules/ajv/lib/dot/not.jst
new file mode 100644
index 000000000..e03185ae8
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/not.jst
@@ -0,0 +1,43 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.setupNextLevel }}
+
+{{? {{# def.nonEmptySchema:$schema }} }}
+ {{
+ $it.schema = $schema;
+ $it.schemaPath = $schemaPath;
+ $it.errSchemaPath = $errSchemaPath;
+ }}
+
+ var {{=$errs}} = errors;
+
+ {{# def.setCompositeRule }}
+
+ {{
+ $it.createErrors = false;
+ var $allErrorsOption;
+ if ($it.opts.allErrors) {
+ $allErrorsOption = $it.opts.allErrors;
+ $it.opts.allErrors = false;
+ }
+ }}
+ {{= it.validate($it) }}
+ {{
+ $it.createErrors = true;
+ if ($allErrorsOption) $it.opts.allErrors = $allErrorsOption;
+ }}
+
+ {{# def.resetCompositeRule }}
+
+ if ({{=$nextValid}}) {
+ {{# def.error:'not' }}
+ } else {
+ {{# def.resetErrors }}
+ {{? it.opts.allErrors }} } {{?}}
+{{??}}
+ {{# def.addError:'not' }}
+ {{? $breakOnError}}
+ if (false) {
+ {{?}}
+{{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/oneOf.jst b/website_quotation_template/node_modules/ajv/lib/dot/oneOf.jst
new file mode 100644
index 000000000..bcce2c6ed
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/oneOf.jst
@@ -0,0 +1,54 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.setupNextLevel }}
+
+{{
+ var $currentBaseId = $it.baseId
+ , $prevValid = 'prevValid' + $lvl
+ , $passingSchemas = 'passingSchemas' + $lvl;
+}}
+
+var {{=$errs}} = errors
+ , {{=$prevValid}} = false
+ , {{=$valid}} = false
+ , {{=$passingSchemas}} = null;
+
+{{# def.setCompositeRule }}
+
+{{~ $schema:$sch:$i }}
+ {{? {{# def.nonEmptySchema:$sch }} }}
+ {{
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + '[' + $i + ']';
+ $it.errSchemaPath = $errSchemaPath + '/' + $i;
+ }}
+
+ {{# def.insertSubschemaCode }}
+ {{??}}
+ var {{=$nextValid}} = true;
+ {{?}}
+
+ {{? $i }}
+ if ({{=$nextValid}} && {{=$prevValid}}) {
+ {{=$valid}} = false;
+ {{=$passingSchemas}} = [{{=$passingSchemas}}, {{=$i}}];
+ } else {
+ {{ $closingBraces += '}'; }}
+ {{?}}
+
+ if ({{=$nextValid}}) {
+ {{=$valid}} = {{=$prevValid}} = true;
+ {{=$passingSchemas}} = {{=$i}};
+ }
+{{~}}
+
+{{# def.resetCompositeRule }}
+
+{{= $closingBraces }}
+
+if (!{{=$valid}}) {
+ {{# def.extraError:'oneOf' }}
+} else {
+ {{# def.resetErrors }}
+{{? it.opts.allErrors }} } {{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/pattern.jst b/website_quotation_template/node_modules/ajv/lib/dot/pattern.jst
new file mode 100644
index 000000000..3a37ef6cb
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/pattern.jst
@@ -0,0 +1,14 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.$data }}
+
+{{
+ var $regexp = $isData
+ ? '(new RegExp(' + $schemaValue + '))'
+ : it.usePattern($schema);
+}}
+
+if ({{# def.$dataNotType:'string' }} !{{=$regexp}}.test({{=$data}}) ) {
+ {{# def.error:'pattern' }}
+} {{? $breakOnError }} else { {{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/properties.jst b/website_quotation_template/node_modules/ajv/lib/dot/properties.jst
new file mode 100644
index 000000000..5cebb9b12
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/properties.jst
@@ -0,0 +1,245 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.setupNextLevel }}
+
+
+{{## def.validateAdditional:
+ {{ /* additionalProperties is schema */
+ $it.schema = $aProperties;
+ $it.schemaPath = it.schemaPath + '.additionalProperties';
+ $it.errSchemaPath = it.errSchemaPath + '/additionalProperties';
+ $it.errorPath = it.opts._errorDataPathProperty
+ ? it.errorPath
+ : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers);
+ var $passData = $data + '[' + $key + ']';
+ $it.dataPathArr[$dataNxt] = $key;
+ }}
+
+ {{# def.generateSubschemaCode }}
+ {{# def.optimizeValidate }}
+#}}
+
+
+{{
+ var $key = 'key' + $lvl
+ , $idx = 'idx' + $lvl
+ , $dataNxt = $it.dataLevel = it.dataLevel + 1
+ , $nextData = 'data' + $dataNxt
+ , $dataProperties = 'dataProperties' + $lvl;
+
+ var $schemaKeys = Object.keys($schema || {}).filter(notProto)
+ , $pProperties = it.schema.patternProperties || {}
+ , $pPropertyKeys = Object.keys($pProperties).filter(notProto)
+ , $aProperties = it.schema.additionalProperties
+ , $someProperties = $schemaKeys.length || $pPropertyKeys.length
+ , $noAdditional = $aProperties === false
+ , $additionalIsSchema = typeof $aProperties == 'object'
+ && Object.keys($aProperties).length
+ , $removeAdditional = it.opts.removeAdditional
+ , $checkAdditional = $noAdditional || $additionalIsSchema || $removeAdditional
+ , $ownProperties = it.opts.ownProperties
+ , $currentBaseId = it.baseId;
+
+ var $required = it.schema.required;
+ if ($required && !(it.opts.$data && $required.$data) && $required.length < it.opts.loopRequired) {
+ var $requiredHash = it.util.toHash($required);
+ }
+
+ function notProto(p) { return p !== '__proto__'; }
+}}
+
+
+var {{=$errs}} = errors;
+var {{=$nextValid}} = true;
+{{? $ownProperties }}
+ var {{=$dataProperties}} = undefined;
+{{?}}
+
+{{? $checkAdditional }}
+ {{# def.iterateProperties }}
+ {{? $someProperties }}
+ var isAdditional{{=$lvl}} = !(false
+ {{? $schemaKeys.length }}
+ {{? $schemaKeys.length > 8 }}
+ || validate.schema{{=$schemaPath}}.hasOwnProperty({{=$key}})
+ {{??}}
+ {{~ $schemaKeys:$propertyKey }}
+ || {{=$key}} == {{= it.util.toQuotedString($propertyKey) }}
+ {{~}}
+ {{?}}
+ {{?}}
+ {{? $pPropertyKeys.length }}
+ {{~ $pPropertyKeys:$pProperty:$i }}
+ || {{= it.usePattern($pProperty) }}.test({{=$key}})
+ {{~}}
+ {{?}}
+ );
+
+ if (isAdditional{{=$lvl}}) {
+ {{?}}
+ {{? $removeAdditional == 'all' }}
+ delete {{=$data}}[{{=$key}}];
+ {{??}}
+ {{
+ var $currentErrorPath = it.errorPath;
+ var $additionalProperty = '\' + ' + $key + ' + \'';
+ if (it.opts._errorDataPathProperty) {
+ it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers);
+ }
+ }}
+ {{? $noAdditional }}
+ {{? $removeAdditional }}
+ delete {{=$data}}[{{=$key}}];
+ {{??}}
+ {{=$nextValid}} = false;
+ {{
+ var $currErrSchemaPath = $errSchemaPath;
+ $errSchemaPath = it.errSchemaPath + '/additionalProperties';
+ }}
+ {{# def.error:'additionalProperties' }}
+ {{ $errSchemaPath = $currErrSchemaPath; }}
+ {{? $breakOnError }} break; {{?}}
+ {{?}}
+ {{?? $additionalIsSchema }}
+ {{? $removeAdditional == 'failing' }}
+ var {{=$errs}} = errors;
+ {{# def.setCompositeRule }}
+
+ {{# def.validateAdditional }}
+
+ if (!{{=$nextValid}}) {
+ errors = {{=$errs}};
+ if (validate.errors !== null) {
+ if (errors) validate.errors.length = errors;
+ else validate.errors = null;
+ }
+ delete {{=$data}}[{{=$key}}];
+ }
+
+ {{# def.resetCompositeRule }}
+ {{??}}
+ {{# def.validateAdditional }}
+ {{? $breakOnError }} if (!{{=$nextValid}}) break; {{?}}
+ {{?}}
+ {{?}}
+ {{ it.errorPath = $currentErrorPath; }}
+ {{?}}
+ {{? $someProperties }}
+ }
+ {{?}}
+ }
+
+ {{# def.ifResultValid }}
+{{?}}
+
+{{ var $useDefaults = it.opts.useDefaults && !it.compositeRule; }}
+
+{{? $schemaKeys.length }}
+ {{~ $schemaKeys:$propertyKey }}
+ {{ var $sch = $schema[$propertyKey]; }}
+
+ {{? {{# def.nonEmptySchema:$sch}} }}
+ {{
+ var $prop = it.util.getProperty($propertyKey)
+ , $passData = $data + $prop
+ , $hasDefault = $useDefaults && $sch.default !== undefined;
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + $prop;
+ $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey);
+ $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers);
+ $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey);
+ }}
+
+ {{# def.generateSubschemaCode }}
+
+ {{? {{# def.willOptimize }} }}
+ {{
+ $code = {{# def._optimizeValidate }};
+ var $useData = $passData;
+ }}
+ {{??}}
+ {{ var $useData = $nextData; }}
+ var {{=$nextData}} = {{=$passData}};
+ {{?}}
+
+ {{? $hasDefault }}
+ {{= $code }}
+ {{??}}
+ {{? $requiredHash && $requiredHash[$propertyKey] }}
+ if ({{# def.noPropertyInData }}) {
+ {{=$nextValid}} = false;
+ {{
+ var $currentErrorPath = it.errorPath
+ , $currErrSchemaPath = $errSchemaPath
+ , $missingProperty = it.util.escapeQuotes($propertyKey);
+ if (it.opts._errorDataPathProperty) {
+ it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers);
+ }
+ $errSchemaPath = it.errSchemaPath + '/required';
+ }}
+ {{# def.error:'required' }}
+ {{ $errSchemaPath = $currErrSchemaPath; }}
+ {{ it.errorPath = $currentErrorPath; }}
+ } else {
+ {{??}}
+ {{? $breakOnError }}
+ if ({{# def.noPropertyInData }}) {
+ {{=$nextValid}} = true;
+ } else {
+ {{??}}
+ if ({{=$useData}} !== undefined
+ {{? $ownProperties }}
+ && {{# def.isOwnProperty }}
+ {{?}}
+ ) {
+ {{?}}
+ {{?}}
+
+ {{= $code }}
+ }
+ {{?}} {{ /* $hasDefault */ }}
+ {{?}} {{ /* def.nonEmptySchema */ }}
+
+ {{# def.ifResultValid }}
+ {{~}}
+{{?}}
+
+{{? $pPropertyKeys.length }}
+ {{~ $pPropertyKeys:$pProperty }}
+ {{ var $sch = $pProperties[$pProperty]; }}
+
+ {{? {{# def.nonEmptySchema:$sch}} }}
+ {{
+ $it.schema = $sch;
+ $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty);
+ $it.errSchemaPath = it.errSchemaPath + '/patternProperties/'
+ + it.util.escapeFragment($pProperty);
+ }}
+
+ {{# def.iterateProperties }}
+ if ({{= it.usePattern($pProperty) }}.test({{=$key}})) {
+ {{
+ $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers);
+ var $passData = $data + '[' + $key + ']';
+ $it.dataPathArr[$dataNxt] = $key;
+ }}
+
+ {{# def.generateSubschemaCode }}
+ {{# def.optimizeValidate }}
+
+ {{? $breakOnError }} if (!{{=$nextValid}}) break; {{?}}
+ }
+ {{? $breakOnError }} else {{=$nextValid}} = true; {{?}}
+ }
+
+ {{# def.ifResultValid }}
+ {{?}} {{ /* def.nonEmptySchema */ }}
+ {{~}}
+{{?}}
+
+
+{{? $breakOnError }}
+ {{= $closingBraces }}
+ if ({{=$errs}} == errors) {
+{{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/propertyNames.jst b/website_quotation_template/node_modules/ajv/lib/dot/propertyNames.jst
new file mode 100644
index 000000000..d456ccafc
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/propertyNames.jst
@@ -0,0 +1,52 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.setupNextLevel }}
+
+var {{=$errs}} = errors;
+
+{{? {{# def.nonEmptySchema:$schema }} }}
+ {{
+ $it.schema = $schema;
+ $it.schemaPath = $schemaPath;
+ $it.errSchemaPath = $errSchemaPath;
+ }}
+
+ {{
+ var $key = 'key' + $lvl
+ , $idx = 'idx' + $lvl
+ , $i = 'i' + $lvl
+ , $invalidName = '\' + ' + $key + ' + \''
+ , $dataNxt = $it.dataLevel = it.dataLevel + 1
+ , $nextData = 'data' + $dataNxt
+ , $dataProperties = 'dataProperties' + $lvl
+ , $ownProperties = it.opts.ownProperties
+ , $currentBaseId = it.baseId;
+ }}
+
+ {{? $ownProperties }}
+ var {{=$dataProperties}} = undefined;
+ {{?}}
+ {{# def.iterateProperties }}
+ var startErrs{{=$lvl}} = errors;
+
+ {{ var $passData = $key; }}
+ {{# def.setCompositeRule }}
+ {{# def.generateSubschemaCode }}
+ {{# def.optimizeValidate }}
+ {{# def.resetCompositeRule }}
+
+ if (!{{=$nextValid}}) {
+ for (var {{=$i}}=startErrs{{=$lvl}}; {{=$i}}= it.opts.loopRequired
+ , $ownProperties = it.opts.ownProperties;
+ }}
+
+ {{? $breakOnError }}
+ var missing{{=$lvl}};
+ {{? $loopRequired }}
+ {{# def.setupLoop }}
+ var {{=$valid}} = true;
+
+ {{?$isData}}{{# def.check$dataIsArray }}{{?}}
+
+ for (var {{=$i}} = 0; {{=$i}} < {{=$vSchema}}.length; {{=$i}}++) {
+ {{=$valid}} = {{=$data}}[{{=$vSchema}}[{{=$i}}]] !== undefined
+ {{? $ownProperties }}
+ && {{# def.isRequiredOwnProperty }}
+ {{?}};
+ if (!{{=$valid}}) break;
+ }
+
+ {{? $isData }} } {{?}}
+
+ {{# def.checkError:'required' }}
+ else {
+ {{??}}
+ if ({{# def.checkMissingProperty:$required }}) {
+ {{# def.errorMissingProperty:'required' }}
+ } else {
+ {{?}}
+ {{??}}
+ {{? $loopRequired }}
+ {{# def.setupLoop }}
+ {{? $isData }}
+ if ({{=$vSchema}} && !Array.isArray({{=$vSchema}})) {
+ {{# def.addError:'required' }}
+ } else if ({{=$vSchema}} !== undefined) {
+ {{?}}
+
+ for (var {{=$i}} = 0; {{=$i}} < {{=$vSchema}}.length; {{=$i}}++) {
+ if ({{=$data}}[{{=$vSchema}}[{{=$i}}]] === undefined
+ {{? $ownProperties }}
+ || !{{# def.isRequiredOwnProperty }}
+ {{?}}) {
+ {{# def.addError:'required' }}
+ }
+ }
+
+ {{? $isData }} } {{?}}
+ {{??}}
+ {{~ $required:$propertyKey }}
+ {{# def.allErrorsMissingProperty:'required' }}
+ {{~}}
+ {{?}}
+ {{?}}
+
+ {{ it.errorPath = $currentErrorPath; }}
+
+{{?? $breakOnError }}
+ if (true) {
+{{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/uniqueItems.jst b/website_quotation_template/node_modules/ajv/lib/dot/uniqueItems.jst
new file mode 100644
index 000000000..e69b8308d
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/uniqueItems.jst
@@ -0,0 +1,62 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.setupKeyword }}
+{{# def.$data }}
+
+
+{{? ($schema || $isData) && it.opts.uniqueItems !== false }}
+ {{? $isData }}
+ var {{=$valid}};
+ if ({{=$schemaValue}} === false || {{=$schemaValue}} === undefined)
+ {{=$valid}} = true;
+ else if (typeof {{=$schemaValue}} != 'boolean')
+ {{=$valid}} = false;
+ else {
+ {{?}}
+
+ var i = {{=$data}}.length
+ , {{=$valid}} = true
+ , j;
+ if (i > 1) {
+ {{
+ var $itemType = it.schema.items && it.schema.items.type
+ , $typeIsArray = Array.isArray($itemType);
+ }}
+ {{? !$itemType || $itemType == 'object' || $itemType == 'array' ||
+ ($typeIsArray && ($itemType.indexOf('object') >= 0 || $itemType.indexOf('array') >= 0)) }}
+ outer:
+ for (;i--;) {
+ for (j = i; j--;) {
+ if (equal({{=$data}}[i], {{=$data}}[j])) {
+ {{=$valid}} = false;
+ break outer;
+ }
+ }
+ }
+ {{??}}
+ var itemIndices = {}, item;
+ for (;i--;) {
+ var item = {{=$data}}[i];
+ {{ var $method = 'checkDataType' + ($typeIsArray ? 's' : ''); }}
+ if ({{= it.util[$method]($itemType, 'item', it.opts.strictNumbers, true) }}) continue;
+ {{? $typeIsArray}}
+ if (typeof item == 'string') item = '"' + item;
+ {{?}}
+ if (typeof itemIndices[item] == 'number') {
+ {{=$valid}} = false;
+ j = itemIndices[item];
+ break;
+ }
+ itemIndices[item] = i;
+ }
+ {{?}}
+ }
+
+ {{? $isData }} } {{?}}
+
+ if (!{{=$valid}}) {
+ {{# def.error:'uniqueItems' }}
+ } {{? $breakOnError }} else { {{?}}
+{{??}}
+ {{? $breakOnError }} if (true) { {{?}}
+{{?}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dot/validate.jst b/website_quotation_template/node_modules/ajv/lib/dot/validate.jst
new file mode 100644
index 000000000..32087e71c
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dot/validate.jst
@@ -0,0 +1,276 @@
+{{# def.definitions }}
+{{# def.errors }}
+{{# def.defaults }}
+{{# def.coerce }}
+
+{{ /**
+ * schema compilation (render) time:
+ * it = { schema, RULES, _validate, opts }
+ * it.validate - this template function,
+ * it is used recursively to generate code for subschemas
+ *
+ * runtime:
+ * "validate" is a variable name to which this function will be assigned
+ * validateRef etc. are defined in the parent scope in index.js
+ */ }}
+
+{{
+ var $async = it.schema.$async === true
+ , $refKeywords = it.util.schemaHasRulesExcept(it.schema, it.RULES.all, '$ref')
+ , $id = it.self._getId(it.schema);
+}}
+
+{{
+ if (it.opts.strictKeywords) {
+ var $unknownKwd = it.util.schemaUnknownRules(it.schema, it.RULES.keywords);
+ if ($unknownKwd) {
+ var $keywordsMsg = 'unknown keyword: ' + $unknownKwd;
+ if (it.opts.strictKeywords === 'log') it.logger.warn($keywordsMsg);
+ else throw new Error($keywordsMsg);
+ }
+ }
+}}
+
+{{? it.isTop }}
+ var validate = {{?$async}}{{it.async = true;}}async {{?}}function(data, dataPath, parentData, parentDataProperty, rootData) {
+ 'use strict';
+ {{? $id && (it.opts.sourceCode || it.opts.processCode) }}
+ {{= '/\*# sourceURL=' + $id + ' */' }}
+ {{?}}
+{{?}}
+
+{{? typeof it.schema == 'boolean' || !($refKeywords || it.schema.$ref) }}
+ {{ var $keyword = 'false schema'; }}
+ {{# def.setupKeyword }}
+ {{? it.schema === false}}
+ {{? it.isTop}}
+ {{ $breakOnError = true; }}
+ {{??}}
+ var {{=$valid}} = false;
+ {{?}}
+ {{# def.error:'false schema' }}
+ {{??}}
+ {{? it.isTop}}
+ {{? $async }}
+ return data;
+ {{??}}
+ validate.errors = null;
+ return true;
+ {{?}}
+ {{??}}
+ var {{=$valid}} = true;
+ {{?}}
+ {{?}}
+
+ {{? it.isTop}}
+ };
+ return validate;
+ {{?}}
+
+ {{ return out; }}
+{{?}}
+
+
+{{? it.isTop }}
+ {{
+ var $top = it.isTop
+ , $lvl = it.level = 0
+ , $dataLvl = it.dataLevel = 0
+ , $data = 'data';
+ it.rootId = it.resolve.fullPath(it.self._getId(it.root.schema));
+ it.baseId = it.baseId || it.rootId;
+ delete it.isTop;
+
+ it.dataPathArr = [""];
+
+ if (it.schema.default !== undefined && it.opts.useDefaults && it.opts.strictDefaults) {
+ var $defaultMsg = 'default is ignored in the schema root';
+ if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg);
+ else throw new Error($defaultMsg);
+ }
+ }}
+
+ var vErrors = null; {{ /* don't edit, used in replace */ }}
+ var errors = 0; {{ /* don't edit, used in replace */ }}
+ if (rootData === undefined) rootData = data; {{ /* don't edit, used in replace */ }}
+{{??}}
+ {{
+ var $lvl = it.level
+ , $dataLvl = it.dataLevel
+ , $data = 'data' + ($dataLvl || '');
+
+ if ($id) it.baseId = it.resolve.url(it.baseId, $id);
+
+ if ($async && !it.async) throw new Error('async schema in sync schema');
+ }}
+
+ var errs_{{=$lvl}} = errors;
+{{?}}
+
+{{
+ var $valid = 'valid' + $lvl
+ , $breakOnError = !it.opts.allErrors
+ , $closingBraces1 = ''
+ , $closingBraces2 = '';
+
+ var $errorKeyword;
+ var $typeSchema = it.schema.type
+ , $typeIsArray = Array.isArray($typeSchema);
+
+ if ($typeSchema && it.opts.nullable && it.schema.nullable === true) {
+ if ($typeIsArray) {
+ if ($typeSchema.indexOf('null') == -1)
+ $typeSchema = $typeSchema.concat('null');
+ } else if ($typeSchema != 'null') {
+ $typeSchema = [$typeSchema, 'null'];
+ $typeIsArray = true;
+ }
+ }
+
+ if ($typeIsArray && $typeSchema.length == 1) {
+ $typeSchema = $typeSchema[0];
+ $typeIsArray = false;
+ }
+}}
+
+{{## def.checkType:
+ {{
+ var $schemaPath = it.schemaPath + '.type'
+ , $errSchemaPath = it.errSchemaPath + '/type'
+ , $method = $typeIsArray ? 'checkDataTypes' : 'checkDataType';
+ }}
+
+ if ({{= it.util[$method]($typeSchema, $data, it.opts.strictNumbers, true) }}) {
+#}}
+
+{{? it.schema.$ref && $refKeywords }}
+ {{? it.opts.extendRefs == 'fail' }}
+ {{ throw new Error('$ref: validation keywords used in schema at path "' + it.errSchemaPath + '" (see option extendRefs)'); }}
+ {{?? it.opts.extendRefs !== true }}
+ {{
+ $refKeywords = false;
+ it.logger.warn('$ref: keywords ignored in schema at path "' + it.errSchemaPath + '"');
+ }}
+ {{?}}
+{{?}}
+
+{{? it.schema.$comment && it.opts.$comment }}
+ {{= it.RULES.all.$comment.code(it, '$comment') }}
+{{?}}
+
+{{? $typeSchema }}
+ {{? it.opts.coerceTypes }}
+ {{ var $coerceToTypes = it.util.coerceToTypes(it.opts.coerceTypes, $typeSchema); }}
+ {{?}}
+
+ {{ var $rulesGroup = it.RULES.types[$typeSchema]; }}
+ {{? $coerceToTypes || $typeIsArray || $rulesGroup === true ||
+ ($rulesGroup && !$shouldUseGroup($rulesGroup)) }}
+ {{
+ var $schemaPath = it.schemaPath + '.type'
+ , $errSchemaPath = it.errSchemaPath + '/type';
+ }}
+ {{# def.checkType }}
+ {{? $coerceToTypes }}
+ {{# def.coerceType }}
+ {{??}}
+ {{# def.error:'type' }}
+ {{?}}
+ }
+ {{?}}
+{{?}}
+
+
+{{? it.schema.$ref && !$refKeywords }}
+ {{= it.RULES.all.$ref.code(it, '$ref') }}
+ {{? $breakOnError }}
+ }
+ if (errors === {{?$top}}0{{??}}errs_{{=$lvl}}{{?}}) {
+ {{ $closingBraces2 += '}'; }}
+ {{?}}
+{{??}}
+ {{~ it.RULES:$rulesGroup }}
+ {{? $shouldUseGroup($rulesGroup) }}
+ {{? $rulesGroup.type }}
+ if ({{= it.util.checkDataType($rulesGroup.type, $data, it.opts.strictNumbers) }}) {
+ {{?}}
+ {{? it.opts.useDefaults }}
+ {{? $rulesGroup.type == 'object' && it.schema.properties }}
+ {{# def.defaultProperties }}
+ {{?? $rulesGroup.type == 'array' && Array.isArray(it.schema.items) }}
+ {{# def.defaultItems }}
+ {{?}}
+ {{?}}
+ {{~ $rulesGroup.rules:$rule }}
+ {{? $shouldUseRule($rule) }}
+ {{ var $code = $rule.code(it, $rule.keyword, $rulesGroup.type); }}
+ {{? $code }}
+ {{= $code }}
+ {{? $breakOnError }}
+ {{ $closingBraces1 += '}'; }}
+ {{?}}
+ {{?}}
+ {{?}}
+ {{~}}
+ {{? $breakOnError }}
+ {{= $closingBraces1 }}
+ {{ $closingBraces1 = ''; }}
+ {{?}}
+ {{? $rulesGroup.type }}
+ }
+ {{? $typeSchema && $typeSchema === $rulesGroup.type && !$coerceToTypes }}
+ else {
+ {{
+ var $schemaPath = it.schemaPath + '.type'
+ , $errSchemaPath = it.errSchemaPath + '/type';
+ }}
+ {{# def.error:'type' }}
+ }
+ {{?}}
+ {{?}}
+
+ {{? $breakOnError }}
+ if (errors === {{?$top}}0{{??}}errs_{{=$lvl}}{{?}}) {
+ {{ $closingBraces2 += '}'; }}
+ {{?}}
+ {{?}}
+ {{~}}
+{{?}}
+
+{{? $breakOnError }} {{= $closingBraces2 }} {{?}}
+
+{{? $top }}
+ {{? $async }}
+ if (errors === 0) return data; {{ /* don't edit, used in replace */ }}
+ else throw new ValidationError(vErrors); {{ /* don't edit, used in replace */ }}
+ {{??}}
+ validate.errors = vErrors; {{ /* don't edit, used in replace */ }}
+ return errors === 0; {{ /* don't edit, used in replace */ }}
+ {{?}}
+ };
+
+ return validate;
+{{??}}
+ var {{=$valid}} = errors === errs_{{=$lvl}};
+{{?}}
+
+{{
+ function $shouldUseGroup($rulesGroup) {
+ var rules = $rulesGroup.rules;
+ for (var i=0; i < rules.length; i++)
+ if ($shouldUseRule(rules[i]))
+ return true;
+ }
+
+ function $shouldUseRule($rule) {
+ return it.schema[$rule.keyword] !== undefined ||
+ ($rule.implements && $ruleImplementsSomeKeyword($rule));
+ }
+
+ function $ruleImplementsSomeKeyword($rule) {
+ var impl = $rule.implements;
+ for (var i=0; i < impl.length; i++)
+ if (it.schema[impl[i]] !== undefined)
+ return true;
+ }
+}}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/README.md b/website_quotation_template/node_modules/ajv/lib/dotjs/README.md
new file mode 100644
index 000000000..4d994846c
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/README.md
@@ -0,0 +1,3 @@
+These files are compiled dot templates from dot folder.
+
+Do NOT edit them directly, edit the templates and run `npm run build` from main ajv folder.
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/_limit.js b/website_quotation_template/node_modules/ajv/lib/dotjs/_limit.js
new file mode 100644
index 000000000..05a1979dc
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/_limit.js
@@ -0,0 +1,163 @@
+'use strict';
+module.exports = function generate__limit(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $errorKeyword;
+ var $data = 'data' + ($dataLvl || '');
+ var $isData = it.opts.$data && $schema && $schema.$data,
+ $schemaValue;
+ if ($isData) {
+ out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; ';
+ $schemaValue = 'schema' + $lvl;
+ } else {
+ $schemaValue = $schema;
+ }
+ var $isMax = $keyword == 'maximum',
+ $exclusiveKeyword = $isMax ? 'exclusiveMaximum' : 'exclusiveMinimum',
+ $schemaExcl = it.schema[$exclusiveKeyword],
+ $isDataExcl = it.opts.$data && $schemaExcl && $schemaExcl.$data,
+ $op = $isMax ? '<' : '>',
+ $notOp = $isMax ? '>' : '<',
+ $errorKeyword = undefined;
+ if (!($isData || typeof $schema == 'number' || $schema === undefined)) {
+ throw new Error($keyword + ' must be number');
+ }
+ if (!($isDataExcl || $schemaExcl === undefined || typeof $schemaExcl == 'number' || typeof $schemaExcl == 'boolean')) {
+ throw new Error($exclusiveKeyword + ' must be number or boolean');
+ }
+ if ($isDataExcl) {
+ var $schemaValueExcl = it.util.getData($schemaExcl.$data, $dataLvl, it.dataPathArr),
+ $exclusive = 'exclusive' + $lvl,
+ $exclType = 'exclType' + $lvl,
+ $exclIsNumber = 'exclIsNumber' + $lvl,
+ $opExpr = 'op' + $lvl,
+ $opStr = '\' + ' + $opExpr + ' + \'';
+ out += ' var schemaExcl' + ($lvl) + ' = ' + ($schemaValueExcl) + '; ';
+ $schemaValueExcl = 'schemaExcl' + $lvl;
+ out += ' var ' + ($exclusive) + '; var ' + ($exclType) + ' = typeof ' + ($schemaValueExcl) + '; if (' + ($exclType) + ' != \'boolean\' && ' + ($exclType) + ' != \'undefined\' && ' + ($exclType) + ' != \'number\') { ';
+ var $errorKeyword = $exclusiveKeyword;
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ($errorKeyword || '_exclusiveLimit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'' + ($exclusiveKeyword) + ' should be boolean\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' } else if ( ';
+ if ($isData) {
+ out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || ';
+ }
+ out += ' ' + ($exclType) + ' == \'number\' ? ( (' + ($exclusive) + ' = ' + ($schemaValue) + ' === undefined || ' + ($schemaValueExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ') ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValueExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) : ( (' + ($exclusive) + ' = ' + ($schemaValueExcl) + ' === true) ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaValue) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { var op' + ($lvl) + ' = ' + ($exclusive) + ' ? \'' + ($op) + '\' : \'' + ($op) + '=\'; ';
+ if ($schema === undefined) {
+ $errorKeyword = $exclusiveKeyword;
+ $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword;
+ $schemaValue = $schemaValueExcl;
+ $isData = $isDataExcl;
+ }
+ } else {
+ var $exclIsNumber = typeof $schemaExcl == 'number',
+ $opStr = $op;
+ if ($exclIsNumber && $isData) {
+ var $opExpr = '\'' + $opStr + '\'';
+ out += ' if ( ';
+ if ($isData) {
+ out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || ';
+ }
+ out += ' ( ' + ($schemaValue) + ' === undefined || ' + ($schemaExcl) + ' ' + ($op) + '= ' + ($schemaValue) + ' ? ' + ($data) + ' ' + ($notOp) + '= ' + ($schemaExcl) + ' : ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' ) || ' + ($data) + ' !== ' + ($data) + ') { ';
+ } else {
+ if ($exclIsNumber && $schema === undefined) {
+ $exclusive = true;
+ $errorKeyword = $exclusiveKeyword;
+ $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword;
+ $schemaValue = $schemaExcl;
+ $notOp += '=';
+ } else {
+ if ($exclIsNumber) $schemaValue = Math[$isMax ? 'min' : 'max']($schemaExcl, $schema);
+ if ($schemaExcl === ($exclIsNumber ? $schemaValue : true)) {
+ $exclusive = true;
+ $errorKeyword = $exclusiveKeyword;
+ $errSchemaPath = it.errSchemaPath + '/' + $exclusiveKeyword;
+ $notOp += '=';
+ } else {
+ $exclusive = false;
+ $opStr += '=';
+ }
+ }
+ var $opExpr = '\'' + $opStr + '\'';
+ out += ' if ( ';
+ if ($isData) {
+ out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || ';
+ }
+ out += ' ' + ($data) + ' ' + ($notOp) + ' ' + ($schemaValue) + ' || ' + ($data) + ' !== ' + ($data) + ') { ';
+ }
+ }
+ $errorKeyword = $errorKeyword || $keyword;
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ($errorKeyword || '_limit') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { comparison: ' + ($opExpr) + ', limit: ' + ($schemaValue) + ', exclusive: ' + ($exclusive) + ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should be ' + ($opStr) + ' ';
+ if ($isData) {
+ out += '\' + ' + ($schemaValue);
+ } else {
+ out += '' + ($schemaValue) + '\'';
+ }
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: ';
+ if ($isData) {
+ out += 'validate.schema' + ($schemaPath);
+ } else {
+ out += '' + ($schema);
+ }
+ out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' } ';
+ if ($breakOnError) {
+ out += ' else { ';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/_limitItems.js b/website_quotation_template/node_modules/ajv/lib/dotjs/_limitItems.js
new file mode 100644
index 000000000..e092a559e
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/_limitItems.js
@@ -0,0 +1,80 @@
+'use strict';
+module.exports = function generate__limitItems(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $errorKeyword;
+ var $data = 'data' + ($dataLvl || '');
+ var $isData = it.opts.$data && $schema && $schema.$data,
+ $schemaValue;
+ if ($isData) {
+ out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; ';
+ $schemaValue = 'schema' + $lvl;
+ } else {
+ $schemaValue = $schema;
+ }
+ if (!($isData || typeof $schema == 'number')) {
+ throw new Error($keyword + ' must be number');
+ }
+ var $op = $keyword == 'maxItems' ? '>' : '<';
+ out += 'if ( ';
+ if ($isData) {
+ out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || ';
+ }
+ out += ' ' + ($data) + '.length ' + ($op) + ' ' + ($schemaValue) + ') { ';
+ var $errorKeyword = $keyword;
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ($errorKeyword || '_limitItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should NOT have ';
+ if ($keyword == 'maxItems') {
+ out += 'more';
+ } else {
+ out += 'fewer';
+ }
+ out += ' than ';
+ if ($isData) {
+ out += '\' + ' + ($schemaValue) + ' + \'';
+ } else {
+ out += '' + ($schema);
+ }
+ out += ' items\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: ';
+ if ($isData) {
+ out += 'validate.schema' + ($schemaPath);
+ } else {
+ out += '' + ($schema);
+ }
+ out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += '} ';
+ if ($breakOnError) {
+ out += ' else { ';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/_limitLength.js b/website_quotation_template/node_modules/ajv/lib/dotjs/_limitLength.js
new file mode 100644
index 000000000..ecbd3fe19
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/_limitLength.js
@@ -0,0 +1,85 @@
+'use strict';
+module.exports = function generate__limitLength(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $errorKeyword;
+ var $data = 'data' + ($dataLvl || '');
+ var $isData = it.opts.$data && $schema && $schema.$data,
+ $schemaValue;
+ if ($isData) {
+ out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; ';
+ $schemaValue = 'schema' + $lvl;
+ } else {
+ $schemaValue = $schema;
+ }
+ if (!($isData || typeof $schema == 'number')) {
+ throw new Error($keyword + ' must be number');
+ }
+ var $op = $keyword == 'maxLength' ? '>' : '<';
+ out += 'if ( ';
+ if ($isData) {
+ out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || ';
+ }
+ if (it.opts.unicode === false) {
+ out += ' ' + ($data) + '.length ';
+ } else {
+ out += ' ucs2length(' + ($data) + ') ';
+ }
+ out += ' ' + ($op) + ' ' + ($schemaValue) + ') { ';
+ var $errorKeyword = $keyword;
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ($errorKeyword || '_limitLength') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should NOT be ';
+ if ($keyword == 'maxLength') {
+ out += 'longer';
+ } else {
+ out += 'shorter';
+ }
+ out += ' than ';
+ if ($isData) {
+ out += '\' + ' + ($schemaValue) + ' + \'';
+ } else {
+ out += '' + ($schema);
+ }
+ out += ' characters\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: ';
+ if ($isData) {
+ out += 'validate.schema' + ($schemaPath);
+ } else {
+ out += '' + ($schema);
+ }
+ out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += '} ';
+ if ($breakOnError) {
+ out += ' else { ';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/_limitProperties.js b/website_quotation_template/node_modules/ajv/lib/dotjs/_limitProperties.js
new file mode 100644
index 000000000..d232755ad
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/_limitProperties.js
@@ -0,0 +1,80 @@
+'use strict';
+module.exports = function generate__limitProperties(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $errorKeyword;
+ var $data = 'data' + ($dataLvl || '');
+ var $isData = it.opts.$data && $schema && $schema.$data,
+ $schemaValue;
+ if ($isData) {
+ out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; ';
+ $schemaValue = 'schema' + $lvl;
+ } else {
+ $schemaValue = $schema;
+ }
+ if (!($isData || typeof $schema == 'number')) {
+ throw new Error($keyword + ' must be number');
+ }
+ var $op = $keyword == 'maxProperties' ? '>' : '<';
+ out += 'if ( ';
+ if ($isData) {
+ out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'number\') || ';
+ }
+ out += ' Object.keys(' + ($data) + ').length ' + ($op) + ' ' + ($schemaValue) + ') { ';
+ var $errorKeyword = $keyword;
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ($errorKeyword || '_limitProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schemaValue) + ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should NOT have ';
+ if ($keyword == 'maxProperties') {
+ out += 'more';
+ } else {
+ out += 'fewer';
+ }
+ out += ' than ';
+ if ($isData) {
+ out += '\' + ' + ($schemaValue) + ' + \'';
+ } else {
+ out += '' + ($schema);
+ }
+ out += ' properties\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: ';
+ if ($isData) {
+ out += 'validate.schema' + ($schemaPath);
+ } else {
+ out += '' + ($schema);
+ }
+ out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += '} ';
+ if ($breakOnError) {
+ out += ' else { ';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/allOf.js b/website_quotation_template/node_modules/ajv/lib/dotjs/allOf.js
new file mode 100644
index 000000000..fb8c2e4bb
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/allOf.js
@@ -0,0 +1,42 @@
+'use strict';
+module.exports = function generate_allOf(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $it = it.util.copy(it);
+ var $closingBraces = '';
+ $it.level++;
+ var $nextValid = 'valid' + $it.level;
+ var $currentBaseId = $it.baseId,
+ $allSchemasEmpty = true;
+ var arr1 = $schema;
+ if (arr1) {
+ var $sch, $i = -1,
+ l1 = arr1.length - 1;
+ while ($i < l1) {
+ $sch = arr1[$i += 1];
+ if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) {
+ $allSchemasEmpty = false;
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + '[' + $i + ']';
+ $it.errSchemaPath = $errSchemaPath + '/' + $i;
+ out += ' ' + (it.validate($it)) + ' ';
+ $it.baseId = $currentBaseId;
+ if ($breakOnError) {
+ out += ' if (' + ($nextValid) + ') { ';
+ $closingBraces += '}';
+ }
+ }
+ }
+ }
+ if ($breakOnError) {
+ if ($allSchemasEmpty) {
+ out += ' if (true) { ';
+ } else {
+ out += ' ' + ($closingBraces.slice(0, -1)) + ' ';
+ }
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/anyOf.js b/website_quotation_template/node_modules/ajv/lib/dotjs/anyOf.js
new file mode 100644
index 000000000..0600a9d42
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/anyOf.js
@@ -0,0 +1,73 @@
+'use strict';
+module.exports = function generate_anyOf(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $valid = 'valid' + $lvl;
+ var $errs = 'errs__' + $lvl;
+ var $it = it.util.copy(it);
+ var $closingBraces = '';
+ $it.level++;
+ var $nextValid = 'valid' + $it.level;
+ var $noEmptySchema = $schema.every(function($sch) {
+ return (it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all));
+ });
+ if ($noEmptySchema) {
+ var $currentBaseId = $it.baseId;
+ out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = false; ';
+ var $wasComposite = it.compositeRule;
+ it.compositeRule = $it.compositeRule = true;
+ var arr1 = $schema;
+ if (arr1) {
+ var $sch, $i = -1,
+ l1 = arr1.length - 1;
+ while ($i < l1) {
+ $sch = arr1[$i += 1];
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + '[' + $i + ']';
+ $it.errSchemaPath = $errSchemaPath + '/' + $i;
+ out += ' ' + (it.validate($it)) + ' ';
+ $it.baseId = $currentBaseId;
+ out += ' ' + ($valid) + ' = ' + ($valid) + ' || ' + ($nextValid) + '; if (!' + ($valid) + ') { ';
+ $closingBraces += '}';
+ }
+ }
+ it.compositeRule = $it.compositeRule = $wasComposite;
+ out += ' ' + ($closingBraces) + ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('anyOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should match some schema in anyOf\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError(vErrors); ';
+ } else {
+ out += ' validate.errors = vErrors; return false; ';
+ }
+ }
+ out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } ';
+ if (it.opts.allErrors) {
+ out += ' } ';
+ }
+ } else {
+ if ($breakOnError) {
+ out += ' if (true) { ';
+ }
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/comment.js b/website_quotation_template/node_modules/ajv/lib/dotjs/comment.js
new file mode 100644
index 000000000..dd66bb8f0
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/comment.js
@@ -0,0 +1,14 @@
+'use strict';
+module.exports = function generate_comment(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $schema = it.schema[$keyword];
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $comment = it.util.toQuotedString($schema);
+ if (it.opts.$comment === true) {
+ out += ' console.log(' + ($comment) + ');';
+ } else if (typeof it.opts.$comment == 'function') {
+ out += ' self._opts.$comment(' + ($comment) + ', ' + (it.util.toQuotedString($errSchemaPath)) + ', validate.root.schema);';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/const.js b/website_quotation_template/node_modules/ajv/lib/dotjs/const.js
new file mode 100644
index 000000000..15b7c619f
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/const.js
@@ -0,0 +1,56 @@
+'use strict';
+module.exports = function generate_const(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $valid = 'valid' + $lvl;
+ var $isData = it.opts.$data && $schema && $schema.$data,
+ $schemaValue;
+ if ($isData) {
+ out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; ';
+ $schemaValue = 'schema' + $lvl;
+ } else {
+ $schemaValue = $schema;
+ }
+ if (!$isData) {
+ out += ' var schema' + ($lvl) + ' = validate.schema' + ($schemaPath) + ';';
+ }
+ out += 'var ' + ($valid) + ' = equal(' + ($data) + ', schema' + ($lvl) + '); if (!' + ($valid) + ') { ';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('const') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValue: schema' + ($lvl) + ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should be equal to constant\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' }';
+ if ($breakOnError) {
+ out += ' else { ';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/contains.js b/website_quotation_template/node_modules/ajv/lib/dotjs/contains.js
new file mode 100644
index 000000000..7d7630090
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/contains.js
@@ -0,0 +1,81 @@
+'use strict';
+module.exports = function generate_contains(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $valid = 'valid' + $lvl;
+ var $errs = 'errs__' + $lvl;
+ var $it = it.util.copy(it);
+ var $closingBraces = '';
+ $it.level++;
+ var $nextValid = 'valid' + $it.level;
+ var $idx = 'i' + $lvl,
+ $dataNxt = $it.dataLevel = it.dataLevel + 1,
+ $nextData = 'data' + $dataNxt,
+ $currentBaseId = it.baseId,
+ $nonEmptySchema = (it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all));
+ out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';';
+ if ($nonEmptySchema) {
+ var $wasComposite = it.compositeRule;
+ it.compositeRule = $it.compositeRule = true;
+ $it.schema = $schema;
+ $it.schemaPath = $schemaPath;
+ $it.errSchemaPath = $errSchemaPath;
+ out += ' var ' + ($nextValid) + ' = false; for (var ' + ($idx) + ' = 0; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { ';
+ $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true);
+ var $passData = $data + '[' + $idx + ']';
+ $it.dataPathArr[$dataNxt] = $idx;
+ var $code = it.validate($it);
+ $it.baseId = $currentBaseId;
+ if (it.util.varOccurences($code, $nextData) < 2) {
+ out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' ';
+ } else {
+ out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' ';
+ }
+ out += ' if (' + ($nextValid) + ') break; } ';
+ it.compositeRule = $it.compositeRule = $wasComposite;
+ out += ' ' + ($closingBraces) + ' if (!' + ($nextValid) + ') {';
+ } else {
+ out += ' if (' + ($data) + '.length == 0) {';
+ }
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('contains') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should contain a valid item\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' } else { ';
+ if ($nonEmptySchema) {
+ out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } ';
+ }
+ if (it.opts.allErrors) {
+ out += ' } ';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/custom.js b/website_quotation_template/node_modules/ajv/lib/dotjs/custom.js
new file mode 100644
index 000000000..f3e641e70
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/custom.js
@@ -0,0 +1,228 @@
+'use strict';
+module.exports = function generate_custom(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $errorKeyword;
+ var $data = 'data' + ($dataLvl || '');
+ var $valid = 'valid' + $lvl;
+ var $errs = 'errs__' + $lvl;
+ var $isData = it.opts.$data && $schema && $schema.$data,
+ $schemaValue;
+ if ($isData) {
+ out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; ';
+ $schemaValue = 'schema' + $lvl;
+ } else {
+ $schemaValue = $schema;
+ }
+ var $rule = this,
+ $definition = 'definition' + $lvl,
+ $rDef = $rule.definition,
+ $closingBraces = '';
+ var $compile, $inline, $macro, $ruleValidate, $validateCode;
+ if ($isData && $rDef.$data) {
+ $validateCode = 'keywordValidate' + $lvl;
+ var $validateSchema = $rDef.validateSchema;
+ out += ' var ' + ($definition) + ' = RULES.custom[\'' + ($keyword) + '\'].definition; var ' + ($validateCode) + ' = ' + ($definition) + '.validate;';
+ } else {
+ $ruleValidate = it.useCustomRule($rule, $schema, it.schema, it);
+ if (!$ruleValidate) return;
+ $schemaValue = 'validate.schema' + $schemaPath;
+ $validateCode = $ruleValidate.code;
+ $compile = $rDef.compile;
+ $inline = $rDef.inline;
+ $macro = $rDef.macro;
+ }
+ var $ruleErrs = $validateCode + '.errors',
+ $i = 'i' + $lvl,
+ $ruleErr = 'ruleErr' + $lvl,
+ $asyncKeyword = $rDef.async;
+ if ($asyncKeyword && !it.async) throw new Error('async keyword in sync schema');
+ if (!($inline || $macro)) {
+ out += '' + ($ruleErrs) + ' = null;';
+ }
+ out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';';
+ if ($isData && $rDef.$data) {
+ $closingBraces += '}';
+ out += ' if (' + ($schemaValue) + ' === undefined) { ' + ($valid) + ' = true; } else { ';
+ if ($validateSchema) {
+ $closingBraces += '}';
+ out += ' ' + ($valid) + ' = ' + ($definition) + '.validateSchema(' + ($schemaValue) + '); if (' + ($valid) + ') { ';
+ }
+ }
+ if ($inline) {
+ if ($rDef.statements) {
+ out += ' ' + ($ruleValidate.validate) + ' ';
+ } else {
+ out += ' ' + ($valid) + ' = ' + ($ruleValidate.validate) + '; ';
+ }
+ } else if ($macro) {
+ var $it = it.util.copy(it);
+ var $closingBraces = '';
+ $it.level++;
+ var $nextValid = 'valid' + $it.level;
+ $it.schema = $ruleValidate.validate;
+ $it.schemaPath = '';
+ var $wasComposite = it.compositeRule;
+ it.compositeRule = $it.compositeRule = true;
+ var $code = it.validate($it).replace(/validate\.schema/g, $validateCode);
+ it.compositeRule = $it.compositeRule = $wasComposite;
+ out += ' ' + ($code);
+ } else {
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = '';
+ out += ' ' + ($validateCode) + '.call( ';
+ if (it.opts.passContext) {
+ out += 'this';
+ } else {
+ out += 'self';
+ }
+ if ($compile || $rDef.schema === false) {
+ out += ' , ' + ($data) + ' ';
+ } else {
+ out += ' , ' + ($schemaValue) + ' , ' + ($data) + ' , validate.schema' + (it.schemaPath) + ' ';
+ }
+ out += ' , (dataPath || \'\')';
+ if (it.errorPath != '""') {
+ out += ' + ' + (it.errorPath);
+ }
+ var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData',
+ $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty';
+ out += ' , ' + ($parentData) + ' , ' + ($parentDataProperty) + ' , rootData ) ';
+ var def_callRuleValidate = out;
+ out = $$outStack.pop();
+ if ($rDef.errors === false) {
+ out += ' ' + ($valid) + ' = ';
+ if ($asyncKeyword) {
+ out += 'await ';
+ }
+ out += '' + (def_callRuleValidate) + '; ';
+ } else {
+ if ($asyncKeyword) {
+ $ruleErrs = 'customErrors' + $lvl;
+ out += ' var ' + ($ruleErrs) + ' = null; try { ' + ($valid) + ' = await ' + (def_callRuleValidate) + '; } catch (e) { ' + ($valid) + ' = false; if (e instanceof ValidationError) ' + ($ruleErrs) + ' = e.errors; else throw e; } ';
+ } else {
+ out += ' ' + ($ruleErrs) + ' = null; ' + ($valid) + ' = ' + (def_callRuleValidate) + '; ';
+ }
+ }
+ }
+ if ($rDef.modifying) {
+ out += ' if (' + ($parentData) + ') ' + ($data) + ' = ' + ($parentData) + '[' + ($parentDataProperty) + '];';
+ }
+ out += '' + ($closingBraces);
+ if ($rDef.valid) {
+ if ($breakOnError) {
+ out += ' if (true) { ';
+ }
+ } else {
+ out += ' if ( ';
+ if ($rDef.valid === undefined) {
+ out += ' !';
+ if ($macro) {
+ out += '' + ($nextValid);
+ } else {
+ out += '' + ($valid);
+ }
+ } else {
+ out += ' ' + (!$rDef.valid) + ' ';
+ }
+ out += ') { ';
+ $errorKeyword = $rule.keyword;
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = '';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ($errorKeyword || 'custom') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { keyword: \'' + ($rule.keyword) + '\' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should pass "' + ($rule.keyword) + '" keyword validation\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ var def_customError = out;
+ out = $$outStack.pop();
+ if ($inline) {
+ if ($rDef.errors) {
+ if ($rDef.errors != 'full') {
+ out += ' for (var ' + ($i) + '=' + ($errs) + '; ' + ($i) + ' 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) {
+ out += ' ' + ($nextValid) + ' = true; if ( ' + ($data) + (it.util.getProperty($property)) + ' !== undefined ';
+ if ($ownProperties) {
+ out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($property)) + '\') ';
+ }
+ out += ') { ';
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + it.util.getProperty($property);
+ $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($property);
+ out += ' ' + (it.validate($it)) + ' ';
+ $it.baseId = $currentBaseId;
+ out += ' } ';
+ if ($breakOnError) {
+ out += ' if (' + ($nextValid) + ') { ';
+ $closingBraces += '}';
+ }
+ }
+ }
+ if ($breakOnError) {
+ out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/enum.js b/website_quotation_template/node_modules/ajv/lib/dotjs/enum.js
new file mode 100644
index 000000000..90580b9ff
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/enum.js
@@ -0,0 +1,66 @@
+'use strict';
+module.exports = function generate_enum(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $valid = 'valid' + $lvl;
+ var $isData = it.opts.$data && $schema && $schema.$data,
+ $schemaValue;
+ if ($isData) {
+ out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; ';
+ $schemaValue = 'schema' + $lvl;
+ } else {
+ $schemaValue = $schema;
+ }
+ var $i = 'i' + $lvl,
+ $vSchema = 'schema' + $lvl;
+ if (!$isData) {
+ out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + ';';
+ }
+ out += 'var ' + ($valid) + ';';
+ if ($isData) {
+ out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {';
+ }
+ out += '' + ($valid) + ' = false;for (var ' + ($i) + '=0; ' + ($i) + '<' + ($vSchema) + '.length; ' + ($i) + '++) if (equal(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + '])) { ' + ($valid) + ' = true; break; }';
+ if ($isData) {
+ out += ' } ';
+ }
+ out += ' if (!' + ($valid) + ') { ';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('enum') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { allowedValues: schema' + ($lvl) + ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should be equal to one of the allowed values\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' }';
+ if ($breakOnError) {
+ out += ' else { ';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/format.js b/website_quotation_template/node_modules/ajv/lib/dotjs/format.js
new file mode 100644
index 000000000..cd9a5693e
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/format.js
@@ -0,0 +1,150 @@
+'use strict';
+module.exports = function generate_format(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ if (it.opts.format === false) {
+ if ($breakOnError) {
+ out += ' if (true) { ';
+ }
+ return out;
+ }
+ var $isData = it.opts.$data && $schema && $schema.$data,
+ $schemaValue;
+ if ($isData) {
+ out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; ';
+ $schemaValue = 'schema' + $lvl;
+ } else {
+ $schemaValue = $schema;
+ }
+ var $unknownFormats = it.opts.unknownFormats,
+ $allowUnknown = Array.isArray($unknownFormats);
+ if ($isData) {
+ var $format = 'format' + $lvl,
+ $isObject = 'isObject' + $lvl,
+ $formatType = 'formatType' + $lvl;
+ out += ' var ' + ($format) + ' = formats[' + ($schemaValue) + ']; var ' + ($isObject) + ' = typeof ' + ($format) + ' == \'object\' && !(' + ($format) + ' instanceof RegExp) && ' + ($format) + '.validate; var ' + ($formatType) + ' = ' + ($isObject) + ' && ' + ($format) + '.type || \'string\'; if (' + ($isObject) + ') { ';
+ if (it.async) {
+ out += ' var async' + ($lvl) + ' = ' + ($format) + '.async; ';
+ }
+ out += ' ' + ($format) + ' = ' + ($format) + '.validate; } if ( ';
+ if ($isData) {
+ out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || ';
+ }
+ out += ' (';
+ if ($unknownFormats != 'ignore') {
+ out += ' (' + ($schemaValue) + ' && !' + ($format) + ' ';
+ if ($allowUnknown) {
+ out += ' && self._opts.unknownFormats.indexOf(' + ($schemaValue) + ') == -1 ';
+ }
+ out += ') || ';
+ }
+ out += ' (' + ($format) + ' && ' + ($formatType) + ' == \'' + ($ruleType) + '\' && !(typeof ' + ($format) + ' == \'function\' ? ';
+ if (it.async) {
+ out += ' (async' + ($lvl) + ' ? await ' + ($format) + '(' + ($data) + ') : ' + ($format) + '(' + ($data) + ')) ';
+ } else {
+ out += ' ' + ($format) + '(' + ($data) + ') ';
+ }
+ out += ' : ' + ($format) + '.test(' + ($data) + '))))) {';
+ } else {
+ var $format = it.formats[$schema];
+ if (!$format) {
+ if ($unknownFormats == 'ignore') {
+ it.logger.warn('unknown format "' + $schema + '" ignored in schema at path "' + it.errSchemaPath + '"');
+ if ($breakOnError) {
+ out += ' if (true) { ';
+ }
+ return out;
+ } else if ($allowUnknown && $unknownFormats.indexOf($schema) >= 0) {
+ if ($breakOnError) {
+ out += ' if (true) { ';
+ }
+ return out;
+ } else {
+ throw new Error('unknown format "' + $schema + '" is used in schema at path "' + it.errSchemaPath + '"');
+ }
+ }
+ var $isObject = typeof $format == 'object' && !($format instanceof RegExp) && $format.validate;
+ var $formatType = $isObject && $format.type || 'string';
+ if ($isObject) {
+ var $async = $format.async === true;
+ $format = $format.validate;
+ }
+ if ($formatType != $ruleType) {
+ if ($breakOnError) {
+ out += ' if (true) { ';
+ }
+ return out;
+ }
+ if ($async) {
+ if (!it.async) throw new Error('async format in sync schema');
+ var $formatRef = 'formats' + it.util.getProperty($schema) + '.validate';
+ out += ' if (!(await ' + ($formatRef) + '(' + ($data) + '))) { ';
+ } else {
+ out += ' if (! ';
+ var $formatRef = 'formats' + it.util.getProperty($schema);
+ if ($isObject) $formatRef += '.validate';
+ if (typeof $format == 'function') {
+ out += ' ' + ($formatRef) + '(' + ($data) + ') ';
+ } else {
+ out += ' ' + ($formatRef) + '.test(' + ($data) + ') ';
+ }
+ out += ') { ';
+ }
+ }
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('format') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { format: ';
+ if ($isData) {
+ out += '' + ($schemaValue);
+ } else {
+ out += '' + (it.util.toQuotedString($schema));
+ }
+ out += ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should match format "';
+ if ($isData) {
+ out += '\' + ' + ($schemaValue) + ' + \'';
+ } else {
+ out += '' + (it.util.escapeQuotes($schema));
+ }
+ out += '"\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: ';
+ if ($isData) {
+ out += 'validate.schema' + ($schemaPath);
+ } else {
+ out += '' + (it.util.toQuotedString($schema));
+ }
+ out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' } ';
+ if ($breakOnError) {
+ out += ' else { ';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/if.js b/website_quotation_template/node_modules/ajv/lib/dotjs/if.js
new file mode 100644
index 000000000..94d27ad85
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/if.js
@@ -0,0 +1,103 @@
+'use strict';
+module.exports = function generate_if(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $valid = 'valid' + $lvl;
+ var $errs = 'errs__' + $lvl;
+ var $it = it.util.copy(it);
+ $it.level++;
+ var $nextValid = 'valid' + $it.level;
+ var $thenSch = it.schema['then'],
+ $elseSch = it.schema['else'],
+ $thenPresent = $thenSch !== undefined && (it.opts.strictKeywords ? (typeof $thenSch == 'object' && Object.keys($thenSch).length > 0) || $thenSch === false : it.util.schemaHasRules($thenSch, it.RULES.all)),
+ $elsePresent = $elseSch !== undefined && (it.opts.strictKeywords ? (typeof $elseSch == 'object' && Object.keys($elseSch).length > 0) || $elseSch === false : it.util.schemaHasRules($elseSch, it.RULES.all)),
+ $currentBaseId = $it.baseId;
+ if ($thenPresent || $elsePresent) {
+ var $ifClause;
+ $it.createErrors = false;
+ $it.schema = $schema;
+ $it.schemaPath = $schemaPath;
+ $it.errSchemaPath = $errSchemaPath;
+ out += ' var ' + ($errs) + ' = errors; var ' + ($valid) + ' = true; ';
+ var $wasComposite = it.compositeRule;
+ it.compositeRule = $it.compositeRule = true;
+ out += ' ' + (it.validate($it)) + ' ';
+ $it.baseId = $currentBaseId;
+ $it.createErrors = true;
+ out += ' errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } ';
+ it.compositeRule = $it.compositeRule = $wasComposite;
+ if ($thenPresent) {
+ out += ' if (' + ($nextValid) + ') { ';
+ $it.schema = it.schema['then'];
+ $it.schemaPath = it.schemaPath + '.then';
+ $it.errSchemaPath = it.errSchemaPath + '/then';
+ out += ' ' + (it.validate($it)) + ' ';
+ $it.baseId = $currentBaseId;
+ out += ' ' + ($valid) + ' = ' + ($nextValid) + '; ';
+ if ($thenPresent && $elsePresent) {
+ $ifClause = 'ifClause' + $lvl;
+ out += ' var ' + ($ifClause) + ' = \'then\'; ';
+ } else {
+ $ifClause = '\'then\'';
+ }
+ out += ' } ';
+ if ($elsePresent) {
+ out += ' else { ';
+ }
+ } else {
+ out += ' if (!' + ($nextValid) + ') { ';
+ }
+ if ($elsePresent) {
+ $it.schema = it.schema['else'];
+ $it.schemaPath = it.schemaPath + '.else';
+ $it.errSchemaPath = it.errSchemaPath + '/else';
+ out += ' ' + (it.validate($it)) + ' ';
+ $it.baseId = $currentBaseId;
+ out += ' ' + ($valid) + ' = ' + ($nextValid) + '; ';
+ if ($thenPresent && $elsePresent) {
+ $ifClause = 'ifClause' + $lvl;
+ out += ' var ' + ($ifClause) + ' = \'else\'; ';
+ } else {
+ $ifClause = '\'else\'';
+ }
+ out += ' } ';
+ }
+ out += ' if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('if') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { failingKeyword: ' + ($ifClause) + ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should match "\' + ' + ($ifClause) + ' + \'" schema\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError(vErrors); ';
+ } else {
+ out += ' validate.errors = vErrors; return false; ';
+ }
+ }
+ out += ' } ';
+ if ($breakOnError) {
+ out += ' else { ';
+ }
+ } else {
+ if ($breakOnError) {
+ out += ' if (true) { ';
+ }
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/index.js b/website_quotation_template/node_modules/ajv/lib/dotjs/index.js
new file mode 100644
index 000000000..2fb1b00ef
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/index.js
@@ -0,0 +1,33 @@
+'use strict';
+
+//all requires must be explicit because browserify won't work with dynamic requires
+module.exports = {
+ '$ref': require('./ref'),
+ allOf: require('./allOf'),
+ anyOf: require('./anyOf'),
+ '$comment': require('./comment'),
+ const: require('./const'),
+ contains: require('./contains'),
+ dependencies: require('./dependencies'),
+ 'enum': require('./enum'),
+ format: require('./format'),
+ 'if': require('./if'),
+ items: require('./items'),
+ maximum: require('./_limit'),
+ minimum: require('./_limit'),
+ maxItems: require('./_limitItems'),
+ minItems: require('./_limitItems'),
+ maxLength: require('./_limitLength'),
+ minLength: require('./_limitLength'),
+ maxProperties: require('./_limitProperties'),
+ minProperties: require('./_limitProperties'),
+ multipleOf: require('./multipleOf'),
+ not: require('./not'),
+ oneOf: require('./oneOf'),
+ pattern: require('./pattern'),
+ properties: require('./properties'),
+ propertyNames: require('./propertyNames'),
+ required: require('./required'),
+ uniqueItems: require('./uniqueItems'),
+ validate: require('./validate')
+};
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/items.js b/website_quotation_template/node_modules/ajv/lib/dotjs/items.js
new file mode 100644
index 000000000..bee5d67da
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/items.js
@@ -0,0 +1,140 @@
+'use strict';
+module.exports = function generate_items(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $valid = 'valid' + $lvl;
+ var $errs = 'errs__' + $lvl;
+ var $it = it.util.copy(it);
+ var $closingBraces = '';
+ $it.level++;
+ var $nextValid = 'valid' + $it.level;
+ var $idx = 'i' + $lvl,
+ $dataNxt = $it.dataLevel = it.dataLevel + 1,
+ $nextData = 'data' + $dataNxt,
+ $currentBaseId = it.baseId;
+ out += 'var ' + ($errs) + ' = errors;var ' + ($valid) + ';';
+ if (Array.isArray($schema)) {
+ var $additionalItems = it.schema.additionalItems;
+ if ($additionalItems === false) {
+ out += ' ' + ($valid) + ' = ' + ($data) + '.length <= ' + ($schema.length) + '; ';
+ var $currErrSchemaPath = $errSchemaPath;
+ $errSchemaPath = it.errSchemaPath + '/additionalItems';
+ out += ' if (!' + ($valid) + ') { ';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('additionalItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { limit: ' + ($schema.length) + ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should NOT have more than ' + ($schema.length) + ' items\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' } ';
+ $errSchemaPath = $currErrSchemaPath;
+ if ($breakOnError) {
+ $closingBraces += '}';
+ out += ' else { ';
+ }
+ }
+ var arr1 = $schema;
+ if (arr1) {
+ var $sch, $i = -1,
+ l1 = arr1.length - 1;
+ while ($i < l1) {
+ $sch = arr1[$i += 1];
+ if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) {
+ out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($i) + ') { ';
+ var $passData = $data + '[' + $i + ']';
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + '[' + $i + ']';
+ $it.errSchemaPath = $errSchemaPath + '/' + $i;
+ $it.errorPath = it.util.getPathExpr(it.errorPath, $i, it.opts.jsonPointers, true);
+ $it.dataPathArr[$dataNxt] = $i;
+ var $code = it.validate($it);
+ $it.baseId = $currentBaseId;
+ if (it.util.varOccurences($code, $nextData) < 2) {
+ out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' ';
+ } else {
+ out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' ';
+ }
+ out += ' } ';
+ if ($breakOnError) {
+ out += ' if (' + ($nextValid) + ') { ';
+ $closingBraces += '}';
+ }
+ }
+ }
+ }
+ if (typeof $additionalItems == 'object' && (it.opts.strictKeywords ? (typeof $additionalItems == 'object' && Object.keys($additionalItems).length > 0) || $additionalItems === false : it.util.schemaHasRules($additionalItems, it.RULES.all))) {
+ $it.schema = $additionalItems;
+ $it.schemaPath = it.schemaPath + '.additionalItems';
+ $it.errSchemaPath = it.errSchemaPath + '/additionalItems';
+ out += ' ' + ($nextValid) + ' = true; if (' + ($data) + '.length > ' + ($schema.length) + ') { for (var ' + ($idx) + ' = ' + ($schema.length) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { ';
+ $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true);
+ var $passData = $data + '[' + $idx + ']';
+ $it.dataPathArr[$dataNxt] = $idx;
+ var $code = it.validate($it);
+ $it.baseId = $currentBaseId;
+ if (it.util.varOccurences($code, $nextData) < 2) {
+ out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' ';
+ } else {
+ out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' ';
+ }
+ if ($breakOnError) {
+ out += ' if (!' + ($nextValid) + ') break; ';
+ }
+ out += ' } } ';
+ if ($breakOnError) {
+ out += ' if (' + ($nextValid) + ') { ';
+ $closingBraces += '}';
+ }
+ }
+ } else if ((it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all))) {
+ $it.schema = $schema;
+ $it.schemaPath = $schemaPath;
+ $it.errSchemaPath = $errSchemaPath;
+ out += ' for (var ' + ($idx) + ' = ' + (0) + '; ' + ($idx) + ' < ' + ($data) + '.length; ' + ($idx) + '++) { ';
+ $it.errorPath = it.util.getPathExpr(it.errorPath, $idx, it.opts.jsonPointers, true);
+ var $passData = $data + '[' + $idx + ']';
+ $it.dataPathArr[$dataNxt] = $idx;
+ var $code = it.validate($it);
+ $it.baseId = $currentBaseId;
+ if (it.util.varOccurences($code, $nextData) < 2) {
+ out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' ';
+ } else {
+ out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' ';
+ }
+ if ($breakOnError) {
+ out += ' if (!' + ($nextValid) + ') break; ';
+ }
+ out += ' }';
+ }
+ if ($breakOnError) {
+ out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/multipleOf.js b/website_quotation_template/node_modules/ajv/lib/dotjs/multipleOf.js
new file mode 100644
index 000000000..9d6401b8f
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/multipleOf.js
@@ -0,0 +1,80 @@
+'use strict';
+module.exports = function generate_multipleOf(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $isData = it.opts.$data && $schema && $schema.$data,
+ $schemaValue;
+ if ($isData) {
+ out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; ';
+ $schemaValue = 'schema' + $lvl;
+ } else {
+ $schemaValue = $schema;
+ }
+ if (!($isData || typeof $schema == 'number')) {
+ throw new Error($keyword + ' must be number');
+ }
+ out += 'var division' + ($lvl) + ';if (';
+ if ($isData) {
+ out += ' ' + ($schemaValue) + ' !== undefined && ( typeof ' + ($schemaValue) + ' != \'number\' || ';
+ }
+ out += ' (division' + ($lvl) + ' = ' + ($data) + ' / ' + ($schemaValue) + ', ';
+ if (it.opts.multipleOfPrecision) {
+ out += ' Math.abs(Math.round(division' + ($lvl) + ') - division' + ($lvl) + ') > 1e-' + (it.opts.multipleOfPrecision) + ' ';
+ } else {
+ out += ' division' + ($lvl) + ' !== parseInt(division' + ($lvl) + ') ';
+ }
+ out += ' ) ';
+ if ($isData) {
+ out += ' ) ';
+ }
+ out += ' ) { ';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('multipleOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { multipleOf: ' + ($schemaValue) + ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should be multiple of ';
+ if ($isData) {
+ out += '\' + ' + ($schemaValue);
+ } else {
+ out += '' + ($schemaValue) + '\'';
+ }
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: ';
+ if ($isData) {
+ out += 'validate.schema' + ($schemaPath);
+ } else {
+ out += '' + ($schema);
+ }
+ out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += '} ';
+ if ($breakOnError) {
+ out += ' else { ';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/not.js b/website_quotation_template/node_modules/ajv/lib/dotjs/not.js
new file mode 100644
index 000000000..f50c93785
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/not.js
@@ -0,0 +1,84 @@
+'use strict';
+module.exports = function generate_not(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $errs = 'errs__' + $lvl;
+ var $it = it.util.copy(it);
+ $it.level++;
+ var $nextValid = 'valid' + $it.level;
+ if ((it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all))) {
+ $it.schema = $schema;
+ $it.schemaPath = $schemaPath;
+ $it.errSchemaPath = $errSchemaPath;
+ out += ' var ' + ($errs) + ' = errors; ';
+ var $wasComposite = it.compositeRule;
+ it.compositeRule = $it.compositeRule = true;
+ $it.createErrors = false;
+ var $allErrorsOption;
+ if ($it.opts.allErrors) {
+ $allErrorsOption = $it.opts.allErrors;
+ $it.opts.allErrors = false;
+ }
+ out += ' ' + (it.validate($it)) + ' ';
+ $it.createErrors = true;
+ if ($allErrorsOption) $it.opts.allErrors = $allErrorsOption;
+ it.compositeRule = $it.compositeRule = $wasComposite;
+ out += ' if (' + ($nextValid) + ') { ';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should NOT be valid\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' } else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; } ';
+ if (it.opts.allErrors) {
+ out += ' } ';
+ }
+ } else {
+ out += ' var err = '; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('not') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should NOT be valid\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ if ($breakOnError) {
+ out += ' if (false) { ';
+ }
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/oneOf.js b/website_quotation_template/node_modules/ajv/lib/dotjs/oneOf.js
new file mode 100644
index 000000000..dfe2fd550
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/oneOf.js
@@ -0,0 +1,73 @@
+'use strict';
+module.exports = function generate_oneOf(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $valid = 'valid' + $lvl;
+ var $errs = 'errs__' + $lvl;
+ var $it = it.util.copy(it);
+ var $closingBraces = '';
+ $it.level++;
+ var $nextValid = 'valid' + $it.level;
+ var $currentBaseId = $it.baseId,
+ $prevValid = 'prevValid' + $lvl,
+ $passingSchemas = 'passingSchemas' + $lvl;
+ out += 'var ' + ($errs) + ' = errors , ' + ($prevValid) + ' = false , ' + ($valid) + ' = false , ' + ($passingSchemas) + ' = null; ';
+ var $wasComposite = it.compositeRule;
+ it.compositeRule = $it.compositeRule = true;
+ var arr1 = $schema;
+ if (arr1) {
+ var $sch, $i = -1,
+ l1 = arr1.length - 1;
+ while ($i < l1) {
+ $sch = arr1[$i += 1];
+ if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) {
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + '[' + $i + ']';
+ $it.errSchemaPath = $errSchemaPath + '/' + $i;
+ out += ' ' + (it.validate($it)) + ' ';
+ $it.baseId = $currentBaseId;
+ } else {
+ out += ' var ' + ($nextValid) + ' = true; ';
+ }
+ if ($i) {
+ out += ' if (' + ($nextValid) + ' && ' + ($prevValid) + ') { ' + ($valid) + ' = false; ' + ($passingSchemas) + ' = [' + ($passingSchemas) + ', ' + ($i) + ']; } else { ';
+ $closingBraces += '}';
+ }
+ out += ' if (' + ($nextValid) + ') { ' + ($valid) + ' = ' + ($prevValid) + ' = true; ' + ($passingSchemas) + ' = ' + ($i) + '; }';
+ }
+ }
+ it.compositeRule = $it.compositeRule = $wasComposite;
+ out += '' + ($closingBraces) + 'if (!' + ($valid) + ') { var err = '; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('oneOf') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { passingSchemas: ' + ($passingSchemas) + ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should match exactly one schema in oneOf\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError(vErrors); ';
+ } else {
+ out += ' validate.errors = vErrors; return false; ';
+ }
+ }
+ out += '} else { errors = ' + ($errs) + '; if (vErrors !== null) { if (' + ($errs) + ') vErrors.length = ' + ($errs) + '; else vErrors = null; }';
+ if (it.opts.allErrors) {
+ out += ' } ';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/pattern.js b/website_quotation_template/node_modules/ajv/lib/dotjs/pattern.js
new file mode 100644
index 000000000..1d74d6b04
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/pattern.js
@@ -0,0 +1,75 @@
+'use strict';
+module.exports = function generate_pattern(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $isData = it.opts.$data && $schema && $schema.$data,
+ $schemaValue;
+ if ($isData) {
+ out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; ';
+ $schemaValue = 'schema' + $lvl;
+ } else {
+ $schemaValue = $schema;
+ }
+ var $regexp = $isData ? '(new RegExp(' + $schemaValue + '))' : it.usePattern($schema);
+ out += 'if ( ';
+ if ($isData) {
+ out += ' (' + ($schemaValue) + ' !== undefined && typeof ' + ($schemaValue) + ' != \'string\') || ';
+ }
+ out += ' !' + ($regexp) + '.test(' + ($data) + ') ) { ';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('pattern') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { pattern: ';
+ if ($isData) {
+ out += '' + ($schemaValue);
+ } else {
+ out += '' + (it.util.toQuotedString($schema));
+ }
+ out += ' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should match pattern "';
+ if ($isData) {
+ out += '\' + ' + ($schemaValue) + ' + \'';
+ } else {
+ out += '' + (it.util.escapeQuotes($schema));
+ }
+ out += '"\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: ';
+ if ($isData) {
+ out += 'validate.schema' + ($schemaPath);
+ } else {
+ out += '' + (it.util.toQuotedString($schema));
+ }
+ out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += '} ';
+ if ($breakOnError) {
+ out += ' else { ';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/properties.js b/website_quotation_template/node_modules/ajv/lib/dotjs/properties.js
new file mode 100644
index 000000000..bc5ee5547
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/properties.js
@@ -0,0 +1,335 @@
+'use strict';
+module.exports = function generate_properties(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $errs = 'errs__' + $lvl;
+ var $it = it.util.copy(it);
+ var $closingBraces = '';
+ $it.level++;
+ var $nextValid = 'valid' + $it.level;
+ var $key = 'key' + $lvl,
+ $idx = 'idx' + $lvl,
+ $dataNxt = $it.dataLevel = it.dataLevel + 1,
+ $nextData = 'data' + $dataNxt,
+ $dataProperties = 'dataProperties' + $lvl;
+ var $schemaKeys = Object.keys($schema || {}).filter(notProto),
+ $pProperties = it.schema.patternProperties || {},
+ $pPropertyKeys = Object.keys($pProperties).filter(notProto),
+ $aProperties = it.schema.additionalProperties,
+ $someProperties = $schemaKeys.length || $pPropertyKeys.length,
+ $noAdditional = $aProperties === false,
+ $additionalIsSchema = typeof $aProperties == 'object' && Object.keys($aProperties).length,
+ $removeAdditional = it.opts.removeAdditional,
+ $checkAdditional = $noAdditional || $additionalIsSchema || $removeAdditional,
+ $ownProperties = it.opts.ownProperties,
+ $currentBaseId = it.baseId;
+ var $required = it.schema.required;
+ if ($required && !(it.opts.$data && $required.$data) && $required.length < it.opts.loopRequired) {
+ var $requiredHash = it.util.toHash($required);
+ }
+
+ function notProto(p) {
+ return p !== '__proto__';
+ }
+ out += 'var ' + ($errs) + ' = errors;var ' + ($nextValid) + ' = true;';
+ if ($ownProperties) {
+ out += ' var ' + ($dataProperties) + ' = undefined;';
+ }
+ if ($checkAdditional) {
+ if ($ownProperties) {
+ out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; ';
+ } else {
+ out += ' for (var ' + ($key) + ' in ' + ($data) + ') { ';
+ }
+ if ($someProperties) {
+ out += ' var isAdditional' + ($lvl) + ' = !(false ';
+ if ($schemaKeys.length) {
+ if ($schemaKeys.length > 8) {
+ out += ' || validate.schema' + ($schemaPath) + '.hasOwnProperty(' + ($key) + ') ';
+ } else {
+ var arr1 = $schemaKeys;
+ if (arr1) {
+ var $propertyKey, i1 = -1,
+ l1 = arr1.length - 1;
+ while (i1 < l1) {
+ $propertyKey = arr1[i1 += 1];
+ out += ' || ' + ($key) + ' == ' + (it.util.toQuotedString($propertyKey)) + ' ';
+ }
+ }
+ }
+ }
+ if ($pPropertyKeys.length) {
+ var arr2 = $pPropertyKeys;
+ if (arr2) {
+ var $pProperty, $i = -1,
+ l2 = arr2.length - 1;
+ while ($i < l2) {
+ $pProperty = arr2[$i += 1];
+ out += ' || ' + (it.usePattern($pProperty)) + '.test(' + ($key) + ') ';
+ }
+ }
+ }
+ out += ' ); if (isAdditional' + ($lvl) + ') { ';
+ }
+ if ($removeAdditional == 'all') {
+ out += ' delete ' + ($data) + '[' + ($key) + ']; ';
+ } else {
+ var $currentErrorPath = it.errorPath;
+ var $additionalProperty = '\' + ' + $key + ' + \'';
+ if (it.opts._errorDataPathProperty) {
+ it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers);
+ }
+ if ($noAdditional) {
+ if ($removeAdditional) {
+ out += ' delete ' + ($data) + '[' + ($key) + ']; ';
+ } else {
+ out += ' ' + ($nextValid) + ' = false; ';
+ var $currErrSchemaPath = $errSchemaPath;
+ $errSchemaPath = it.errSchemaPath + '/additionalProperties';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('additionalProperties') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { additionalProperty: \'' + ($additionalProperty) + '\' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'';
+ if (it.opts._errorDataPathProperty) {
+ out += 'is an invalid additional property';
+ } else {
+ out += 'should NOT have additional properties';
+ }
+ out += '\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ $errSchemaPath = $currErrSchemaPath;
+ if ($breakOnError) {
+ out += ' break; ';
+ }
+ }
+ } else if ($additionalIsSchema) {
+ if ($removeAdditional == 'failing') {
+ out += ' var ' + ($errs) + ' = errors; ';
+ var $wasComposite = it.compositeRule;
+ it.compositeRule = $it.compositeRule = true;
+ $it.schema = $aProperties;
+ $it.schemaPath = it.schemaPath + '.additionalProperties';
+ $it.errSchemaPath = it.errSchemaPath + '/additionalProperties';
+ $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers);
+ var $passData = $data + '[' + $key + ']';
+ $it.dataPathArr[$dataNxt] = $key;
+ var $code = it.validate($it);
+ $it.baseId = $currentBaseId;
+ if (it.util.varOccurences($code, $nextData) < 2) {
+ out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' ';
+ } else {
+ out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' ';
+ }
+ out += ' if (!' + ($nextValid) + ') { errors = ' + ($errs) + '; if (validate.errors !== null) { if (errors) validate.errors.length = errors; else validate.errors = null; } delete ' + ($data) + '[' + ($key) + ']; } ';
+ it.compositeRule = $it.compositeRule = $wasComposite;
+ } else {
+ $it.schema = $aProperties;
+ $it.schemaPath = it.schemaPath + '.additionalProperties';
+ $it.errSchemaPath = it.errSchemaPath + '/additionalProperties';
+ $it.errorPath = it.opts._errorDataPathProperty ? it.errorPath : it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers);
+ var $passData = $data + '[' + $key + ']';
+ $it.dataPathArr[$dataNxt] = $key;
+ var $code = it.validate($it);
+ $it.baseId = $currentBaseId;
+ if (it.util.varOccurences($code, $nextData) < 2) {
+ out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' ';
+ } else {
+ out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' ';
+ }
+ if ($breakOnError) {
+ out += ' if (!' + ($nextValid) + ') break; ';
+ }
+ }
+ }
+ it.errorPath = $currentErrorPath;
+ }
+ if ($someProperties) {
+ out += ' } ';
+ }
+ out += ' } ';
+ if ($breakOnError) {
+ out += ' if (' + ($nextValid) + ') { ';
+ $closingBraces += '}';
+ }
+ }
+ var $useDefaults = it.opts.useDefaults && !it.compositeRule;
+ if ($schemaKeys.length) {
+ var arr3 = $schemaKeys;
+ if (arr3) {
+ var $propertyKey, i3 = -1,
+ l3 = arr3.length - 1;
+ while (i3 < l3) {
+ $propertyKey = arr3[i3 += 1];
+ var $sch = $schema[$propertyKey];
+ if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) {
+ var $prop = it.util.getProperty($propertyKey),
+ $passData = $data + $prop,
+ $hasDefault = $useDefaults && $sch.default !== undefined;
+ $it.schema = $sch;
+ $it.schemaPath = $schemaPath + $prop;
+ $it.errSchemaPath = $errSchemaPath + '/' + it.util.escapeFragment($propertyKey);
+ $it.errorPath = it.util.getPath(it.errorPath, $propertyKey, it.opts.jsonPointers);
+ $it.dataPathArr[$dataNxt] = it.util.toQuotedString($propertyKey);
+ var $code = it.validate($it);
+ $it.baseId = $currentBaseId;
+ if (it.util.varOccurences($code, $nextData) < 2) {
+ $code = it.util.varReplace($code, $nextData, $passData);
+ var $useData = $passData;
+ } else {
+ var $useData = $nextData;
+ out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ';
+ }
+ if ($hasDefault) {
+ out += ' ' + ($code) + ' ';
+ } else {
+ if ($requiredHash && $requiredHash[$propertyKey]) {
+ out += ' if ( ' + ($useData) + ' === undefined ';
+ if ($ownProperties) {
+ out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') ';
+ }
+ out += ') { ' + ($nextValid) + ' = false; ';
+ var $currentErrorPath = it.errorPath,
+ $currErrSchemaPath = $errSchemaPath,
+ $missingProperty = it.util.escapeQuotes($propertyKey);
+ if (it.opts._errorDataPathProperty) {
+ it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers);
+ }
+ $errSchemaPath = it.errSchemaPath + '/required';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'';
+ if (it.opts._errorDataPathProperty) {
+ out += 'is a required property';
+ } else {
+ out += 'should have required property \\\'' + ($missingProperty) + '\\\'';
+ }
+ out += '\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ $errSchemaPath = $currErrSchemaPath;
+ it.errorPath = $currentErrorPath;
+ out += ' } else { ';
+ } else {
+ if ($breakOnError) {
+ out += ' if ( ' + ($useData) + ' === undefined ';
+ if ($ownProperties) {
+ out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') ';
+ }
+ out += ') { ' + ($nextValid) + ' = true; } else { ';
+ } else {
+ out += ' if (' + ($useData) + ' !== undefined ';
+ if ($ownProperties) {
+ out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') ';
+ }
+ out += ' ) { ';
+ }
+ }
+ out += ' ' + ($code) + ' } ';
+ }
+ }
+ if ($breakOnError) {
+ out += ' if (' + ($nextValid) + ') { ';
+ $closingBraces += '}';
+ }
+ }
+ }
+ }
+ if ($pPropertyKeys.length) {
+ var arr4 = $pPropertyKeys;
+ if (arr4) {
+ var $pProperty, i4 = -1,
+ l4 = arr4.length - 1;
+ while (i4 < l4) {
+ $pProperty = arr4[i4 += 1];
+ var $sch = $pProperties[$pProperty];
+ if ((it.opts.strictKeywords ? (typeof $sch == 'object' && Object.keys($sch).length > 0) || $sch === false : it.util.schemaHasRules($sch, it.RULES.all))) {
+ $it.schema = $sch;
+ $it.schemaPath = it.schemaPath + '.patternProperties' + it.util.getProperty($pProperty);
+ $it.errSchemaPath = it.errSchemaPath + '/patternProperties/' + it.util.escapeFragment($pProperty);
+ if ($ownProperties) {
+ out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; ';
+ } else {
+ out += ' for (var ' + ($key) + ' in ' + ($data) + ') { ';
+ }
+ out += ' if (' + (it.usePattern($pProperty)) + '.test(' + ($key) + ')) { ';
+ $it.errorPath = it.util.getPathExpr(it.errorPath, $key, it.opts.jsonPointers);
+ var $passData = $data + '[' + $key + ']';
+ $it.dataPathArr[$dataNxt] = $key;
+ var $code = it.validate($it);
+ $it.baseId = $currentBaseId;
+ if (it.util.varOccurences($code, $nextData) < 2) {
+ out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' ';
+ } else {
+ out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' ';
+ }
+ if ($breakOnError) {
+ out += ' if (!' + ($nextValid) + ') break; ';
+ }
+ out += ' } ';
+ if ($breakOnError) {
+ out += ' else ' + ($nextValid) + ' = true; ';
+ }
+ out += ' } ';
+ if ($breakOnError) {
+ out += ' if (' + ($nextValid) + ') { ';
+ $closingBraces += '}';
+ }
+ }
+ }
+ }
+ }
+ if ($breakOnError) {
+ out += ' ' + ($closingBraces) + ' if (' + ($errs) + ' == errors) {';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/propertyNames.js b/website_quotation_template/node_modules/ajv/lib/dotjs/propertyNames.js
new file mode 100644
index 000000000..2a54a08f4
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/propertyNames.js
@@ -0,0 +1,81 @@
+'use strict';
+module.exports = function generate_propertyNames(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $errs = 'errs__' + $lvl;
+ var $it = it.util.copy(it);
+ var $closingBraces = '';
+ $it.level++;
+ var $nextValid = 'valid' + $it.level;
+ out += 'var ' + ($errs) + ' = errors;';
+ if ((it.opts.strictKeywords ? (typeof $schema == 'object' && Object.keys($schema).length > 0) || $schema === false : it.util.schemaHasRules($schema, it.RULES.all))) {
+ $it.schema = $schema;
+ $it.schemaPath = $schemaPath;
+ $it.errSchemaPath = $errSchemaPath;
+ var $key = 'key' + $lvl,
+ $idx = 'idx' + $lvl,
+ $i = 'i' + $lvl,
+ $invalidName = '\' + ' + $key + ' + \'',
+ $dataNxt = $it.dataLevel = it.dataLevel + 1,
+ $nextData = 'data' + $dataNxt,
+ $dataProperties = 'dataProperties' + $lvl,
+ $ownProperties = it.opts.ownProperties,
+ $currentBaseId = it.baseId;
+ if ($ownProperties) {
+ out += ' var ' + ($dataProperties) + ' = undefined; ';
+ }
+ if ($ownProperties) {
+ out += ' ' + ($dataProperties) + ' = ' + ($dataProperties) + ' || Object.keys(' + ($data) + '); for (var ' + ($idx) + '=0; ' + ($idx) + '<' + ($dataProperties) + '.length; ' + ($idx) + '++) { var ' + ($key) + ' = ' + ($dataProperties) + '[' + ($idx) + ']; ';
+ } else {
+ out += ' for (var ' + ($key) + ' in ' + ($data) + ') { ';
+ }
+ out += ' var startErrs' + ($lvl) + ' = errors; ';
+ var $passData = $key;
+ var $wasComposite = it.compositeRule;
+ it.compositeRule = $it.compositeRule = true;
+ var $code = it.validate($it);
+ $it.baseId = $currentBaseId;
+ if (it.util.varOccurences($code, $nextData) < 2) {
+ out += ' ' + (it.util.varReplace($code, $nextData, $passData)) + ' ';
+ } else {
+ out += ' var ' + ($nextData) + ' = ' + ($passData) + '; ' + ($code) + ' ';
+ }
+ it.compositeRule = $it.compositeRule = $wasComposite;
+ out += ' if (!' + ($nextValid) + ') { for (var ' + ($i) + '=startErrs' + ($lvl) + '; ' + ($i) + ' 0) || $propertySch === false : it.util.schemaHasRules($propertySch, it.RULES.all)))) {
+ $required[$required.length] = $property;
+ }
+ }
+ }
+ } else {
+ var $required = $schema;
+ }
+ }
+ if ($isData || $required.length) {
+ var $currentErrorPath = it.errorPath,
+ $loopRequired = $isData || $required.length >= it.opts.loopRequired,
+ $ownProperties = it.opts.ownProperties;
+ if ($breakOnError) {
+ out += ' var missing' + ($lvl) + '; ';
+ if ($loopRequired) {
+ if (!$isData) {
+ out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; ';
+ }
+ var $i = 'i' + $lvl,
+ $propertyPath = 'schema' + $lvl + '[' + $i + ']',
+ $missingProperty = '\' + ' + $propertyPath + ' + \'';
+ if (it.opts._errorDataPathProperty) {
+ it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers);
+ }
+ out += ' var ' + ($valid) + ' = true; ';
+ if ($isData) {
+ out += ' if (schema' + ($lvl) + ' === undefined) ' + ($valid) + ' = true; else if (!Array.isArray(schema' + ($lvl) + ')) ' + ($valid) + ' = false; else {';
+ }
+ out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { ' + ($valid) + ' = ' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] !== undefined ';
+ if ($ownProperties) {
+ out += ' && Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) ';
+ }
+ out += '; if (!' + ($valid) + ') break; } ';
+ if ($isData) {
+ out += ' } ';
+ }
+ out += ' if (!' + ($valid) + ') { ';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'';
+ if (it.opts._errorDataPathProperty) {
+ out += 'is a required property';
+ } else {
+ out += 'should have required property \\\'' + ($missingProperty) + '\\\'';
+ }
+ out += '\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' } else { ';
+ } else {
+ out += ' if ( ';
+ var arr2 = $required;
+ if (arr2) {
+ var $propertyKey, $i = -1,
+ l2 = arr2.length - 1;
+ while ($i < l2) {
+ $propertyKey = arr2[$i += 1];
+ if ($i) {
+ out += ' || ';
+ }
+ var $prop = it.util.getProperty($propertyKey),
+ $useData = $data + $prop;
+ out += ' ( ( ' + ($useData) + ' === undefined ';
+ if ($ownProperties) {
+ out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') ';
+ }
+ out += ') && (missing' + ($lvl) + ' = ' + (it.util.toQuotedString(it.opts.jsonPointers ? $propertyKey : $prop)) + ') ) ';
+ }
+ }
+ out += ') { ';
+ var $propertyPath = 'missing' + $lvl,
+ $missingProperty = '\' + ' + $propertyPath + ' + \'';
+ if (it.opts._errorDataPathProperty) {
+ it.errorPath = it.opts.jsonPointers ? it.util.getPathExpr($currentErrorPath, $propertyPath, true) : $currentErrorPath + ' + ' + $propertyPath;
+ }
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'';
+ if (it.opts._errorDataPathProperty) {
+ out += 'is a required property';
+ } else {
+ out += 'should have required property \\\'' + ($missingProperty) + '\\\'';
+ }
+ out += '\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' } else { ';
+ }
+ } else {
+ if ($loopRequired) {
+ if (!$isData) {
+ out += ' var ' + ($vSchema) + ' = validate.schema' + ($schemaPath) + '; ';
+ }
+ var $i = 'i' + $lvl,
+ $propertyPath = 'schema' + $lvl + '[' + $i + ']',
+ $missingProperty = '\' + ' + $propertyPath + ' + \'';
+ if (it.opts._errorDataPathProperty) {
+ it.errorPath = it.util.getPathExpr($currentErrorPath, $propertyPath, it.opts.jsonPointers);
+ }
+ if ($isData) {
+ out += ' if (' + ($vSchema) + ' && !Array.isArray(' + ($vSchema) + ')) { var err = '; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'';
+ if (it.opts._errorDataPathProperty) {
+ out += 'is a required property';
+ } else {
+ out += 'should have required property \\\'' + ($missingProperty) + '\\\'';
+ }
+ out += '\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } else if (' + ($vSchema) + ' !== undefined) { ';
+ }
+ out += ' for (var ' + ($i) + ' = 0; ' + ($i) + ' < ' + ($vSchema) + '.length; ' + ($i) + '++) { if (' + ($data) + '[' + ($vSchema) + '[' + ($i) + ']] === undefined ';
+ if ($ownProperties) {
+ out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', ' + ($vSchema) + '[' + ($i) + ']) ';
+ }
+ out += ') { var err = '; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'';
+ if (it.opts._errorDataPathProperty) {
+ out += 'is a required property';
+ } else {
+ out += 'should have required property \\\'' + ($missingProperty) + '\\\'';
+ }
+ out += '\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } } ';
+ if ($isData) {
+ out += ' } ';
+ }
+ } else {
+ var arr3 = $required;
+ if (arr3) {
+ var $propertyKey, i3 = -1,
+ l3 = arr3.length - 1;
+ while (i3 < l3) {
+ $propertyKey = arr3[i3 += 1];
+ var $prop = it.util.getProperty($propertyKey),
+ $missingProperty = it.util.escapeQuotes($propertyKey),
+ $useData = $data + $prop;
+ if (it.opts._errorDataPathProperty) {
+ it.errorPath = it.util.getPath($currentErrorPath, $propertyKey, it.opts.jsonPointers);
+ }
+ out += ' if ( ' + ($useData) + ' === undefined ';
+ if ($ownProperties) {
+ out += ' || ! Object.prototype.hasOwnProperty.call(' + ($data) + ', \'' + (it.util.escapeQuotes($propertyKey)) + '\') ';
+ }
+ out += ') { var err = '; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('required') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { missingProperty: \'' + ($missingProperty) + '\' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'';
+ if (it.opts._errorDataPathProperty) {
+ out += 'is a required property';
+ } else {
+ out += 'should have required property \\\'' + ($missingProperty) + '\\\'';
+ }
+ out += '\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ out += '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; } ';
+ }
+ }
+ }
+ }
+ it.errorPath = $currentErrorPath;
+ } else if ($breakOnError) {
+ out += ' if (true) {';
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/uniqueItems.js b/website_quotation_template/node_modules/ajv/lib/dotjs/uniqueItems.js
new file mode 100644
index 000000000..0736a0ed2
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/uniqueItems.js
@@ -0,0 +1,86 @@
+'use strict';
+module.exports = function generate_uniqueItems(it, $keyword, $ruleType) {
+ var out = ' ';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $data = 'data' + ($dataLvl || '');
+ var $valid = 'valid' + $lvl;
+ var $isData = it.opts.$data && $schema && $schema.$data,
+ $schemaValue;
+ if ($isData) {
+ out += ' var schema' + ($lvl) + ' = ' + (it.util.getData($schema.$data, $dataLvl, it.dataPathArr)) + '; ';
+ $schemaValue = 'schema' + $lvl;
+ } else {
+ $schemaValue = $schema;
+ }
+ if (($schema || $isData) && it.opts.uniqueItems !== false) {
+ if ($isData) {
+ out += ' var ' + ($valid) + '; if (' + ($schemaValue) + ' === false || ' + ($schemaValue) + ' === undefined) ' + ($valid) + ' = true; else if (typeof ' + ($schemaValue) + ' != \'boolean\') ' + ($valid) + ' = false; else { ';
+ }
+ out += ' var i = ' + ($data) + '.length , ' + ($valid) + ' = true , j; if (i > 1) { ';
+ var $itemType = it.schema.items && it.schema.items.type,
+ $typeIsArray = Array.isArray($itemType);
+ if (!$itemType || $itemType == 'object' || $itemType == 'array' || ($typeIsArray && ($itemType.indexOf('object') >= 0 || $itemType.indexOf('array') >= 0))) {
+ out += ' outer: for (;i--;) { for (j = i; j--;) { if (equal(' + ($data) + '[i], ' + ($data) + '[j])) { ' + ($valid) + ' = false; break outer; } } } ';
+ } else {
+ out += ' var itemIndices = {}, item; for (;i--;) { var item = ' + ($data) + '[i]; ';
+ var $method = 'checkDataType' + ($typeIsArray ? 's' : '');
+ out += ' if (' + (it.util[$method]($itemType, 'item', it.opts.strictNumbers, true)) + ') continue; ';
+ if ($typeIsArray) {
+ out += ' if (typeof item == \'string\') item = \'"\' + item; ';
+ }
+ out += ' if (typeof itemIndices[item] == \'number\') { ' + ($valid) + ' = false; j = itemIndices[item]; break; } itemIndices[item] = i; } ';
+ }
+ out += ' } ';
+ if ($isData) {
+ out += ' } ';
+ }
+ out += ' if (!' + ($valid) + ') { ';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ('uniqueItems') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { i: i, j: j } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should NOT have duplicate items (items ## \' + j + \' and \' + i + \' are identical)\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: ';
+ if ($isData) {
+ out += 'validate.schema' + ($schemaPath);
+ } else {
+ out += '' + ($schema);
+ }
+ out += ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' } ';
+ if ($breakOnError) {
+ out += ' else { ';
+ }
+ } else {
+ if ($breakOnError) {
+ out += ' if (true) { ';
+ }
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/dotjs/validate.js b/website_quotation_template/node_modules/ajv/lib/dotjs/validate.js
new file mode 100644
index 000000000..f295824b9
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/dotjs/validate.js
@@ -0,0 +1,482 @@
+'use strict';
+module.exports = function generate_validate(it, $keyword, $ruleType) {
+ var out = '';
+ var $async = it.schema.$async === true,
+ $refKeywords = it.util.schemaHasRulesExcept(it.schema, it.RULES.all, '$ref'),
+ $id = it.self._getId(it.schema);
+ if (it.opts.strictKeywords) {
+ var $unknownKwd = it.util.schemaUnknownRules(it.schema, it.RULES.keywords);
+ if ($unknownKwd) {
+ var $keywordsMsg = 'unknown keyword: ' + $unknownKwd;
+ if (it.opts.strictKeywords === 'log') it.logger.warn($keywordsMsg);
+ else throw new Error($keywordsMsg);
+ }
+ }
+ if (it.isTop) {
+ out += ' var validate = ';
+ if ($async) {
+ it.async = true;
+ out += 'async ';
+ }
+ out += 'function(data, dataPath, parentData, parentDataProperty, rootData) { \'use strict\'; ';
+ if ($id && (it.opts.sourceCode || it.opts.processCode)) {
+ out += ' ' + ('/\*# sourceURL=' + $id + ' */') + ' ';
+ }
+ }
+ if (typeof it.schema == 'boolean' || !($refKeywords || it.schema.$ref)) {
+ var $keyword = 'false schema';
+ var $lvl = it.level;
+ var $dataLvl = it.dataLevel;
+ var $schema = it.schema[$keyword];
+ var $schemaPath = it.schemaPath + it.util.getProperty($keyword);
+ var $errSchemaPath = it.errSchemaPath + '/' + $keyword;
+ var $breakOnError = !it.opts.allErrors;
+ var $errorKeyword;
+ var $data = 'data' + ($dataLvl || '');
+ var $valid = 'valid' + $lvl;
+ if (it.schema === false) {
+ if (it.isTop) {
+ $breakOnError = true;
+ } else {
+ out += ' var ' + ($valid) + ' = false; ';
+ }
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ($errorKeyword || 'false schema') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: {} ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'boolean schema is false\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: false , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ } else {
+ if (it.isTop) {
+ if ($async) {
+ out += ' return data; ';
+ } else {
+ out += ' validate.errors = null; return true; ';
+ }
+ } else {
+ out += ' var ' + ($valid) + ' = true; ';
+ }
+ }
+ if (it.isTop) {
+ out += ' }; return validate; ';
+ }
+ return out;
+ }
+ if (it.isTop) {
+ var $top = it.isTop,
+ $lvl = it.level = 0,
+ $dataLvl = it.dataLevel = 0,
+ $data = 'data';
+ it.rootId = it.resolve.fullPath(it.self._getId(it.root.schema));
+ it.baseId = it.baseId || it.rootId;
+ delete it.isTop;
+ it.dataPathArr = [""];
+ if (it.schema.default !== undefined && it.opts.useDefaults && it.opts.strictDefaults) {
+ var $defaultMsg = 'default is ignored in the schema root';
+ if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg);
+ else throw new Error($defaultMsg);
+ }
+ out += ' var vErrors = null; ';
+ out += ' var errors = 0; ';
+ out += ' if (rootData === undefined) rootData = data; ';
+ } else {
+ var $lvl = it.level,
+ $dataLvl = it.dataLevel,
+ $data = 'data' + ($dataLvl || '');
+ if ($id) it.baseId = it.resolve.url(it.baseId, $id);
+ if ($async && !it.async) throw new Error('async schema in sync schema');
+ out += ' var errs_' + ($lvl) + ' = errors;';
+ }
+ var $valid = 'valid' + $lvl,
+ $breakOnError = !it.opts.allErrors,
+ $closingBraces1 = '',
+ $closingBraces2 = '';
+ var $errorKeyword;
+ var $typeSchema = it.schema.type,
+ $typeIsArray = Array.isArray($typeSchema);
+ if ($typeSchema && it.opts.nullable && it.schema.nullable === true) {
+ if ($typeIsArray) {
+ if ($typeSchema.indexOf('null') == -1) $typeSchema = $typeSchema.concat('null');
+ } else if ($typeSchema != 'null') {
+ $typeSchema = [$typeSchema, 'null'];
+ $typeIsArray = true;
+ }
+ }
+ if ($typeIsArray && $typeSchema.length == 1) {
+ $typeSchema = $typeSchema[0];
+ $typeIsArray = false;
+ }
+ if (it.schema.$ref && $refKeywords) {
+ if (it.opts.extendRefs == 'fail') {
+ throw new Error('$ref: validation keywords used in schema at path "' + it.errSchemaPath + '" (see option extendRefs)');
+ } else if (it.opts.extendRefs !== true) {
+ $refKeywords = false;
+ it.logger.warn('$ref: keywords ignored in schema at path "' + it.errSchemaPath + '"');
+ }
+ }
+ if (it.schema.$comment && it.opts.$comment) {
+ out += ' ' + (it.RULES.all.$comment.code(it, '$comment'));
+ }
+ if ($typeSchema) {
+ if (it.opts.coerceTypes) {
+ var $coerceToTypes = it.util.coerceToTypes(it.opts.coerceTypes, $typeSchema);
+ }
+ var $rulesGroup = it.RULES.types[$typeSchema];
+ if ($coerceToTypes || $typeIsArray || $rulesGroup === true || ($rulesGroup && !$shouldUseGroup($rulesGroup))) {
+ var $schemaPath = it.schemaPath + '.type',
+ $errSchemaPath = it.errSchemaPath + '/type';
+ var $schemaPath = it.schemaPath + '.type',
+ $errSchemaPath = it.errSchemaPath + '/type',
+ $method = $typeIsArray ? 'checkDataTypes' : 'checkDataType';
+ out += ' if (' + (it.util[$method]($typeSchema, $data, it.opts.strictNumbers, true)) + ') { ';
+ if ($coerceToTypes) {
+ var $dataType = 'dataType' + $lvl,
+ $coerced = 'coerced' + $lvl;
+ out += ' var ' + ($dataType) + ' = typeof ' + ($data) + '; var ' + ($coerced) + ' = undefined; ';
+ if (it.opts.coerceTypes == 'array') {
+ out += ' if (' + ($dataType) + ' == \'object\' && Array.isArray(' + ($data) + ') && ' + ($data) + '.length == 1) { ' + ($data) + ' = ' + ($data) + '[0]; ' + ($dataType) + ' = typeof ' + ($data) + '; if (' + (it.util.checkDataType(it.schema.type, $data, it.opts.strictNumbers)) + ') ' + ($coerced) + ' = ' + ($data) + '; } ';
+ }
+ out += ' if (' + ($coerced) + ' !== undefined) ; ';
+ var arr1 = $coerceToTypes;
+ if (arr1) {
+ var $type, $i = -1,
+ l1 = arr1.length - 1;
+ while ($i < l1) {
+ $type = arr1[$i += 1];
+ if ($type == 'string') {
+ out += ' else if (' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\') ' + ($coerced) + ' = \'\' + ' + ($data) + '; else if (' + ($data) + ' === null) ' + ($coerced) + ' = \'\'; ';
+ } else if ($type == 'number' || $type == 'integer') {
+ out += ' else if (' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' === null || (' + ($dataType) + ' == \'string\' && ' + ($data) + ' && ' + ($data) + ' == +' + ($data) + ' ';
+ if ($type == 'integer') {
+ out += ' && !(' + ($data) + ' % 1)';
+ }
+ out += ')) ' + ($coerced) + ' = +' + ($data) + '; ';
+ } else if ($type == 'boolean') {
+ out += ' else if (' + ($data) + ' === \'false\' || ' + ($data) + ' === 0 || ' + ($data) + ' === null) ' + ($coerced) + ' = false; else if (' + ($data) + ' === \'true\' || ' + ($data) + ' === 1) ' + ($coerced) + ' = true; ';
+ } else if ($type == 'null') {
+ out += ' else if (' + ($data) + ' === \'\' || ' + ($data) + ' === 0 || ' + ($data) + ' === false) ' + ($coerced) + ' = null; ';
+ } else if (it.opts.coerceTypes == 'array' && $type == 'array') {
+ out += ' else if (' + ($dataType) + ' == \'string\' || ' + ($dataType) + ' == \'number\' || ' + ($dataType) + ' == \'boolean\' || ' + ($data) + ' == null) ' + ($coerced) + ' = [' + ($data) + ']; ';
+ }
+ }
+ }
+ out += ' else { ';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \'';
+ if ($typeIsArray) {
+ out += '' + ($typeSchema.join(","));
+ } else {
+ out += '' + ($typeSchema);
+ }
+ out += '\' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should be ';
+ if ($typeIsArray) {
+ out += '' + ($typeSchema.join(","));
+ } else {
+ out += '' + ($typeSchema);
+ }
+ out += '\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' } if (' + ($coerced) + ' !== undefined) { ';
+ var $parentData = $dataLvl ? 'data' + (($dataLvl - 1) || '') : 'parentData',
+ $parentDataProperty = $dataLvl ? it.dataPathArr[$dataLvl] : 'parentDataProperty';
+ out += ' ' + ($data) + ' = ' + ($coerced) + '; ';
+ if (!$dataLvl) {
+ out += 'if (' + ($parentData) + ' !== undefined)';
+ }
+ out += ' ' + ($parentData) + '[' + ($parentDataProperty) + '] = ' + ($coerced) + '; } ';
+ } else {
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \'';
+ if ($typeIsArray) {
+ out += '' + ($typeSchema.join(","));
+ } else {
+ out += '' + ($typeSchema);
+ }
+ out += '\' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should be ';
+ if ($typeIsArray) {
+ out += '' + ($typeSchema.join(","));
+ } else {
+ out += '' + ($typeSchema);
+ }
+ out += '\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ }
+ out += ' } ';
+ }
+ }
+ if (it.schema.$ref && !$refKeywords) {
+ out += ' ' + (it.RULES.all.$ref.code(it, '$ref')) + ' ';
+ if ($breakOnError) {
+ out += ' } if (errors === ';
+ if ($top) {
+ out += '0';
+ } else {
+ out += 'errs_' + ($lvl);
+ }
+ out += ') { ';
+ $closingBraces2 += '}';
+ }
+ } else {
+ var arr2 = it.RULES;
+ if (arr2) {
+ var $rulesGroup, i2 = -1,
+ l2 = arr2.length - 1;
+ while (i2 < l2) {
+ $rulesGroup = arr2[i2 += 1];
+ if ($shouldUseGroup($rulesGroup)) {
+ if ($rulesGroup.type) {
+ out += ' if (' + (it.util.checkDataType($rulesGroup.type, $data, it.opts.strictNumbers)) + ') { ';
+ }
+ if (it.opts.useDefaults) {
+ if ($rulesGroup.type == 'object' && it.schema.properties) {
+ var $schema = it.schema.properties,
+ $schemaKeys = Object.keys($schema);
+ var arr3 = $schemaKeys;
+ if (arr3) {
+ var $propertyKey, i3 = -1,
+ l3 = arr3.length - 1;
+ while (i3 < l3) {
+ $propertyKey = arr3[i3 += 1];
+ var $sch = $schema[$propertyKey];
+ if ($sch.default !== undefined) {
+ var $passData = $data + it.util.getProperty($propertyKey);
+ if (it.compositeRule) {
+ if (it.opts.strictDefaults) {
+ var $defaultMsg = 'default is ignored for: ' + $passData;
+ if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg);
+ else throw new Error($defaultMsg);
+ }
+ } else {
+ out += ' if (' + ($passData) + ' === undefined ';
+ if (it.opts.useDefaults == 'empty') {
+ out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' ';
+ }
+ out += ' ) ' + ($passData) + ' = ';
+ if (it.opts.useDefaults == 'shared') {
+ out += ' ' + (it.useDefault($sch.default)) + ' ';
+ } else {
+ out += ' ' + (JSON.stringify($sch.default)) + ' ';
+ }
+ out += '; ';
+ }
+ }
+ }
+ }
+ } else if ($rulesGroup.type == 'array' && Array.isArray(it.schema.items)) {
+ var arr4 = it.schema.items;
+ if (arr4) {
+ var $sch, $i = -1,
+ l4 = arr4.length - 1;
+ while ($i < l4) {
+ $sch = arr4[$i += 1];
+ if ($sch.default !== undefined) {
+ var $passData = $data + '[' + $i + ']';
+ if (it.compositeRule) {
+ if (it.opts.strictDefaults) {
+ var $defaultMsg = 'default is ignored for: ' + $passData;
+ if (it.opts.strictDefaults === 'log') it.logger.warn($defaultMsg);
+ else throw new Error($defaultMsg);
+ }
+ } else {
+ out += ' if (' + ($passData) + ' === undefined ';
+ if (it.opts.useDefaults == 'empty') {
+ out += ' || ' + ($passData) + ' === null || ' + ($passData) + ' === \'\' ';
+ }
+ out += ' ) ' + ($passData) + ' = ';
+ if (it.opts.useDefaults == 'shared') {
+ out += ' ' + (it.useDefault($sch.default)) + ' ';
+ } else {
+ out += ' ' + (JSON.stringify($sch.default)) + ' ';
+ }
+ out += '; ';
+ }
+ }
+ }
+ }
+ }
+ }
+ var arr5 = $rulesGroup.rules;
+ if (arr5) {
+ var $rule, i5 = -1,
+ l5 = arr5.length - 1;
+ while (i5 < l5) {
+ $rule = arr5[i5 += 1];
+ if ($shouldUseRule($rule)) {
+ var $code = $rule.code(it, $rule.keyword, $rulesGroup.type);
+ if ($code) {
+ out += ' ' + ($code) + ' ';
+ if ($breakOnError) {
+ $closingBraces1 += '}';
+ }
+ }
+ }
+ }
+ }
+ if ($breakOnError) {
+ out += ' ' + ($closingBraces1) + ' ';
+ $closingBraces1 = '';
+ }
+ if ($rulesGroup.type) {
+ out += ' } ';
+ if ($typeSchema && $typeSchema === $rulesGroup.type && !$coerceToTypes) {
+ out += ' else { ';
+ var $schemaPath = it.schemaPath + '.type',
+ $errSchemaPath = it.errSchemaPath + '/type';
+ var $$outStack = $$outStack || [];
+ $$outStack.push(out);
+ out = ''; /* istanbul ignore else */
+ if (it.createErrors !== false) {
+ out += ' { keyword: \'' + ($errorKeyword || 'type') + '\' , dataPath: (dataPath || \'\') + ' + (it.errorPath) + ' , schemaPath: ' + (it.util.toQuotedString($errSchemaPath)) + ' , params: { type: \'';
+ if ($typeIsArray) {
+ out += '' + ($typeSchema.join(","));
+ } else {
+ out += '' + ($typeSchema);
+ }
+ out += '\' } ';
+ if (it.opts.messages !== false) {
+ out += ' , message: \'should be ';
+ if ($typeIsArray) {
+ out += '' + ($typeSchema.join(","));
+ } else {
+ out += '' + ($typeSchema);
+ }
+ out += '\' ';
+ }
+ if (it.opts.verbose) {
+ out += ' , schema: validate.schema' + ($schemaPath) + ' , parentSchema: validate.schema' + (it.schemaPath) + ' , data: ' + ($data) + ' ';
+ }
+ out += ' } ';
+ } else {
+ out += ' {} ';
+ }
+ var __err = out;
+ out = $$outStack.pop();
+ if (!it.compositeRule && $breakOnError) {
+ /* istanbul ignore if */
+ if (it.async) {
+ out += ' throw new ValidationError([' + (__err) + ']); ';
+ } else {
+ out += ' validate.errors = [' + (__err) + ']; return false; ';
+ }
+ } else {
+ out += ' var err = ' + (__err) + '; if (vErrors === null) vErrors = [err]; else vErrors.push(err); errors++; ';
+ }
+ out += ' } ';
+ }
+ }
+ if ($breakOnError) {
+ out += ' if (errors === ';
+ if ($top) {
+ out += '0';
+ } else {
+ out += 'errs_' + ($lvl);
+ }
+ out += ') { ';
+ $closingBraces2 += '}';
+ }
+ }
+ }
+ }
+ }
+ if ($breakOnError) {
+ out += ' ' + ($closingBraces2) + ' ';
+ }
+ if ($top) {
+ if ($async) {
+ out += ' if (errors === 0) return data; ';
+ out += ' else throw new ValidationError(vErrors); ';
+ } else {
+ out += ' validate.errors = vErrors; ';
+ out += ' return errors === 0; ';
+ }
+ out += ' }; return validate;';
+ } else {
+ out += ' var ' + ($valid) + ' = errors === errs_' + ($lvl) + ';';
+ }
+
+ function $shouldUseGroup($rulesGroup) {
+ var rules = $rulesGroup.rules;
+ for (var i = 0; i < rules.length; i++)
+ if ($shouldUseRule(rules[i])) return true;
+ }
+
+ function $shouldUseRule($rule) {
+ return it.schema[$rule.keyword] !== undefined || ($rule.implements && $ruleImplementsSomeKeyword($rule));
+ }
+
+ function $ruleImplementsSomeKeyword($rule) {
+ var impl = $rule.implements;
+ for (var i = 0; i < impl.length; i++)
+ if (it.schema[impl[i]] !== undefined) return true;
+ }
+ return out;
+}
diff --git a/website_quotation_template/node_modules/ajv/lib/keyword.js b/website_quotation_template/node_modules/ajv/lib/keyword.js
new file mode 100644
index 000000000..06da9a2df
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/keyword.js
@@ -0,0 +1,146 @@
+'use strict';
+
+var IDENTIFIER = /^[a-z_$][a-z0-9_$-]*$/i;
+var customRuleCode = require('./dotjs/custom');
+var definitionSchema = require('./definition_schema');
+
+module.exports = {
+ add: addKeyword,
+ get: getKeyword,
+ remove: removeKeyword,
+ validate: validateKeyword
+};
+
+
+/**
+ * Define custom keyword
+ * @this Ajv
+ * @param {String} keyword custom keyword, should be unique (including different from all standard, custom and macro keywords).
+ * @param {Object} definition keyword definition object with properties `type` (type(s) which the keyword applies to), `validate` or `compile`.
+ * @return {Ajv} this for method chaining
+ */
+function addKeyword(keyword, definition) {
+ /* jshint validthis: true */
+ /* eslint no-shadow: 0 */
+ var RULES = this.RULES;
+ if (RULES.keywords[keyword])
+ throw new Error('Keyword ' + keyword + ' is already defined');
+
+ if (!IDENTIFIER.test(keyword))
+ throw new Error('Keyword ' + keyword + ' is not a valid identifier');
+
+ if (definition) {
+ this.validateKeyword(definition, true);
+
+ var dataType = definition.type;
+ if (Array.isArray(dataType)) {
+ for (var i=0; i ../ajv-dist/bower.json
+ cd ../ajv-dist
+
+ if [[ `git status --porcelain` ]]; then
+ echo "Changes detected. Updating master branch..."
+ git add -A
+ git commit -m "updated by travis build #$TRAVIS_BUILD_NUMBER"
+ git push --quiet origin master > /dev/null 2>&1
+ fi
+
+ echo "Publishing tag..."
+
+ git tag $TRAVIS_TAG
+ git push --tags > /dev/null 2>&1
+
+ echo "Done"
+fi
diff --git a/website_quotation_template/node_modules/ajv/scripts/travis-gh-pages b/website_quotation_template/node_modules/ajv/scripts/travis-gh-pages
new file mode 100644
index 000000000..b3d4f3d0f
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/scripts/travis-gh-pages
@@ -0,0 +1,23 @@
+#!/usr/bin/env bash
+
+set -e
+
+if [[ "$TRAVIS_BRANCH" == "master" && "$TRAVIS_PULL_REQUEST" == "false" && $TRAVIS_JOB_NUMBER =~ ".3" ]]; then
+ git diff --name-only $TRAVIS_COMMIT_RANGE | grep -qE '\.md$|^LICENSE$|travis-gh-pages$' && {
+ rm -rf ../gh-pages
+ git clone -b gh-pages --single-branch https://${GITHUB_TOKEN}@github.com/ajv-validator/ajv.git ../gh-pages
+ mkdir -p ../gh-pages/_source
+ cp *.md ../gh-pages/_source
+ cp LICENSE ../gh-pages/_source
+ currentDir=$(pwd)
+ cd ../gh-pages
+ $currentDir/node_modules/.bin/gh-pages-generator
+ # remove logo from README
+ sed -i -E "s/]+ajv_logo[^>]+>//" index.md
+ git config user.email "$GIT_USER_EMAIL"
+ git config user.name "$GIT_USER_NAME"
+ git add .
+ git commit -am "updated by travis build #$TRAVIS_BUILD_NUMBER"
+ git push --quiet origin gh-pages > /dev/null 2>&1
+ }
+fi
diff --git a/website_quotation_template/node_modules/argparse/CHANGELOG.md b/website_quotation_template/node_modules/argparse/CHANGELOG.md
new file mode 100644
index 000000000..a43c628cc
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/CHANGELOG.md
@@ -0,0 +1,185 @@
+1.0.10 / 2018-02-15
+------------------
+
+- Use .concat instead of + for arrays, #122.
+
+
+1.0.9 / 2016-09-29
+------------------
+
+- Rerelease after 1.0.8 - deps cleanup.
+
+
+1.0.8 / 2016-09-29
+------------------
+
+- Maintenance (deps bump, fix node 6.5+ tests, coverage report).
+
+
+1.0.7 / 2016-03-17
+------------------
+
+- Teach `addArgument` to accept string arg names. #97, @tomxtobin.
+
+
+1.0.6 / 2016-02-06
+------------------
+
+- Maintenance: moved to eslint & updated CS.
+
+
+1.0.5 / 2016-02-05
+------------------
+
+- Removed lodash dependency to significantly reduce install size.
+ Thanks to @mourner.
+
+
+1.0.4 / 2016-01-17
+------------------
+
+- Maintenance: lodash update to 4.0.0.
+
+
+1.0.3 / 2015-10-27
+------------------
+
+- Fix parse `=` in args: `--examplepath="C:\myfolder\env=x64"`. #84, @CatWithApple.
+
+
+1.0.2 / 2015-03-22
+------------------
+
+- Relaxed lodash version dependency.
+
+
+1.0.1 / 2015-02-20
+------------------
+
+- Changed dependencies to be compatible with ancient nodejs.
+
+
+1.0.0 / 2015-02-19
+------------------
+
+- Maintenance release.
+- Replaced `underscore` with `lodash`.
+- Bumped version to 1.0.0 to better reflect semver meaning.
+- HISTORY.md -> CHANGELOG.md
+
+
+0.1.16 / 2013-12-01
+-------------------
+
+- Maintenance release. Updated dependencies and docs.
+
+
+0.1.15 / 2013-05-13
+-------------------
+
+- Fixed #55, @trebor89
+
+
+0.1.14 / 2013-05-12
+-------------------
+
+- Fixed #62, @maxtaco
+
+
+0.1.13 / 2013-04-08
+-------------------
+
+- Added `.npmignore` to reduce package size
+
+
+0.1.12 / 2013-02-10
+-------------------
+
+- Fixed conflictHandler (#46), @hpaulj
+
+
+0.1.11 / 2013-02-07
+-------------------
+
+- Multiple bugfixes, @hpaulj
+- Added 70+ tests (ported from python), @hpaulj
+- Added conflictHandler, @applepicke
+- Added fromfilePrefixChar, @hpaulj
+
+
+0.1.10 / 2012-12-30
+-------------------
+
+- Added [mutual exclusion](http://docs.python.org/dev/library/argparse.html#mutual-exclusion)
+ support, thanks to @hpaulj
+- Fixed options check for `storeConst` & `appendConst` actions, thanks to @hpaulj
+
+
+0.1.9 / 2012-12-27
+------------------
+
+- Fixed option dest interferens with other options (issue #23), thanks to @hpaulj
+- Fixed default value behavior with `*` positionals, thanks to @hpaulj
+- Improve `getDefault()` behavior, thanks to @hpaulj
+- Imrove negative argument parsing, thanks to @hpaulj
+
+
+0.1.8 / 2012-12-01
+------------------
+
+- Fixed parser parents (issue #19), thanks to @hpaulj
+- Fixed negative argument parse (issue #20), thanks to @hpaulj
+
+
+0.1.7 / 2012-10-14
+------------------
+
+- Fixed 'choices' argument parse (issue #16)
+- Fixed stderr output (issue #15)
+
+
+0.1.6 / 2012-09-09
+------------------
+
+- Fixed check for conflict of options (thanks to @tomxtobin)
+
+
+0.1.5 / 2012-09-03
+------------------
+
+- Fix parser #setDefaults method (thanks to @tomxtobin)
+
+
+0.1.4 / 2012-07-30
+------------------
+
+- Fixed pseudo-argument support (thanks to @CGamesPlay)
+- Fixed addHelp default (should be true), if not set (thanks to @benblank)
+
+
+0.1.3 / 2012-06-27
+------------------
+
+- Fixed formatter api name: Formatter -> HelpFormatter
+
+
+0.1.2 / 2012-05-29
+------------------
+
+- Added basic tests
+- Removed excess whitespace in help
+- Fixed error reporting, when parcer with subcommands
+ called with empty arguments
+
+
+0.1.1 / 2012-05-23
+------------------
+
+- Fixed line wrapping in help formatter
+- Added better error reporting on invalid arguments
+
+
+0.1.0 / 2012-05-16
+------------------
+
+- First release.
diff --git a/website_quotation_template/node_modules/argparse/LICENSE b/website_quotation_template/node_modules/argparse/LICENSE
new file mode 100644
index 000000000..1afdae558
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/LICENSE
@@ -0,0 +1,21 @@
+(The MIT License)
+
+Copyright (C) 2012 by Vitaly Puzrin
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/website_quotation_template/node_modules/argparse/README.md b/website_quotation_template/node_modules/argparse/README.md
new file mode 100644
index 000000000..7fa6c4050
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/README.md
@@ -0,0 +1,257 @@
+argparse
+========
+
+[](http://travis-ci.org/nodeca/argparse)
+[](https://www.npmjs.org/package/argparse)
+
+CLI arguments parser for node.js. Javascript port of python's
+[argparse](http://docs.python.org/dev/library/argparse.html) module
+(original version 3.2). That's a full port, except some very rare options,
+recorded in issue tracker.
+
+**NB. Difference with original.**
+
+- Method names changed to camelCase. See [generated docs](http://nodeca.github.com/argparse/).
+- Use `defaultValue` instead of `default`.
+- Use `argparse.Const.REMAINDER` instead of `argparse.REMAINDER`, and
+ similarly for constant values `OPTIONAL`, `ZERO_OR_MORE`, and `ONE_OR_MORE`
+ (aliases for `nargs` values `'?'`, `'*'`, `'+'`, respectively), and
+ `SUPPRESS`.
+
+
+Example
+=======
+
+test.js file:
+
+```javascript
+#!/usr/bin/env node
+'use strict';
+
+var ArgumentParser = require('../lib/argparse').ArgumentParser;
+var parser = new ArgumentParser({
+ version: '0.0.1',
+ addHelp:true,
+ description: 'Argparse example'
+});
+parser.addArgument(
+ [ '-f', '--foo' ],
+ {
+ help: 'foo bar'
+ }
+);
+parser.addArgument(
+ [ '-b', '--bar' ],
+ {
+ help: 'bar foo'
+ }
+);
+parser.addArgument(
+ '--baz',
+ {
+ help: 'baz bar'
+ }
+);
+var args = parser.parseArgs();
+console.dir(args);
+```
+
+Display help:
+
+```
+$ ./test.js -h
+usage: example.js [-h] [-v] [-f FOO] [-b BAR] [--baz BAZ]
+
+Argparse example
+
+Optional arguments:
+ -h, --help Show this help message and exit.
+ -v, --version Show program's version number and exit.
+ -f FOO, --foo FOO foo bar
+ -b BAR, --bar BAR bar foo
+ --baz BAZ baz bar
+```
+
+Parse arguments:
+
+```
+$ ./test.js -f=3 --bar=4 --baz 5
+{ foo: '3', bar: '4', baz: '5' }
+```
+
+More [examples](https://github.com/nodeca/argparse/tree/master/examples).
+
+
+ArgumentParser objects
+======================
+
+```
+new ArgumentParser({parameters hash});
+```
+
+Creates a new ArgumentParser object.
+
+**Supported params:**
+
+- ```description``` - Text to display before the argument help.
+- ```epilog``` - Text to display after the argument help.
+- ```addHelp``` - Add a -h/–help option to the parser. (default: true)
+- ```argumentDefault``` - Set the global default value for arguments. (default: null)
+- ```parents``` - A list of ArgumentParser objects whose arguments should also be included.
+- ```prefixChars``` - The set of characters that prefix optional arguments. (default: ‘-‘)
+- ```formatterClass``` - A class for customizing the help output.
+- ```prog``` - The name of the program (default: `path.basename(process.argv[1])`)
+- ```usage``` - The string describing the program usage (default: generated)
+- ```conflictHandler``` - Usually unnecessary, defines strategy for resolving conflicting optionals.
+
+**Not supported yet**
+
+- ```fromfilePrefixChars``` - The set of characters that prefix files from which additional arguments should be read.
+
+
+Details in [original ArgumentParser guide](http://docs.python.org/dev/library/argparse.html#argumentparser-objects)
+
+
+addArgument() method
+====================
+
+```
+ArgumentParser.addArgument(name or flag or [name] or [flags...], {options})
+```
+
+Defines how a single command-line argument should be parsed.
+
+- ```name or flag or [name] or [flags...]``` - Either a positional name
+ (e.g., `'foo'`), a single option (e.g., `'-f'` or `'--foo'`), an array
+ of a single positional name (e.g., `['foo']`), or an array of options
+ (e.g., `['-f', '--foo']`).
+
+Options:
+
+- ```action``` - The basic type of action to be taken when this argument is encountered at the command line.
+- ```nargs```- The number of command-line arguments that should be consumed.
+- ```constant``` - A constant value required by some action and nargs selections.
+- ```defaultValue``` - The value produced if the argument is absent from the command line.
+- ```type``` - The type to which the command-line argument should be converted.
+- ```choices``` - A container of the allowable values for the argument.
+- ```required``` - Whether or not the command-line option may be omitted (optionals only).
+- ```help``` - A brief description of what the argument does.
+- ```metavar``` - A name for the argument in usage messages.
+- ```dest``` - The name of the attribute to be added to the object returned by parseArgs().
+
+Details in [original add_argument guide](http://docs.python.org/dev/library/argparse.html#the-add-argument-method)
+
+
+Action (some details)
+================
+
+ArgumentParser objects associate command-line arguments with actions.
+These actions can do just about anything with the command-line arguments associated
+with them, though most actions simply add an attribute to the object returned by
+parseArgs(). The action keyword argument specifies how the command-line arguments
+should be handled. The supported actions are:
+
+- ```store``` - Just stores the argument’s value. This is the default action.
+- ```storeConst``` - Stores value, specified by the const keyword argument.
+ (Note that the const keyword argument defaults to the rather unhelpful None.)
+ The 'storeConst' action is most commonly used with optional arguments, that
+ specify some sort of flag.
+- ```storeTrue``` and ```storeFalse``` - Stores values True and False
+ respectively. These are special cases of 'storeConst'.
+- ```append``` - Stores a list, and appends each argument value to the list.
+ This is useful to allow an option to be specified multiple times.
+- ```appendConst``` - Stores a list, and appends value, specified by the
+ const keyword argument to the list. (Note, that the const keyword argument defaults
+ is None.) The 'appendConst' action is typically used when multiple arguments need
+ to store constants to the same list.
+- ```count``` - Counts the number of times a keyword argument occurs. For example,
+ used for increasing verbosity levels.
+- ```help``` - Prints a complete help message for all the options in the current
+ parser and then exits. By default a help action is automatically added to the parser.
+ See ArgumentParser for details of how the output is created.
+- ```version``` - Prints version information and exit. Expects a `version=`
+ keyword argument in the addArgument() call.
+
+Details in [original action guide](http://docs.python.org/dev/library/argparse.html#action)
+
+
+Sub-commands
+============
+
+ArgumentParser.addSubparsers()
+
+Many programs split their functionality into a number of sub-commands, for
+example, the svn program can invoke sub-commands like `svn checkout`, `svn update`,
+and `svn commit`. Splitting up functionality this way can be a particularly good
+idea when a program performs several different functions which require different
+kinds of command-line arguments. `ArgumentParser` supports creation of such
+sub-commands with `addSubparsers()` method. The `addSubparsers()` method is
+normally called with no arguments and returns an special action object.
+This object has a single method `addParser()`, which takes a command name and
+any `ArgumentParser` constructor arguments, and returns an `ArgumentParser` object
+that can be modified as usual.
+
+Example:
+
+sub_commands.js
+```javascript
+#!/usr/bin/env node
+'use strict';
+
+var ArgumentParser = require('../lib/argparse').ArgumentParser;
+var parser = new ArgumentParser({
+ version: '0.0.1',
+ addHelp:true,
+ description: 'Argparse examples: sub-commands',
+});
+
+var subparsers = parser.addSubparsers({
+ title:'subcommands',
+ dest:"subcommand_name"
+});
+
+var bar = subparsers.addParser('c1', {addHelp:true});
+bar.addArgument(
+ [ '-f', '--foo' ],
+ {
+ action: 'store',
+ help: 'foo3 bar3'
+ }
+);
+var bar = subparsers.addParser(
+ 'c2',
+ {aliases:['co'], addHelp:true}
+);
+bar.addArgument(
+ [ '-b', '--bar' ],
+ {
+ action: 'store',
+ type: 'int',
+ help: 'foo3 bar3'
+ }
+);
+
+var args = parser.parseArgs();
+console.dir(args);
+
+```
+
+Details in [original sub-commands guide](http://docs.python.org/dev/library/argparse.html#sub-commands)
+
+
+Contributors
+============
+
+- [Eugene Shkuropat](https://github.com/shkuropat)
+- [Paul Jacobson](https://github.com/hpaulj)
+
+[others](https://github.com/nodeca/argparse/graphs/contributors)
+
+License
+=======
+
+Copyright (c) 2012 [Vitaly Puzrin](https://github.com/puzrin).
+Released under the MIT license. See
+[LICENSE](https://github.com/nodeca/argparse/blob/master/LICENSE) for details.
+
+
diff --git a/website_quotation_template/node_modules/argparse/index.js b/website_quotation_template/node_modules/argparse/index.js
new file mode 100644
index 000000000..3bbc14320
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/index.js
@@ -0,0 +1,3 @@
+'use strict';
+
+module.exports = require('./lib/argparse');
diff --git a/website_quotation_template/node_modules/argparse/lib/action.js b/website_quotation_template/node_modules/argparse/lib/action.js
new file mode 100644
index 000000000..1483c79ff
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action.js
@@ -0,0 +1,146 @@
+/**
+ * class Action
+ *
+ * Base class for all actions
+ * Do not call in your code, use this class only for inherits your own action
+ *
+ * Information about how to convert command line strings to Javascript objects.
+ * Action objects are used by an ArgumentParser to represent the information
+ * needed to parse a single argument from one or more strings from the command
+ * line. The keyword arguments to the Action constructor are also all attributes
+ * of Action instances.
+ *
+ * ##### Allowed keywords:
+ *
+ * - `store`
+ * - `storeConstant`
+ * - `storeTrue`
+ * - `storeFalse`
+ * - `append`
+ * - `appendConstant`
+ * - `count`
+ * - `help`
+ * - `version`
+ *
+ * Information about action options see [[Action.new]]
+ *
+ * See also [original guide](http://docs.python.org/dev/library/argparse.html#action)
+ *
+ **/
+
+'use strict';
+
+
+// Constants
+var c = require('./const');
+
+
+/**
+ * new Action(options)
+ *
+ * Base class for all actions. Used only for inherits
+ *
+ *
+ * ##### Options:
+ *
+ * - `optionStrings` A list of command-line option strings for the action.
+ * - `dest` Attribute to hold the created object(s)
+ * - `nargs` The number of command-line arguments that should be consumed.
+ * By default, one argument will be consumed and a single value will be
+ * produced.
+ * - `constant` Default value for an action with no value.
+ * - `defaultValue` The value to be produced if the option is not specified.
+ * - `type` Cast to 'string'|'int'|'float'|'complex'|function (string). If
+ * None, 'string'.
+ * - `choices` The choices available.
+ * - `required` True if the action must always be specified at the command
+ * line.
+ * - `help` The help describing the argument.
+ * - `metavar` The name to be used for the option's argument with the help
+ * string. If None, the 'dest' value will be used as the name.
+ *
+ * ##### nargs supported values:
+ *
+ * - `N` (an integer) consumes N arguments (and produces a list)
+ * - `?` consumes zero or one arguments
+ * - `*` consumes zero or more arguments (and produces a list)
+ * - `+` consumes one or more arguments (and produces a list)
+ *
+ * Note: that the difference between the default and nargs=1 is that with the
+ * default, a single value will be produced, while with nargs=1, a list
+ * containing a single value will be produced.
+ **/
+var Action = module.exports = function Action(options) {
+ options = options || {};
+ this.optionStrings = options.optionStrings || [];
+ this.dest = options.dest;
+ this.nargs = typeof options.nargs !== 'undefined' ? options.nargs : null;
+ this.constant = typeof options.constant !== 'undefined' ? options.constant : null;
+ this.defaultValue = options.defaultValue;
+ this.type = typeof options.type !== 'undefined' ? options.type : null;
+ this.choices = typeof options.choices !== 'undefined' ? options.choices : null;
+ this.required = typeof options.required !== 'undefined' ? options.required : false;
+ this.help = typeof options.help !== 'undefined' ? options.help : null;
+ this.metavar = typeof options.metavar !== 'undefined' ? options.metavar : null;
+
+ if (!(this.optionStrings instanceof Array)) {
+ throw new Error('optionStrings should be an array');
+ }
+ if (typeof this.required !== 'undefined' && typeof this.required !== 'boolean') {
+ throw new Error('required should be a boolean');
+ }
+};
+
+/**
+ * Action#getName -> String
+ *
+ * Tells action name
+ **/
+Action.prototype.getName = function () {
+ if (this.optionStrings.length > 0) {
+ return this.optionStrings.join('/');
+ } else if (this.metavar !== null && this.metavar !== c.SUPPRESS) {
+ return this.metavar;
+ } else if (typeof this.dest !== 'undefined' && this.dest !== c.SUPPRESS) {
+ return this.dest;
+ }
+ return null;
+};
+
+/**
+ * Action#isOptional -> Boolean
+ *
+ * Return true if optional
+ **/
+Action.prototype.isOptional = function () {
+ return !this.isPositional();
+};
+
+/**
+ * Action#isPositional -> Boolean
+ *
+ * Return true if positional
+ **/
+Action.prototype.isPositional = function () {
+ return (this.optionStrings.length === 0);
+};
+
+/**
+ * Action#call(parser, namespace, values, optionString) -> Void
+ * - parser (ArgumentParser): current parser
+ * - namespace (Namespace): namespace for output data
+ * - values (Array): parsed values
+ * - optionString (Array): input option string(not parsed)
+ *
+ * Call the action. Should be implemented in inherited classes
+ *
+ * ##### Example
+ *
+ * ActionCount.prototype.call = function (parser, namespace, values, optionString) {
+ * namespace.set(this.dest, (namespace[this.dest] || 0) + 1);
+ * };
+ *
+ **/
+Action.prototype.call = function () {
+ throw new Error('.call() not defined');// Not Implemented error
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/action/append.js b/website_quotation_template/node_modules/argparse/lib/action/append.js
new file mode 100644
index 000000000..b5da0de23
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action/append.js
@@ -0,0 +1,53 @@
+/*:nodoc:*
+ * class ActionAppend
+ *
+ * This action stores a list, and appends each argument value to the list.
+ * This is useful to allow an option to be specified multiple times.
+ * This class inherided from [[Action]]
+ *
+ **/
+
+'use strict';
+
+var util = require('util');
+
+var Action = require('../action');
+
+// Constants
+var c = require('../const');
+
+/*:nodoc:*
+ * new ActionAppend(options)
+ * - options (object): options hash see [[Action.new]]
+ *
+ * Note: options.nargs should be optional for constants
+ * and more then zero for other
+ **/
+var ActionAppend = module.exports = function ActionAppend(options) {
+ options = options || {};
+ if (this.nargs <= 0) {
+ throw new Error('nargs for append actions must be > 0; if arg ' +
+ 'strings are not supplying the value to append, ' +
+ 'the append const action may be more appropriate');
+ }
+ if (!!this.constant && this.nargs !== c.OPTIONAL) {
+ throw new Error('nargs must be OPTIONAL to supply const');
+ }
+ Action.call(this, options);
+};
+util.inherits(ActionAppend, Action);
+
+/*:nodoc:*
+ * ActionAppend#call(parser, namespace, values, optionString) -> Void
+ * - parser (ArgumentParser): current parser
+ * - namespace (Namespace): namespace for output data
+ * - values (Array): parsed values
+ * - optionString (Array): input option string(not parsed)
+ *
+ * Call the action. Save result in namespace object
+ **/
+ActionAppend.prototype.call = function (parser, namespace, values) {
+ var items = (namespace[this.dest] || []).slice();
+ items.push(values);
+ namespace.set(this.dest, items);
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/action/append/constant.js b/website_quotation_template/node_modules/argparse/lib/action/append/constant.js
new file mode 100644
index 000000000..313f5d2ef
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action/append/constant.js
@@ -0,0 +1,47 @@
+/*:nodoc:*
+ * class ActionAppendConstant
+ *
+ * This stores a list, and appends the value specified by
+ * the const keyword argument to the list.
+ * (Note that the const keyword argument defaults to null.)
+ * The 'appendConst' action is typically useful when multiple
+ * arguments need to store constants to the same list.
+ *
+ * This class inherited from [[Action]]
+ **/
+
+'use strict';
+
+var util = require('util');
+
+var Action = require('../../action');
+
+/*:nodoc:*
+ * new ActionAppendConstant(options)
+ * - options (object): options hash see [[Action.new]]
+ *
+ **/
+var ActionAppendConstant = module.exports = function ActionAppendConstant(options) {
+ options = options || {};
+ options.nargs = 0;
+ if (typeof options.constant === 'undefined') {
+ throw new Error('constant option is required for appendAction');
+ }
+ Action.call(this, options);
+};
+util.inherits(ActionAppendConstant, Action);
+
+/*:nodoc:*
+ * ActionAppendConstant#call(parser, namespace, values, optionString) -> Void
+ * - parser (ArgumentParser): current parser
+ * - namespace (Namespace): namespace for output data
+ * - values (Array): parsed values
+ * - optionString (Array): input option string(not parsed)
+ *
+ * Call the action. Save result in namespace object
+ **/
+ActionAppendConstant.prototype.call = function (parser, namespace) {
+ var items = [].concat(namespace[this.dest] || []);
+ items.push(this.constant);
+ namespace.set(this.dest, items);
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/action/count.js b/website_quotation_template/node_modules/argparse/lib/action/count.js
new file mode 100644
index 000000000..d6a5899d0
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action/count.js
@@ -0,0 +1,40 @@
+/*:nodoc:*
+ * class ActionCount
+ *
+ * This counts the number of times a keyword argument occurs.
+ * For example, this is useful for increasing verbosity levels
+ *
+ * This class inherided from [[Action]]
+ *
+ **/
+'use strict';
+
+var util = require('util');
+
+var Action = require('../action');
+
+/*:nodoc:*
+ * new ActionCount(options)
+ * - options (object): options hash see [[Action.new]]
+ *
+ **/
+var ActionCount = module.exports = function ActionCount(options) {
+ options = options || {};
+ options.nargs = 0;
+
+ Action.call(this, options);
+};
+util.inherits(ActionCount, Action);
+
+/*:nodoc:*
+ * ActionCount#call(parser, namespace, values, optionString) -> Void
+ * - parser (ArgumentParser): current parser
+ * - namespace (Namespace): namespace for output data
+ * - values (Array): parsed values
+ * - optionString (Array): input option string(not parsed)
+ *
+ * Call the action. Save result in namespace object
+ **/
+ActionCount.prototype.call = function (parser, namespace) {
+ namespace.set(this.dest, (namespace[this.dest] || 0) + 1);
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/action/help.js b/website_quotation_template/node_modules/argparse/lib/action/help.js
new file mode 100644
index 000000000..b40e05a6f
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action/help.js
@@ -0,0 +1,47 @@
+/*:nodoc:*
+ * class ActionHelp
+ *
+ * Support action for printing help
+ * This class inherided from [[Action]]
+ **/
+'use strict';
+
+var util = require('util');
+
+var Action = require('../action');
+
+// Constants
+var c = require('../const');
+
+/*:nodoc:*
+ * new ActionHelp(options)
+ * - options (object): options hash see [[Action.new]]
+ *
+ **/
+var ActionHelp = module.exports = function ActionHelp(options) {
+ options = options || {};
+ if (options.defaultValue !== null) {
+ options.defaultValue = options.defaultValue;
+ } else {
+ options.defaultValue = c.SUPPRESS;
+ }
+ options.dest = (options.dest !== null ? options.dest : c.SUPPRESS);
+ options.nargs = 0;
+ Action.call(this, options);
+
+};
+util.inherits(ActionHelp, Action);
+
+/*:nodoc:*
+ * ActionHelp#call(parser, namespace, values, optionString)
+ * - parser (ArgumentParser): current parser
+ * - namespace (Namespace): namespace for output data
+ * - values (Array): parsed values
+ * - optionString (Array): input option string(not parsed)
+ *
+ * Print help and exit
+ **/
+ActionHelp.prototype.call = function (parser) {
+ parser.printHelp();
+ parser.exit();
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/action/store.js b/website_quotation_template/node_modules/argparse/lib/action/store.js
new file mode 100644
index 000000000..283b86092
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action/store.js
@@ -0,0 +1,50 @@
+/*:nodoc:*
+ * class ActionStore
+ *
+ * This action just stores the argument’s value. This is the default action.
+ *
+ * This class inherited from [[Action]]
+ *
+ **/
+'use strict';
+
+var util = require('util');
+
+var Action = require('../action');
+
+// Constants
+var c = require('../const');
+
+
+/*:nodoc:*
+ * new ActionStore(options)
+ * - options (object): options hash see [[Action.new]]
+ *
+ **/
+var ActionStore = module.exports = function ActionStore(options) {
+ options = options || {};
+ if (this.nargs <= 0) {
+ throw new Error('nargs for store actions must be > 0; if you ' +
+ 'have nothing to store, actions such as store ' +
+ 'true or store const may be more appropriate');
+
+ }
+ if (typeof this.constant !== 'undefined' && this.nargs !== c.OPTIONAL) {
+ throw new Error('nargs must be OPTIONAL to supply const');
+ }
+ Action.call(this, options);
+};
+util.inherits(ActionStore, Action);
+
+/*:nodoc:*
+ * ActionStore#call(parser, namespace, values, optionString) -> Void
+ * - parser (ArgumentParser): current parser
+ * - namespace (Namespace): namespace for output data
+ * - values (Array): parsed values
+ * - optionString (Array): input option string(not parsed)
+ *
+ * Call the action. Save result in namespace object
+ **/
+ActionStore.prototype.call = function (parser, namespace, values) {
+ namespace.set(this.dest, values);
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/action/store/constant.js b/website_quotation_template/node_modules/argparse/lib/action/store/constant.js
new file mode 100644
index 000000000..23caa897b
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action/store/constant.js
@@ -0,0 +1,43 @@
+/*:nodoc:*
+ * class ActionStoreConstant
+ *
+ * This action stores the value specified by the const keyword argument.
+ * (Note that the const keyword argument defaults to the rather unhelpful null.)
+ * The 'store_const' action is most commonly used with optional
+ * arguments that specify some sort of flag.
+ *
+ * This class inherited from [[Action]]
+ **/
+'use strict';
+
+var util = require('util');
+
+var Action = require('../../action');
+
+/*:nodoc:*
+ * new ActionStoreConstant(options)
+ * - options (object): options hash see [[Action.new]]
+ *
+ **/
+var ActionStoreConstant = module.exports = function ActionStoreConstant(options) {
+ options = options || {};
+ options.nargs = 0;
+ if (typeof options.constant === 'undefined') {
+ throw new Error('constant option is required for storeAction');
+ }
+ Action.call(this, options);
+};
+util.inherits(ActionStoreConstant, Action);
+
+/*:nodoc:*
+ * ActionStoreConstant#call(parser, namespace, values, optionString) -> Void
+ * - parser (ArgumentParser): current parser
+ * - namespace (Namespace): namespace for output data
+ * - values (Array): parsed values
+ * - optionString (Array): input option string(not parsed)
+ *
+ * Call the action. Save result in namespace object
+ **/
+ActionStoreConstant.prototype.call = function (parser, namespace) {
+ namespace.set(this.dest, this.constant);
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/action/store/false.js b/website_quotation_template/node_modules/argparse/lib/action/store/false.js
new file mode 100644
index 000000000..9924f461d
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action/store/false.js
@@ -0,0 +1,27 @@
+/*:nodoc:*
+ * class ActionStoreFalse
+ *
+ * This action store the values False respectively.
+ * This is special cases of 'storeConst'
+ *
+ * This class inherited from [[Action]]
+ **/
+
+'use strict';
+
+var util = require('util');
+
+var ActionStoreConstant = require('./constant');
+
+/*:nodoc:*
+ * new ActionStoreFalse(options)
+ * - options (object): hash of options see [[Action.new]]
+ *
+ **/
+var ActionStoreFalse = module.exports = function ActionStoreFalse(options) {
+ options = options || {};
+ options.constant = false;
+ options.defaultValue = options.defaultValue !== null ? options.defaultValue : true;
+ ActionStoreConstant.call(this, options);
+};
+util.inherits(ActionStoreFalse, ActionStoreConstant);
diff --git a/website_quotation_template/node_modules/argparse/lib/action/store/true.js b/website_quotation_template/node_modules/argparse/lib/action/store/true.js
new file mode 100644
index 000000000..9e22f7d44
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action/store/true.js
@@ -0,0 +1,26 @@
+/*:nodoc:*
+ * class ActionStoreTrue
+ *
+ * This action store the values True respectively.
+ * This isspecial cases of 'storeConst'
+ *
+ * This class inherited from [[Action]]
+ **/
+'use strict';
+
+var util = require('util');
+
+var ActionStoreConstant = require('./constant');
+
+/*:nodoc:*
+ * new ActionStoreTrue(options)
+ * - options (object): options hash see [[Action.new]]
+ *
+ **/
+var ActionStoreTrue = module.exports = function ActionStoreTrue(options) {
+ options = options || {};
+ options.constant = true;
+ options.defaultValue = options.defaultValue !== null ? options.defaultValue : false;
+ ActionStoreConstant.call(this, options);
+};
+util.inherits(ActionStoreTrue, ActionStoreConstant);
diff --git a/website_quotation_template/node_modules/argparse/lib/action/subparsers.js b/website_quotation_template/node_modules/argparse/lib/action/subparsers.js
new file mode 100644
index 000000000..99dfedd0f
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action/subparsers.js
@@ -0,0 +1,149 @@
+/** internal
+ * class ActionSubparsers
+ *
+ * Support the creation of such sub-commands with the addSubparsers()
+ *
+ * This class inherited from [[Action]]
+ **/
+'use strict';
+
+var util = require('util');
+var format = require('util').format;
+
+
+var Action = require('../action');
+
+// Constants
+var c = require('../const');
+
+// Errors
+var argumentErrorHelper = require('../argument/error');
+
+
+/*:nodoc:*
+ * new ChoicesPseudoAction(name, help)
+ *
+ * Create pseudo action for correct help text
+ *
+ **/
+function ChoicesPseudoAction(name, help) {
+ var options = {
+ optionStrings: [],
+ dest: name,
+ help: help
+ };
+
+ Action.call(this, options);
+}
+
+util.inherits(ChoicesPseudoAction, Action);
+
+/**
+ * new ActionSubparsers(options)
+ * - options (object): options hash see [[Action.new]]
+ *
+ **/
+function ActionSubparsers(options) {
+ options = options || {};
+ options.dest = options.dest || c.SUPPRESS;
+ options.nargs = c.PARSER;
+
+ this.debug = (options.debug === true);
+
+ this._progPrefix = options.prog;
+ this._parserClass = options.parserClass;
+ this._nameParserMap = {};
+ this._choicesActions = [];
+
+ options.choices = this._nameParserMap;
+ Action.call(this, options);
+}
+
+util.inherits(ActionSubparsers, Action);
+
+/*:nodoc:*
+ * ActionSubparsers#addParser(name, options) -> ArgumentParser
+ * - name (string): sub-command name
+ * - options (object): see [[ArgumentParser.new]]
+ *
+ * Note:
+ * addParser supports an additional aliases option,
+ * which allows multiple strings to refer to the same subparser.
+ * This example, like svn, aliases co as a shorthand for checkout
+ *
+ **/
+ActionSubparsers.prototype.addParser = function (name, options) {
+ var parser;
+
+ var self = this;
+
+ options = options || {};
+
+ options.debug = (this.debug === true);
+
+ // set program from the existing prefix
+ if (!options.prog) {
+ options.prog = this._progPrefix + ' ' + name;
+ }
+
+ var aliases = options.aliases || [];
+
+ // create a pseudo-action to hold the choice help
+ if (!!options.help || typeof options.help === 'string') {
+ var help = options.help;
+ delete options.help;
+
+ var choiceAction = new ChoicesPseudoAction(name, help);
+ this._choicesActions.push(choiceAction);
+ }
+
+ // create the parser and add it to the map
+ parser = new this._parserClass(options);
+ this._nameParserMap[name] = parser;
+
+ // make parser available under aliases also
+ aliases.forEach(function (alias) {
+ self._nameParserMap[alias] = parser;
+ });
+
+ return parser;
+};
+
+ActionSubparsers.prototype._getSubactions = function () {
+ return this._choicesActions;
+};
+
+/*:nodoc:*
+ * ActionSubparsers#call(parser, namespace, values, optionString) -> Void
+ * - parser (ArgumentParser): current parser
+ * - namespace (Namespace): namespace for output data
+ * - values (Array): parsed values
+ * - optionString (Array): input option string(not parsed)
+ *
+ * Call the action. Parse input aguments
+ **/
+ActionSubparsers.prototype.call = function (parser, namespace, values) {
+ var parserName = values[0];
+ var argStrings = values.slice(1);
+
+ // set the parser name if requested
+ if (this.dest !== c.SUPPRESS) {
+ namespace[this.dest] = parserName;
+ }
+
+ // select the parser
+ if (this._nameParserMap[parserName]) {
+ parser = this._nameParserMap[parserName];
+ } else {
+ throw argumentErrorHelper(format(
+ 'Unknown parser "%s" (choices: [%s]).',
+ parserName,
+ Object.keys(this._nameParserMap).join(', ')
+ ));
+ }
+
+ // parse all the remaining options into the namespace
+ parser.parseArgs(argStrings, namespace);
+};
+
+module.exports = ActionSubparsers;
diff --git a/website_quotation_template/node_modules/argparse/lib/action/version.js b/website_quotation_template/node_modules/argparse/lib/action/version.js
new file mode 100644
index 000000000..8053328cd
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action/version.js
@@ -0,0 +1,47 @@
+/*:nodoc:*
+ * class ActionVersion
+ *
+ * Support action for printing program version
+ * This class inherited from [[Action]]
+ **/
+'use strict';
+
+var util = require('util');
+
+var Action = require('../action');
+
+//
+// Constants
+//
+var c = require('../const');
+
+/*:nodoc:*
+ * new ActionVersion(options)
+ * - options (object): options hash see [[Action.new]]
+ *
+ **/
+var ActionVersion = module.exports = function ActionVersion(options) {
+ options = options || {};
+ options.defaultValue = (options.defaultValue ? options.defaultValue : c.SUPPRESS);
+ options.dest = (options.dest || c.SUPPRESS);
+ options.nargs = 0;
+ this.version = options.version;
+ Action.call(this, options);
+};
+util.inherits(ActionVersion, Action);
+
+/*:nodoc:*
+ * ActionVersion#call(parser, namespace, values, optionString) -> Void
+ * - parser (ArgumentParser): current parser
+ * - namespace (Namespace): namespace for output data
+ * - values (Array): parsed values
+ * - optionString (Array): input option string(not parsed)
+ *
+ * Print version and exit
+ **/
+ActionVersion.prototype.call = function (parser) {
+ var version = this.version || parser.version;
+ var formatter = parser._getFormatter();
+ formatter.addText(version);
+ parser.exit(0, formatter.formatHelp());
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/action_container.js b/website_quotation_template/node_modules/argparse/lib/action_container.js
new file mode 100644
index 000000000..6f1237bea
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/action_container.js
@@ -0,0 +1,482 @@
+/** internal
+ * class ActionContainer
+ *
+ * Action container. Parent for [[ArgumentParser]] and [[ArgumentGroup]]
+ **/
+
+'use strict';
+
+var format = require('util').format;
+
+// Constants
+var c = require('./const');
+
+var $$ = require('./utils');
+
+//Actions
+var ActionHelp = require('./action/help');
+var ActionAppend = require('./action/append');
+var ActionAppendConstant = require('./action/append/constant');
+var ActionCount = require('./action/count');
+var ActionStore = require('./action/store');
+var ActionStoreConstant = require('./action/store/constant');
+var ActionStoreTrue = require('./action/store/true');
+var ActionStoreFalse = require('./action/store/false');
+var ActionVersion = require('./action/version');
+var ActionSubparsers = require('./action/subparsers');
+
+// Errors
+var argumentErrorHelper = require('./argument/error');
+
+/**
+ * new ActionContainer(options)
+ *
+ * Action container. Parent for [[ArgumentParser]] and [[ArgumentGroup]]
+ *
+ * ##### Options:
+ *
+ * - `description` -- A description of what the program does
+ * - `prefixChars` -- Characters that prefix optional arguments
+ * - `argumentDefault` -- The default value for all arguments
+ * - `conflictHandler` -- The conflict handler to use for duplicate arguments
+ **/
+var ActionContainer = module.exports = function ActionContainer(options) {
+ options = options || {};
+
+ this.description = options.description;
+ this.argumentDefault = options.argumentDefault;
+ this.prefixChars = options.prefixChars || '';
+ this.conflictHandler = options.conflictHandler;
+
+ // set up registries
+ this._registries = {};
+
+ // register actions
+ this.register('action', null, ActionStore);
+ this.register('action', 'store', ActionStore);
+ this.register('action', 'storeConst', ActionStoreConstant);
+ this.register('action', 'storeTrue', ActionStoreTrue);
+ this.register('action', 'storeFalse', ActionStoreFalse);
+ this.register('action', 'append', ActionAppend);
+ this.register('action', 'appendConst', ActionAppendConstant);
+ this.register('action', 'count', ActionCount);
+ this.register('action', 'help', ActionHelp);
+ this.register('action', 'version', ActionVersion);
+ this.register('action', 'parsers', ActionSubparsers);
+
+ // raise an exception if the conflict handler is invalid
+ this._getHandler();
+
+ // action storage
+ this._actions = [];
+ this._optionStringActions = {};
+
+ // groups
+ this._actionGroups = [];
+ this._mutuallyExclusiveGroups = [];
+
+ // defaults storage
+ this._defaults = {};
+
+ // determines whether an "option" looks like a negative number
+ // -1, -1.5 -5e+4
+ this._regexpNegativeNumber = new RegExp('^[-]?[0-9]*\\.?[0-9]+([eE][-+]?[0-9]+)?$');
+
+ // whether or not there are any optionals that look like negative
+ // numbers -- uses a list so it can be shared and edited
+ this._hasNegativeNumberOptionals = [];
+};
+
+// Groups must be required, then ActionContainer already defined
+var ArgumentGroup = require('./argument/group');
+var MutuallyExclusiveGroup = require('./argument/exclusive');
+
+//
+// Registration methods
+//
+
+/**
+ * ActionContainer#register(registryName, value, object) -> Void
+ * - registryName (String) : object type action|type
+ * - value (string) : keyword
+ * - object (Object|Function) : handler
+ *
+ * Register handlers
+ **/
+ActionContainer.prototype.register = function (registryName, value, object) {
+ this._registries[registryName] = this._registries[registryName] || {};
+ this._registries[registryName][value] = object;
+};
+
+ActionContainer.prototype._registryGet = function (registryName, value, defaultValue) {
+ if (arguments.length < 3) {
+ defaultValue = null;
+ }
+ return this._registries[registryName][value] || defaultValue;
+};
+
+//
+// Namespace default accessor methods
+//
+
+/**
+ * ActionContainer#setDefaults(options) -> Void
+ * - options (object):hash of options see [[Action.new]]
+ *
+ * Set defaults
+ **/
+ActionContainer.prototype.setDefaults = function (options) {
+ options = options || {};
+ for (var property in options) {
+ if ($$.has(options, property)) {
+ this._defaults[property] = options[property];
+ }
+ }
+
+ // if these defaults match any existing arguments, replace the previous
+ // default on the object with the new one
+ this._actions.forEach(function (action) {
+ if ($$.has(options, action.dest)) {
+ action.defaultValue = options[action.dest];
+ }
+ });
+};
+
+/**
+ * ActionContainer#getDefault(dest) -> Mixed
+ * - dest (string): action destination
+ *
+ * Return action default value
+ **/
+ActionContainer.prototype.getDefault = function (dest) {
+ var result = $$.has(this._defaults, dest) ? this._defaults[dest] : null;
+
+ this._actions.forEach(function (action) {
+ if (action.dest === dest && $$.has(action, 'defaultValue')) {
+ result = action.defaultValue;
+ }
+ });
+
+ return result;
+};
+//
+// Adding argument actions
+//
+
+/**
+ * ActionContainer#addArgument(args, options) -> Object
+ * - args (String|Array): argument key, or array of argument keys
+ * - options (Object): action objects see [[Action.new]]
+ *
+ * #### Examples
+ * - addArgument([ '-f', '--foo' ], { action: 'store', defaultValue: 1, ... })
+ * - addArgument([ 'bar' ], { action: 'store', nargs: 1, ... })
+ * - addArgument('--baz', { action: 'store', nargs: 1, ... })
+ **/
+ActionContainer.prototype.addArgument = function (args, options) {
+ args = args;
+ options = options || {};
+
+ if (typeof args === 'string') {
+ args = [ args ];
+ }
+ if (!Array.isArray(args)) {
+ throw new TypeError('addArgument first argument should be a string or an array');
+ }
+ if (typeof options !== 'object' || Array.isArray(options)) {
+ throw new TypeError('addArgument second argument should be a hash');
+ }
+
+ // if no positional args are supplied or only one is supplied and
+ // it doesn't look like an option string, parse a positional argument
+ if (!args || args.length === 1 && this.prefixChars.indexOf(args[0][0]) < 0) {
+ if (args && !!options.dest) {
+ throw new Error('dest supplied twice for positional argument');
+ }
+ options = this._getPositional(args, options);
+
+ // otherwise, we're adding an optional argument
+ } else {
+ options = this._getOptional(args, options);
+ }
+
+ // if no default was supplied, use the parser-level default
+ if (typeof options.defaultValue === 'undefined') {
+ var dest = options.dest;
+ if ($$.has(this._defaults, dest)) {
+ options.defaultValue = this._defaults[dest];
+ } else if (typeof this.argumentDefault !== 'undefined') {
+ options.defaultValue = this.argumentDefault;
+ }
+ }
+
+ // create the action object, and add it to the parser
+ var ActionClass = this._popActionClass(options);
+ if (typeof ActionClass !== 'function') {
+ throw new Error(format('Unknown action "%s".', ActionClass));
+ }
+ var action = new ActionClass(options);
+
+ // throw an error if the action type is not callable
+ var typeFunction = this._registryGet('type', action.type, action.type);
+ if (typeof typeFunction !== 'function') {
+ throw new Error(format('"%s" is not callable', typeFunction));
+ }
+
+ return this._addAction(action);
+};
+
+/**
+ * ActionContainer#addArgumentGroup(options) -> ArgumentGroup
+ * - options (Object): hash of options see [[ArgumentGroup.new]]
+ *
+ * Create new arguments groups
+ **/
+ActionContainer.prototype.addArgumentGroup = function (options) {
+ var group = new ArgumentGroup(this, options);
+ this._actionGroups.push(group);
+ return group;
+};
+
+/**
+ * ActionContainer#addMutuallyExclusiveGroup(options) -> ArgumentGroup
+ * - options (Object): {required: false}
+ *
+ * Create new mutual exclusive groups
+ **/
+ActionContainer.prototype.addMutuallyExclusiveGroup = function (options) {
+ var group = new MutuallyExclusiveGroup(this, options);
+ this._mutuallyExclusiveGroups.push(group);
+ return group;
+};
+
+ActionContainer.prototype._addAction = function (action) {
+ var self = this;
+
+ // resolve any conflicts
+ this._checkConflict(action);
+
+ // add to actions list
+ this._actions.push(action);
+ action.container = this;
+
+ // index the action by any option strings it has
+ action.optionStrings.forEach(function (optionString) {
+ self._optionStringActions[optionString] = action;
+ });
+
+ // set the flag if any option strings look like negative numbers
+ action.optionStrings.forEach(function (optionString) {
+ if (optionString.match(self._regexpNegativeNumber)) {
+ if (!self._hasNegativeNumberOptionals.some(Boolean)) {
+ self._hasNegativeNumberOptionals.push(true);
+ }
+ }
+ });
+
+ // return the created action
+ return action;
+};
+
+ActionContainer.prototype._removeAction = function (action) {
+ var actionIndex = this._actions.indexOf(action);
+ if (actionIndex >= 0) {
+ this._actions.splice(actionIndex, 1);
+ }
+};
+
+ActionContainer.prototype._addContainerActions = function (container) {
+ // collect groups by titles
+ var titleGroupMap = {};
+ this._actionGroups.forEach(function (group) {
+ if (titleGroupMap[group.title]) {
+ throw new Error(format('Cannot merge actions - two groups are named "%s".', group.title));
+ }
+ titleGroupMap[group.title] = group;
+ });
+
+ // map each action to its group
+ var groupMap = {};
+ function actionHash(action) {
+ // unique (hopefully?) string suitable as dictionary key
+ return action.getName();
+ }
+ container._actionGroups.forEach(function (group) {
+ // if a group with the title exists, use that, otherwise
+ // create a new group matching the container's group
+ if (!titleGroupMap[group.title]) {
+ titleGroupMap[group.title] = this.addArgumentGroup({
+ title: group.title,
+ description: group.description
+ });
+ }
+
+ // map the actions to their new group
+ group._groupActions.forEach(function (action) {
+ groupMap[actionHash(action)] = titleGroupMap[group.title];
+ });
+ }, this);
+
+ // add container's mutually exclusive groups
+ // NOTE: if add_mutually_exclusive_group ever gains title= and
+ // description= then this code will need to be expanded as above
+ var mutexGroup;
+ container._mutuallyExclusiveGroups.forEach(function (group) {
+ mutexGroup = this.addMutuallyExclusiveGroup({
+ required: group.required
+ });
+ // map the actions to their new mutex group
+ group._groupActions.forEach(function (action) {
+ groupMap[actionHash(action)] = mutexGroup;
+ });
+ }, this); // forEach takes a 'this' argument
+
+ // add all actions to this container or their group
+ container._actions.forEach(function (action) {
+ var key = actionHash(action);
+ if (groupMap[key]) {
+ groupMap[key]._addAction(action);
+ } else {
+ this._addAction(action);
+ }
+ });
+};
+
+ActionContainer.prototype._getPositional = function (dest, options) {
+ if (Array.isArray(dest)) {
+ dest = dest[0];
+ }
+ // make sure required is not specified
+ if (options.required) {
+ throw new Error('"required" is an invalid argument for positionals.');
+ }
+
+ // mark positional arguments as required if at least one is
+ // always required
+ if (options.nargs !== c.OPTIONAL && options.nargs !== c.ZERO_OR_MORE) {
+ options.required = true;
+ }
+ if (options.nargs === c.ZERO_OR_MORE && typeof options.defaultValue === 'undefined') {
+ options.required = true;
+ }
+
+ // return the keyword arguments with no option strings
+ options.dest = dest;
+ options.optionStrings = [];
+ return options;
+};
+
+ActionContainer.prototype._getOptional = function (args, options) {
+ var prefixChars = this.prefixChars;
+ var optionStrings = [];
+ var optionStringsLong = [];
+
+ // determine short and long option strings
+ args.forEach(function (optionString) {
+ // error on strings that don't start with an appropriate prefix
+ if (prefixChars.indexOf(optionString[0]) < 0) {
+ throw new Error(format('Invalid option string "%s": must start with a "%s".',
+ optionString,
+ prefixChars
+ ));
+ }
+
+ // strings starting with two prefix characters are long options
+ optionStrings.push(optionString);
+ if (optionString.length > 1 && prefixChars.indexOf(optionString[1]) >= 0) {
+ optionStringsLong.push(optionString);
+ }
+ });
+
+ // infer dest, '--foo-bar' -> 'foo_bar' and '-x' -> 'x'
+ var dest = options.dest || null;
+ delete options.dest;
+
+ if (!dest) {
+ var optionStringDest = optionStringsLong.length ? optionStringsLong[0] : optionStrings[0];
+ dest = $$.trimChars(optionStringDest, this.prefixChars);
+
+ if (dest.length === 0) {
+ throw new Error(
+ format('dest= is required for options like "%s"', optionStrings.join(', '))
+ );
+ }
+ dest = dest.replace(/-/g, '_');
+ }
+
+ // return the updated keyword arguments
+ options.dest = dest;
+ options.optionStrings = optionStrings;
+
+ return options;
+};
+
+ActionContainer.prototype._popActionClass = function (options, defaultValue) {
+ defaultValue = defaultValue || null;
+
+ var action = (options.action || defaultValue);
+ delete options.action;
+
+ var actionClass = this._registryGet('action', action, action);
+ return actionClass;
+};
+
+ActionContainer.prototype._getHandler = function () {
+ var handlerString = this.conflictHandler;
+ var handlerFuncName = '_handleConflict' + $$.capitalize(handlerString);
+ var func = this[handlerFuncName];
+ if (typeof func === 'undefined') {
+ var msg = 'invalid conflict resolution value: ' + handlerString;
+ throw new Error(msg);
+ } else {
+ return func;
+ }
+};
+
+ActionContainer.prototype._checkConflict = function (action) {
+ var optionStringActions = this._optionStringActions;
+ var conflictOptionals = [];
+
+ // find all options that conflict with this option
+ // collect pairs, the string, and an existing action that it conflicts with
+ action.optionStrings.forEach(function (optionString) {
+ var conflOptional = optionStringActions[optionString];
+ if (typeof conflOptional !== 'undefined') {
+ conflictOptionals.push([ optionString, conflOptional ]);
+ }
+ });
+
+ if (conflictOptionals.length > 0) {
+ var conflictHandler = this._getHandler();
+ conflictHandler.call(this, action, conflictOptionals);
+ }
+};
+
+ActionContainer.prototype._handleConflictError = function (action, conflOptionals) {
+ var conflicts = conflOptionals.map(function (pair) { return pair[0]; });
+ conflicts = conflicts.join(', ');
+ throw argumentErrorHelper(
+ action,
+ format('Conflicting option string(s): %s', conflicts)
+ );
+};
+
+ActionContainer.prototype._handleConflictResolve = function (action, conflOptionals) {
+ // remove all conflicting options
+ var self = this;
+ conflOptionals.forEach(function (pair) {
+ var optionString = pair[0];
+ var conflictingAction = pair[1];
+ // remove the conflicting option string
+ var i = conflictingAction.optionStrings.indexOf(optionString);
+ if (i >= 0) {
+ conflictingAction.optionStrings.splice(i, 1);
+ }
+ delete self._optionStringActions[optionString];
+ // if the option now has no option string, remove it from the
+ // container holding it
+ if (conflictingAction.optionStrings.length === 0) {
+ conflictingAction.container._removeAction(conflictingAction);
+ }
+ });
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/argparse.js b/website_quotation_template/node_modules/argparse/lib/argparse.js
new file mode 100644
index 000000000..f2a2c51d9
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/argparse.js
@@ -0,0 +1,14 @@
+'use strict';
+
+module.exports.ArgumentParser = require('./argument_parser.js');
+module.exports.Namespace = require('./namespace');
+module.exports.Action = require('./action');
+module.exports.HelpFormatter = require('./help/formatter.js');
+module.exports.Const = require('./const.js');
+
+module.exports.ArgumentDefaultsHelpFormatter =
+ require('./help/added_formatters.js').ArgumentDefaultsHelpFormatter;
+module.exports.RawDescriptionHelpFormatter =
+ require('./help/added_formatters.js').RawDescriptionHelpFormatter;
+module.exports.RawTextHelpFormatter =
+ require('./help/added_formatters.js').RawTextHelpFormatter;
diff --git a/website_quotation_template/node_modules/argparse/lib/argument/error.js b/website_quotation_template/node_modules/argparse/lib/argument/error.js
new file mode 100644
index 000000000..c8a02a08b
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/argument/error.js
@@ -0,0 +1,50 @@
+'use strict';
+
+
+var format = require('util').format;
+
+
+var ERR_CODE = 'ARGError';
+
+/*:nodoc:*
+ * argumentError(argument, message) -> TypeError
+ * - argument (Object): action with broken argument
+ * - message (String): error message
+ *
+ * Error format helper. An error from creating or using an argument
+ * (optional or positional). The string value of this exception
+ * is the message, augmented with information
+ * about the argument that caused it.
+ *
+ * #####Example
+ *
+ * var argumentErrorHelper = require('./argument/error');
+ * if (conflictOptionals.length > 0) {
+ * throw argumentErrorHelper(
+ * action,
+ * format('Conflicting option string(s): %s', conflictOptionals.join(', '))
+ * );
+ * }
+ *
+ **/
+module.exports = function (argument, message) {
+ var argumentName = null;
+ var errMessage;
+ var err;
+
+ if (argument.getName) {
+ argumentName = argument.getName();
+ } else {
+ argumentName = '' + argument;
+ }
+
+ if (!argumentName) {
+ errMessage = message;
+ } else {
+ errMessage = format('argument "%s": %s', argumentName, message);
+ }
+
+ err = new TypeError(errMessage);
+ err.code = ERR_CODE;
+ return err;
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/argument/exclusive.js b/website_quotation_template/node_modules/argparse/lib/argument/exclusive.js
new file mode 100644
index 000000000..8287e00d0
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/argument/exclusive.js
@@ -0,0 +1,54 @@
+/** internal
+ * class MutuallyExclusiveGroup
+ *
+ * Group arguments.
+ * By default, ArgumentParser groups command-line arguments
+ * into “positional arguments” and “optional arguments”
+ * when displaying help messages. When there is a better
+ * conceptual grouping of arguments than this default one,
+ * appropriate groups can be created using the addArgumentGroup() method
+ *
+ * This class inherited from [[ArgumentContainer]]
+ **/
+'use strict';
+
+var util = require('util');
+
+var ArgumentGroup = require('./group');
+
+/**
+ * new MutuallyExclusiveGroup(container, options)
+ * - container (object): main container
+ * - options (object): options.required -> true/false
+ *
+ * `required` could be an argument itself, but making it a property of
+ * the options argument is more consistent with the JS adaptation of the Python)
+ **/
+var MutuallyExclusiveGroup = module.exports = function MutuallyExclusiveGroup(container, options) {
+ var required;
+ options = options || {};
+ required = options.required || false;
+ ArgumentGroup.call(this, container);
+ this.required = required;
+
+};
+util.inherits(MutuallyExclusiveGroup, ArgumentGroup);
+
+
+MutuallyExclusiveGroup.prototype._addAction = function (action) {
+ var msg;
+ if (action.required) {
+ msg = 'mutually exclusive arguments must be optional';
+ throw new Error(msg);
+ }
+ action = this._container._addAction(action);
+ this._groupActions.push(action);
+ return action;
+};
+
+
+MutuallyExclusiveGroup.prototype._removeAction = function (action) {
+ this._container._removeAction(action);
+ this._groupActions.remove(action);
+};
+
diff --git a/website_quotation_template/node_modules/argparse/lib/argument/group.js b/website_quotation_template/node_modules/argparse/lib/argument/group.js
new file mode 100644
index 000000000..58b271f2f
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/argument/group.js
@@ -0,0 +1,75 @@
+/** internal
+ * class ArgumentGroup
+ *
+ * Group arguments.
+ * By default, ArgumentParser groups command-line arguments
+ * into “positional arguments” and “optional arguments”
+ * when displaying help messages. When there is a better
+ * conceptual grouping of arguments than this default one,
+ * appropriate groups can be created using the addArgumentGroup() method
+ *
+ * This class inherited from [[ArgumentContainer]]
+ **/
+'use strict';
+
+var util = require('util');
+
+var ActionContainer = require('../action_container');
+
+
+/**
+ * new ArgumentGroup(container, options)
+ * - container (object): main container
+ * - options (object): hash of group options
+ *
+ * #### options
+ * - **prefixChars** group name prefix
+ * - **argumentDefault** default argument value
+ * - **title** group title
+ * - **description** group description
+ *
+ **/
+var ArgumentGroup = module.exports = function ArgumentGroup(container, options) {
+
+ options = options || {};
+
+ // add any missing keyword arguments by checking the container
+ options.conflictHandler = (options.conflictHandler || container.conflictHandler);
+ options.prefixChars = (options.prefixChars || container.prefixChars);
+ options.argumentDefault = (options.argumentDefault || container.argumentDefault);
+
+ ActionContainer.call(this, options);
+
+ // group attributes
+ this.title = options.title;
+ this._groupActions = [];
+
+ // share most attributes with the container
+ this._container = container;
+ this._registries = container._registries;
+ this._actions = container._actions;
+ this._optionStringActions = container._optionStringActions;
+ this._defaults = container._defaults;
+ this._hasNegativeNumberOptionals = container._hasNegativeNumberOptionals;
+ this._mutuallyExclusiveGroups = container._mutuallyExclusiveGroups;
+};
+util.inherits(ArgumentGroup, ActionContainer);
+
+
+ArgumentGroup.prototype._addAction = function (action) {
+ // Parent add action
+ action = ActionContainer.prototype._addAction.call(this, action);
+ this._groupActions.push(action);
+ return action;
+};
+
+
+ArgumentGroup.prototype._removeAction = function (action) {
+ // Parent remove action
+ ActionContainer.prototype._removeAction.call(this, action);
+ var actionIndex = this._groupActions.indexOf(action);
+ if (actionIndex >= 0) {
+ this._groupActions.splice(actionIndex, 1);
+ }
+};
+
diff --git a/website_quotation_template/node_modules/argparse/lib/argument_parser.js b/website_quotation_template/node_modules/argparse/lib/argument_parser.js
new file mode 100644
index 000000000..bd9a59a45
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/argument_parser.js
@@ -0,0 +1,1161 @@
+/**
+ * class ArgumentParser
+ *
+ * Object for parsing command line strings into js objects.
+ *
+ * Inherited from [[ActionContainer]]
+ **/
+'use strict';
+
+var util = require('util');
+var format = require('util').format;
+var Path = require('path');
+var sprintf = require('sprintf-js').sprintf;
+
+// Constants
+var c = require('./const');
+
+var $$ = require('./utils');
+
+var ActionContainer = require('./action_container');
+
+// Errors
+var argumentErrorHelper = require('./argument/error');
+
+var HelpFormatter = require('./help/formatter');
+
+var Namespace = require('./namespace');
+
+
+/**
+ * new ArgumentParser(options)
+ *
+ * Create a new ArgumentParser object.
+ *
+ * ##### Options:
+ * - `prog` The name of the program (default: Path.basename(process.argv[1]))
+ * - `usage` A usage message (default: auto-generated from arguments)
+ * - `description` A description of what the program does
+ * - `epilog` Text following the argument descriptions
+ * - `parents` Parsers whose arguments should be copied into this one
+ * - `formatterClass` HelpFormatter class for printing help messages
+ * - `prefixChars` Characters that prefix optional arguments
+ * - `fromfilePrefixChars` Characters that prefix files containing additional arguments
+ * - `argumentDefault` The default value for all arguments
+ * - `addHelp` Add a -h/-help option
+ * - `conflictHandler` Specifies how to handle conflicting argument names
+ * - `debug` Enable debug mode. Argument errors throw exception in
+ * debug mode and process.exit in normal. Used for development and
+ * testing (default: false)
+ *
+ * See also [original guide][1]
+ *
+ * [1]:http://docs.python.org/dev/library/argparse.html#argumentparser-objects
+ **/
+function ArgumentParser(options) {
+ if (!(this instanceof ArgumentParser)) {
+ return new ArgumentParser(options);
+ }
+ var self = this;
+ options = options || {};
+
+ options.description = (options.description || null);
+ options.argumentDefault = (options.argumentDefault || null);
+ options.prefixChars = (options.prefixChars || '-');
+ options.conflictHandler = (options.conflictHandler || 'error');
+ ActionContainer.call(this, options);
+
+ options.addHelp = typeof options.addHelp === 'undefined' || !!options.addHelp;
+ options.parents = options.parents || [];
+ // default program name
+ options.prog = (options.prog || Path.basename(process.argv[1]));
+ this.prog = options.prog;
+ this.usage = options.usage;
+ this.epilog = options.epilog;
+ this.version = options.version;
+
+ this.debug = (options.debug === true);
+
+ this.formatterClass = (options.formatterClass || HelpFormatter);
+ this.fromfilePrefixChars = options.fromfilePrefixChars || null;
+ this._positionals = this.addArgumentGroup({ title: 'Positional arguments' });
+ this._optionals = this.addArgumentGroup({ title: 'Optional arguments' });
+ this._subparsers = null;
+
+ // register types
+ function FUNCTION_IDENTITY(o) {
+ return o;
+ }
+ this.register('type', 'auto', FUNCTION_IDENTITY);
+ this.register('type', null, FUNCTION_IDENTITY);
+ this.register('type', 'int', function (x) {
+ var result = parseInt(x, 10);
+ if (isNaN(result)) {
+ throw new Error(x + ' is not a valid integer.');
+ }
+ return result;
+ });
+ this.register('type', 'float', function (x) {
+ var result = parseFloat(x);
+ if (isNaN(result)) {
+ throw new Error(x + ' is not a valid float.');
+ }
+ return result;
+ });
+ this.register('type', 'string', function (x) {
+ return '' + x;
+ });
+
+ // add help and version arguments if necessary
+ var defaultPrefix = (this.prefixChars.indexOf('-') > -1) ? '-' : this.prefixChars[0];
+ if (options.addHelp) {
+ this.addArgument(
+ [ defaultPrefix + 'h', defaultPrefix + defaultPrefix + 'help' ],
+ {
+ action: 'help',
+ defaultValue: c.SUPPRESS,
+ help: 'Show this help message and exit.'
+ }
+ );
+ }
+ if (typeof this.version !== 'undefined') {
+ this.addArgument(
+ [ defaultPrefix + 'v', defaultPrefix + defaultPrefix + 'version' ],
+ {
+ action: 'version',
+ version: this.version,
+ defaultValue: c.SUPPRESS,
+ help: "Show program's version number and exit."
+ }
+ );
+ }
+
+ // add parent arguments and defaults
+ options.parents.forEach(function (parent) {
+ self._addContainerActions(parent);
+ if (typeof parent._defaults !== 'undefined') {
+ for (var defaultKey in parent._defaults) {
+ if (parent._defaults.hasOwnProperty(defaultKey)) {
+ self._defaults[defaultKey] = parent._defaults[defaultKey];
+ }
+ }
+ }
+ });
+}
+
+util.inherits(ArgumentParser, ActionContainer);
+
+/**
+ * ArgumentParser#addSubparsers(options) -> [[ActionSubparsers]]
+ * - options (object): hash of options see [[ActionSubparsers.new]]
+ *
+ * See also [subcommands][1]
+ *
+ * [1]:http://docs.python.org/dev/library/argparse.html#sub-commands
+ **/
+ArgumentParser.prototype.addSubparsers = function (options) {
+ if (this._subparsers) {
+ this.error('Cannot have multiple subparser arguments.');
+ }
+
+ options = options || {};
+ options.debug = (this.debug === true);
+ options.optionStrings = [];
+ options.parserClass = (options.parserClass || ArgumentParser);
+
+
+ if (!!options.title || !!options.description) {
+
+ this._subparsers = this.addArgumentGroup({
+ title: (options.title || 'subcommands'),
+ description: options.description
+ });
+ delete options.title;
+ delete options.description;
+
+ } else {
+ this._subparsers = this._positionals;
+ }
+
+ // prog defaults to the usage message of this parser, skipping
+ // optional arguments and with no "usage:" prefix
+ if (!options.prog) {
+ var formatter = this._getFormatter();
+ var positionals = this._getPositionalActions();
+ var groups = this._mutuallyExclusiveGroups;
+ formatter.addUsage(this.usage, positionals, groups, '');
+ options.prog = formatter.formatHelp().trim();
+ }
+
+ // create the parsers action and add it to the positionals list
+ var ParsersClass = this._popActionClass(options, 'parsers');
+ var action = new ParsersClass(options);
+ this._subparsers._addAction(action);
+
+ // return the created parsers action
+ return action;
+};
+
+ArgumentParser.prototype._addAction = function (action) {
+ if (action.isOptional()) {
+ this._optionals._addAction(action);
+ } else {
+ this._positionals._addAction(action);
+ }
+ return action;
+};
+
+ArgumentParser.prototype._getOptionalActions = function () {
+ return this._actions.filter(function (action) {
+ return action.isOptional();
+ });
+};
+
+ArgumentParser.prototype._getPositionalActions = function () {
+ return this._actions.filter(function (action) {
+ return action.isPositional();
+ });
+};
+
+
+/**
+ * ArgumentParser#parseArgs(args, namespace) -> Namespace|Object
+ * - args (array): input elements
+ * - namespace (Namespace|Object): result object
+ *
+ * Parsed args and throws error if some arguments are not recognized
+ *
+ * See also [original guide][1]
+ *
+ * [1]:http://docs.python.org/dev/library/argparse.html#the-parse-args-method
+ **/
+ArgumentParser.prototype.parseArgs = function (args, namespace) {
+ var argv;
+ var result = this.parseKnownArgs(args, namespace);
+
+ args = result[0];
+ argv = result[1];
+ if (argv && argv.length > 0) {
+ this.error(
+ format('Unrecognized arguments: %s.', argv.join(' '))
+ );
+ }
+ return args;
+};
+
+/**
+ * ArgumentParser#parseKnownArgs(args, namespace) -> array
+ * - args (array): input options
+ * - namespace (Namespace|Object): result object
+ *
+ * Parse known arguments and return tuple of result object
+ * and unknown args
+ *
+ * See also [original guide][1]
+ *
+ * [1]:http://docs.python.org/dev/library/argparse.html#partial-parsing
+ **/
+ArgumentParser.prototype.parseKnownArgs = function (args, namespace) {
+ var self = this;
+
+ // args default to the system args
+ args = args || process.argv.slice(2);
+
+ // default Namespace built from parser defaults
+ namespace = namespace || new Namespace();
+
+ self._actions.forEach(function (action) {
+ if (action.dest !== c.SUPPRESS) {
+ if (!$$.has(namespace, action.dest)) {
+ if (action.defaultValue !== c.SUPPRESS) {
+ var defaultValue = action.defaultValue;
+ if (typeof action.defaultValue === 'string') {
+ defaultValue = self._getValue(action, defaultValue);
+ }
+ namespace[action.dest] = defaultValue;
+ }
+ }
+ }
+ });
+
+ Object.keys(self._defaults).forEach(function (dest) {
+ namespace[dest] = self._defaults[dest];
+ });
+
+ // parse the arguments and exit if there are any errors
+ try {
+ var res = this._parseKnownArgs(args, namespace);
+
+ namespace = res[0];
+ args = res[1];
+ if ($$.has(namespace, c._UNRECOGNIZED_ARGS_ATTR)) {
+ args = $$.arrayUnion(args, namespace[c._UNRECOGNIZED_ARGS_ATTR]);
+ delete namespace[c._UNRECOGNIZED_ARGS_ATTR];
+ }
+ return [ namespace, args ];
+ } catch (e) {
+ this.error(e);
+ }
+};
+
+ArgumentParser.prototype._parseKnownArgs = function (argStrings, namespace) {
+ var self = this;
+
+ var extras = [];
+
+ // replace arg strings that are file references
+ if (this.fromfilePrefixChars !== null) {
+ argStrings = this._readArgsFromFiles(argStrings);
+ }
+ // map all mutually exclusive arguments to the other arguments
+ // they can't occur with
+ // Python has 'conflicts = action_conflicts.setdefault(mutex_action, [])'
+ // though I can't conceive of a way in which an action could be a member
+ // of two different mutually exclusive groups.
+
+ function actionHash(action) {
+ // some sort of hashable key for this action
+ // action itself cannot be a key in actionConflicts
+ // I think getName() (join of optionStrings) is unique enough
+ return action.getName();
+ }
+
+ var conflicts, key;
+ var actionConflicts = {};
+
+ this._mutuallyExclusiveGroups.forEach(function (mutexGroup) {
+ mutexGroup._groupActions.forEach(function (mutexAction, i, groupActions) {
+ key = actionHash(mutexAction);
+ if (!$$.has(actionConflicts, key)) {
+ actionConflicts[key] = [];
+ }
+ conflicts = actionConflicts[key];
+ conflicts.push.apply(conflicts, groupActions.slice(0, i));
+ conflicts.push.apply(conflicts, groupActions.slice(i + 1));
+ });
+ });
+
+ // find all option indices, and determine the arg_string_pattern
+ // which has an 'O' if there is an option at an index,
+ // an 'A' if there is an argument, or a '-' if there is a '--'
+ var optionStringIndices = {};
+
+ var argStringPatternParts = [];
+
+ argStrings.forEach(function (argString, argStringIndex) {
+ if (argString === '--') {
+ argStringPatternParts.push('-');
+ while (argStringIndex < argStrings.length) {
+ argStringPatternParts.push('A');
+ argStringIndex++;
+ }
+ } else {
+ // otherwise, add the arg to the arg strings
+ // and note the index if it was an option
+ var pattern;
+ var optionTuple = self._parseOptional(argString);
+ if (!optionTuple) {
+ pattern = 'A';
+ } else {
+ optionStringIndices[argStringIndex] = optionTuple;
+ pattern = 'O';
+ }
+ argStringPatternParts.push(pattern);
+ }
+ });
+ var argStringsPattern = argStringPatternParts.join('');
+
+ var seenActions = [];
+ var seenNonDefaultActions = [];
+
+
+ function takeAction(action, argumentStrings, optionString) {
+ seenActions.push(action);
+ var argumentValues = self._getValues(action, argumentStrings);
+
+ // error if this argument is not allowed with other previously
+ // seen arguments, assuming that actions that use the default
+ // value don't really count as "present"
+ if (argumentValues !== action.defaultValue) {
+ seenNonDefaultActions.push(action);
+ if (actionConflicts[actionHash(action)]) {
+ actionConflicts[actionHash(action)].forEach(function (actionConflict) {
+ if (seenNonDefaultActions.indexOf(actionConflict) >= 0) {
+ throw argumentErrorHelper(
+ action,
+ format('Not allowed with argument "%s".', actionConflict.getName())
+ );
+ }
+ });
+ }
+ }
+
+ if (argumentValues !== c.SUPPRESS) {
+ action.call(self, namespace, argumentValues, optionString);
+ }
+ }
+
+ function consumeOptional(startIndex) {
+ // get the optional identified at this index
+ var optionTuple = optionStringIndices[startIndex];
+ var action = optionTuple[0];
+ var optionString = optionTuple[1];
+ var explicitArg = optionTuple[2];
+
+ // identify additional optionals in the same arg string
+ // (e.g. -xyz is the same as -x -y -z if no args are required)
+ var actionTuples = [];
+
+ var args, argCount, start, stop;
+
+ for (;;) {
+ if (!action) {
+ extras.push(argStrings[startIndex]);
+ return startIndex + 1;
+ }
+ if (explicitArg) {
+ argCount = self._matchArgument(action, 'A');
+
+ // if the action is a single-dash option and takes no
+ // arguments, try to parse more single-dash options out
+ // of the tail of the option string
+ var chars = self.prefixChars;
+ if (argCount === 0 && chars.indexOf(optionString[1]) < 0) {
+ actionTuples.push([ action, [], optionString ]);
+ optionString = optionString[0] + explicitArg[0];
+ var newExplicitArg = explicitArg.slice(1) || null;
+ var optionalsMap = self._optionStringActions;
+
+ if (Object.keys(optionalsMap).indexOf(optionString) >= 0) {
+ action = optionalsMap[optionString];
+ explicitArg = newExplicitArg;
+ } else {
+ throw argumentErrorHelper(action, sprintf('ignored explicit argument %r', explicitArg));
+ }
+ } else if (argCount === 1) {
+ // if the action expect exactly one argument, we've
+ // successfully matched the option; exit the loop
+ stop = startIndex + 1;
+ args = [ explicitArg ];
+ actionTuples.push([ action, args, optionString ]);
+ break;
+ } else {
+ // error if a double-dash option did not use the
+ // explicit argument
+ throw argumentErrorHelper(action, sprintf('ignored explicit argument %r', explicitArg));
+ }
+ } else {
+ // if there is no explicit argument, try to match the
+ // optional's string arguments with the following strings
+ // if successful, exit the loop
+
+ start = startIndex + 1;
+ var selectedPatterns = argStringsPattern.substr(start);
+
+ argCount = self._matchArgument(action, selectedPatterns);
+ stop = start + argCount;
+
+
+ args = argStrings.slice(start, stop);
+
+ actionTuples.push([ action, args, optionString ]);
+ break;
+ }
+
+ }
+
+ // add the Optional to the list and return the index at which
+ // the Optional's string args stopped
+ if (actionTuples.length < 1) {
+ throw new Error('length should be > 0');
+ }
+ for (var i = 0; i < actionTuples.length; i++) {
+ takeAction.apply(self, actionTuples[i]);
+ }
+ return stop;
+ }
+
+ // the list of Positionals left to be parsed; this is modified
+ // by consume_positionals()
+ var positionals = self._getPositionalActions();
+
+ function consumePositionals(startIndex) {
+ // match as many Positionals as possible
+ var selectedPattern = argStringsPattern.substr(startIndex);
+ var argCounts = self._matchArgumentsPartial(positionals, selectedPattern);
+
+ // slice off the appropriate arg strings for each Positional
+ // and add the Positional and its args to the list
+ for (var i = 0; i < positionals.length; i++) {
+ var action = positionals[i];
+ var argCount = argCounts[i];
+ if (typeof argCount === 'undefined') {
+ continue;
+ }
+ var args = argStrings.slice(startIndex, startIndex + argCount);
+
+ startIndex += argCount;
+ takeAction(action, args);
+ }
+
+ // slice off the Positionals that we just parsed and return the
+ // index at which the Positionals' string args stopped
+ positionals = positionals.slice(argCounts.length);
+ return startIndex;
+ }
+
+ // consume Positionals and Optionals alternately, until we have
+ // passed the last option string
+ var startIndex = 0;
+ var position;
+
+ var maxOptionStringIndex = -1;
+
+ Object.keys(optionStringIndices).forEach(function (position) {
+ maxOptionStringIndex = Math.max(maxOptionStringIndex, parseInt(position, 10));
+ });
+
+ var positionalsEndIndex, nextOptionStringIndex;
+
+ while (startIndex <= maxOptionStringIndex) {
+ // consume any Positionals preceding the next option
+ nextOptionStringIndex = null;
+ for (position in optionStringIndices) {
+ if (!optionStringIndices.hasOwnProperty(position)) { continue; }
+
+ position = parseInt(position, 10);
+ if (position >= startIndex) {
+ if (nextOptionStringIndex !== null) {
+ nextOptionStringIndex = Math.min(nextOptionStringIndex, position);
+ } else {
+ nextOptionStringIndex = position;
+ }
+ }
+ }
+
+ if (startIndex !== nextOptionStringIndex) {
+ positionalsEndIndex = consumePositionals(startIndex);
+ // only try to parse the next optional if we didn't consume
+ // the option string during the positionals parsing
+ if (positionalsEndIndex > startIndex) {
+ startIndex = positionalsEndIndex;
+ continue;
+ } else {
+ startIndex = positionalsEndIndex;
+ }
+ }
+
+ // if we consumed all the positionals we could and we're not
+ // at the index of an option string, there were extra arguments
+ if (!optionStringIndices[startIndex]) {
+ var strings = argStrings.slice(startIndex, nextOptionStringIndex);
+ extras = extras.concat(strings);
+ startIndex = nextOptionStringIndex;
+ }
+ // consume the next optional and any arguments for it
+ startIndex = consumeOptional(startIndex);
+ }
+
+ // consume any positionals following the last Optional
+ var stopIndex = consumePositionals(startIndex);
+
+ // if we didn't consume all the argument strings, there were extras
+ extras = extras.concat(argStrings.slice(stopIndex));
+
+ // if we didn't use all the Positional objects, there were too few
+ // arg strings supplied.
+ if (positionals.length > 0) {
+ self.error('too few arguments');
+ }
+
+ // make sure all required actions were present
+ self._actions.forEach(function (action) {
+ if (action.required) {
+ if (seenActions.indexOf(action) < 0) {
+ self.error(format('Argument "%s" is required', action.getName()));
+ }
+ }
+ });
+
+ // make sure all required groups have one option present
+ var actionUsed = false;
+ self._mutuallyExclusiveGroups.forEach(function (group) {
+ if (group.required) {
+ actionUsed = group._groupActions.some(function (action) {
+ return seenNonDefaultActions.indexOf(action) !== -1;
+ });
+
+ // if no actions were used, report the error
+ if (!actionUsed) {
+ var names = [];
+ group._groupActions.forEach(function (action) {
+ if (action.help !== c.SUPPRESS) {
+ names.push(action.getName());
+ }
+ });
+ names = names.join(' ');
+ var msg = 'one of the arguments ' + names + ' is required';
+ self.error(msg);
+ }
+ }
+ });
+
+ // return the updated namespace and the extra arguments
+ return [ namespace, extras ];
+};
+
+ArgumentParser.prototype._readArgsFromFiles = function (argStrings) {
+ // expand arguments referencing files
+ var self = this;
+ var fs = require('fs');
+ var newArgStrings = [];
+ argStrings.forEach(function (argString) {
+ if (self.fromfilePrefixChars.indexOf(argString[0]) < 0) {
+ // for regular arguments, just add them back into the list
+ newArgStrings.push(argString);
+ } else {
+ // replace arguments referencing files with the file content
+ try {
+ var argstrs = [];
+ var filename = argString.slice(1);
+ var content = fs.readFileSync(filename, 'utf8');
+ content = content.trim().split('\n');
+ content.forEach(function (argLine) {
+ self.convertArgLineToArgs(argLine).forEach(function (arg) {
+ argstrs.push(arg);
+ });
+ argstrs = self._readArgsFromFiles(argstrs);
+ });
+ newArgStrings.push.apply(newArgStrings, argstrs);
+ } catch (error) {
+ return self.error(error.message);
+ }
+ }
+ });
+ return newArgStrings;
+};
+
+ArgumentParser.prototype.convertArgLineToArgs = function (argLine) {
+ return [ argLine ];
+};
+
+ArgumentParser.prototype._matchArgument = function (action, regexpArgStrings) {
+
+ // match the pattern for this action to the arg strings
+ var regexpNargs = new RegExp('^' + this._getNargsPattern(action));
+ var matches = regexpArgStrings.match(regexpNargs);
+ var message;
+
+ // throw an exception if we weren't able to find a match
+ if (!matches) {
+ switch (action.nargs) {
+ /*eslint-disable no-undefined*/
+ case undefined:
+ case null:
+ message = 'Expected one argument.';
+ break;
+ case c.OPTIONAL:
+ message = 'Expected at most one argument.';
+ break;
+ case c.ONE_OR_MORE:
+ message = 'Expected at least one argument.';
+ break;
+ default:
+ message = 'Expected %s argument(s)';
+ }
+
+ throw argumentErrorHelper(
+ action,
+ format(message, action.nargs)
+ );
+ }
+ // return the number of arguments matched
+ return matches[1].length;
+};
+
+ArgumentParser.prototype._matchArgumentsPartial = function (actions, regexpArgStrings) {
+ // progressively shorten the actions list by slicing off the
+ // final actions until we find a match
+ var self = this;
+ var result = [];
+ var actionSlice, pattern, matches;
+ var i, j;
+
+ function getLength(string) {
+ return string.length;
+ }
+
+ for (i = actions.length; i > 0; i--) {
+ pattern = '';
+ actionSlice = actions.slice(0, i);
+ for (j = 0; j < actionSlice.length; j++) {
+ pattern += self._getNargsPattern(actionSlice[j]);
+ }
+
+ pattern = new RegExp('^' + pattern);
+ matches = regexpArgStrings.match(pattern);
+
+ if (matches && matches.length > 0) {
+ // need only groups
+ matches = matches.splice(1);
+ result = result.concat(matches.map(getLength));
+ break;
+ }
+ }
+
+ // return the list of arg string counts
+ return result;
+};
+
+ArgumentParser.prototype._parseOptional = function (argString) {
+ var action, optionString, argExplicit, optionTuples;
+
+ // if it's an empty string, it was meant to be a positional
+ if (!argString) {
+ return null;
+ }
+
+ // if it doesn't start with a prefix, it was meant to be positional
+ if (this.prefixChars.indexOf(argString[0]) < 0) {
+ return null;
+ }
+
+ // if the option string is present in the parser, return the action
+ if (this._optionStringActions[argString]) {
+ return [ this._optionStringActions[argString], argString, null ];
+ }
+
+ // if it's just a single character, it was meant to be positional
+ if (argString.length === 1) {
+ return null;
+ }
+
+ // if the option string before the "=" is present, return the action
+ if (argString.indexOf('=') >= 0) {
+ optionString = argString.split('=', 1)[0];
+ argExplicit = argString.slice(optionString.length + 1);
+
+ if (this._optionStringActions[optionString]) {
+ action = this._optionStringActions[optionString];
+ return [ action, optionString, argExplicit ];
+ }
+ }
+
+ // search through all possible prefixes of the option string
+ // and all actions in the parser for possible interpretations
+ optionTuples = this._getOptionTuples(argString);
+
+ // if multiple actions match, the option string was ambiguous
+ if (optionTuples.length > 1) {
+ var optionStrings = optionTuples.map(function (optionTuple) {
+ return optionTuple[1];
+ });
+ this.error(format(
+ 'Ambiguous option: "%s" could match %s.',
+ argString, optionStrings.join(', ')
+ ));
+ // if exactly one action matched, this segmentation is good,
+ // so return the parsed action
+ } else if (optionTuples.length === 1) {
+ return optionTuples[0];
+ }
+
+ // if it was not found as an option, but it looks like a negative
+ // number, it was meant to be positional
+ // unless there are negative-number-like options
+ if (argString.match(this._regexpNegativeNumber)) {
+ if (!this._hasNegativeNumberOptionals.some(Boolean)) {
+ return null;
+ }
+ }
+ // if it contains a space, it was meant to be a positional
+ if (argString.search(' ') >= 0) {
+ return null;
+ }
+
+ // it was meant to be an optional but there is no such option
+ // in this parser (though it might be a valid option in a subparser)
+ return [ null, argString, null ];
+};
+
+ArgumentParser.prototype._getOptionTuples = function (optionString) {
+ var result = [];
+ var chars = this.prefixChars;
+ var optionPrefix;
+ var argExplicit;
+ var action;
+ var actionOptionString;
+
+ // option strings starting with two prefix characters are only split at
+ // the '='
+ if (chars.indexOf(optionString[0]) >= 0 && chars.indexOf(optionString[1]) >= 0) {
+ if (optionString.indexOf('=') >= 0) {
+ var optionStringSplit = optionString.split('=', 1);
+
+ optionPrefix = optionStringSplit[0];
+ argExplicit = optionStringSplit[1];
+ } else {
+ optionPrefix = optionString;
+ argExplicit = null;
+ }
+
+ for (actionOptionString in this._optionStringActions) {
+ if (actionOptionString.substr(0, optionPrefix.length) === optionPrefix) {
+ action = this._optionStringActions[actionOptionString];
+ result.push([ action, actionOptionString, argExplicit ]);
+ }
+ }
+
+ // single character options can be concatenated with their arguments
+ // but multiple character options always have to have their argument
+ // separate
+ } else if (chars.indexOf(optionString[0]) >= 0 && chars.indexOf(optionString[1]) < 0) {
+ optionPrefix = optionString;
+ argExplicit = null;
+ var optionPrefixShort = optionString.substr(0, 2);
+ var argExplicitShort = optionString.substr(2);
+
+ for (actionOptionString in this._optionStringActions) {
+ if (!$$.has(this._optionStringActions, actionOptionString)) continue;
+
+ action = this._optionStringActions[actionOptionString];
+ if (actionOptionString === optionPrefixShort) {
+ result.push([ action, actionOptionString, argExplicitShort ]);
+ } else if (actionOptionString.substr(0, optionPrefix.length) === optionPrefix) {
+ result.push([ action, actionOptionString, argExplicit ]);
+ }
+ }
+
+ // shouldn't ever get here
+ } else {
+ throw new Error(format('Unexpected option string: %s.', optionString));
+ }
+ // return the collected option tuples
+ return result;
+};
+
+ArgumentParser.prototype._getNargsPattern = function (action) {
+ // in all examples below, we have to allow for '--' args
+ // which are represented as '-' in the pattern
+ var regexpNargs;
+
+ switch (action.nargs) {
+ // the default (null) is assumed to be a single argument
+ case undefined:
+ case null:
+ regexpNargs = '(-*A-*)';
+ break;
+ // allow zero or more arguments
+ case c.OPTIONAL:
+ regexpNargs = '(-*A?-*)';
+ break;
+ // allow zero or more arguments
+ case c.ZERO_OR_MORE:
+ regexpNargs = '(-*[A-]*)';
+ break;
+ // allow one or more arguments
+ case c.ONE_OR_MORE:
+ regexpNargs = '(-*A[A-]*)';
+ break;
+ // allow any number of options or arguments
+ case c.REMAINDER:
+ regexpNargs = '([-AO]*)';
+ break;
+ // allow one argument followed by any number of options or arguments
+ case c.PARSER:
+ regexpNargs = '(-*A[-AO]*)';
+ break;
+ // all others should be integers
+ default:
+ regexpNargs = '(-*' + $$.repeat('-*A', action.nargs) + '-*)';
+ }
+
+ // if this is an optional action, -- is not allowed
+ if (action.isOptional()) {
+ regexpNargs = regexpNargs.replace(/-\*/g, '');
+ regexpNargs = regexpNargs.replace(/-/g, '');
+ }
+
+ // return the pattern
+ return regexpNargs;
+};
+
+//
+// Value conversion methods
+//
+
+ArgumentParser.prototype._getValues = function (action, argStrings) {
+ var self = this;
+
+ // for everything but PARSER args, strip out '--'
+ if (action.nargs !== c.PARSER && action.nargs !== c.REMAINDER) {
+ argStrings = argStrings.filter(function (arrayElement) {
+ return arrayElement !== '--';
+ });
+ }
+
+ var value, argString;
+
+ // optional argument produces a default when not present
+ if (argStrings.length === 0 && action.nargs === c.OPTIONAL) {
+
+ value = (action.isOptional()) ? action.constant : action.defaultValue;
+
+ if (typeof (value) === 'string') {
+ value = this._getValue(action, value);
+ this._checkValue(action, value);
+ }
+
+ // when nargs='*' on a positional, if there were no command-line
+ // args, use the default if it is anything other than None
+ } else if (argStrings.length === 0 && action.nargs === c.ZERO_OR_MORE &&
+ action.optionStrings.length === 0) {
+
+ value = (action.defaultValue || argStrings);
+ this._checkValue(action, value);
+
+ // single argument or optional argument produces a single value
+ } else if (argStrings.length === 1 &&
+ (!action.nargs || action.nargs === c.OPTIONAL)) {
+
+ argString = argStrings[0];
+ value = this._getValue(action, argString);
+ this._checkValue(action, value);
+
+ // REMAINDER arguments convert all values, checking none
+ } else if (action.nargs === c.REMAINDER) {
+ value = argStrings.map(function (v) {
+ return self._getValue(action, v);
+ });
+
+ // PARSER arguments convert all values, but check only the first
+ } else if (action.nargs === c.PARSER) {
+ value = argStrings.map(function (v) {
+ return self._getValue(action, v);
+ });
+ this._checkValue(action, value[0]);
+
+ // all other types of nargs produce a list
+ } else {
+ value = argStrings.map(function (v) {
+ return self._getValue(action, v);
+ });
+ value.forEach(function (v) {
+ self._checkValue(action, v);
+ });
+ }
+
+ // return the converted value
+ return value;
+};
+
+ArgumentParser.prototype._getValue = function (action, argString) {
+ var result;
+
+ var typeFunction = this._registryGet('type', action.type, action.type);
+ if (typeof typeFunction !== 'function') {
+ var message = format('%s is not callable', typeFunction);
+ throw argumentErrorHelper(action, message);
+ }
+
+ // convert the value to the appropriate type
+ try {
+ result = typeFunction(argString);
+
+ // ArgumentTypeErrors indicate errors
+ // If action.type is not a registered string, it is a function
+ // Try to deduce its name for inclusion in the error message
+ // Failing that, include the error message it raised.
+ } catch (e) {
+ var name = null;
+ if (typeof action.type === 'string') {
+ name = action.type;
+ } else {
+ name = action.type.name || action.type.displayName || '';
+ }
+ var msg = format('Invalid %s value: %s', name, argString);
+ if (name === '') { msg += '\n' + e.message; }
+ throw argumentErrorHelper(action, msg);
+ }
+ // return the converted value
+ return result;
+};
+
+ArgumentParser.prototype._checkValue = function (action, value) {
+ // converted value must be one of the choices (if specified)
+ var choices = action.choices;
+ if (choices) {
+ // choise for argument can by array or string
+ if ((typeof choices === 'string' || Array.isArray(choices)) &&
+ choices.indexOf(value) !== -1) {
+ return;
+ }
+ // choise for subparsers can by only hash
+ if (typeof choices === 'object' && !Array.isArray(choices) && choices[value]) {
+ return;
+ }
+
+ if (typeof choices === 'string') {
+ choices = choices.split('').join(', ');
+ } else if (Array.isArray(choices)) {
+ choices = choices.join(', ');
+ } else {
+ choices = Object.keys(choices).join(', ');
+ }
+ var message = format('Invalid choice: %s (choose from [%s])', value, choices);
+ throw argumentErrorHelper(action, message);
+ }
+};
+
+//
+// Help formatting methods
+//
+
+/**
+ * ArgumentParser#formatUsage -> string
+ *
+ * Return usage string
+ *
+ * See also [original guide][1]
+ *
+ * [1]:http://docs.python.org/dev/library/argparse.html#printing-help
+ **/
+ArgumentParser.prototype.formatUsage = function () {
+ var formatter = this._getFormatter();
+ formatter.addUsage(this.usage, this._actions, this._mutuallyExclusiveGroups);
+ return formatter.formatHelp();
+};
+
+/**
+ * ArgumentParser#formatHelp -> string
+ *
+ * Return help
+ *
+ * See also [original guide][1]
+ *
+ * [1]:http://docs.python.org/dev/library/argparse.html#printing-help
+ **/
+ArgumentParser.prototype.formatHelp = function () {
+ var formatter = this._getFormatter();
+
+ // usage
+ formatter.addUsage(this.usage, this._actions, this._mutuallyExclusiveGroups);
+
+ // description
+ formatter.addText(this.description);
+
+ // positionals, optionals and user-defined groups
+ this._actionGroups.forEach(function (actionGroup) {
+ formatter.startSection(actionGroup.title);
+ formatter.addText(actionGroup.description);
+ formatter.addArguments(actionGroup._groupActions);
+ formatter.endSection();
+ });
+
+ // epilog
+ formatter.addText(this.epilog);
+
+ // determine help from format above
+ return formatter.formatHelp();
+};
+
+ArgumentParser.prototype._getFormatter = function () {
+ var FormatterClass = this.formatterClass;
+ var formatter = new FormatterClass({ prog: this.prog });
+ return formatter;
+};
+
+//
+// Print functions
+//
+
+/**
+ * ArgumentParser#printUsage() -> Void
+ *
+ * Print usage
+ *
+ * See also [original guide][1]
+ *
+ * [1]:http://docs.python.org/dev/library/argparse.html#printing-help
+ **/
+ArgumentParser.prototype.printUsage = function () {
+ this._printMessage(this.formatUsage());
+};
+
+/**
+ * ArgumentParser#printHelp() -> Void
+ *
+ * Print help
+ *
+ * See also [original guide][1]
+ *
+ * [1]:http://docs.python.org/dev/library/argparse.html#printing-help
+ **/
+ArgumentParser.prototype.printHelp = function () {
+ this._printMessage(this.formatHelp());
+};
+
+ArgumentParser.prototype._printMessage = function (message, stream) {
+ if (!stream) {
+ stream = process.stdout;
+ }
+ if (message) {
+ stream.write('' + message);
+ }
+};
+
+//
+// Exit functions
+//
+
+/**
+ * ArgumentParser#exit(status=0, message) -> Void
+ * - status (int): exit status
+ * - message (string): message
+ *
+ * Print message in stderr/stdout and exit program
+ **/
+ArgumentParser.prototype.exit = function (status, message) {
+ if (message) {
+ if (status === 0) {
+ this._printMessage(message);
+ } else {
+ this._printMessage(message, process.stderr);
+ }
+ }
+
+ process.exit(status);
+};
+
+/**
+ * ArgumentParser#error(message) -> Void
+ * - err (Error|string): message
+ *
+ * Error method Prints a usage message incorporating the message to stderr and
+ * exits. If you override this in a subclass,
+ * it should not return -- it should
+ * either exit or throw an exception.
+ *
+ **/
+ArgumentParser.prototype.error = function (err) {
+ var message;
+ if (err instanceof Error) {
+ if (this.debug === true) {
+ throw err;
+ }
+ message = err.message;
+ } else {
+ message = err;
+ }
+ var msg = format('%s: error: %s', this.prog, message) + c.EOL;
+
+ if (this.debug === true) {
+ throw new Error(msg);
+ }
+
+ this.printUsage(process.stderr);
+
+ return this.exit(2, msg);
+};
+
+module.exports = ArgumentParser;
diff --git a/website_quotation_template/node_modules/argparse/lib/const.js b/website_quotation_template/node_modules/argparse/lib/const.js
new file mode 100644
index 000000000..b1fd4ced4
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/const.js
@@ -0,0 +1,21 @@
+//
+// Constants
+//
+
+'use strict';
+
+module.exports.EOL = '\n';
+
+module.exports.SUPPRESS = '==SUPPRESS==';
+
+module.exports.OPTIONAL = '?';
+
+module.exports.ZERO_OR_MORE = '*';
+
+module.exports.ONE_OR_MORE = '+';
+
+module.exports.PARSER = 'A...';
+
+module.exports.REMAINDER = '...';
+
+module.exports._UNRECOGNIZED_ARGS_ATTR = '_unrecognized_args';
diff --git a/website_quotation_template/node_modules/argparse/lib/help/added_formatters.js b/website_quotation_template/node_modules/argparse/lib/help/added_formatters.js
new file mode 100644
index 000000000..f8e42998e
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/help/added_formatters.js
@@ -0,0 +1,87 @@
+'use strict';
+
+var util = require('util');
+
+// Constants
+var c = require('../const');
+
+var $$ = require('../utils');
+var HelpFormatter = require('./formatter.js');
+
+/**
+ * new RawDescriptionHelpFormatter(options)
+ * new ArgumentParser({formatterClass: argparse.RawDescriptionHelpFormatter, ...})
+ *
+ * Help message formatter which adds default values to argument help.
+ *
+ * Only the name of this class is considered a public API. All the methods
+ * provided by the class are considered an implementation detail.
+ **/
+
+function ArgumentDefaultsHelpFormatter(options) {
+ HelpFormatter.call(this, options);
+}
+
+util.inherits(ArgumentDefaultsHelpFormatter, HelpFormatter);
+
+ArgumentDefaultsHelpFormatter.prototype._getHelpString = function (action) {
+ var help = action.help;
+ if (action.help.indexOf('%(defaultValue)s') === -1) {
+ if (action.defaultValue !== c.SUPPRESS) {
+ var defaulting_nargs = [ c.OPTIONAL, c.ZERO_OR_MORE ];
+ if (action.isOptional() || (defaulting_nargs.indexOf(action.nargs) >= 0)) {
+ help += ' (default: %(defaultValue)s)';
+ }
+ }
+ }
+ return help;
+};
+
+module.exports.ArgumentDefaultsHelpFormatter = ArgumentDefaultsHelpFormatter;
+
+/**
+ * new RawDescriptionHelpFormatter(options)
+ * new ArgumentParser({formatterClass: argparse.RawDescriptionHelpFormatter, ...})
+ *
+ * Help message formatter which retains any formatting in descriptions.
+ *
+ * Only the name of this class is considered a public API. All the methods
+ * provided by the class are considered an implementation detail.
+ **/
+
+function RawDescriptionHelpFormatter(options) {
+ HelpFormatter.call(this, options);
+}
+
+util.inherits(RawDescriptionHelpFormatter, HelpFormatter);
+
+RawDescriptionHelpFormatter.prototype._fillText = function (text, width, indent) {
+ var lines = text.split('\n');
+ lines = lines.map(function (line) {
+ return $$.trimEnd(indent + line);
+ });
+ return lines.join('\n');
+};
+module.exports.RawDescriptionHelpFormatter = RawDescriptionHelpFormatter;
+
+/**
+ * new RawTextHelpFormatter(options)
+ * new ArgumentParser({formatterClass: argparse.RawTextHelpFormatter, ...})
+ *
+ * Help message formatter which retains formatting of all help text.
+ *
+ * Only the name of this class is considered a public API. All the methods
+ * provided by the class are considered an implementation detail.
+ **/
+
+function RawTextHelpFormatter(options) {
+ RawDescriptionHelpFormatter.call(this, options);
+}
+
+util.inherits(RawTextHelpFormatter, RawDescriptionHelpFormatter);
+
+RawTextHelpFormatter.prototype._splitLines = function (text) {
+ return text.split('\n');
+};
+
+module.exports.RawTextHelpFormatter = RawTextHelpFormatter;
diff --git a/website_quotation_template/node_modules/argparse/lib/help/formatter.js b/website_quotation_template/node_modules/argparse/lib/help/formatter.js
new file mode 100644
index 000000000..29036c14b
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/help/formatter.js
@@ -0,0 +1,795 @@
+/**
+ * class HelpFormatter
+ *
+ * Formatter for generating usage messages and argument help strings. Only the
+ * name of this class is considered a public API. All the methods provided by
+ * the class are considered an implementation detail.
+ *
+ * Do not call in your code, use this class only for inherits your own forvatter
+ *
+ * ToDo add [additonal formatters][1]
+ *
+ * [1]:http://docs.python.org/dev/library/argparse.html#formatter-class
+ **/
+'use strict';
+
+var sprintf = require('sprintf-js').sprintf;
+
+// Constants
+var c = require('../const');
+
+var $$ = require('../utils');
+
+
+/*:nodoc:* internal
+ * new Support(parent, heding)
+ * - parent (object): parent section
+ * - heading (string): header string
+ *
+ **/
+function Section(parent, heading) {
+ this._parent = parent;
+ this._heading = heading;
+ this._items = [];
+}
+
+/*:nodoc:* internal
+ * Section#addItem(callback) -> Void
+ * - callback (array): tuple with function and args
+ *
+ * Add function for single element
+ **/
+Section.prototype.addItem = function (callback) {
+ this._items.push(callback);
+};
+
+/*:nodoc:* internal
+ * Section#formatHelp(formatter) -> string
+ * - formatter (HelpFormatter): current formatter
+ *
+ * Form help section string
+ *
+ **/
+Section.prototype.formatHelp = function (formatter) {
+ var itemHelp, heading;
+
+ // format the indented section
+ if (this._parent) {
+ formatter._indent();
+ }
+
+ itemHelp = this._items.map(function (item) {
+ var obj, func, args;
+
+ obj = formatter;
+ func = item[0];
+ args = item[1];
+ return func.apply(obj, args);
+ });
+ itemHelp = formatter._joinParts(itemHelp);
+
+ if (this._parent) {
+ formatter._dedent();
+ }
+
+ // return nothing if the section was empty
+ if (!itemHelp) {
+ return '';
+ }
+
+ // add the heading if the section was non-empty
+ heading = '';
+ if (this._heading && this._heading !== c.SUPPRESS) {
+ var currentIndent = formatter.currentIndent;
+ heading = $$.repeat(' ', currentIndent) + this._heading + ':' + c.EOL;
+ }
+
+ // join the section-initialize newline, the heading and the help
+ return formatter._joinParts([ c.EOL, heading, itemHelp, c.EOL ]);
+};
+
+/**
+ * new HelpFormatter(options)
+ *
+ * #### Options:
+ * - `prog`: program name
+ * - `indentIncriment`: indent step, default value 2
+ * - `maxHelpPosition`: max help position, default value = 24
+ * - `width`: line width
+ *
+ **/
+var HelpFormatter = module.exports = function HelpFormatter(options) {
+ options = options || {};
+
+ this._prog = options.prog;
+
+ this._maxHelpPosition = options.maxHelpPosition || 24;
+ this._width = (options.width || ((process.env.COLUMNS || 80) - 2));
+
+ this._currentIndent = 0;
+ this._indentIncriment = options.indentIncriment || 2;
+ this._level = 0;
+ this._actionMaxLength = 0;
+
+ this._rootSection = new Section(null);
+ this._currentSection = this._rootSection;
+
+ this._whitespaceMatcher = new RegExp('\\s+', 'g');
+ this._longBreakMatcher = new RegExp(c.EOL + c.EOL + c.EOL + '+', 'g');
+};
+
+HelpFormatter.prototype._indent = function () {
+ this._currentIndent += this._indentIncriment;
+ this._level += 1;
+};
+
+HelpFormatter.prototype._dedent = function () {
+ this._currentIndent -= this._indentIncriment;
+ this._level -= 1;
+ if (this._currentIndent < 0) {
+ throw new Error('Indent decreased below 0.');
+ }
+};
+
+HelpFormatter.prototype._addItem = function (func, args) {
+ this._currentSection.addItem([ func, args ]);
+};
+
+//
+// Message building methods
+//
+
+/**
+ * HelpFormatter#startSection(heading) -> Void
+ * - heading (string): header string
+ *
+ * Start new help section
+ *
+ * See alse [code example][1]
+ *
+ * ##### Example
+ *
+ * formatter.startSection(actionGroup.title);
+ * formatter.addText(actionGroup.description);
+ * formatter.addArguments(actionGroup._groupActions);
+ * formatter.endSection();
+ *
+ **/
+HelpFormatter.prototype.startSection = function (heading) {
+ this._indent();
+ var section = new Section(this._currentSection, heading);
+ var func = section.formatHelp.bind(section);
+ this._addItem(func, [ this ]);
+ this._currentSection = section;
+};
+
+/**
+ * HelpFormatter#endSection -> Void
+ *
+ * End help section
+ *
+ * ##### Example
+ *
+ * formatter.startSection(actionGroup.title);
+ * formatter.addText(actionGroup.description);
+ * formatter.addArguments(actionGroup._groupActions);
+ * formatter.endSection();
+ **/
+HelpFormatter.prototype.endSection = function () {
+ this._currentSection = this._currentSection._parent;
+ this._dedent();
+};
+
+/**
+ * HelpFormatter#addText(text) -> Void
+ * - text (string): plain text
+ *
+ * Add plain text into current section
+ *
+ * ##### Example
+ *
+ * formatter.startSection(actionGroup.title);
+ * formatter.addText(actionGroup.description);
+ * formatter.addArguments(actionGroup._groupActions);
+ * formatter.endSection();
+ *
+ **/
+HelpFormatter.prototype.addText = function (text) {
+ if (text && text !== c.SUPPRESS) {
+ this._addItem(this._formatText, [ text ]);
+ }
+};
+
+/**
+ * HelpFormatter#addUsage(usage, actions, groups, prefix) -> Void
+ * - usage (string): usage text
+ * - actions (array): actions list
+ * - groups (array): groups list
+ * - prefix (string): usage prefix
+ *
+ * Add usage data into current section
+ *
+ * ##### Example
+ *
+ * formatter.addUsage(this.usage, this._actions, []);
+ * return formatter.formatHelp();
+ *
+ **/
+HelpFormatter.prototype.addUsage = function (usage, actions, groups, prefix) {
+ if (usage !== c.SUPPRESS) {
+ this._addItem(this._formatUsage, [ usage, actions, groups, prefix ]);
+ }
+};
+
+/**
+ * HelpFormatter#addArgument(action) -> Void
+ * - action (object): action
+ *
+ * Add argument into current section
+ *
+ * Single variant of [[HelpFormatter#addArguments]]
+ **/
+HelpFormatter.prototype.addArgument = function (action) {
+ if (action.help !== c.SUPPRESS) {
+ var self = this;
+
+ // find all invocations
+ var invocations = [ this._formatActionInvocation(action) ];
+ var invocationLength = invocations[0].length;
+
+ var actionLength;
+
+ if (action._getSubactions) {
+ this._indent();
+ action._getSubactions().forEach(function (subaction) {
+
+ var invocationNew = self._formatActionInvocation(subaction);
+ invocations.push(invocationNew);
+ invocationLength = Math.max(invocationLength, invocationNew.length);
+
+ });
+ this._dedent();
+ }
+
+ // update the maximum item length
+ actionLength = invocationLength + this._currentIndent;
+ this._actionMaxLength = Math.max(this._actionMaxLength, actionLength);
+
+ // add the item to the list
+ this._addItem(this._formatAction, [ action ]);
+ }
+};
+
+/**
+ * HelpFormatter#addArguments(actions) -> Void
+ * - actions (array): actions list
+ *
+ * Mass add arguments into current section
+ *
+ * ##### Example
+ *
+ * formatter.startSection(actionGroup.title);
+ * formatter.addText(actionGroup.description);
+ * formatter.addArguments(actionGroup._groupActions);
+ * formatter.endSection();
+ *
+ **/
+HelpFormatter.prototype.addArguments = function (actions) {
+ var self = this;
+ actions.forEach(function (action) {
+ self.addArgument(action);
+ });
+};
+
+//
+// Help-formatting methods
+//
+
+/**
+ * HelpFormatter#formatHelp -> string
+ *
+ * Format help
+ *
+ * ##### Example
+ *
+ * formatter.addText(this.epilog);
+ * return formatter.formatHelp();
+ *
+ **/
+HelpFormatter.prototype.formatHelp = function () {
+ var help = this._rootSection.formatHelp(this);
+ if (help) {
+ help = help.replace(this._longBreakMatcher, c.EOL + c.EOL);
+ help = $$.trimChars(help, c.EOL) + c.EOL;
+ }
+ return help;
+};
+
+HelpFormatter.prototype._joinParts = function (partStrings) {
+ return partStrings.filter(function (part) {
+ return (part && part !== c.SUPPRESS);
+ }).join('');
+};
+
+HelpFormatter.prototype._formatUsage = function (usage, actions, groups, prefix) {
+ if (!prefix && typeof prefix !== 'string') {
+ prefix = 'usage: ';
+ }
+
+ actions = actions || [];
+ groups = groups || [];
+
+
+ // if usage is specified, use that
+ if (usage) {
+ usage = sprintf(usage, { prog: this._prog });
+
+ // if no optionals or positionals are available, usage is just prog
+ } else if (!usage && actions.length === 0) {
+ usage = this._prog;
+
+ // if optionals and positionals are available, calculate usage
+ } else if (!usage) {
+ var prog = this._prog;
+ var optionals = [];
+ var positionals = [];
+ var actionUsage;
+ var textWidth;
+
+ // split optionals from positionals
+ actions.forEach(function (action) {
+ if (action.isOptional()) {
+ optionals.push(action);
+ } else {
+ positionals.push(action);
+ }
+ });
+
+ // build full usage string
+ actionUsage = this._formatActionsUsage([].concat(optionals, positionals), groups);
+ usage = [ prog, actionUsage ].join(' ');
+
+ // wrap the usage parts if it's too long
+ textWidth = this._width - this._currentIndent;
+ if ((prefix.length + usage.length) > textWidth) {
+
+ // break usage into wrappable parts
+ var regexpPart = new RegExp('\\(.*?\\)+|\\[.*?\\]+|\\S+', 'g');
+ var optionalUsage = this._formatActionsUsage(optionals, groups);
+ var positionalUsage = this._formatActionsUsage(positionals, groups);
+
+
+ var optionalParts = optionalUsage.match(regexpPart);
+ var positionalParts = positionalUsage.match(regexpPart) || [];
+
+ if (optionalParts.join(' ') !== optionalUsage) {
+ throw new Error('assert "optionalParts.join(\' \') === optionalUsage"');
+ }
+ if (positionalParts.join(' ') !== positionalUsage) {
+ throw new Error('assert "positionalParts.join(\' \') === positionalUsage"');
+ }
+
+ // helper for wrapping lines
+ /*eslint-disable func-style*/ // node 0.10 compat
+ var _getLines = function (parts, indent, prefix) {
+ var lines = [];
+ var line = [];
+
+ var lineLength = prefix ? prefix.length - 1 : indent.length - 1;
+
+ parts.forEach(function (part) {
+ if (lineLength + 1 + part.length > textWidth) {
+ lines.push(indent + line.join(' '));
+ line = [];
+ lineLength = indent.length - 1;
+ }
+ line.push(part);
+ lineLength += part.length + 1;
+ });
+
+ if (line) {
+ lines.push(indent + line.join(' '));
+ }
+ if (prefix) {
+ lines[0] = lines[0].substr(indent.length);
+ }
+ return lines;
+ };
+
+ var lines, indent, parts;
+ // if prog is short, follow it with optionals or positionals
+ if (prefix.length + prog.length <= 0.75 * textWidth) {
+ indent = $$.repeat(' ', (prefix.length + prog.length + 1));
+ if (optionalParts) {
+ lines = [].concat(
+ _getLines([ prog ].concat(optionalParts), indent, prefix),
+ _getLines(positionalParts, indent)
+ );
+ } else if (positionalParts) {
+ lines = _getLines([ prog ].concat(positionalParts), indent, prefix);
+ } else {
+ lines = [ prog ];
+ }
+
+ // if prog is long, put it on its own line
+ } else {
+ indent = $$.repeat(' ', prefix.length);
+ parts = optionalParts.concat(positionalParts);
+ lines = _getLines(parts, indent);
+ if (lines.length > 1) {
+ lines = [].concat(
+ _getLines(optionalParts, indent),
+ _getLines(positionalParts, indent)
+ );
+ }
+ lines = [ prog ].concat(lines);
+ }
+ // join lines into usage
+ usage = lines.join(c.EOL);
+ }
+ }
+
+ // prefix with 'usage:'
+ return prefix + usage + c.EOL + c.EOL;
+};
+
+HelpFormatter.prototype._formatActionsUsage = function (actions, groups) {
+ // find group indices and identify actions in groups
+ var groupActions = [];
+ var inserts = [];
+ var self = this;
+
+ groups.forEach(function (group) {
+ var end;
+ var i;
+
+ var start = actions.indexOf(group._groupActions[0]);
+ if (start >= 0) {
+ end = start + group._groupActions.length;
+
+ //if (actions.slice(start, end) === group._groupActions) {
+ if ($$.arrayEqual(actions.slice(start, end), group._groupActions)) {
+ group._groupActions.forEach(function (action) {
+ groupActions.push(action);
+ });
+
+ if (!group.required) {
+ if (inserts[start]) {
+ inserts[start] += ' [';
+ } else {
+ inserts[start] = '[';
+ }
+ inserts[end] = ']';
+ } else {
+ if (inserts[start]) {
+ inserts[start] += ' (';
+ } else {
+ inserts[start] = '(';
+ }
+ inserts[end] = ')';
+ }
+ for (i = start + 1; i < end; i += 1) {
+ inserts[i] = '|';
+ }
+ }
+ }
+ });
+
+ // collect all actions format strings
+ var parts = [];
+
+ actions.forEach(function (action, actionIndex) {
+ var part;
+ var optionString;
+ var argsDefault;
+ var argsString;
+
+ // suppressed arguments are marked with None
+ // remove | separators for suppressed arguments
+ if (action.help === c.SUPPRESS) {
+ parts.push(null);
+ if (inserts[actionIndex] === '|') {
+ inserts.splice(actionIndex, actionIndex);
+ } else if (inserts[actionIndex + 1] === '|') {
+ inserts.splice(actionIndex + 1, actionIndex + 1);
+ }
+
+ // produce all arg strings
+ } else if (!action.isOptional()) {
+ part = self._formatArgs(action, action.dest);
+
+ // if it's in a group, strip the outer []
+ if (groupActions.indexOf(action) >= 0) {
+ if (part[0] === '[' && part[part.length - 1] === ']') {
+ part = part.slice(1, -1);
+ }
+ }
+ // add the action string to the list
+ parts.push(part);
+
+ // produce the first way to invoke the option in brackets
+ } else {
+ optionString = action.optionStrings[0];
+
+ // if the Optional doesn't take a value, format is: -s or --long
+ if (action.nargs === 0) {
+ part = '' + optionString;
+
+ // if the Optional takes a value, format is: -s ARGS or --long ARGS
+ } else {
+ argsDefault = action.dest.toUpperCase();
+ argsString = self._formatArgs(action, argsDefault);
+ part = optionString + ' ' + argsString;
+ }
+ // make it look optional if it's not required or in a group
+ if (!action.required && groupActions.indexOf(action) < 0) {
+ part = '[' + part + ']';
+ }
+ // add the action string to the list
+ parts.push(part);
+ }
+ });
+
+ // insert things at the necessary indices
+ for (var i = inserts.length - 1; i >= 0; --i) {
+ if (inserts[i] !== null) {
+ parts.splice(i, 0, inserts[i]);
+ }
+ }
+
+ // join all the action items with spaces
+ var text = parts.filter(function (part) {
+ return !!part;
+ }).join(' ');
+
+ // clean up separators for mutually exclusive groups
+ text = text.replace(/([\[(]) /g, '$1'); // remove spaces
+ text = text.replace(/ ([\])])/g, '$1');
+ text = text.replace(/\[ *\]/g, ''); // remove empty groups
+ text = text.replace(/\( *\)/g, '');
+ text = text.replace(/\(([^|]*)\)/g, '$1'); // remove () from single action groups
+
+ text = text.trim();
+
+ // return the text
+ return text;
+};
+
+HelpFormatter.prototype._formatText = function (text) {
+ text = sprintf(text, { prog: this._prog });
+ var textWidth = this._width - this._currentIndent;
+ var indentIncriment = $$.repeat(' ', this._currentIndent);
+ return this._fillText(text, textWidth, indentIncriment) + c.EOL + c.EOL;
+};
+
+HelpFormatter.prototype._formatAction = function (action) {
+ var self = this;
+
+ var helpText;
+ var helpLines;
+ var parts;
+ var indentFirst;
+
+ // determine the required width and the entry label
+ var helpPosition = Math.min(this._actionMaxLength + 2, this._maxHelpPosition);
+ var helpWidth = this._width - helpPosition;
+ var actionWidth = helpPosition - this._currentIndent - 2;
+ var actionHeader = this._formatActionInvocation(action);
+
+ // no help; start on same line and add a final newline
+ if (!action.help) {
+ actionHeader = $$.repeat(' ', this._currentIndent) + actionHeader + c.EOL;
+
+ // short action name; start on the same line and pad two spaces
+ } else if (actionHeader.length <= actionWidth) {
+ actionHeader = $$.repeat(' ', this._currentIndent) +
+ actionHeader +
+ ' ' +
+ $$.repeat(' ', actionWidth - actionHeader.length);
+ indentFirst = 0;
+
+ // long action name; start on the next line
+ } else {
+ actionHeader = $$.repeat(' ', this._currentIndent) + actionHeader + c.EOL;
+ indentFirst = helpPosition;
+ }
+
+ // collect the pieces of the action help
+ parts = [ actionHeader ];
+
+ // if there was help for the action, add lines of help text
+ if (action.help) {
+ helpText = this._expandHelp(action);
+ helpLines = this._splitLines(helpText, helpWidth);
+ parts.push($$.repeat(' ', indentFirst) + helpLines[0] + c.EOL);
+ helpLines.slice(1).forEach(function (line) {
+ parts.push($$.repeat(' ', helpPosition) + line + c.EOL);
+ });
+
+ // or add a newline if the description doesn't end with one
+ } else if (actionHeader.charAt(actionHeader.length - 1) !== c.EOL) {
+ parts.push(c.EOL);
+ }
+ // if there are any sub-actions, add their help as well
+ if (action._getSubactions) {
+ this._indent();
+ action._getSubactions().forEach(function (subaction) {
+ parts.push(self._formatAction(subaction));
+ });
+ this._dedent();
+ }
+ // return a single string
+ return this._joinParts(parts);
+};
+
+HelpFormatter.prototype._formatActionInvocation = function (action) {
+ if (!action.isOptional()) {
+ var format_func = this._metavarFormatter(action, action.dest);
+ var metavars = format_func(1);
+ return metavars[0];
+ }
+
+ var parts = [];
+ var argsDefault;
+ var argsString;
+
+ // if the Optional doesn't take a value, format is: -s, --long
+ if (action.nargs === 0) {
+ parts = parts.concat(action.optionStrings);
+
+ // if the Optional takes a value, format is: -s ARGS, --long ARGS
+ } else {
+ argsDefault = action.dest.toUpperCase();
+ argsString = this._formatArgs(action, argsDefault);
+ action.optionStrings.forEach(function (optionString) {
+ parts.push(optionString + ' ' + argsString);
+ });
+ }
+ return parts.join(', ');
+};
+
+HelpFormatter.prototype._metavarFormatter = function (action, metavarDefault) {
+ var result;
+
+ if (action.metavar || action.metavar === '') {
+ result = action.metavar;
+ } else if (action.choices) {
+ var choices = action.choices;
+
+ if (typeof choices === 'string') {
+ choices = choices.split('').join(', ');
+ } else if (Array.isArray(choices)) {
+ choices = choices.join(',');
+ } else {
+ choices = Object.keys(choices).join(',');
+ }
+ result = '{' + choices + '}';
+ } else {
+ result = metavarDefault;
+ }
+
+ return function (size) {
+ if (Array.isArray(result)) {
+ return result;
+ }
+
+ var metavars = [];
+ for (var i = 0; i < size; i += 1) {
+ metavars.push(result);
+ }
+ return metavars;
+ };
+};
+
+HelpFormatter.prototype._formatArgs = function (action, metavarDefault) {
+ var result;
+ var metavars;
+
+ var buildMetavar = this._metavarFormatter(action, metavarDefault);
+
+ switch (action.nargs) {
+ /*eslint-disable no-undefined*/
+ case undefined:
+ case null:
+ metavars = buildMetavar(1);
+ result = '' + metavars[0];
+ break;
+ case c.OPTIONAL:
+ metavars = buildMetavar(1);
+ result = '[' + metavars[0] + ']';
+ break;
+ case c.ZERO_OR_MORE:
+ metavars = buildMetavar(2);
+ result = '[' + metavars[0] + ' [' + metavars[1] + ' ...]]';
+ break;
+ case c.ONE_OR_MORE:
+ metavars = buildMetavar(2);
+ result = '' + metavars[0] + ' [' + metavars[1] + ' ...]';
+ break;
+ case c.REMAINDER:
+ result = '...';
+ break;
+ case c.PARSER:
+ metavars = buildMetavar(1);
+ result = metavars[0] + ' ...';
+ break;
+ default:
+ metavars = buildMetavar(action.nargs);
+ result = metavars.join(' ');
+ }
+ return result;
+};
+
+HelpFormatter.prototype._expandHelp = function (action) {
+ var params = { prog: this._prog };
+
+ Object.keys(action).forEach(function (actionProperty) {
+ var actionValue = action[actionProperty];
+
+ if (actionValue !== c.SUPPRESS) {
+ params[actionProperty] = actionValue;
+ }
+ });
+
+ if (params.choices) {
+ if (typeof params.choices === 'string') {
+ params.choices = params.choices.split('').join(', ');
+ } else if (Array.isArray(params.choices)) {
+ params.choices = params.choices.join(', ');
+ } else {
+ params.choices = Object.keys(params.choices).join(', ');
+ }
+ }
+
+ return sprintf(this._getHelpString(action), params);
+};
+
+HelpFormatter.prototype._splitLines = function (text, width) {
+ var lines = [];
+ var delimiters = [ ' ', '.', ',', '!', '?' ];
+ var re = new RegExp('[' + delimiters.join('') + '][^' + delimiters.join('') + ']*$');
+
+ text = text.replace(/[\n\|\t]/g, ' ');
+
+ text = text.trim();
+ text = text.replace(this._whitespaceMatcher, ' ');
+
+ // Wraps the single paragraph in text (a string) so every line
+ // is at most width characters long.
+ text.split(c.EOL).forEach(function (line) {
+ if (width >= line.length) {
+ lines.push(line);
+ return;
+ }
+
+ var wrapStart = 0;
+ var wrapEnd = width;
+ var delimiterIndex = 0;
+ while (wrapEnd <= line.length) {
+ if (wrapEnd !== line.length && delimiters.indexOf(line[wrapEnd] < -1)) {
+ delimiterIndex = (re.exec(line.substring(wrapStart, wrapEnd)) || {}).index;
+ wrapEnd = wrapStart + delimiterIndex + 1;
+ }
+ lines.push(line.substring(wrapStart, wrapEnd));
+ wrapStart = wrapEnd;
+ wrapEnd += width;
+ }
+ if (wrapStart < line.length) {
+ lines.push(line.substring(wrapStart, wrapEnd));
+ }
+ });
+
+ return lines;
+};
+
+HelpFormatter.prototype._fillText = function (text, width, indent) {
+ var lines = this._splitLines(text, width);
+ lines = lines.map(function (line) {
+ return indent + line;
+ });
+ return lines.join(c.EOL);
+};
+
+HelpFormatter.prototype._getHelpString = function (action) {
+ return action.help;
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/namespace.js b/website_quotation_template/node_modules/argparse/lib/namespace.js
new file mode 100644
index 000000000..a860de9ec
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/namespace.js
@@ -0,0 +1,76 @@
+/**
+ * class Namespace
+ *
+ * Simple object for storing attributes. Implements equality by attribute names
+ * and values, and provides a simple string representation.
+ *
+ * See also [original guide][1]
+ *
+ * [1]:http://docs.python.org/dev/library/argparse.html#the-namespace-object
+ **/
+'use strict';
+
+var $$ = require('./utils');
+
+/**
+ * new Namespace(options)
+ * - options(object): predefined propertis for result object
+ *
+ **/
+var Namespace = module.exports = function Namespace(options) {
+ $$.extend(this, options);
+};
+
+/**
+ * Namespace#isset(key) -> Boolean
+ * - key (string|number): property name
+ *
+ * Tells whenever `namespace` contains given `key` or not.
+ **/
+Namespace.prototype.isset = function (key) {
+ return $$.has(this, key);
+};
+
+/**
+ * Namespace#set(key, value) -> self
+ * -key (string|number|object): propery name
+ * -value (mixed): new property value
+ *
+ * Set the property named key with value.
+ * If key object then set all key properties to namespace object
+ **/
+Namespace.prototype.set = function (key, value) {
+ if (typeof (key) === 'object') {
+ $$.extend(this, key);
+ } else {
+ this[key] = value;
+ }
+ return this;
+};
+
+/**
+ * Namespace#get(key, defaultValue) -> mixed
+ * - key (string|number): property name
+ * - defaultValue (mixed): default value
+ *
+ * Return the property key or defaulValue if not set
+ **/
+Namespace.prototype.get = function (key, defaultValue) {
+ return !this[key] ? defaultValue : this[key];
+};
+
+/**
+ * Namespace#unset(key, defaultValue) -> mixed
+ * - key (string|number): property name
+ * - defaultValue (mixed): default value
+ *
+ * Return data[key](and delete it) or defaultValue
+ **/
+Namespace.prototype.unset = function (key, defaultValue) {
+ var value = this[key];
+ if (value !== null) {
+ delete this[key];
+ return value;
+ }
+ return defaultValue;
+};
diff --git a/website_quotation_template/node_modules/argparse/lib/utils.js b/website_quotation_template/node_modules/argparse/lib/utils.js
new file mode 100644
index 000000000..4a9cf3edb
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/lib/utils.js
@@ -0,0 +1,57 @@
+'use strict';
+
+exports.repeat = function (str, num) {
+ var result = '';
+ for (var i = 0; i < num; i++) { result += str; }
+ return result;
+};
+
+exports.arrayEqual = function (a, b) {
+ if (a.length !== b.length) { return false; }
+ for (var i = 0; i < a.length; i++) {
+ if (a[i] !== b[i]) { return false; }
+ }
+ return true;
+};
+
+exports.trimChars = function (str, chars) {
+ var start = 0;
+ var end = str.length - 1;
+ while (chars.indexOf(str.charAt(start)) >= 0) { start++; }
+ while (chars.indexOf(str.charAt(end)) >= 0) { end--; }
+ return str.slice(start, end + 1);
+};
+
+exports.capitalize = function (str) {
+ return str.charAt(0).toUpperCase() + str.slice(1);
+};
+
+exports.arrayUnion = function () {
+ var result = [];
+ for (var i = 0, values = {}; i < arguments.length; i++) {
+ var arr = arguments[i];
+ for (var j = 0; j < arr.length; j++) {
+ if (!values[arr[j]]) {
+ values[arr[j]] = true;
+ result.push(arr[j]);
+ }
+ }
+ }
+ return result;
+};
+
+function has(obj, key) {
+ return Object.prototype.hasOwnProperty.call(obj, key);
+}
+
+exports.has = has;
+
+exports.extend = function (dest, src) {
+ for (var i in src) {
+ if (has(src, i)) { dest[i] = src[i]; }
+ }
+};
+
+exports.trimEnd = function (str) {
+ return str.replace(/\s+$/g, '');
+};
diff --git a/website_quotation_template/node_modules/argparse/package.json b/website_quotation_template/node_modules/argparse/package.json
new file mode 100644
index 000000000..941fde55c
--- /dev/null
+++ b/website_quotation_template/node_modules/argparse/package.json
@@ -0,0 +1,70 @@
+{
+ "_from": "argparse@~1.0.3",
+ "_id": "argparse@1.0.10",
+ "_inBundle": false,
+ "_integrity": "sha512-o5Roy6tNG4SL/FOkCAN6RzjiakZS25RLYFrcMttJqbdd8BWrnA+fGz57iN5Pb06pvBGvl5gQ0B48dJlslXvoTg==",
+ "_location": "/argparse",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "argparse@~1.0.3",
+ "name": "argparse",
+ "escapedName": "argparse",
+ "rawSpec": "~1.0.3",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.3"
+ },
+ "_requiredBy": [
+ "/mammoth"
+ ],
+ "_resolved": "https://registry.npmjs.org/argparse/-/argparse-1.0.10.tgz",
+ "_shasum": "bcd6791ea5ae09725e17e5ad988134cd40b3d911",
+ "_spec": "argparse@~1.0.3",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/mammoth",
+ "bugs": {
+ "url": "https://github.com/nodeca/argparse/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Eugene Shkuropat"
+ },
+ {
+ "name": "Paul Jacobson"
+ }
+ ],
+ "dependencies": {
+ "sprintf-js": "~1.0.2"
+ },
+ "deprecated": false,
+ "description": "Very powerful CLI arguments parser. Native port of argparse - python's options parsing library",
+ "devDependencies": {
+ "eslint": "^2.13.1",
+ "istanbul": "^0.4.5",
+ "mocha": "^3.1.0",
+ "ndoc": "^5.0.1"
+ },
+ "files": [
+ "index.js",
+ "lib/"
+ ],
+ "homepage": "https://github.com/nodeca/argparse#readme",
+ "keywords": [
+ "cli",
+ "parser",
+ "argparse",
+ "option",
+ "args"
+ ],
+ "license": "MIT",
+ "name": "argparse",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/nodeca/argparse.git"
+ },
+ "scripts": {
+ "test": "make test"
+ },
+ "version": "1.0.10"
+}
diff --git a/website_quotation_template/node_modules/asn1/Jenkinsfile b/website_quotation_template/node_modules/asn1/Jenkinsfile
new file mode 100644
index 000000000..d1b459375
--- /dev/null
+++ b/website_quotation_template/node_modules/asn1/Jenkinsfile
@@ -0,0 +1,65 @@
+@Library('jenkins-joylib@v1.0.8') _
+
+pipeline {
+
+ agent none
+
+ options {
+ buildDiscarder(logRotator(numToKeepStr: '45'))
+ timestamps()
+ }
+
+ stages {
+ stage('top') {
+ parallel {
+ stage('v4-zone') {
+ agent {
+ label joyCommonLabels(image_ver: '15.4.1')
+ }
+ tools {
+ nodejs 'sdcnode-v4-zone'
+ }
+ stages {
+ stage('check') {
+ steps{
+ sh('make check')
+ }
+ }
+ stage('test') {
+ steps{
+ sh('make test')
+ }
+ }
+ }
+ }
+
+ stage('v6-zone64') {
+ agent {
+ label joyCommonLabels(image_ver: '18.4.0')
+ }
+ tools {
+ nodejs 'sdcnode-v6-zone64'
+ }
+ stages {
+ stage('check') {
+ steps{
+ sh('make check')
+ }
+ }
+ stage('test') {
+ steps{
+ sh('make test')
+ }
+ }
+ }
+ }
+ }
+ }
+ }
+
+ post {
+ always {
+ joySlackNotifications()
+ }
+ }
+}
diff --git a/website_quotation_template/node_modules/asn1/LICENSE b/website_quotation_template/node_modules/asn1/LICENSE
new file mode 100644
index 000000000..9b5dcdb7f
--- /dev/null
+++ b/website_quotation_template/node_modules/asn1/LICENSE
@@ -0,0 +1,19 @@
+Copyright (c) 2011 Mark Cavage, All rights reserved.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE
diff --git a/website_quotation_template/node_modules/asn1/README.md b/website_quotation_template/node_modules/asn1/README.md
new file mode 100644
index 000000000..2208210a3
--- /dev/null
+++ b/website_quotation_template/node_modules/asn1/README.md
@@ -0,0 +1,50 @@
+node-asn1 is a library for encoding and decoding ASN.1 datatypes in pure JS.
+Currently BER encoding is supported; at some point I'll likely have to do DER.
+
+## Usage
+
+Mostly, if you're *actually* needing to read and write ASN.1, you probably don't
+need this readme to explain what and why. If you have no idea what ASN.1 is,
+see this: ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc
+
+The source is pretty much self-explanatory, and has read/write methods for the
+common types out there.
+
+### Decoding
+
+The following reads an ASN.1 sequence with a boolean.
+
+ var Ber = require('asn1').Ber;
+
+ var reader = new Ber.Reader(Buffer.from([0x30, 0x03, 0x01, 0x01, 0xff]));
+
+ reader.readSequence();
+ console.log('Sequence len: ' + reader.length);
+ if (reader.peek() === Ber.Boolean)
+ console.log(reader.readBoolean());
+
+### Encoding
+
+The following generates the same payload as above.
+
+ var Ber = require('asn1').Ber;
+
+ var writer = new Ber.Writer();
+
+ writer.startSequence();
+ writer.writeBoolean(true);
+ writer.endSequence();
+
+ console.log(writer.buffer);
+
+## Installation
+
+ npm install asn1
+
+## License
+
+MIT.
+
+## Bugs
+
+See .
diff --git a/website_quotation_template/node_modules/asn1/lib/ber/errors.js b/website_quotation_template/node_modules/asn1/lib/ber/errors.js
new file mode 100644
index 000000000..4557b8aea
--- /dev/null
+++ b/website_quotation_template/node_modules/asn1/lib/ber/errors.js
@@ -0,0 +1,13 @@
+// Copyright 2011 Mark Cavage All rights reserved.
+
+
+module.exports = {
+
+ newInvalidAsn1Error: function (msg) {
+ var e = new Error();
+ e.name = 'InvalidAsn1Error';
+ e.message = msg || '';
+ return e;
+ }
+
+};
diff --git a/website_quotation_template/node_modules/asn1/lib/ber/index.js b/website_quotation_template/node_modules/asn1/lib/ber/index.js
new file mode 100644
index 000000000..387d1326f
--- /dev/null
+++ b/website_quotation_template/node_modules/asn1/lib/ber/index.js
@@ -0,0 +1,27 @@
+// Copyright 2011 Mark Cavage All rights reserved.
+
+var errors = require('./errors');
+var types = require('./types');
+
+var Reader = require('./reader');
+var Writer = require('./writer');
+
+
+// --- Exports
+
+module.exports = {
+
+ Reader: Reader,
+
+ Writer: Writer
+
+};
+
+for (var t in types) {
+ if (types.hasOwnProperty(t))
+ module.exports[t] = types[t];
+}
+for (var e in errors) {
+ if (errors.hasOwnProperty(e))
+ module.exports[e] = errors[e];
+}
diff --git a/website_quotation_template/node_modules/asn1/lib/ber/reader.js b/website_quotation_template/node_modules/asn1/lib/ber/reader.js
new file mode 100644
index 000000000..8a7e4ca01
--- /dev/null
+++ b/website_quotation_template/node_modules/asn1/lib/ber/reader.js
@@ -0,0 +1,262 @@
+// Copyright 2011 Mark Cavage All rights reserved.
+
+var assert = require('assert');
+var Buffer = require('safer-buffer').Buffer;
+
+var ASN1 = require('./types');
+var errors = require('./errors');
+
+
+// --- Globals
+
+var newInvalidAsn1Error = errors.newInvalidAsn1Error;
+
+
+
+// --- API
+
+function Reader(data) {
+ if (!data || !Buffer.isBuffer(data))
+ throw new TypeError('data must be a node Buffer');
+
+ this._buf = data;
+ this._size = data.length;
+
+ // These hold the "current" state
+ this._len = 0;
+ this._offset = 0;
+}
+
+Object.defineProperty(Reader.prototype, 'length', {
+ enumerable: true,
+ get: function () { return (this._len); }
+});
+
+Object.defineProperty(Reader.prototype, 'offset', {
+ enumerable: true,
+ get: function () { return (this._offset); }
+});
+
+Object.defineProperty(Reader.prototype, 'remain', {
+ get: function () { return (this._size - this._offset); }
+});
+
+Object.defineProperty(Reader.prototype, 'buffer', {
+ get: function () { return (this._buf.slice(this._offset)); }
+});
+
+
+/**
+ * Reads a single byte and advances offset; you can pass in `true` to make this
+ * a "peek" operation (i.e., get the byte, but don't advance the offset).
+ *
+ * @param {Boolean} peek true means don't move offset.
+ * @return {Number} the next byte, null if not enough data.
+ */
+Reader.prototype.readByte = function (peek) {
+ if (this._size - this._offset < 1)
+ return null;
+
+ var b = this._buf[this._offset] & 0xff;
+
+ if (!peek)
+ this._offset += 1;
+
+ return b;
+};
+
+
+Reader.prototype.peek = function () {
+ return this.readByte(true);
+};
+
+
+/**
+ * Reads a (potentially) variable length off the BER buffer. This call is
+ * not really meant to be called directly, as callers have to manipulate
+ * the internal buffer afterwards.
+ *
+ * As a result of this call, you can call `Reader.length`, until the
+ * next thing called that does a readLength.
+ *
+ * @return {Number} the amount of offset to advance the buffer.
+ * @throws {InvalidAsn1Error} on bad ASN.1
+ */
+Reader.prototype.readLength = function (offset) {
+ if (offset === undefined)
+ offset = this._offset;
+
+ if (offset >= this._size)
+ return null;
+
+ var lenB = this._buf[offset++] & 0xff;
+ if (lenB === null)
+ return null;
+
+ if ((lenB & 0x80) === 0x80) {
+ lenB &= 0x7f;
+
+ if (lenB === 0)
+ throw newInvalidAsn1Error('Indefinite length not supported');
+
+ if (lenB > 4)
+ throw newInvalidAsn1Error('encoding too long');
+
+ if (this._size - offset < lenB)
+ return null;
+
+ this._len = 0;
+ for (var i = 0; i < lenB; i++)
+ this._len = (this._len << 8) + (this._buf[offset++] & 0xff);
+
+ } else {
+ // Wasn't a variable length
+ this._len = lenB;
+ }
+
+ return offset;
+};
+
+
+/**
+ * Parses the next sequence in this BER buffer.
+ *
+ * To get the length of the sequence, call `Reader.length`.
+ *
+ * @return {Number} the sequence's tag.
+ */
+Reader.prototype.readSequence = function (tag) {
+ var seq = this.peek();
+ if (seq === null)
+ return null;
+ if (tag !== undefined && tag !== seq)
+ throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) +
+ ': got 0x' + seq.toString(16));
+
+ var o = this.readLength(this._offset + 1); // stored in `length`
+ if (o === null)
+ return null;
+
+ this._offset = o;
+ return seq;
+};
+
+
+Reader.prototype.readInt = function () {
+ return this._readTag(ASN1.Integer);
+};
+
+
+Reader.prototype.readBoolean = function () {
+ return (this._readTag(ASN1.Boolean) === 0 ? false : true);
+};
+
+
+Reader.prototype.readEnumeration = function () {
+ return this._readTag(ASN1.Enumeration);
+};
+
+
+Reader.prototype.readString = function (tag, retbuf) {
+ if (!tag)
+ tag = ASN1.OctetString;
+
+ var b = this.peek();
+ if (b === null)
+ return null;
+
+ if (b !== tag)
+ throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) +
+ ': got 0x' + b.toString(16));
+
+ var o = this.readLength(this._offset + 1); // stored in `length`
+
+ if (o === null)
+ return null;
+
+ if (this.length > this._size - o)
+ return null;
+
+ this._offset = o;
+
+ if (this.length === 0)
+ return retbuf ? Buffer.alloc(0) : '';
+
+ var str = this._buf.slice(this._offset, this._offset + this.length);
+ this._offset += this.length;
+
+ return retbuf ? str : str.toString('utf8');
+};
+
+Reader.prototype.readOID = function (tag) {
+ if (!tag)
+ tag = ASN1.OID;
+
+ var b = this.readString(tag, true);
+ if (b === null)
+ return null;
+
+ var values = [];
+ var value = 0;
+
+ for (var i = 0; i < b.length; i++) {
+ var byte = b[i] & 0xff;
+
+ value <<= 7;
+ value += byte & 0x7f;
+ if ((byte & 0x80) === 0) {
+ values.push(value);
+ value = 0;
+ }
+ }
+
+ value = values.shift();
+ values.unshift(value % 40);
+ values.unshift((value / 40) >> 0);
+
+ return values.join('.');
+};
+
+
+Reader.prototype._readTag = function (tag) {
+ assert.ok(tag !== undefined);
+
+ var b = this.peek();
+
+ if (b === null)
+ return null;
+
+ if (b !== tag)
+ throw newInvalidAsn1Error('Expected 0x' + tag.toString(16) +
+ ': got 0x' + b.toString(16));
+
+ var o = this.readLength(this._offset + 1); // stored in `length`
+ if (o === null)
+ return null;
+
+ if (this.length > 4)
+ throw newInvalidAsn1Error('Integer too long: ' + this.length);
+
+ if (this.length > this._size - o)
+ return null;
+ this._offset = o;
+
+ var fb = this._buf[this._offset];
+ var value = 0;
+
+ for (var i = 0; i < this.length; i++) {
+ value <<= 8;
+ value |= (this._buf[this._offset++] & 0xff);
+ }
+
+ if ((fb & 0x80) === 0x80 && i !== 4)
+ value -= (1 << (i * 8));
+
+ return value >> 0;
+};
+
+
+
+// --- Exported API
+
+module.exports = Reader;
diff --git a/website_quotation_template/node_modules/asn1/lib/ber/types.js b/website_quotation_template/node_modules/asn1/lib/ber/types.js
new file mode 100644
index 000000000..8aea00013
--- /dev/null
+++ b/website_quotation_template/node_modules/asn1/lib/ber/types.js
@@ -0,0 +1,36 @@
+// Copyright 2011 Mark Cavage All rights reserved.
+
+
+module.exports = {
+ EOC: 0,
+ Boolean: 1,
+ Integer: 2,
+ BitString: 3,
+ OctetString: 4,
+ Null: 5,
+ OID: 6,
+ ObjectDescriptor: 7,
+ External: 8,
+ Real: 9, // float
+ Enumeration: 10,
+ PDV: 11,
+ Utf8String: 12,
+ RelativeOID: 13,
+ Sequence: 16,
+ Set: 17,
+ NumericString: 18,
+ PrintableString: 19,
+ T61String: 20,
+ VideotexString: 21,
+ IA5String: 22,
+ UTCTime: 23,
+ GeneralizedTime: 24,
+ GraphicString: 25,
+ VisibleString: 26,
+ GeneralString: 28,
+ UniversalString: 29,
+ CharacterString: 30,
+ BMPString: 31,
+ Constructor: 32,
+ Context: 128
+};
diff --git a/website_quotation_template/node_modules/asn1/lib/ber/writer.js b/website_quotation_template/node_modules/asn1/lib/ber/writer.js
new file mode 100644
index 000000000..3515acf79
--- /dev/null
+++ b/website_quotation_template/node_modules/asn1/lib/ber/writer.js
@@ -0,0 +1,317 @@
+// Copyright 2011 Mark Cavage All rights reserved.
+
+var assert = require('assert');
+var Buffer = require('safer-buffer').Buffer;
+var ASN1 = require('./types');
+var errors = require('./errors');
+
+
+// --- Globals
+
+var newInvalidAsn1Error = errors.newInvalidAsn1Error;
+
+var DEFAULT_OPTS = {
+ size: 1024,
+ growthFactor: 8
+};
+
+
+// --- Helpers
+
+function merge(from, to) {
+ assert.ok(from);
+ assert.equal(typeof (from), 'object');
+ assert.ok(to);
+ assert.equal(typeof (to), 'object');
+
+ var keys = Object.getOwnPropertyNames(from);
+ keys.forEach(function (key) {
+ if (to[key])
+ return;
+
+ var value = Object.getOwnPropertyDescriptor(from, key);
+ Object.defineProperty(to, key, value);
+ });
+
+ return to;
+}
+
+
+
+// --- API
+
+function Writer(options) {
+ options = merge(DEFAULT_OPTS, options || {});
+
+ this._buf = Buffer.alloc(options.size || 1024);
+ this._size = this._buf.length;
+ this._offset = 0;
+ this._options = options;
+
+ // A list of offsets in the buffer where we need to insert
+ // sequence tag/len pairs.
+ this._seq = [];
+}
+
+Object.defineProperty(Writer.prototype, 'buffer', {
+ get: function () {
+ if (this._seq.length)
+ throw newInvalidAsn1Error(this._seq.length + ' unended sequence(s)');
+
+ return (this._buf.slice(0, this._offset));
+ }
+});
+
+Writer.prototype.writeByte = function (b) {
+ if (typeof (b) !== 'number')
+ throw new TypeError('argument must be a Number');
+
+ this._ensure(1);
+ this._buf[this._offset++] = b;
+};
+
+
+Writer.prototype.writeInt = function (i, tag) {
+ if (typeof (i) !== 'number')
+ throw new TypeError('argument must be a Number');
+ if (typeof (tag) !== 'number')
+ tag = ASN1.Integer;
+
+ var sz = 4;
+
+ while ((((i & 0xff800000) === 0) || ((i & 0xff800000) === 0xff800000 >> 0)) &&
+ (sz > 1)) {
+ sz--;
+ i <<= 8;
+ }
+
+ if (sz > 4)
+ throw newInvalidAsn1Error('BER ints cannot be > 0xffffffff');
+
+ this._ensure(2 + sz);
+ this._buf[this._offset++] = tag;
+ this._buf[this._offset++] = sz;
+
+ while (sz-- > 0) {
+ this._buf[this._offset++] = ((i & 0xff000000) >>> 24);
+ i <<= 8;
+ }
+
+};
+
+
+Writer.prototype.writeNull = function () {
+ this.writeByte(ASN1.Null);
+ this.writeByte(0x00);
+};
+
+
+Writer.prototype.writeEnumeration = function (i, tag) {
+ if (typeof (i) !== 'number')
+ throw new TypeError('argument must be a Number');
+ if (typeof (tag) !== 'number')
+ tag = ASN1.Enumeration;
+
+ return this.writeInt(i, tag);
+};
+
+
+Writer.prototype.writeBoolean = function (b, tag) {
+ if (typeof (b) !== 'boolean')
+ throw new TypeError('argument must be a Boolean');
+ if (typeof (tag) !== 'number')
+ tag = ASN1.Boolean;
+
+ this._ensure(3);
+ this._buf[this._offset++] = tag;
+ this._buf[this._offset++] = 0x01;
+ this._buf[this._offset++] = b ? 0xff : 0x00;
+};
+
+
+Writer.prototype.writeString = function (s, tag) {
+ if (typeof (s) !== 'string')
+ throw new TypeError('argument must be a string (was: ' + typeof (s) + ')');
+ if (typeof (tag) !== 'number')
+ tag = ASN1.OctetString;
+
+ var len = Buffer.byteLength(s);
+ this.writeByte(tag);
+ this.writeLength(len);
+ if (len) {
+ this._ensure(len);
+ this._buf.write(s, this._offset);
+ this._offset += len;
+ }
+};
+
+
+Writer.prototype.writeBuffer = function (buf, tag) {
+ if (typeof (tag) !== 'number')
+ throw new TypeError('tag must be a number');
+ if (!Buffer.isBuffer(buf))
+ throw new TypeError('argument must be a buffer');
+
+ this.writeByte(tag);
+ this.writeLength(buf.length);
+ this._ensure(buf.length);
+ buf.copy(this._buf, this._offset, 0, buf.length);
+ this._offset += buf.length;
+};
+
+
+Writer.prototype.writeStringArray = function (strings) {
+ if ((!strings instanceof Array))
+ throw new TypeError('argument must be an Array[String]');
+
+ var self = this;
+ strings.forEach(function (s) {
+ self.writeString(s);
+ });
+};
+
+// This is really to solve DER cases, but whatever for now
+Writer.prototype.writeOID = function (s, tag) {
+ if (typeof (s) !== 'string')
+ throw new TypeError('argument must be a string');
+ if (typeof (tag) !== 'number')
+ tag = ASN1.OID;
+
+ if (!/^([0-9]+\.){3,}[0-9]+$/.test(s))
+ throw new Error('argument is not a valid OID string');
+
+ function encodeOctet(bytes, octet) {
+ if (octet < 128) {
+ bytes.push(octet);
+ } else if (octet < 16384) {
+ bytes.push((octet >>> 7) | 0x80);
+ bytes.push(octet & 0x7F);
+ } else if (octet < 2097152) {
+ bytes.push((octet >>> 14) | 0x80);
+ bytes.push(((octet >>> 7) | 0x80) & 0xFF);
+ bytes.push(octet & 0x7F);
+ } else if (octet < 268435456) {
+ bytes.push((octet >>> 21) | 0x80);
+ bytes.push(((octet >>> 14) | 0x80) & 0xFF);
+ bytes.push(((octet >>> 7) | 0x80) & 0xFF);
+ bytes.push(octet & 0x7F);
+ } else {
+ bytes.push(((octet >>> 28) | 0x80) & 0xFF);
+ bytes.push(((octet >>> 21) | 0x80) & 0xFF);
+ bytes.push(((octet >>> 14) | 0x80) & 0xFF);
+ bytes.push(((octet >>> 7) | 0x80) & 0xFF);
+ bytes.push(octet & 0x7F);
+ }
+ }
+
+ var tmp = s.split('.');
+ var bytes = [];
+ bytes.push(parseInt(tmp[0], 10) * 40 + parseInt(tmp[1], 10));
+ tmp.slice(2).forEach(function (b) {
+ encodeOctet(bytes, parseInt(b, 10));
+ });
+
+ var self = this;
+ this._ensure(2 + bytes.length);
+ this.writeByte(tag);
+ this.writeLength(bytes.length);
+ bytes.forEach(function (b) {
+ self.writeByte(b);
+ });
+};
+
+
+Writer.prototype.writeLength = function (len) {
+ if (typeof (len) !== 'number')
+ throw new TypeError('argument must be a Number');
+
+ this._ensure(4);
+
+ if (len <= 0x7f) {
+ this._buf[this._offset++] = len;
+ } else if (len <= 0xff) {
+ this._buf[this._offset++] = 0x81;
+ this._buf[this._offset++] = len;
+ } else if (len <= 0xffff) {
+ this._buf[this._offset++] = 0x82;
+ this._buf[this._offset++] = len >> 8;
+ this._buf[this._offset++] = len;
+ } else if (len <= 0xffffff) {
+ this._buf[this._offset++] = 0x83;
+ this._buf[this._offset++] = len >> 16;
+ this._buf[this._offset++] = len >> 8;
+ this._buf[this._offset++] = len;
+ } else {
+ throw newInvalidAsn1Error('Length too long (> 4 bytes)');
+ }
+};
+
+Writer.prototype.startSequence = function (tag) {
+ if (typeof (tag) !== 'number')
+ tag = ASN1.Sequence | ASN1.Constructor;
+
+ this.writeByte(tag);
+ this._seq.push(this._offset);
+ this._ensure(3);
+ this._offset += 3;
+};
+
+
+Writer.prototype.endSequence = function () {
+ var seq = this._seq.pop();
+ var start = seq + 3;
+ var len = this._offset - start;
+
+ if (len <= 0x7f) {
+ this._shift(start, len, -2);
+ this._buf[seq] = len;
+ } else if (len <= 0xff) {
+ this._shift(start, len, -1);
+ this._buf[seq] = 0x81;
+ this._buf[seq + 1] = len;
+ } else if (len <= 0xffff) {
+ this._buf[seq] = 0x82;
+ this._buf[seq + 1] = len >> 8;
+ this._buf[seq + 2] = len;
+ } else if (len <= 0xffffff) {
+ this._shift(start, len, 1);
+ this._buf[seq] = 0x83;
+ this._buf[seq + 1] = len >> 16;
+ this._buf[seq + 2] = len >> 8;
+ this._buf[seq + 3] = len;
+ } else {
+ throw newInvalidAsn1Error('Sequence too long');
+ }
+};
+
+
+Writer.prototype._shift = function (start, len, shift) {
+ assert.ok(start !== undefined);
+ assert.ok(len !== undefined);
+ assert.ok(shift);
+
+ this._buf.copy(this._buf, start + shift, start, start + len);
+ this._offset += shift;
+};
+
+Writer.prototype._ensure = function (len) {
+ assert.ok(len);
+
+ if (this._size - this._offset < len) {
+ var sz = this._size * this._options.growthFactor;
+ if (sz - this._offset < len)
+ sz += len;
+
+ var buf = Buffer.alloc(sz);
+
+ this._buf.copy(buf, 0, 0, this._offset);
+ this._buf = buf;
+ this._size = sz;
+ }
+};
+
+
+
+// --- Exported API
+
+module.exports = Writer;
diff --git a/website_quotation_template/node_modules/asn1/lib/index.js b/website_quotation_template/node_modules/asn1/lib/index.js
new file mode 100644
index 000000000..ede3ab232
--- /dev/null
+++ b/website_quotation_template/node_modules/asn1/lib/index.js
@@ -0,0 +1,20 @@
+// Copyright 2011 Mark Cavage All rights reserved.
+
+// If you have no idea what ASN.1 or BER is, see this:
+// ftp://ftp.rsa.com/pub/pkcs/ascii/layman.asc
+
+var Ber = require('./ber/index');
+
+
+
+// --- Exported API
+
+module.exports = {
+
+ Ber: Ber,
+
+ BerReader: Ber.Reader,
+
+ BerWriter: Ber.Writer
+
+};
diff --git a/website_quotation_template/node_modules/asn1/package.json b/website_quotation_template/node_modules/asn1/package.json
new file mode 100644
index 000000000..297e63132
--- /dev/null
+++ b/website_quotation_template/node_modules/asn1/package.json
@@ -0,0 +1,75 @@
+{
+ "_from": "asn1@~0.2.3",
+ "_id": "asn1@0.2.6",
+ "_inBundle": false,
+ "_integrity": "sha512-ix/FxPn0MDjeyJ7i/yoHGFt/EX6LyNbxSEhPPXODPL+KB0VPk86UYfL0lMdy+KCnv+fmvIzySwaK5COwqVbWTQ==",
+ "_location": "/asn1",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "asn1@~0.2.3",
+ "name": "asn1",
+ "escapedName": "asn1",
+ "rawSpec": "~0.2.3",
+ "saveSpec": null,
+ "fetchSpec": "~0.2.3"
+ },
+ "_requiredBy": [
+ "/sshpk"
+ ],
+ "_resolved": "https://registry.npmjs.org/asn1/-/asn1-0.2.6.tgz",
+ "_shasum": "0d3a7bb6e64e02a90c0303b31f292868ea09a08d",
+ "_spec": "asn1@~0.2.3",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/sshpk",
+ "author": {
+ "name": "Joyent",
+ "url": "joyent.com"
+ },
+ "bugs": {
+ "url": "https://github.com/joyent/node-asn1/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Mark Cavage",
+ "email": "mcavage@gmail.com"
+ },
+ {
+ "name": "David Gwynne",
+ "email": "loki@animata.net"
+ },
+ {
+ "name": "Yunong Xiao",
+ "email": "yunong@joyent.com"
+ },
+ {
+ "name": "Alex Wilson",
+ "email": "alex.wilson@joyent.com"
+ }
+ ],
+ "dependencies": {
+ "safer-buffer": "~2.1.0"
+ },
+ "deprecated": false,
+ "description": "Contains parsers and serializers for ASN.1 (currently BER only)",
+ "devDependencies": {
+ "eslint": "2.13.1",
+ "eslint-plugin-joyent": "~1.3.0",
+ "faucet": "0.0.1",
+ "istanbul": "^0.3.6",
+ "tape": "^3.5.0"
+ },
+ "homepage": "https://github.com/joyent/node-asn1#readme",
+ "license": "MIT",
+ "main": "lib/index.js",
+ "name": "asn1",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/joyent/node-asn1.git"
+ },
+ "scripts": {
+ "test": "tape ./test/ber/*.test.js"
+ },
+ "version": "0.2.6"
+}
diff --git a/website_quotation_template/node_modules/assert-plus/AUTHORS b/website_quotation_template/node_modules/assert-plus/AUTHORS
new file mode 100644
index 000000000..1923524fe
--- /dev/null
+++ b/website_quotation_template/node_modules/assert-plus/AUTHORS
@@ -0,0 +1,6 @@
+Dave Eddy
+Fred Kuo
+Lars-Magnus Skog
+Mark Cavage
+Patrick Mooney
+Rob Gulewich
diff --git a/website_quotation_template/node_modules/assert-plus/CHANGES.md b/website_quotation_template/node_modules/assert-plus/CHANGES.md
new file mode 100644
index 000000000..57d92bfdb
--- /dev/null
+++ b/website_quotation_template/node_modules/assert-plus/CHANGES.md
@@ -0,0 +1,14 @@
+# assert-plus Changelog
+
+## 1.0.0
+
+- *BREAKING* assert.number (and derivatives) now accept Infinity as valid input
+- Add assert.finite check. Previous assert.number callers should use this if
+ they expect Infinity inputs to throw.
+
+## 0.2.0
+
+- Fix `assert.object(null)` so it throws
+- Fix optional/arrayOf exports for non-type-of asserts
+- Add optiona/arrayOf exports for Stream/Date/Regex/uuid
+- Add basic unit test coverage
diff --git a/website_quotation_template/node_modules/assert-plus/README.md b/website_quotation_template/node_modules/assert-plus/README.md
new file mode 100644
index 000000000..ec200d161
--- /dev/null
+++ b/website_quotation_template/node_modules/assert-plus/README.md
@@ -0,0 +1,162 @@
+# assert-plus
+
+This library is a super small wrapper over node's assert module that has two
+things: (1) the ability to disable assertions with the environment variable
+NODE\_NDEBUG, and (2) some API wrappers for argument testing. Like
+`assert.string(myArg, 'myArg')`. As a simple example, most of my code looks
+like this:
+
+```javascript
+ var assert = require('assert-plus');
+
+ function fooAccount(options, callback) {
+ assert.object(options, 'options');
+ assert.number(options.id, 'options.id');
+ assert.bool(options.isManager, 'options.isManager');
+ assert.string(options.name, 'options.name');
+ assert.arrayOfString(options.email, 'options.email');
+ assert.func(callback, 'callback');
+
+ // Do stuff
+ callback(null, {});
+ }
+```
+
+# API
+
+All methods that *aren't* part of node's core assert API are simply assumed to
+take an argument, and then a string 'name' that's not a message; `AssertionError`
+will be thrown if the assertion fails with a message like:
+
+ AssertionError: foo (string) is required
+ at test (/home/mark/work/foo/foo.js:3:9)
+ at Object. (/home/mark/work/foo/foo.js:15:1)
+ at Module._compile (module.js:446:26)
+ at Object..js (module.js:464:10)
+ at Module.load (module.js:353:31)
+ at Function._load (module.js:311:12)
+ at Array.0 (module.js:484:10)
+ at EventEmitter._tickCallback (node.js:190:38)
+
+from:
+
+```javascript
+ function test(foo) {
+ assert.string(foo, 'foo');
+ }
+```
+
+There you go. You can check that arrays are of a homogeneous type with `Arrayof$Type`:
+
+```javascript
+ function test(foo) {
+ assert.arrayOfString(foo, 'foo');
+ }
+```
+
+You can assert IFF an argument is not `undefined` (i.e., an optional arg):
+
+```javascript
+ assert.optionalString(foo, 'foo');
+```
+
+Lastly, you can opt-out of assertion checking altogether by setting the
+environment variable `NODE_NDEBUG=1`. This is pseudo-useful if you have
+lots of assertions, and don't want to pay `typeof ()` taxes to v8 in
+production. Be advised: The standard functions re-exported from `assert` are
+also disabled in assert-plus if NDEBUG is specified. Using them directly from
+the `assert` module avoids this behavior.
+
+The complete list of APIs is:
+
+* assert.array
+* assert.bool
+* assert.buffer
+* assert.func
+* assert.number
+* assert.finite
+* assert.object
+* assert.string
+* assert.stream
+* assert.date
+* assert.regexp
+* assert.uuid
+* assert.arrayOfArray
+* assert.arrayOfBool
+* assert.arrayOfBuffer
+* assert.arrayOfFunc
+* assert.arrayOfNumber
+* assert.arrayOfFinite
+* assert.arrayOfObject
+* assert.arrayOfString
+* assert.arrayOfStream
+* assert.arrayOfDate
+* assert.arrayOfRegexp
+* assert.arrayOfUuid
+* assert.optionalArray
+* assert.optionalBool
+* assert.optionalBuffer
+* assert.optionalFunc
+* assert.optionalNumber
+* assert.optionalFinite
+* assert.optionalObject
+* assert.optionalString
+* assert.optionalStream
+* assert.optionalDate
+* assert.optionalRegexp
+* assert.optionalUuid
+* assert.optionalArrayOfArray
+* assert.optionalArrayOfBool
+* assert.optionalArrayOfBuffer
+* assert.optionalArrayOfFunc
+* assert.optionalArrayOfNumber
+* assert.optionalArrayOfFinite
+* assert.optionalArrayOfObject
+* assert.optionalArrayOfString
+* assert.optionalArrayOfStream
+* assert.optionalArrayOfDate
+* assert.optionalArrayOfRegexp
+* assert.optionalArrayOfUuid
+* assert.AssertionError
+* assert.fail
+* assert.ok
+* assert.equal
+* assert.notEqual
+* assert.deepEqual
+* assert.notDeepEqual
+* assert.strictEqual
+* assert.notStrictEqual
+* assert.throws
+* assert.doesNotThrow
+* assert.ifError
+
+# Installation
+
+ npm install assert-plus
+
+## License
+
+The MIT License (MIT)
+Copyright (c) 2012 Mark Cavage
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of
+the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
+
+## Bugs
+
+See .
diff --git a/website_quotation_template/node_modules/assert-plus/assert.js b/website_quotation_template/node_modules/assert-plus/assert.js
new file mode 100644
index 000000000..26f944eec
--- /dev/null
+++ b/website_quotation_template/node_modules/assert-plus/assert.js
@@ -0,0 +1,211 @@
+// Copyright (c) 2012, Mark Cavage. All rights reserved.
+// Copyright 2015 Joyent, Inc.
+
+var assert = require('assert');
+var Stream = require('stream').Stream;
+var util = require('util');
+
+
+///--- Globals
+
+/* JSSTYLED */
+var UUID_REGEXP = /^[a-fA-F0-9]{8}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{4}-[a-fA-F0-9]{12}$/;
+
+
+///--- Internal
+
+function _capitalize(str) {
+ return (str.charAt(0).toUpperCase() + str.slice(1));
+}
+
+function _toss(name, expected, oper, arg, actual) {
+ throw new assert.AssertionError({
+ message: util.format('%s (%s) is required', name, expected),
+ actual: (actual === undefined) ? typeof (arg) : actual(arg),
+ expected: expected,
+ operator: oper || '===',
+ stackStartFunction: _toss.caller
+ });
+}
+
+function _getClass(arg) {
+ return (Object.prototype.toString.call(arg).slice(8, -1));
+}
+
+function noop() {
+ // Why even bother with asserts?
+}
+
+
+///--- Exports
+
+var types = {
+ bool: {
+ check: function (arg) { return typeof (arg) === 'boolean'; }
+ },
+ func: {
+ check: function (arg) { return typeof (arg) === 'function'; }
+ },
+ string: {
+ check: function (arg) { return typeof (arg) === 'string'; }
+ },
+ object: {
+ check: function (arg) {
+ return typeof (arg) === 'object' && arg !== null;
+ }
+ },
+ number: {
+ check: function (arg) {
+ return typeof (arg) === 'number' && !isNaN(arg);
+ }
+ },
+ finite: {
+ check: function (arg) {
+ return typeof (arg) === 'number' && !isNaN(arg) && isFinite(arg);
+ }
+ },
+ buffer: {
+ check: function (arg) { return Buffer.isBuffer(arg); },
+ operator: 'Buffer.isBuffer'
+ },
+ array: {
+ check: function (arg) { return Array.isArray(arg); },
+ operator: 'Array.isArray'
+ },
+ stream: {
+ check: function (arg) { return arg instanceof Stream; },
+ operator: 'instanceof',
+ actual: _getClass
+ },
+ date: {
+ check: function (arg) { return arg instanceof Date; },
+ operator: 'instanceof',
+ actual: _getClass
+ },
+ regexp: {
+ check: function (arg) { return arg instanceof RegExp; },
+ operator: 'instanceof',
+ actual: _getClass
+ },
+ uuid: {
+ check: function (arg) {
+ return typeof (arg) === 'string' && UUID_REGEXP.test(arg);
+ },
+ operator: 'isUUID'
+ }
+};
+
+function _setExports(ndebug) {
+ var keys = Object.keys(types);
+ var out;
+
+ /* re-export standard assert */
+ if (process.env.NODE_NDEBUG) {
+ out = noop;
+ } else {
+ out = function (arg, msg) {
+ if (!arg) {
+ _toss(msg, 'true', arg);
+ }
+ };
+ }
+
+ /* standard checks */
+ keys.forEach(function (k) {
+ if (ndebug) {
+ out[k] = noop;
+ return;
+ }
+ var type = types[k];
+ out[k] = function (arg, msg) {
+ if (!type.check(arg)) {
+ _toss(msg, k, type.operator, arg, type.actual);
+ }
+ };
+ });
+
+ /* optional checks */
+ keys.forEach(function (k) {
+ var name = 'optional' + _capitalize(k);
+ if (ndebug) {
+ out[name] = noop;
+ return;
+ }
+ var type = types[k];
+ out[name] = function (arg, msg) {
+ if (arg === undefined || arg === null) {
+ return;
+ }
+ if (!type.check(arg)) {
+ _toss(msg, k, type.operator, arg, type.actual);
+ }
+ };
+ });
+
+ /* arrayOf checks */
+ keys.forEach(function (k) {
+ var name = 'arrayOf' + _capitalize(k);
+ if (ndebug) {
+ out[name] = noop;
+ return;
+ }
+ var type = types[k];
+ var expected = '[' + k + ']';
+ out[name] = function (arg, msg) {
+ if (!Array.isArray(arg)) {
+ _toss(msg, expected, type.operator, arg, type.actual);
+ }
+ var i;
+ for (i = 0; i < arg.length; i++) {
+ if (!type.check(arg[i])) {
+ _toss(msg, expected, type.operator, arg, type.actual);
+ }
+ }
+ };
+ });
+
+ /* optionalArrayOf checks */
+ keys.forEach(function (k) {
+ var name = 'optionalArrayOf' + _capitalize(k);
+ if (ndebug) {
+ out[name] = noop;
+ return;
+ }
+ var type = types[k];
+ var expected = '[' + k + ']';
+ out[name] = function (arg, msg) {
+ if (arg === undefined || arg === null) {
+ return;
+ }
+ if (!Array.isArray(arg)) {
+ _toss(msg, expected, type.operator, arg, type.actual);
+ }
+ var i;
+ for (i = 0; i < arg.length; i++) {
+ if (!type.check(arg[i])) {
+ _toss(msg, expected, type.operator, arg, type.actual);
+ }
+ }
+ };
+ });
+
+ /* re-export built-in assertions */
+ Object.keys(assert).forEach(function (k) {
+ if (k === 'AssertionError') {
+ out[k] = assert[k];
+ return;
+ }
+ if (ndebug) {
+ out[k] = noop;
+ return;
+ }
+ out[k] = assert[k];
+ });
+
+ /* export ourselves (for unit tests _only_) */
+ out._setExports = _setExports;
+
+ return out;
+}
+
+module.exports = _setExports(process.env.NODE_NDEBUG);
diff --git a/website_quotation_template/node_modules/assert-plus/package.json b/website_quotation_template/node_modules/assert-plus/package.json
new file mode 100644
index 000000000..2496d6c9b
--- /dev/null
+++ b/website_quotation_template/node_modules/assert-plus/package.json
@@ -0,0 +1,87 @@
+{
+ "_from": "assert-plus@^1.0.0",
+ "_id": "assert-plus@1.0.0",
+ "_inBundle": false,
+ "_integrity": "sha512-NfJ4UzBCcQGLDlQq7nHxH+tv3kyZ0hHQqF5BO6J7tNJeP5do1llPr8dZ8zHonfhAu0PHAdMkSo+8o0wxg9lZWw==",
+ "_location": "/assert-plus",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "assert-plus@^1.0.0",
+ "name": "assert-plus",
+ "escapedName": "assert-plus",
+ "rawSpec": "^1.0.0",
+ "saveSpec": null,
+ "fetchSpec": "^1.0.0"
+ },
+ "_requiredBy": [
+ "/dashdash",
+ "/getpass",
+ "/http-signature",
+ "/jsprim",
+ "/sshpk",
+ "/verror"
+ ],
+ "_resolved": "https://registry.npmjs.org/assert-plus/-/assert-plus-1.0.0.tgz",
+ "_shasum": "f12e0f3c5d77b0b1cdd9146942e4e96c1e4dd525",
+ "_spec": "assert-plus@^1.0.0",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/http-signature",
+ "author": {
+ "name": "Mark Cavage",
+ "email": "mcavage@gmail.com"
+ },
+ "bugs": {
+ "url": "https://github.com/mcavage/node-assert-plus/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Dave Eddy",
+ "email": "dave@daveeddy.com"
+ },
+ {
+ "name": "Fred Kuo",
+ "email": "fred.kuo@joyent.com"
+ },
+ {
+ "name": "Lars-Magnus Skog",
+ "email": "ralphtheninja@riseup.net"
+ },
+ {
+ "name": "Mark Cavage",
+ "email": "mcavage@gmail.com"
+ },
+ {
+ "name": "Patrick Mooney",
+ "email": "pmooney@pfmooney.com"
+ },
+ {
+ "name": "Rob Gulewich",
+ "email": "robert.gulewich@joyent.com"
+ }
+ ],
+ "dependencies": {},
+ "deprecated": false,
+ "description": "Extra assertions on top of node's assert module",
+ "devDependencies": {
+ "faucet": "0.0.1",
+ "tape": "4.2.2"
+ },
+ "engines": {
+ "node": ">=0.8"
+ },
+ "homepage": "https://github.com/mcavage/node-assert-plus#readme",
+ "license": "MIT",
+ "main": "./assert.js",
+ "name": "assert-plus",
+ "optionalDependencies": {},
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/mcavage/node-assert-plus.git"
+ },
+ "scripts": {
+ "test": "tape tests/*.js | ./node_modules/.bin/faucet"
+ },
+ "version": "1.0.0"
+}
diff --git a/website_quotation_template/node_modules/asynckit/LICENSE b/website_quotation_template/node_modules/asynckit/LICENSE
new file mode 100644
index 000000000..c9eca5dd9
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2016 Alex Indigo
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/website_quotation_template/node_modules/asynckit/README.md b/website_quotation_template/node_modules/asynckit/README.md
new file mode 100644
index 000000000..ddcc7e6b9
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/README.md
@@ -0,0 +1,233 @@
+# asynckit [](https://www.npmjs.com/package/asynckit)
+
+Minimal async jobs utility library, with streams support.
+
+[](https://travis-ci.org/alexindigo/asynckit)
+[](https://travis-ci.org/alexindigo/asynckit)
+[](https://ci.appveyor.com/project/alexindigo/asynckit)
+
+[](https://coveralls.io/github/alexindigo/asynckit?branch=master)
+[](https://david-dm.org/alexindigo/asynckit)
+[](https://www.bithound.io/github/alexindigo/asynckit)
+
+
+
+AsyncKit provides harness for `parallel` and `serial` iterators over list of items represented by arrays or objects.
+Optionally it accepts abort function (should be synchronously return by iterator for each item), and terminates left over jobs upon an error event. For specific iteration order built-in (`ascending` and `descending`) and custom sort helpers also supported, via `asynckit.serialOrdered` method.
+
+It ensures async operations to keep behavior more stable and prevent `Maximum call stack size exceeded` errors, from sync iterators.
+
+| compression | size |
+| :----------------- | -------: |
+| asynckit.js | 12.34 kB |
+| asynckit.min.js | 4.11 kB |
+| asynckit.min.js.gz | 1.47 kB |
+
+
+## Install
+
+```sh
+$ npm install --save asynckit
+```
+
+## Examples
+
+### Parallel Jobs
+
+Runs iterator over provided array in parallel. Stores output in the `result` array,
+on the matching positions. In unlikely event of an error from one of the jobs,
+will terminate rest of the active jobs (if abort function is provided)
+and return error along with salvaged data to the main callback function.
+
+#### Input Array
+
+```javascript
+var parallel = require('asynckit').parallel
+ , assert = require('assert')
+ ;
+
+var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ]
+ , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ]
+ , expectedTarget = [ 1, 1, 2, 4, 8, 16, 32, 64 ]
+ , target = []
+ ;
+
+parallel(source, asyncJob, function(err, result)
+{
+ assert.deepEqual(result, expectedResult);
+ assert.deepEqual(target, expectedTarget);
+});
+
+// async job accepts one element from the array
+// and a callback function
+function asyncJob(item, cb)
+{
+ // different delays (in ms) per item
+ var delay = item * 25;
+
+ // pretend different jobs take different time to finish
+ // and not in consequential order
+ var timeoutId = setTimeout(function() {
+ target.push(item);
+ cb(null, item * 2);
+ }, delay);
+
+ // allow to cancel "leftover" jobs upon error
+ // return function, invoking of which will abort this job
+ return clearTimeout.bind(null, timeoutId);
+}
+```
+
+More examples could be found in [test/test-parallel-array.js](test/test-parallel-array.js).
+
+#### Input Object
+
+Also it supports named jobs, listed via object.
+
+```javascript
+var parallel = require('asynckit/parallel')
+ , assert = require('assert')
+ ;
+
+var source = { first: 1, one: 1, four: 4, sixteen: 16, sixtyFour: 64, thirtyTwo: 32, eight: 8, two: 2 }
+ , expectedResult = { first: 2, one: 2, four: 8, sixteen: 32, sixtyFour: 128, thirtyTwo: 64, eight: 16, two: 4 }
+ , expectedTarget = [ 1, 1, 2, 4, 8, 16, 32, 64 ]
+ , expectedKeys = [ 'first', 'one', 'two', 'four', 'eight', 'sixteen', 'thirtyTwo', 'sixtyFour' ]
+ , target = []
+ , keys = []
+ ;
+
+parallel(source, asyncJob, function(err, result)
+{
+ assert.deepEqual(result, expectedResult);
+ assert.deepEqual(target, expectedTarget);
+ assert.deepEqual(keys, expectedKeys);
+});
+
+// supports full value, key, callback (shortcut) interface
+function asyncJob(item, key, cb)
+{
+ // different delays (in ms) per item
+ var delay = item * 25;
+
+ // pretend different jobs take different time to finish
+ // and not in consequential order
+ var timeoutId = setTimeout(function() {
+ keys.push(key);
+ target.push(item);
+ cb(null, item * 2);
+ }, delay);
+
+ // allow to cancel "leftover" jobs upon error
+ // return function, invoking of which will abort this job
+ return clearTimeout.bind(null, timeoutId);
+}
+```
+
+More examples could be found in [test/test-parallel-object.js](test/test-parallel-object.js).
+
+### Serial Jobs
+
+Runs iterator over provided array sequentially. Stores output in the `result` array,
+on the matching positions. In unlikely event of an error from one of the jobs,
+will not proceed to the rest of the items in the list
+and return error along with salvaged data to the main callback function.
+
+#### Input Array
+
+```javascript
+var serial = require('asynckit/serial')
+ , assert = require('assert')
+ ;
+
+var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ]
+ , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ]
+ , expectedTarget = [ 0, 1, 2, 3, 4, 5, 6, 7 ]
+ , target = []
+ ;
+
+serial(source, asyncJob, function(err, result)
+{
+ assert.deepEqual(result, expectedResult);
+ assert.deepEqual(target, expectedTarget);
+});
+
+// extended interface (item, key, callback)
+// also supported for arrays
+function asyncJob(item, key, cb)
+{
+ target.push(key);
+
+ // it will be automatically made async
+ // even it iterator "returns" in the same event loop
+ cb(null, item * 2);
+}
+```
+
+More examples could be found in [test/test-serial-array.js](test/test-serial-array.js).
+
+#### Input Object
+
+Also it supports named jobs, listed via object.
+
+```javascript
+var serial = require('asynckit').serial
+ , assert = require('assert')
+ ;
+
+var source = [ 1, 1, 4, 16, 64, 32, 8, 2 ]
+ , expectedResult = [ 2, 2, 8, 32, 128, 64, 16, 4 ]
+ , expectedTarget = [ 0, 1, 2, 3, 4, 5, 6, 7 ]
+ , target = []
+ ;
+
+var source = { first: 1, one: 1, four: 4, sixteen: 16, sixtyFour: 64, thirtyTwo: 32, eight: 8, two: 2 }
+ , expectedResult = { first: 2, one: 2, four: 8, sixteen: 32, sixtyFour: 128, thirtyTwo: 64, eight: 16, two: 4 }
+ , expectedTarget = [ 1, 1, 4, 16, 64, 32, 8, 2 ]
+ , target = []
+ ;
+
+
+serial(source, asyncJob, function(err, result)
+{
+ assert.deepEqual(result, expectedResult);
+ assert.deepEqual(target, expectedTarget);
+});
+
+// shortcut interface (item, callback)
+// works for object as well as for the arrays
+function asyncJob(item, cb)
+{
+ target.push(item);
+
+ // it will be automatically made async
+ // even it iterator "returns" in the same event loop
+ cb(null, item * 2);
+}
+```
+
+More examples could be found in [test/test-serial-object.js](test/test-serial-object.js).
+
+_Note: Since _object_ is an _unordered_ collection of properties,
+it may produce unexpected results with sequential iterations.
+Whenever order of the jobs' execution is important please use `serialOrdered` method._
+
+### Ordered Serial Iterations
+
+TBD
+
+For example [compare-property](compare-property) package.
+
+### Streaming interface
+
+TBD
+
+## Want to Know More?
+
+More examples can be found in [test folder](test/).
+
+Or open an [issue](https://github.com/alexindigo/asynckit/issues) with questions and/or suggestions.
+
+## License
+
+AsyncKit is licensed under the MIT license.
diff --git a/website_quotation_template/node_modules/asynckit/bench.js b/website_quotation_template/node_modules/asynckit/bench.js
new file mode 100644
index 000000000..c612f1a55
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/bench.js
@@ -0,0 +1,76 @@
+/* eslint no-console: "off" */
+
+var asynckit = require('./')
+ , async = require('async')
+ , assert = require('assert')
+ , expected = 0
+ ;
+
+var Benchmark = require('benchmark');
+var suite = new Benchmark.Suite;
+
+var source = [];
+for (var z = 1; z < 100; z++)
+{
+ source.push(z);
+ expected += z;
+}
+
+suite
+// add tests
+
+.add('async.map', function(deferred)
+{
+ var total = 0;
+
+ async.map(source,
+ function(i, cb)
+ {
+ setImmediate(function()
+ {
+ total += i;
+ cb(null, total);
+ });
+ },
+ function(err, result)
+ {
+ assert.ifError(err);
+ assert.equal(result[result.length - 1], expected);
+ deferred.resolve();
+ });
+}, {'defer': true})
+
+
+.add('asynckit.parallel', function(deferred)
+{
+ var total = 0;
+
+ asynckit.parallel(source,
+ function(i, cb)
+ {
+ setImmediate(function()
+ {
+ total += i;
+ cb(null, total);
+ });
+ },
+ function(err, result)
+ {
+ assert.ifError(err);
+ assert.equal(result[result.length - 1], expected);
+ deferred.resolve();
+ });
+}, {'defer': true})
+
+
+// add listeners
+.on('cycle', function(ev)
+{
+ console.log(String(ev.target));
+})
+.on('complete', function()
+{
+ console.log('Fastest is ' + this.filter('fastest').map('name'));
+})
+// run async
+.run({ 'async': true });
diff --git a/website_quotation_template/node_modules/asynckit/index.js b/website_quotation_template/node_modules/asynckit/index.js
new file mode 100644
index 000000000..455f9454e
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/index.js
@@ -0,0 +1,6 @@
+module.exports =
+{
+ parallel : require('./parallel.js'),
+ serial : require('./serial.js'),
+ serialOrdered : require('./serialOrdered.js')
+};
diff --git a/website_quotation_template/node_modules/asynckit/lib/abort.js b/website_quotation_template/node_modules/asynckit/lib/abort.js
new file mode 100644
index 000000000..114367e5f
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/lib/abort.js
@@ -0,0 +1,29 @@
+// API
+module.exports = abort;
+
+/**
+ * Aborts leftover active jobs
+ *
+ * @param {object} state - current state object
+ */
+function abort(state)
+{
+ Object.keys(state.jobs).forEach(clean.bind(state));
+
+ // reset leftover jobs
+ state.jobs = {};
+}
+
+/**
+ * Cleans up leftover job by invoking abort function for the provided job id
+ *
+ * @this state
+ * @param {string|number} key - job id to abort
+ */
+function clean(key)
+{
+ if (typeof this.jobs[key] == 'function')
+ {
+ this.jobs[key]();
+ }
+}
diff --git a/website_quotation_template/node_modules/asynckit/lib/async.js b/website_quotation_template/node_modules/asynckit/lib/async.js
new file mode 100644
index 000000000..7f1288a4c
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/lib/async.js
@@ -0,0 +1,34 @@
+var defer = require('./defer.js');
+
+// API
+module.exports = async;
+
+/**
+ * Runs provided callback asynchronously
+ * even if callback itself is not
+ *
+ * @param {function} callback - callback to invoke
+ * @returns {function} - augmented callback
+ */
+function async(callback)
+{
+ var isAsync = false;
+
+ // check if async happened
+ defer(function() { isAsync = true; });
+
+ return function async_callback(err, result)
+ {
+ if (isAsync)
+ {
+ callback(err, result);
+ }
+ else
+ {
+ defer(function nextTick_callback()
+ {
+ callback(err, result);
+ });
+ }
+ };
+}
diff --git a/website_quotation_template/node_modules/asynckit/lib/defer.js b/website_quotation_template/node_modules/asynckit/lib/defer.js
new file mode 100644
index 000000000..b67110c7a
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/lib/defer.js
@@ -0,0 +1,26 @@
+module.exports = defer;
+
+/**
+ * Runs provided function on next iteration of the event loop
+ *
+ * @param {function} fn - function to run
+ */
+function defer(fn)
+{
+ var nextTick = typeof setImmediate == 'function'
+ ? setImmediate
+ : (
+ typeof process == 'object' && typeof process.nextTick == 'function'
+ ? process.nextTick
+ : null
+ );
+
+ if (nextTick)
+ {
+ nextTick(fn);
+ }
+ else
+ {
+ setTimeout(fn, 0);
+ }
+}
diff --git a/website_quotation_template/node_modules/asynckit/lib/iterate.js b/website_quotation_template/node_modules/asynckit/lib/iterate.js
new file mode 100644
index 000000000..5d2839a59
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/lib/iterate.js
@@ -0,0 +1,75 @@
+var async = require('./async.js')
+ , abort = require('./abort.js')
+ ;
+
+// API
+module.exports = iterate;
+
+/**
+ * Iterates over each job object
+ *
+ * @param {array|object} list - array or object (named list) to iterate over
+ * @param {function} iterator - iterator to run
+ * @param {object} state - current job status
+ * @param {function} callback - invoked when all elements processed
+ */
+function iterate(list, iterator, state, callback)
+{
+ // store current index
+ var key = state['keyedList'] ? state['keyedList'][state.index] : state.index;
+
+ state.jobs[key] = runJob(iterator, key, list[key], function(error, output)
+ {
+ // don't repeat yourself
+ // skip secondary callbacks
+ if (!(key in state.jobs))
+ {
+ return;
+ }
+
+ // clean up jobs
+ delete state.jobs[key];
+
+ if (error)
+ {
+ // don't process rest of the results
+ // stop still active jobs
+ // and reset the list
+ abort(state);
+ }
+ else
+ {
+ state.results[key] = output;
+ }
+
+ // return salvaged results
+ callback(error, state.results);
+ });
+}
+
+/**
+ * Runs iterator over provided job element
+ *
+ * @param {function} iterator - iterator to invoke
+ * @param {string|number} key - key/index of the element in the list of jobs
+ * @param {mixed} item - job description
+ * @param {function} callback - invoked after iterator is done with the job
+ * @returns {function|mixed} - job abort function or something else
+ */
+function runJob(iterator, key, item, callback)
+{
+ var aborter;
+
+ // allow shortcut if iterator expects only two arguments
+ if (iterator.length == 2)
+ {
+ aborter = iterator(item, async(callback));
+ }
+ // otherwise go with full three arguments
+ else
+ {
+ aborter = iterator(item, key, async(callback));
+ }
+
+ return aborter;
+}
diff --git a/website_quotation_template/node_modules/asynckit/lib/readable_asynckit.js b/website_quotation_template/node_modules/asynckit/lib/readable_asynckit.js
new file mode 100644
index 000000000..78ad240f0
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/lib/readable_asynckit.js
@@ -0,0 +1,91 @@
+var streamify = require('./streamify.js')
+ , defer = require('./defer.js')
+ ;
+
+// API
+module.exports = ReadableAsyncKit;
+
+/**
+ * Base constructor for all streams
+ * used to hold properties/methods
+ */
+function ReadableAsyncKit()
+{
+ ReadableAsyncKit.super_.apply(this, arguments);
+
+ // list of active jobs
+ this.jobs = {};
+
+ // add stream methods
+ this.destroy = destroy;
+ this._start = _start;
+ this._read = _read;
+}
+
+/**
+ * Destroys readable stream,
+ * by aborting outstanding jobs
+ *
+ * @returns {void}
+ */
+function destroy()
+{
+ if (this.destroyed)
+ {
+ return;
+ }
+
+ this.destroyed = true;
+
+ if (typeof this.terminator == 'function')
+ {
+ this.terminator();
+ }
+}
+
+/**
+ * Starts provided jobs in async manner
+ *
+ * @private
+ */
+function _start()
+{
+ // first argument – runner function
+ var runner = arguments[0]
+ // take away first argument
+ , args = Array.prototype.slice.call(arguments, 1)
+ // second argument - input data
+ , input = args[0]
+ // last argument - result callback
+ , endCb = streamify.callback.call(this, args[args.length - 1])
+ ;
+
+ args[args.length - 1] = endCb;
+ // third argument - iterator
+ args[1] = streamify.iterator.call(this, args[1]);
+
+ // allow time for proper setup
+ defer(function()
+ {
+ if (!this.destroyed)
+ {
+ this.terminator = runner.apply(null, args);
+ }
+ else
+ {
+ endCb(null, Array.isArray(input) ? [] : {});
+ }
+ }.bind(this));
+}
+
+
+/**
+ * Implement _read to comply with Readable streams
+ * Doesn't really make sense for flowing object mode
+ *
+ * @private
+ */
+function _read()
+{
+
+}
diff --git a/website_quotation_template/node_modules/asynckit/lib/readable_parallel.js b/website_quotation_template/node_modules/asynckit/lib/readable_parallel.js
new file mode 100644
index 000000000..5d2929f7a
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/lib/readable_parallel.js
@@ -0,0 +1,25 @@
+var parallel = require('../parallel.js');
+
+// API
+module.exports = ReadableParallel;
+
+/**
+ * Streaming wrapper to `asynckit.parallel`
+ *
+ * @param {array|object} list - array or object (named list) to iterate over
+ * @param {function} iterator - iterator to run
+ * @param {function} callback - invoked when all elements processed
+ * @returns {stream.Readable#}
+ */
+function ReadableParallel(list, iterator, callback)
+{
+ if (!(this instanceof ReadableParallel))
+ {
+ return new ReadableParallel(list, iterator, callback);
+ }
+
+ // turn on object mode
+ ReadableParallel.super_.call(this, {objectMode: true});
+
+ this._start(parallel, list, iterator, callback);
+}
diff --git a/website_quotation_template/node_modules/asynckit/lib/readable_serial.js b/website_quotation_template/node_modules/asynckit/lib/readable_serial.js
new file mode 100644
index 000000000..782269820
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/lib/readable_serial.js
@@ -0,0 +1,25 @@
+var serial = require('../serial.js');
+
+// API
+module.exports = ReadableSerial;
+
+/**
+ * Streaming wrapper to `asynckit.serial`
+ *
+ * @param {array|object} list - array or object (named list) to iterate over
+ * @param {function} iterator - iterator to run
+ * @param {function} callback - invoked when all elements processed
+ * @returns {stream.Readable#}
+ */
+function ReadableSerial(list, iterator, callback)
+{
+ if (!(this instanceof ReadableSerial))
+ {
+ return new ReadableSerial(list, iterator, callback);
+ }
+
+ // turn on object mode
+ ReadableSerial.super_.call(this, {objectMode: true});
+
+ this._start(serial, list, iterator, callback);
+}
diff --git a/website_quotation_template/node_modules/asynckit/lib/readable_serial_ordered.js b/website_quotation_template/node_modules/asynckit/lib/readable_serial_ordered.js
new file mode 100644
index 000000000..3de89c472
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/lib/readable_serial_ordered.js
@@ -0,0 +1,29 @@
+var serialOrdered = require('../serialOrdered.js');
+
+// API
+module.exports = ReadableSerialOrdered;
+// expose sort helpers
+module.exports.ascending = serialOrdered.ascending;
+module.exports.descending = serialOrdered.descending;
+
+/**
+ * Streaming wrapper to `asynckit.serialOrdered`
+ *
+ * @param {array|object} list - array or object (named list) to iterate over
+ * @param {function} iterator - iterator to run
+ * @param {function} sortMethod - custom sort function
+ * @param {function} callback - invoked when all elements processed
+ * @returns {stream.Readable#}
+ */
+function ReadableSerialOrdered(list, iterator, sortMethod, callback)
+{
+ if (!(this instanceof ReadableSerialOrdered))
+ {
+ return new ReadableSerialOrdered(list, iterator, sortMethod, callback);
+ }
+
+ // turn on object mode
+ ReadableSerialOrdered.super_.call(this, {objectMode: true});
+
+ this._start(serialOrdered, list, iterator, sortMethod, callback);
+}
diff --git a/website_quotation_template/node_modules/asynckit/lib/state.js b/website_quotation_template/node_modules/asynckit/lib/state.js
new file mode 100644
index 000000000..cbea7ad8f
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/lib/state.js
@@ -0,0 +1,37 @@
+// API
+module.exports = state;
+
+/**
+ * Creates initial state object
+ * for iteration over list
+ *
+ * @param {array|object} list - list to iterate over
+ * @param {function|null} sortMethod - function to use for keys sort,
+ * or `null` to keep them as is
+ * @returns {object} - initial state object
+ */
+function state(list, sortMethod)
+{
+ var isNamedList = !Array.isArray(list)
+ , initState =
+ {
+ index : 0,
+ keyedList: isNamedList || sortMethod ? Object.keys(list) : null,
+ jobs : {},
+ results : isNamedList ? {} : [],
+ size : isNamedList ? Object.keys(list).length : list.length
+ }
+ ;
+
+ if (sortMethod)
+ {
+ // sort array keys based on it's values
+ // sort object's keys just on own merit
+ initState.keyedList.sort(isNamedList ? sortMethod : function(a, b)
+ {
+ return sortMethod(list[a], list[b]);
+ });
+ }
+
+ return initState;
+}
diff --git a/website_quotation_template/node_modules/asynckit/lib/streamify.js b/website_quotation_template/node_modules/asynckit/lib/streamify.js
new file mode 100644
index 000000000..f56a1c92b
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/lib/streamify.js
@@ -0,0 +1,141 @@
+var async = require('./async.js');
+
+// API
+module.exports = {
+ iterator: wrapIterator,
+ callback: wrapCallback
+};
+
+/**
+ * Wraps iterators with long signature
+ *
+ * @this ReadableAsyncKit#
+ * @param {function} iterator - function to wrap
+ * @returns {function} - wrapped function
+ */
+function wrapIterator(iterator)
+{
+ var stream = this;
+
+ return function(item, key, cb)
+ {
+ var aborter
+ , wrappedCb = async(wrapIteratorCallback.call(stream, cb, key))
+ ;
+
+ stream.jobs[key] = wrappedCb;
+
+ // it's either shortcut (item, cb)
+ if (iterator.length == 2)
+ {
+ aborter = iterator(item, wrappedCb);
+ }
+ // or long format (item, key, cb)
+ else
+ {
+ aborter = iterator(item, key, wrappedCb);
+ }
+
+ return aborter;
+ };
+}
+
+/**
+ * Wraps provided callback function
+ * allowing to execute snitch function before
+ * real callback
+ *
+ * @this ReadableAsyncKit#
+ * @param {function} callback - function to wrap
+ * @returns {function} - wrapped function
+ */
+function wrapCallback(callback)
+{
+ var stream = this;
+
+ var wrapped = function(error, result)
+ {
+ return finisher.call(stream, error, result, callback);
+ };
+
+ return wrapped;
+}
+
+/**
+ * Wraps provided iterator callback function
+ * makes sure snitch only called once,
+ * but passes secondary calls to the original callback
+ *
+ * @this ReadableAsyncKit#
+ * @param {function} callback - callback to wrap
+ * @param {number|string} key - iteration key
+ * @returns {function} wrapped callback
+ */
+function wrapIteratorCallback(callback, key)
+{
+ var stream = this;
+
+ return function(error, output)
+ {
+ // don't repeat yourself
+ if (!(key in stream.jobs))
+ {
+ callback(error, output);
+ return;
+ }
+
+ // clean up jobs
+ delete stream.jobs[key];
+
+ return streamer.call(stream, error, {key: key, value: output}, callback);
+ };
+}
+
+/**
+ * Stream wrapper for iterator callback
+ *
+ * @this ReadableAsyncKit#
+ * @param {mixed} error - error response
+ * @param {mixed} output - iterator output
+ * @param {function} callback - callback that expects iterator results
+ */
+function streamer(error, output, callback)
+{
+ if (error && !this.error)
+ {
+ this.error = error;
+ this.pause();
+ this.emit('error', error);
+ // send back value only, as expected
+ callback(error, output && output.value);
+ return;
+ }
+
+ // stream stuff
+ this.push(output);
+
+ // back to original track
+ // send back value only, as expected
+ callback(error, output && output.value);
+}
+
+/**
+ * Stream wrapper for finishing callback
+ *
+ * @this ReadableAsyncKit#
+ * @param {mixed} error - error response
+ * @param {mixed} output - iterator output
+ * @param {function} callback - callback that expects final results
+ */
+function finisher(error, output, callback)
+{
+ // signal end of the stream
+ // only for successfully finished streams
+ if (!error)
+ {
+ this.push(null);
+ }
+
+ // back to original track
+ callback(error, output);
+}
diff --git a/website_quotation_template/node_modules/asynckit/lib/terminator.js b/website_quotation_template/node_modules/asynckit/lib/terminator.js
new file mode 100644
index 000000000..d6eb99219
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/lib/terminator.js
@@ -0,0 +1,29 @@
+var abort = require('./abort.js')
+ , async = require('./async.js')
+ ;
+
+// API
+module.exports = terminator;
+
+/**
+ * Terminates jobs in the attached state context
+ *
+ * @this AsyncKitState#
+ * @param {function} callback - final callback to invoke after termination
+ */
+function terminator(callback)
+{
+ if (!Object.keys(this.jobs).length)
+ {
+ return;
+ }
+
+ // fast forward iteration index
+ this.index = this.size;
+
+ // abort jobs
+ abort(this);
+
+ // send back results we have so far
+ async(callback)(null, this.results);
+}
diff --git a/website_quotation_template/node_modules/asynckit/package.json b/website_quotation_template/node_modules/asynckit/package.json
new file mode 100644
index 000000000..b7f6d1e43
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/package.json
@@ -0,0 +1,91 @@
+{
+ "_from": "asynckit@^0.4.0",
+ "_id": "asynckit@0.4.0",
+ "_inBundle": false,
+ "_integrity": "sha512-Oei9OH4tRh0YqU3GxhX79dM/mwVgvbZJaSNaRk+bshkj0S5cfHcgYakreBjrHwatXKbz+IoIdYLxrKim2MjW0Q==",
+ "_location": "/asynckit",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "asynckit@^0.4.0",
+ "name": "asynckit",
+ "escapedName": "asynckit",
+ "rawSpec": "^0.4.0",
+ "saveSpec": null,
+ "fetchSpec": "^0.4.0"
+ },
+ "_requiredBy": [
+ "/form-data"
+ ],
+ "_resolved": "https://registry.npmjs.org/asynckit/-/asynckit-0.4.0.tgz",
+ "_shasum": "c79ed97f7f34cb8f2ba1bc9790bcc366474b4b79",
+ "_spec": "asynckit@^0.4.0",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/form-data",
+ "author": {
+ "name": "Alex Indigo",
+ "email": "iam@alexindigo.com"
+ },
+ "bugs": {
+ "url": "https://github.com/alexindigo/asynckit/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {},
+ "deprecated": false,
+ "description": "Minimal async jobs utility library, with streams support",
+ "devDependencies": {
+ "browserify": "^13.0.0",
+ "browserify-istanbul": "^2.0.0",
+ "coveralls": "^2.11.9",
+ "eslint": "^2.9.0",
+ "istanbul": "^0.4.3",
+ "obake": "^0.1.2",
+ "phantomjs-prebuilt": "^2.1.7",
+ "pre-commit": "^1.1.3",
+ "reamde": "^1.1.0",
+ "rimraf": "^2.5.2",
+ "size-table": "^0.2.0",
+ "tap-spec": "^4.1.1",
+ "tape": "^4.5.1"
+ },
+ "homepage": "https://github.com/alexindigo/asynckit#readme",
+ "keywords": [
+ "async",
+ "jobs",
+ "parallel",
+ "serial",
+ "iterator",
+ "array",
+ "object",
+ "stream",
+ "destroy",
+ "terminate",
+ "abort"
+ ],
+ "license": "MIT",
+ "main": "index.js",
+ "name": "asynckit",
+ "pre-commit": [
+ "clean",
+ "lint",
+ "test",
+ "browser",
+ "report",
+ "size"
+ ],
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/alexindigo/asynckit.git"
+ },
+ "scripts": {
+ "browser": "browserify -t browserify-istanbul test/lib/browserify_adjustment.js test/test-*.js | obake --coverage | tap-spec",
+ "clean": "rimraf coverage",
+ "debug": "tape test/test-*.js",
+ "lint": "eslint *.js lib/*.js test/*.js",
+ "report": "istanbul report",
+ "size": "browserify index.js | size-table asynckit",
+ "test": "istanbul cover --reporter=json tape -- 'test/test-*.js' | tap-spec",
+ "win-test": "tape test/test-*.js"
+ },
+ "version": "0.4.0"
+}
diff --git a/website_quotation_template/node_modules/asynckit/parallel.js b/website_quotation_template/node_modules/asynckit/parallel.js
new file mode 100644
index 000000000..3c50344d8
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/parallel.js
@@ -0,0 +1,43 @@
+var iterate = require('./lib/iterate.js')
+ , initState = require('./lib/state.js')
+ , terminator = require('./lib/terminator.js')
+ ;
+
+// Public API
+module.exports = parallel;
+
+/**
+ * Runs iterator over provided array elements in parallel
+ *
+ * @param {array|object} list - array or object (named list) to iterate over
+ * @param {function} iterator - iterator to run
+ * @param {function} callback - invoked when all elements processed
+ * @returns {function} - jobs terminator
+ */
+function parallel(list, iterator, callback)
+{
+ var state = initState(list);
+
+ while (state.index < (state['keyedList'] || list).length)
+ {
+ iterate(list, iterator, state, function(error, result)
+ {
+ if (error)
+ {
+ callback(error, result);
+ return;
+ }
+
+ // looks like it's the last one
+ if (Object.keys(state.jobs).length === 0)
+ {
+ callback(null, state.results);
+ return;
+ }
+ });
+
+ state.index++;
+ }
+
+ return terminator.bind(state, callback);
+}
diff --git a/website_quotation_template/node_modules/asynckit/serial.js b/website_quotation_template/node_modules/asynckit/serial.js
new file mode 100644
index 000000000..6cd949a67
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/serial.js
@@ -0,0 +1,17 @@
+var serialOrdered = require('./serialOrdered.js');
+
+// Public API
+module.exports = serial;
+
+/**
+ * Runs iterator over provided array elements in series
+ *
+ * @param {array|object} list - array or object (named list) to iterate over
+ * @param {function} iterator - iterator to run
+ * @param {function} callback - invoked when all elements processed
+ * @returns {function} - jobs terminator
+ */
+function serial(list, iterator, callback)
+{
+ return serialOrdered(list, iterator, null, callback);
+}
diff --git a/website_quotation_template/node_modules/asynckit/serialOrdered.js b/website_quotation_template/node_modules/asynckit/serialOrdered.js
new file mode 100644
index 000000000..607eafea5
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/serialOrdered.js
@@ -0,0 +1,75 @@
+var iterate = require('./lib/iterate.js')
+ , initState = require('./lib/state.js')
+ , terminator = require('./lib/terminator.js')
+ ;
+
+// Public API
+module.exports = serialOrdered;
+// sorting helpers
+module.exports.ascending = ascending;
+module.exports.descending = descending;
+
+/**
+ * Runs iterator over provided sorted array elements in series
+ *
+ * @param {array|object} list - array or object (named list) to iterate over
+ * @param {function} iterator - iterator to run
+ * @param {function} sortMethod - custom sort function
+ * @param {function} callback - invoked when all elements processed
+ * @returns {function} - jobs terminator
+ */
+function serialOrdered(list, iterator, sortMethod, callback)
+{
+ var state = initState(list, sortMethod);
+
+ iterate(list, iterator, state, function iteratorHandler(error, result)
+ {
+ if (error)
+ {
+ callback(error, result);
+ return;
+ }
+
+ state.index++;
+
+ // are we there yet?
+ if (state.index < (state['keyedList'] || list).length)
+ {
+ iterate(list, iterator, state, iteratorHandler);
+ return;
+ }
+
+ // done here
+ callback(null, state.results);
+ });
+
+ return terminator.bind(state, callback);
+}
+
+/*
+ * -- Sort methods
+ */
+
+/**
+ * sort helper to sort array elements in ascending order
+ *
+ * @param {mixed} a - an item to compare
+ * @param {mixed} b - an item to compare
+ * @returns {number} - comparison result
+ */
+function ascending(a, b)
+{
+ return a < b ? -1 : a > b ? 1 : 0;
+}
+
+/**
+ * sort helper to sort array elements in descending order
+ *
+ * @param {mixed} a - an item to compare
+ * @param {mixed} b - an item to compare
+ * @returns {number} - comparison result
+ */
+function descending(a, b)
+{
+ return -1 * ascending(a, b);
+}
diff --git a/website_quotation_template/node_modules/asynckit/stream.js b/website_quotation_template/node_modules/asynckit/stream.js
new file mode 100644
index 000000000..d43465f90
--- /dev/null
+++ b/website_quotation_template/node_modules/asynckit/stream.js
@@ -0,0 +1,21 @@
+var inherits = require('util').inherits
+ , Readable = require('stream').Readable
+ , ReadableAsyncKit = require('./lib/readable_asynckit.js')
+ , ReadableParallel = require('./lib/readable_parallel.js')
+ , ReadableSerial = require('./lib/readable_serial.js')
+ , ReadableSerialOrdered = require('./lib/readable_serial_ordered.js')
+ ;
+
+// API
+module.exports =
+{
+ parallel : ReadableParallel,
+ serial : ReadableSerial,
+ serialOrdered : ReadableSerialOrdered,
+};
+
+inherits(ReadableAsyncKit, Readable);
+
+inherits(ReadableParallel, ReadableAsyncKit);
+inherits(ReadableSerial, ReadableAsyncKit);
+inherits(ReadableSerialOrdered, ReadableAsyncKit);
diff --git a/website_quotation_template/node_modules/aws-sign2/LICENSE b/website_quotation_template/node_modules/aws-sign2/LICENSE
new file mode 100644
index 000000000..a4a9aee0c
--- /dev/null
+++ b/website_quotation_template/node_modules/aws-sign2/LICENSE
@@ -0,0 +1,55 @@
+Apache License
+
+Version 2.0, January 2004
+
+http://www.apache.org/licenses/
+
+TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
+
+1. Definitions.
+
+"License" shall mean the terms and conditions for use, reproduction, and distribution as defined by Sections 1 through 9 of this document.
+
+"Licensor" shall mean the copyright owner or entity authorized by the copyright owner that is granting the License.
+
+"Legal Entity" shall mean the union of the acting entity and all other entities that control, are controlled by, or are under common control with that entity. For the purposes of this definition, "control" means (i) the power, direct or indirect, to cause the direction or management of such entity, whether by contract or otherwise, or (ii) ownership of fifty percent (50%) or more of the outstanding shares, or (iii) beneficial ownership of such entity.
+
+"You" (or "Your") shall mean an individual or Legal Entity exercising permissions granted by this License.
+
+"Source" form shall mean the preferred form for making modifications, including but not limited to software source code, documentation source, and configuration files.
+
+"Object" form shall mean any form resulting from mechanical transformation or translation of a Source form, including but not limited to compiled object code, generated documentation, and conversions to other media types.
+
+"Work" shall mean the work of authorship, whether in Source or Object form, made available under the License, as indicated by a copyright notice that is included in or attached to the work (an example is provided in the Appendix below).
+
+"Derivative Works" shall mean any work, whether in Source or Object form, that is based on (or derived from) the Work and for which the editorial revisions, annotations, elaborations, or other modifications represent, as a whole, an original work of authorship. For the purposes of this License, Derivative Works shall not include works that remain separable from, or merely link (or bind by name) to the interfaces of, the Work and Derivative Works thereof.
+
+"Contribution" shall mean any work of authorship, including the original version of the Work and any modifications or additions to that Work or Derivative Works thereof, that is intentionally submitted to Licensor for inclusion in the Work by the copyright owner or by an individual or Legal Entity authorized to submit on behalf of the copyright owner. For the purposes of this definition, "submitted" means any form of electronic, verbal, or written communication sent to the Licensor or its representatives, including but not limited to communication on electronic mailing lists, source code control systems, and issue tracking systems that are managed by, or on behalf of, the Licensor for the purpose of discussing and improving the Work, but excluding communication that is conspicuously marked or otherwise designated in writing by the copyright owner as "Not a Contribution."
+
+"Contributor" shall mean Licensor and any individual or Legal Entity on behalf of whom a Contribution has been received by Licensor and subsequently incorporated within the Work.
+
+2. Grant of Copyright License. Subject to the terms and conditions of this License, each Contributor hereby grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, irrevocable copyright license to reproduce, prepare Derivative Works of, publicly display, publicly perform, sublicense, and distribute the Work and such Derivative Works in Source or Object form.
+
+3. Grant of Patent License. Subject to the terms and conditions of this License, each Contributor hereby grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, irrevocable (except as stated in this section) patent license to make, have made, use, offer to sell, sell, import, and otherwise transfer the Work, where such license applies only to those patent claims licensable by such Contributor that are necessarily infringed by their Contribution(s) alone or by combination of their Contribution(s) with the Work to which such Contribution(s) was submitted. If You institute patent litigation against any entity (including a cross-claim or counterclaim in a lawsuit) alleging that the Work or a Contribution incorporated within the Work constitutes direct or contributory patent infringement, then any patent licenses granted to You under this License for that Work shall terminate as of the date such litigation is filed.
+
+4. Redistribution. You may reproduce and distribute copies of the Work or Derivative Works thereof in any medium, with or without modifications, and in Source or Object form, provided that You meet the following conditions:
+
+You must give any other recipients of the Work or Derivative Works a copy of this License; and
+
+You must cause any modified files to carry prominent notices stating that You changed the files; and
+
+You must retain, in the Source form of any Derivative Works that You distribute, all copyright, patent, trademark, and attribution notices from the Source form of the Work, excluding those notices that do not pertain to any part of the Derivative Works; and
+
+If the Work includes a "NOTICE" text file as part of its distribution, then any Derivative Works that You distribute must include a readable copy of the attribution notices contained within such NOTICE file, excluding those notices that do not pertain to any part of the Derivative Works, in at least one of the following places: within a NOTICE text file distributed as part of the Derivative Works; within the Source form or documentation, if provided along with the Derivative Works; or, within a display generated by the Derivative Works, if and wherever such third-party notices normally appear. The contents of the NOTICE file are for informational purposes only and do not modify the License. You may add Your own attribution notices within Derivative Works that You distribute, alongside or as an addendum to the NOTICE text from the Work, provided that such additional attribution notices cannot be construed as modifying the License. You may add Your own copyright statement to Your modifications and may provide additional or different license terms and conditions for use, reproduction, or distribution of Your modifications, or for any such Derivative Works as a whole, provided Your use, reproduction, and distribution of the Work otherwise complies with the conditions stated in this License.
+
+5. Submission of Contributions. Unless You explicitly state otherwise, any Contribution intentionally submitted for inclusion in the Work by You to the Licensor shall be under the terms and conditions of this License, without any additional terms or conditions. Notwithstanding the above, nothing herein shall supersede or modify the terms of any separate license agreement you may have executed with Licensor regarding such Contributions.
+
+6. Trademarks. This License does not grant permission to use the trade names, trademarks, service marks, or product names of the Licensor, except as required for reasonable and customary use in describing the origin of the Work and reproducing the content of the NOTICE file.
+
+7. Disclaimer of Warranty. Unless required by applicable law or agreed to in writing, Licensor provides the Work (and each Contributor provides its Contributions) on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied, including, without limitation, any warranties or conditions of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A PARTICULAR PURPOSE. You are solely responsible for determining the appropriateness of using or redistributing the Work and assume any risks associated with Your exercise of permissions under this License.
+
+8. Limitation of Liability. In no event and under no legal theory, whether in tort (including negligence), contract, or otherwise, unless required by applicable law (such as deliberate and grossly negligent acts) or agreed to in writing, shall any Contributor be liable to You for damages, including any direct, indirect, special, incidental, or consequential damages of any character arising as a result of this License or out of the use or inability to use the Work (including but not limited to damages for loss of goodwill, work stoppage, computer failure or malfunction, or any and all other commercial damages or losses), even if such Contributor has been advised of the possibility of such damages.
+
+9. Accepting Warranty or Additional Liability. While redistributing the Work or Derivative Works thereof, You may choose to offer, and charge a fee for, acceptance of support, warranty, indemnity, or other liability obligations and/or rights consistent with this License. However, in accepting such obligations, You may act only on Your own behalf and on Your sole responsibility, not on behalf of any other Contributor, and only if You agree to indemnify, defend, and hold each Contributor harmless for any liability incurred by, or claims asserted against, such Contributor by reason of your accepting any such warranty or additional liability.
+
+END OF TERMS AND CONDITIONS
\ No newline at end of file
diff --git a/website_quotation_template/node_modules/aws-sign2/README.md b/website_quotation_template/node_modules/aws-sign2/README.md
new file mode 100644
index 000000000..763564e0a
--- /dev/null
+++ b/website_quotation_template/node_modules/aws-sign2/README.md
@@ -0,0 +1,4 @@
+aws-sign
+========
+
+AWS signing. Originally pulled from LearnBoost/knox, maintained as vendor in request, now a standalone module.
diff --git a/website_quotation_template/node_modules/aws-sign2/index.js b/website_quotation_template/node_modules/aws-sign2/index.js
new file mode 100644
index 000000000..fb35f6db0
--- /dev/null
+++ b/website_quotation_template/node_modules/aws-sign2/index.js
@@ -0,0 +1,212 @@
+
+/*!
+ * Copyright 2010 LearnBoost
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ * http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+/**
+ * Module dependencies.
+ */
+
+var crypto = require('crypto')
+ , parse = require('url').parse
+ ;
+
+/**
+ * Valid keys.
+ */
+
+var keys =
+ [ 'acl'
+ , 'location'
+ , 'logging'
+ , 'notification'
+ , 'partNumber'
+ , 'policy'
+ , 'requestPayment'
+ , 'torrent'
+ , 'uploadId'
+ , 'uploads'
+ , 'versionId'
+ , 'versioning'
+ , 'versions'
+ , 'website'
+ ]
+
+/**
+ * Return an "Authorization" header value with the given `options`
+ * in the form of "AWS :"
+ *
+ * @param {Object} options
+ * @return {String}
+ * @api private
+ */
+
+function authorization (options) {
+ return 'AWS ' + options.key + ':' + sign(options)
+}
+
+module.exports = authorization
+module.exports.authorization = authorization
+
+/**
+ * Simple HMAC-SHA1 Wrapper
+ *
+ * @param {Object} options
+ * @return {String}
+ * @api private
+ */
+
+function hmacSha1 (options) {
+ return crypto.createHmac('sha1', options.secret).update(options.message).digest('base64')
+}
+
+module.exports.hmacSha1 = hmacSha1
+
+/**
+ * Create a base64 sha1 HMAC for `options`.
+ *
+ * @param {Object} options
+ * @return {String}
+ * @api private
+ */
+
+function sign (options) {
+ options.message = stringToSign(options)
+ return hmacSha1(options)
+}
+module.exports.sign = sign
+
+/**
+ * Create a base64 sha1 HMAC for `options`.
+ *
+ * Specifically to be used with S3 presigned URLs
+ *
+ * @param {Object} options
+ * @return {String}
+ * @api private
+ */
+
+function signQuery (options) {
+ options.message = queryStringToSign(options)
+ return hmacSha1(options)
+}
+module.exports.signQuery= signQuery
+
+/**
+ * Return a string for sign() with the given `options`.
+ *
+ * Spec:
+ *
+ * \n
+ * \n
+ * \n
+ * \n
+ * [headers\n]
+ *
+ *
+ * @param {Object} options
+ * @return {String}
+ * @api private
+ */
+
+function stringToSign (options) {
+ var headers = options.amazonHeaders || ''
+ if (headers) headers += '\n'
+ var r =
+ [ options.verb
+ , options.md5
+ , options.contentType
+ , options.date ? options.date.toUTCString() : ''
+ , headers + options.resource
+ ]
+ return r.join('\n')
+}
+module.exports.stringToSign = stringToSign
+
+/**
+ * Return a string for sign() with the given `options`, but is meant exclusively
+ * for S3 presigned URLs
+ *
+ * Spec:
+ *
+ * \n
+ *
+ *
+ * @param {Object} options
+ * @return {String}
+ * @api private
+ */
+
+function queryStringToSign (options){
+ return 'GET\n\n\n' + options.date + '\n' + options.resource
+}
+module.exports.queryStringToSign = queryStringToSign
+
+/**
+ * Perform the following:
+ *
+ * - ignore non-amazon headers
+ * - lowercase fields
+ * - sort lexicographically
+ * - trim whitespace between ":"
+ * - join with newline
+ *
+ * @param {Object} headers
+ * @return {String}
+ * @api private
+ */
+
+function canonicalizeHeaders (headers) {
+ var buf = []
+ , fields = Object.keys(headers)
+ ;
+ for (var i = 0, len = fields.length; i < len; ++i) {
+ var field = fields[i]
+ , val = headers[field]
+ , field = field.toLowerCase()
+ ;
+ if (0 !== field.indexOf('x-amz')) continue
+ buf.push(field + ':' + val)
+ }
+ return buf.sort().join('\n')
+}
+module.exports.canonicalizeHeaders = canonicalizeHeaders
+
+/**
+ * Perform the following:
+ *
+ * - ignore non sub-resources
+ * - sort lexicographically
+ *
+ * @param {String} resource
+ * @return {String}
+ * @api private
+ */
+
+function canonicalizeResource (resource) {
+ var url = parse(resource, true)
+ , path = url.pathname
+ , buf = []
+ ;
+
+ Object.keys(url.query).forEach(function(key){
+ if (!~keys.indexOf(key)) return
+ var val = '' == url.query[key] ? '' : '=' + encodeURIComponent(url.query[key])
+ buf.push(key + val)
+ })
+
+ return path + (buf.length ? '?' + buf.sort().join('&') : '')
+}
+module.exports.canonicalizeResource = canonicalizeResource
diff --git a/website_quotation_template/node_modules/aws-sign2/package.json b/website_quotation_template/node_modules/aws-sign2/package.json
new file mode 100644
index 000000000..f1fa848ff
--- /dev/null
+++ b/website_quotation_template/node_modules/aws-sign2/package.json
@@ -0,0 +1,50 @@
+{
+ "_from": "aws-sign2@~0.7.0",
+ "_id": "aws-sign2@0.7.0",
+ "_inBundle": false,
+ "_integrity": "sha512-08kcGqnYf/YmjoRhfxyu+CLxBjUtHLXLXX/vUfx9l2LYzG3c1m61nrpyFUZI6zeS+Li/wWMMidD9KgrqtGq3mA==",
+ "_location": "/aws-sign2",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "aws-sign2@~0.7.0",
+ "name": "aws-sign2",
+ "escapedName": "aws-sign2",
+ "rawSpec": "~0.7.0",
+ "saveSpec": null,
+ "fetchSpec": "~0.7.0"
+ },
+ "_requiredBy": [
+ "/request"
+ ],
+ "_resolved": "https://registry.npmjs.org/aws-sign2/-/aws-sign2-0.7.0.tgz",
+ "_shasum": "b46e890934a9591f2d2f6f86d7e6a9f1b3fe76a8",
+ "_spec": "aws-sign2@~0.7.0",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/request",
+ "author": {
+ "name": "Mikeal Rogers",
+ "email": "mikeal.rogers@gmail.com",
+ "url": "http://www.futurealoof.com"
+ },
+ "bugs": {
+ "url": "https://github.com/mikeal/aws-sign/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {},
+ "deprecated": false,
+ "description": "AWS signing. Originally pulled from LearnBoost/knox, maintained as vendor in request, now a standalone module.",
+ "devDependencies": {},
+ "engines": {
+ "node": "*"
+ },
+ "homepage": "https://github.com/mikeal/aws-sign#readme",
+ "license": "Apache-2.0",
+ "main": "index.js",
+ "name": "aws-sign2",
+ "optionalDependencies": {},
+ "repository": {
+ "url": "git+https://github.com/mikeal/aws-sign.git"
+ },
+ "version": "0.7.0"
+}
diff --git a/website_quotation_template/node_modules/aws4/.github/FUNDING.yml b/website_quotation_template/node_modules/aws4/.github/FUNDING.yml
new file mode 100644
index 000000000..b7fdd9747
--- /dev/null
+++ b/website_quotation_template/node_modules/aws4/.github/FUNDING.yml
@@ -0,0 +1,3 @@
+# These are supported funding model platforms
+
+github: mhart
diff --git a/website_quotation_template/node_modules/aws4/.travis.yml b/website_quotation_template/node_modules/aws4/.travis.yml
new file mode 100644
index 000000000..178bf31ed
--- /dev/null
+++ b/website_quotation_template/node_modules/aws4/.travis.yml
@@ -0,0 +1,9 @@
+language: node_js
+node_js:
+ - "0.10"
+ - "0.12"
+ - "4"
+ - "6"
+ - "8"
+ - "10"
+ - "12"
diff --git a/website_quotation_template/node_modules/aws4/LICENSE b/website_quotation_template/node_modules/aws4/LICENSE
new file mode 100644
index 000000000..4f321e599
--- /dev/null
+++ b/website_quotation_template/node_modules/aws4/LICENSE
@@ -0,0 +1,19 @@
+Copyright 2013 Michael Hart (michael.hart.au@gmail.com)
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/website_quotation_template/node_modules/aws4/README.md b/website_quotation_template/node_modules/aws4/README.md
new file mode 100644
index 000000000..4e9e66fb4
--- /dev/null
+++ b/website_quotation_template/node_modules/aws4/README.md
@@ -0,0 +1,213 @@
+aws4
+----
+
+[](https://travis-ci.org/github/mhart/aws4)
+
+A small utility to sign vanilla Node.js http(s) request options using Amazon's
+[AWS Signature Version 4](https://docs.aws.amazon.com/general/latest/gr/signature-version-4.html).
+
+If you want to sign and send AWS requests in a browser, or an environment like [Cloudflare Workers](https://developers.cloudflare.com/workers/), then check out [aws4fetch](https://github.com/mhart/aws4fetch) – otherwise you can also bundle this library for use [in older browsers](./browser).
+
+The only AWS service that *doesn't* support v4 as of 2020-05-22 is
+[SimpleDB](https://docs.aws.amazon.com/AmazonSimpleDB/latest/DeveloperGuide/SDB_API.html)
+(it only supports [AWS Signature Version 2](https://github.com/mhart/aws2)).
+
+It also provides defaults for a number of core AWS headers and
+request parameters, making it very easy to query AWS services, or
+build out a fully-featured AWS library.
+
+Example
+-------
+
+```javascript
+var https = require('https')
+var aws4 = require('aws4')
+
+// to illustrate usage, we'll create a utility function to request and pipe to stdout
+function request(opts) { https.request(opts, function(res) { res.pipe(process.stdout) }).end(opts.body || '') }
+
+// aws4 will sign an options object as you'd pass to http.request, with an AWS service and region
+var opts = { host: 'my-bucket.s3.us-west-1.amazonaws.com', path: '/my-object', service: 's3', region: 'us-west-1' }
+
+// aws4.sign() will sign and modify these options, ready to pass to http.request
+aws4.sign(opts, { accessKeyId: '', secretAccessKey: '' })
+
+// or it can get credentials from process.env.AWS_ACCESS_KEY_ID, etc
+aws4.sign(opts)
+
+// for most AWS services, aws4 can figure out the service and region if you pass a host
+opts = { host: 'my-bucket.s3.us-west-1.amazonaws.com', path: '/my-object' }
+
+// usually it will add/modify request headers, but you can also sign the query:
+opts = { host: 'my-bucket.s3.amazonaws.com', path: '/?X-Amz-Expires=12345', signQuery: true }
+
+// and for services with simple hosts, aws4 can infer the host from service and region:
+opts = { service: 'sqs', region: 'us-east-1', path: '/?Action=ListQueues' }
+
+// and if you're using us-east-1, it's the default:
+opts = { service: 'sqs', path: '/?Action=ListQueues' }
+
+aws4.sign(opts)
+console.log(opts)
+/*
+{
+ host: 'sqs.us-east-1.amazonaws.com',
+ path: '/?Action=ListQueues',
+ headers: {
+ Host: 'sqs.us-east-1.amazonaws.com',
+ 'X-Amz-Date': '20121226T061030Z',
+ Authorization: 'AWS4-HMAC-SHA256 Credential=ABCDEF/20121226/us-east-1/sqs/aws4_request, ...'
+ }
+}
+*/
+
+// we can now use this to query AWS
+request(opts)
+/*
+
+
+...
+*/
+
+// aws4 can infer the HTTP method if a body is passed in
+// method will be POST and Content-Type: 'application/x-www-form-urlencoded; charset=utf-8'
+request(aws4.sign({ service: 'iam', body: 'Action=ListGroups&Version=2010-05-08' }))
+/*
+
+...
+*/
+
+// you can specify any custom option or header as per usual
+request(aws4.sign({
+ service: 'dynamodb',
+ region: 'ap-southeast-2',
+ method: 'POST',
+ path: '/',
+ headers: {
+ 'Content-Type': 'application/x-amz-json-1.0',
+ 'X-Amz-Target': 'DynamoDB_20120810.ListTables'
+ },
+ body: '{}'
+}))
+/*
+{"TableNames":[]}
+...
+*/
+
+// you can also specify extra headers to ignore during signing
+request(aws4.sign({
+ host: '07tjusf2h91cunochc.us-east-1.aoss.amazonaws.com',
+ method: 'PUT',
+ path: '/my-index',
+ body: '{"mappings":{}}',
+ headers: {
+ 'Content-Type': 'application/json',
+ 'X-Amz-Content-Sha256': 'UNSIGNED-PAYLOAD'
+ },
+ extraHeadersToIgnore: {
+ 'content-length': true
+ }
+}))
+
+// and headers to include that would normally be ignored
+request(aws4.sign({
+ service: 'mycustomservice',
+ path: '/whatever',
+ headers: {
+ 'Range': 'bytes=200-1000, 2000-6576, 19000-'
+ },
+ extraHeadersToInclude: {
+ 'range': true
+ }
+}))
+
+
+// The raw RequestSigner can be used to generate CodeCommit Git passwords
+var signer = new aws4.RequestSigner({
+ service: 'codecommit',
+ host: 'git-codecommit.us-east-1.amazonaws.com',
+ method: 'GIT',
+ path: '/v1/repos/MyAwesomeRepo',
+})
+var password = signer.getDateTime() + 'Z' + signer.signature()
+
+// see example.js for examples with other services
+```
+
+API
+---
+
+### aws4.sign(requestOptions, [credentials])
+
+Calculates and populates any necessary AWS headers and/or request
+options on `requestOptions`. Returns `requestOptions` as a convenience for chaining.
+
+`requestOptions` is an object holding the same options that the Node.js
+[http.request](https://nodejs.org/docs/latest/api/http.html#http_http_request_options_callback)
+function takes.
+
+The following properties of `requestOptions` are used in the signing or
+populated if they don't already exist:
+
+- `hostname` or `host` (will try to be determined from `service` and `region` if not given)
+- `method` (will use `'GET'` if not given or `'POST'` if there is a `body`)
+- `path` (will use `'/'` if not given)
+- `body` (will use `''` if not given)
+- `service` (will try to be calculated from `hostname` or `host` if not given)
+- `region` (will try to be calculated from `hostname` or `host` or use `'us-east-1'` if not given)
+- `signQuery` (to sign the query instead of adding an `Authorization` header, defaults to false)
+- `extraHeadersToIgnore` (an object with lowercase header keys to ignore when signing, eg `{ 'content-length': true }`)
+- `extraHeadersToInclude` (an object with lowercase header keys to include when signing, overriding any ignores)
+- `headers['Host']` (will use `hostname` or `host` or be calculated if not given)
+- `headers['Content-Type']` (will use `'application/x-www-form-urlencoded; charset=utf-8'`
+ if not given and there is a `body`)
+- `headers['Date']` (used to calculate the signature date if given, otherwise `new Date` is used)
+
+Your AWS credentials (which can be found in your
+[AWS console](https://portal.aws.amazon.com/gp/aws/securityCredentials))
+can be specified in one of two ways:
+
+- As the second argument, like this:
+
+```javascript
+aws4.sign(requestOptions, {
+ secretAccessKey: "",
+ accessKeyId: "",
+ sessionToken: ""
+})
+```
+
+- From `process.env`, such as this:
+
+```
+export AWS_ACCESS_KEY_ID=""
+export AWS_SECRET_ACCESS_KEY=""
+export AWS_SESSION_TOKEN=""
+```
+
+(will also use `AWS_ACCESS_KEY` and `AWS_SECRET_KEY` if available)
+
+The `sessionToken` property and `AWS_SESSION_TOKEN` environment variable are optional for signing
+with [IAM STS temporary credentials](https://docs.aws.amazon.com/IAM/latest/UserGuide/id_credentials_temp_use-resources.html).
+
+Installation
+------------
+
+With [npm](https://www.npmjs.com/) do:
+
+```
+npm install aws4
+```
+
+Can also be used [in the browser](./browser).
+
+Thanks
+------
+
+Thanks to [@jed](https://github.com/jed) for his
+[dynamo-client](https://github.com/jed/dynamo-client) lib where I first
+committed and subsequently extracted this code.
+
+Also thanks to the
+[official Node.js AWS SDK](https://github.com/aws/aws-sdk-js) for giving
+me a start on implementing the v4 signature.
diff --git a/website_quotation_template/node_modules/aws4/aws4.js b/website_quotation_template/node_modules/aws4/aws4.js
new file mode 100644
index 000000000..b0cfb7c19
--- /dev/null
+++ b/website_quotation_template/node_modules/aws4/aws4.js
@@ -0,0 +1,381 @@
+var aws4 = exports,
+ url = require('url'),
+ querystring = require('querystring'),
+ crypto = require('crypto'),
+ lru = require('./lru'),
+ credentialsCache = lru(1000)
+
+// http://docs.amazonwebservices.com/general/latest/gr/signature-version-4.html
+
+function hmac(key, string, encoding) {
+ return crypto.createHmac('sha256', key).update(string, 'utf8').digest(encoding)
+}
+
+function hash(string, encoding) {
+ return crypto.createHash('sha256').update(string, 'utf8').digest(encoding)
+}
+
+// This function assumes the string has already been percent encoded
+function encodeRfc3986(urlEncodedString) {
+ return urlEncodedString.replace(/[!'()*]/g, function(c) {
+ return '%' + c.charCodeAt(0).toString(16).toUpperCase()
+ })
+}
+
+function encodeRfc3986Full(str) {
+ return encodeRfc3986(encodeURIComponent(str))
+}
+
+// A bit of a combination of:
+// https://github.com/aws/aws-sdk-java-v2/blob/dc695de6ab49ad03934e1b02e7263abbd2354be0/core/auth/src/main/java/software/amazon/awssdk/auth/signer/internal/AbstractAws4Signer.java#L59
+// https://github.com/aws/aws-sdk-js/blob/18cb7e5b463b46239f9fdd4a65e2ff8c81831e8f/lib/signers/v4.js#L191-L199
+// https://github.com/mhart/aws4fetch/blob/b3aed16b6f17384cf36ea33bcba3c1e9f3bdfefd/src/main.js#L25-L34
+var HEADERS_TO_IGNORE = {
+ 'authorization': true,
+ 'connection': true,
+ 'x-amzn-trace-id': true,
+ 'user-agent': true,
+ 'expect': true,
+ 'presigned-expires': true,
+ 'range': true,
+}
+
+// request: { path | body, [host], [method], [headers], [service], [region] }
+// credentials: { accessKeyId, secretAccessKey, [sessionToken] }
+function RequestSigner(request, credentials) {
+
+ if (typeof request === 'string') request = url.parse(request)
+
+ var headers = request.headers = (request.headers || {}),
+ hostParts = (!this.service || !this.region) && this.matchHost(request.hostname || request.host || headers.Host || headers.host)
+
+ this.request = request
+ this.credentials = credentials || this.defaultCredentials()
+
+ this.service = request.service || hostParts[0] || ''
+ this.region = request.region || hostParts[1] || 'us-east-1'
+
+ // SES uses a different domain from the service name
+ if (this.service === 'email') this.service = 'ses'
+
+ if (!request.method && request.body)
+ request.method = 'POST'
+
+ if (!headers.Host && !headers.host) {
+ headers.Host = request.hostname || request.host || this.createHost()
+
+ // If a port is specified explicitly, use it as is
+ if (request.port)
+ headers.Host += ':' + request.port
+ }
+ if (!request.hostname && !request.host)
+ request.hostname = headers.Host || headers.host
+
+ this.isCodeCommitGit = this.service === 'codecommit' && request.method === 'GIT'
+
+ this.extraHeadersToIgnore = request.extraHeadersToIgnore || Object.create(null)
+ this.extraHeadersToInclude = request.extraHeadersToInclude || Object.create(null)
+}
+
+RequestSigner.prototype.matchHost = function(host) {
+ var match = (host || '').match(/([^\.]+)\.(?:([^\.]*)\.)?amazonaws\.com(\.cn)?$/)
+ var hostParts = (match || []).slice(1, 3)
+
+ // ES's hostParts are sometimes the other way round, if the value that is expected
+ // to be region equals ‘es’ switch them back
+ // e.g. search-cluster-name-aaaa00aaaa0aaa0aaaaaaa0aaa.us-east-1.es.amazonaws.com
+ if (hostParts[1] === 'es' || hostParts[1] === 'aoss')
+ hostParts = hostParts.reverse()
+
+ if (hostParts[1] == 's3') {
+ hostParts[0] = 's3'
+ hostParts[1] = 'us-east-1'
+ } else {
+ for (var i = 0; i < 2; i++) {
+ if (/^s3-/.test(hostParts[i])) {
+ hostParts[1] = hostParts[i].slice(3)
+ hostParts[0] = 's3'
+ break
+ }
+ }
+ }
+
+ return hostParts
+}
+
+// http://docs.aws.amazon.com/general/latest/gr/rande.html
+RequestSigner.prototype.isSingleRegion = function() {
+ // Special case for S3 and SimpleDB in us-east-1
+ if (['s3', 'sdb'].indexOf(this.service) >= 0 && this.region === 'us-east-1') return true
+
+ return ['cloudfront', 'ls', 'route53', 'iam', 'importexport', 'sts']
+ .indexOf(this.service) >= 0
+}
+
+RequestSigner.prototype.createHost = function() {
+ var region = this.isSingleRegion() ? '' : '.' + this.region,
+ subdomain = this.service === 'ses' ? 'email' : this.service
+ return subdomain + region + '.amazonaws.com'
+}
+
+RequestSigner.prototype.prepareRequest = function() {
+ this.parsePath()
+
+ var request = this.request, headers = request.headers, query
+
+ if (request.signQuery) {
+
+ this.parsedPath.query = query = this.parsedPath.query || {}
+
+ if (this.credentials.sessionToken)
+ query['X-Amz-Security-Token'] = this.credentials.sessionToken
+
+ if (this.service === 's3' && !query['X-Amz-Expires'])
+ query['X-Amz-Expires'] = 86400
+
+ if (query['X-Amz-Date'])
+ this.datetime = query['X-Amz-Date']
+ else
+ query['X-Amz-Date'] = this.getDateTime()
+
+ query['X-Amz-Algorithm'] = 'AWS4-HMAC-SHA256'
+ query['X-Amz-Credential'] = this.credentials.accessKeyId + '/' + this.credentialString()
+ query['X-Amz-SignedHeaders'] = this.signedHeaders()
+
+ } else {
+
+ if (!request.doNotModifyHeaders && !this.isCodeCommitGit) {
+ if (request.body && !headers['Content-Type'] && !headers['content-type'])
+ headers['Content-Type'] = 'application/x-www-form-urlencoded; charset=utf-8'
+
+ if (request.body && !headers['Content-Length'] && !headers['content-length'])
+ headers['Content-Length'] = Buffer.byteLength(request.body)
+
+ if (this.credentials.sessionToken && !headers['X-Amz-Security-Token'] && !headers['x-amz-security-token'])
+ headers['X-Amz-Security-Token'] = this.credentials.sessionToken
+
+ if (this.service === 's3' && !headers['X-Amz-Content-Sha256'] && !headers['x-amz-content-sha256'])
+ headers['X-Amz-Content-Sha256'] = hash(this.request.body || '', 'hex')
+
+ if (headers['X-Amz-Date'] || headers['x-amz-date'])
+ this.datetime = headers['X-Amz-Date'] || headers['x-amz-date']
+ else
+ headers['X-Amz-Date'] = this.getDateTime()
+ }
+
+ delete headers.Authorization
+ delete headers.authorization
+ }
+}
+
+RequestSigner.prototype.sign = function() {
+ if (!this.parsedPath) this.prepareRequest()
+
+ if (this.request.signQuery) {
+ this.parsedPath.query['X-Amz-Signature'] = this.signature()
+ } else {
+ this.request.headers.Authorization = this.authHeader()
+ }
+
+ this.request.path = this.formatPath()
+
+ return this.request
+}
+
+RequestSigner.prototype.getDateTime = function() {
+ if (!this.datetime) {
+ var headers = this.request.headers,
+ date = new Date(headers.Date || headers.date || new Date)
+
+ this.datetime = date.toISOString().replace(/[:\-]|\.\d{3}/g, '')
+
+ // Remove the trailing 'Z' on the timestamp string for CodeCommit git access
+ if (this.isCodeCommitGit) this.datetime = this.datetime.slice(0, -1)
+ }
+ return this.datetime
+}
+
+RequestSigner.prototype.getDate = function() {
+ return this.getDateTime().substr(0, 8)
+}
+
+RequestSigner.prototype.authHeader = function() {
+ return [
+ 'AWS4-HMAC-SHA256 Credential=' + this.credentials.accessKeyId + '/' + this.credentialString(),
+ 'SignedHeaders=' + this.signedHeaders(),
+ 'Signature=' + this.signature(),
+ ].join(', ')
+}
+
+RequestSigner.prototype.signature = function() {
+ var date = this.getDate(),
+ cacheKey = [this.credentials.secretAccessKey, date, this.region, this.service].join(),
+ kDate, kRegion, kService, kCredentials = credentialsCache.get(cacheKey)
+ if (!kCredentials) {
+ kDate = hmac('AWS4' + this.credentials.secretAccessKey, date)
+ kRegion = hmac(kDate, this.region)
+ kService = hmac(kRegion, this.service)
+ kCredentials = hmac(kService, 'aws4_request')
+ credentialsCache.set(cacheKey, kCredentials)
+ }
+ return hmac(kCredentials, this.stringToSign(), 'hex')
+}
+
+RequestSigner.prototype.stringToSign = function() {
+ return [
+ 'AWS4-HMAC-SHA256',
+ this.getDateTime(),
+ this.credentialString(),
+ hash(this.canonicalString(), 'hex'),
+ ].join('\n')
+}
+
+RequestSigner.prototype.canonicalString = function() {
+ if (!this.parsedPath) this.prepareRequest()
+
+ var pathStr = this.parsedPath.path,
+ query = this.parsedPath.query,
+ headers = this.request.headers,
+ queryStr = '',
+ normalizePath = this.service !== 's3',
+ decodePath = this.service === 's3' || this.request.doNotEncodePath,
+ decodeSlashesInPath = this.service === 's3',
+ firstValOnly = this.service === 's3',
+ bodyHash
+
+ if (this.service === 's3' && this.request.signQuery) {
+ bodyHash = 'UNSIGNED-PAYLOAD'
+ } else if (this.isCodeCommitGit) {
+ bodyHash = ''
+ } else {
+ bodyHash = headers['X-Amz-Content-Sha256'] || headers['x-amz-content-sha256'] ||
+ hash(this.request.body || '', 'hex')
+ }
+
+ if (query) {
+ var reducedQuery = Object.keys(query).reduce(function(obj, key) {
+ if (!key) return obj
+ obj[encodeRfc3986Full(key)] = !Array.isArray(query[key]) ? query[key] :
+ (firstValOnly ? query[key][0] : query[key])
+ return obj
+ }, {})
+ var encodedQueryPieces = []
+ Object.keys(reducedQuery).sort().forEach(function(key) {
+ if (!Array.isArray(reducedQuery[key])) {
+ encodedQueryPieces.push(key + '=' + encodeRfc3986Full(reducedQuery[key]))
+ } else {
+ reducedQuery[key].map(encodeRfc3986Full).sort()
+ .forEach(function(val) { encodedQueryPieces.push(key + '=' + val) })
+ }
+ })
+ queryStr = encodedQueryPieces.join('&')
+ }
+ if (pathStr !== '/') {
+ if (normalizePath) pathStr = pathStr.replace(/\/{2,}/g, '/')
+ pathStr = pathStr.split('/').reduce(function(path, piece) {
+ if (normalizePath && piece === '..') {
+ path.pop()
+ } else if (!normalizePath || piece !== '.') {
+ if (decodePath) piece = decodeURIComponent(piece.replace(/\+/g, ' '))
+ path.push(encodeRfc3986Full(piece))
+ }
+ return path
+ }, []).join('/')
+ if (pathStr[0] !== '/') pathStr = '/' + pathStr
+ if (decodeSlashesInPath) pathStr = pathStr.replace(/%2F/g, '/')
+ }
+
+ return [
+ this.request.method || 'GET',
+ pathStr,
+ queryStr,
+ this.canonicalHeaders() + '\n',
+ this.signedHeaders(),
+ bodyHash,
+ ].join('\n')
+}
+
+RequestSigner.prototype.canonicalHeaders = function() {
+ var headers = this.request.headers
+ function trimAll(header) {
+ return header.toString().trim().replace(/\s+/g, ' ')
+ }
+ return Object.keys(headers)
+ .filter(function(key) { return HEADERS_TO_IGNORE[key.toLowerCase()] == null })
+ .sort(function(a, b) { return a.toLowerCase() < b.toLowerCase() ? -1 : 1 })
+ .map(function(key) { return key.toLowerCase() + ':' + trimAll(headers[key]) })
+ .join('\n')
+}
+
+RequestSigner.prototype.signedHeaders = function() {
+ var extraHeadersToInclude = this.extraHeadersToInclude,
+ extraHeadersToIgnore = this.extraHeadersToIgnore
+ return Object.keys(this.request.headers)
+ .map(function(key) { return key.toLowerCase() })
+ .filter(function(key) {
+ return extraHeadersToInclude[key] ||
+ (HEADERS_TO_IGNORE[key] == null && !extraHeadersToIgnore[key])
+ })
+ .sort()
+ .join(';')
+}
+
+RequestSigner.prototype.credentialString = function() {
+ return [
+ this.getDate(),
+ this.region,
+ this.service,
+ 'aws4_request',
+ ].join('/')
+}
+
+RequestSigner.prototype.defaultCredentials = function() {
+ var env = process.env
+ return {
+ accessKeyId: env.AWS_ACCESS_KEY_ID || env.AWS_ACCESS_KEY,
+ secretAccessKey: env.AWS_SECRET_ACCESS_KEY || env.AWS_SECRET_KEY,
+ sessionToken: env.AWS_SESSION_TOKEN,
+ }
+}
+
+RequestSigner.prototype.parsePath = function() {
+ var path = this.request.path || '/'
+
+ // S3 doesn't always encode characters > 127 correctly and
+ // all services don't encode characters > 255 correctly
+ // So if there are non-reserved chars (and it's not already all % encoded), just encode them all
+ if (/[^0-9A-Za-z;,/?:@&=+$\-_.!~*'()#%]/.test(path)) {
+ path = encodeURI(decodeURI(path))
+ }
+
+ var queryIx = path.indexOf('?'),
+ query = null
+
+ if (queryIx >= 0) {
+ query = querystring.parse(path.slice(queryIx + 1))
+ path = path.slice(0, queryIx)
+ }
+
+ this.parsedPath = {
+ path: path,
+ query: query,
+ }
+}
+
+RequestSigner.prototype.formatPath = function() {
+ var path = this.parsedPath.path,
+ query = this.parsedPath.query
+
+ if (!query) return path
+
+ // Services don't support empty query string keys
+ if (query[''] != null) delete query['']
+
+ return path + '?' + encodeRfc3986(querystring.stringify(query))
+}
+
+aws4.RequestSigner = RequestSigner
+
+aws4.sign = function(request, credentials) {
+ return new RequestSigner(request, credentials).sign()
+}
diff --git a/website_quotation_template/node_modules/aws4/lru.js b/website_quotation_template/node_modules/aws4/lru.js
new file mode 100644
index 000000000..333f66a44
--- /dev/null
+++ b/website_quotation_template/node_modules/aws4/lru.js
@@ -0,0 +1,96 @@
+module.exports = function(size) {
+ return new LruCache(size)
+}
+
+function LruCache(size) {
+ this.capacity = size | 0
+ this.map = Object.create(null)
+ this.list = new DoublyLinkedList()
+}
+
+LruCache.prototype.get = function(key) {
+ var node = this.map[key]
+ if (node == null) return undefined
+ this.used(node)
+ return node.val
+}
+
+LruCache.prototype.set = function(key, val) {
+ var node = this.map[key]
+ if (node != null) {
+ node.val = val
+ } else {
+ if (!this.capacity) this.prune()
+ if (!this.capacity) return false
+ node = new DoublyLinkedNode(key, val)
+ this.map[key] = node
+ this.capacity--
+ }
+ this.used(node)
+ return true
+}
+
+LruCache.prototype.used = function(node) {
+ this.list.moveToFront(node)
+}
+
+LruCache.prototype.prune = function() {
+ var node = this.list.pop()
+ if (node != null) {
+ delete this.map[node.key]
+ this.capacity++
+ }
+}
+
+
+function DoublyLinkedList() {
+ this.firstNode = null
+ this.lastNode = null
+}
+
+DoublyLinkedList.prototype.moveToFront = function(node) {
+ if (this.firstNode == node) return
+
+ this.remove(node)
+
+ if (this.firstNode == null) {
+ this.firstNode = node
+ this.lastNode = node
+ node.prev = null
+ node.next = null
+ } else {
+ node.prev = null
+ node.next = this.firstNode
+ node.next.prev = node
+ this.firstNode = node
+ }
+}
+
+DoublyLinkedList.prototype.pop = function() {
+ var lastNode = this.lastNode
+ if (lastNode != null) {
+ this.remove(lastNode)
+ }
+ return lastNode
+}
+
+DoublyLinkedList.prototype.remove = function(node) {
+ if (this.firstNode == node) {
+ this.firstNode = node.next
+ } else if (node.prev != null) {
+ node.prev.next = node.next
+ }
+ if (this.lastNode == node) {
+ this.lastNode = node.prev
+ } else if (node.next != null) {
+ node.next.prev = node.prev
+ }
+}
+
+
+function DoublyLinkedNode(key, val) {
+ this.key = key
+ this.val = val
+ this.prev = null
+ this.next = null
+}
diff --git a/website_quotation_template/node_modules/aws4/package.json b/website_quotation_template/node_modules/aws4/package.json
new file mode 100644
index 000000000..6f4c07bb4
--- /dev/null
+++ b/website_quotation_template/node_modules/aws4/package.json
@@ -0,0 +1,53 @@
+{
+ "_from": "aws4@^1.8.0",
+ "_id": "aws4@1.12.0",
+ "_inBundle": false,
+ "_integrity": "sha512-NmWvPnx0F1SfrQbYwOi7OeaNGokp9XhzNioJ/CSBs8Qa4vxug81mhJEAVZwxXuBmYB5KDRfMq/F3RR0BIU7sWg==",
+ "_location": "/aws4",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "aws4@^1.8.0",
+ "name": "aws4",
+ "escapedName": "aws4",
+ "rawSpec": "^1.8.0",
+ "saveSpec": null,
+ "fetchSpec": "^1.8.0"
+ },
+ "_requiredBy": [
+ "/request"
+ ],
+ "_resolved": "https://registry.npmjs.org/aws4/-/aws4-1.12.0.tgz",
+ "_shasum": "ce1c9d143389679e253b314241ea9aa5cec980d3",
+ "_spec": "aws4@^1.8.0",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/request",
+ "author": {
+ "name": "Michael Hart",
+ "email": "michael.hart.au@gmail.com",
+ "url": "https://github.com/mhart"
+ },
+ "bugs": {
+ "url": "https://github.com/mhart/aws4/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Signs and prepares requests using AWS Signature Version 4",
+ "devDependencies": {
+ "mocha": "^2.5.3",
+ "should": "^8.4.0"
+ },
+ "homepage": "https://github.com/mhart/aws4#readme",
+ "license": "MIT",
+ "main": "aws4.js",
+ "name": "aws4",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/mhart/aws4.git"
+ },
+ "scripts": {
+ "integration": "node ./test/slow.js",
+ "test": "mocha ./test/fast.js -R list"
+ },
+ "version": "1.12.0"
+}
diff --git a/website_quotation_template/node_modules/bcrypt-pbkdf/CONTRIBUTING.md b/website_quotation_template/node_modules/bcrypt-pbkdf/CONTRIBUTING.md
new file mode 100644
index 000000000..401d34ed5
--- /dev/null
+++ b/website_quotation_template/node_modules/bcrypt-pbkdf/CONTRIBUTING.md
@@ -0,0 +1,13 @@
+# Contributing
+
+This repository uses [cr.joyent.us](https://cr.joyent.us) (Gerrit) for new
+changes. Anyone can submit changes. To get started, see the [cr.joyent.us user
+guide](https://github.com/joyent/joyent-gerrit/blob/master/docs/user/README.md).
+This repo does not use GitHub pull requests.
+
+See the [Joyent Engineering
+Guidelines](https://github.com/joyent/eng/blob/master/docs/index.md) for general
+best practices expected in this repository.
+
+If you're changing something non-trivial or user-facing, you may want to submit
+an issue first.
diff --git a/website_quotation_template/node_modules/bcrypt-pbkdf/LICENSE b/website_quotation_template/node_modules/bcrypt-pbkdf/LICENSE
new file mode 100644
index 000000000..fc58d2ab1
--- /dev/null
+++ b/website_quotation_template/node_modules/bcrypt-pbkdf/LICENSE
@@ -0,0 +1,66 @@
+The Blowfish portions are under the following license:
+
+Blowfish block cipher for OpenBSD
+Copyright 1997 Niels Provos
+All rights reserved.
+
+Implementation advice by David Mazieres .
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions
+are met:
+1. Redistributions of source code must retain the above copyright
+ notice, this list of conditions and the following disclaimer.
+2. Redistributions in binary form must reproduce the above copyright
+ notice, this list of conditions and the following disclaimer in the
+ documentation and/or other materials provided with the distribution.
+3. The name of the author may not be used to endorse or promote products
+ derived from this software without specific prior written permission.
+
+THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
+IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
+OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
+IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
+INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
+NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
+THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+
+
+
+The bcrypt_pbkdf portions are under the following license:
+
+Copyright (c) 2013 Ted Unangst
+
+Permission to use, copy, modify, and distribute this software for any
+purpose with or without fee is hereby granted, provided that the above
+copyright notice and this permission notice appear in all copies.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+
+
+
+Performance improvements (Javascript-specific):
+
+Copyright 2016, Joyent Inc
+Author: Alex Wilson
+
+Permission to use, copy, modify, and distribute this software for any
+purpose with or without fee is hereby granted, provided that the above
+copyright notice and this permission notice appear in all copies.
+
+THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
diff --git a/website_quotation_template/node_modules/bcrypt-pbkdf/README.md b/website_quotation_template/node_modules/bcrypt-pbkdf/README.md
new file mode 100644
index 000000000..7551f335c
--- /dev/null
+++ b/website_quotation_template/node_modules/bcrypt-pbkdf/README.md
@@ -0,0 +1,45 @@
+Port of the OpenBSD `bcrypt_pbkdf` function to pure Javascript. `npm`-ified
+version of [Devi Mandiri's port](https://github.com/devi/tmp/blob/master/js/bcrypt_pbkdf.js),
+with some minor performance improvements. The code is copied verbatim (and
+un-styled) from Devi's work.
+
+This product includes software developed by Niels Provos.
+
+## API
+
+### `bcrypt_pbkdf.pbkdf(pass, passlen, salt, saltlen, key, keylen, rounds)`
+
+Derive a cryptographic key of arbitrary length from a given password and salt,
+using the OpenBSD `bcrypt_pbkdf` function. This is a combination of Blowfish and
+SHA-512.
+
+See [this article](http://www.tedunangst.com/flak/post/bcrypt-pbkdf) for
+further information.
+
+Parameters:
+
+ * `pass`, a Uint8Array of length `passlen`
+ * `passlen`, an integer Number
+ * `salt`, a Uint8Array of length `saltlen`
+ * `saltlen`, an integer Number
+ * `key`, a Uint8Array of length `keylen`, will be filled with output
+ * `keylen`, an integer Number
+ * `rounds`, an integer Number, number of rounds of the PBKDF to run
+
+### `bcrypt_pbkdf.hash(sha2pass, sha2salt, out)`
+
+Calculate a Blowfish hash, given SHA2-512 output of a password and salt. Used as
+part of the inner round function in the PBKDF.
+
+Parameters:
+
+ * `sha2pass`, a Uint8Array of length 64
+ * `sha2salt`, a Uint8Array of length 64
+ * `out`, a Uint8Array of length 32, will be filled with output
+
+## License
+
+This source form is a 1:1 port from the OpenBSD `blowfish.c` and `bcrypt_pbkdf.c`.
+As a result, it retains the original copyright and license. The two files are
+under slightly different (but compatible) licenses, and are here combined in
+one file. For each of the full license texts see `LICENSE`.
diff --git a/website_quotation_template/node_modules/bcrypt-pbkdf/index.js b/website_quotation_template/node_modules/bcrypt-pbkdf/index.js
new file mode 100644
index 000000000..b1b5ad4b7
--- /dev/null
+++ b/website_quotation_template/node_modules/bcrypt-pbkdf/index.js
@@ -0,0 +1,556 @@
+'use strict';
+
+var crypto_hash_sha512 = require('tweetnacl').lowlevel.crypto_hash;
+
+/*
+ * This file is a 1:1 port from the OpenBSD blowfish.c and bcrypt_pbkdf.c. As a
+ * result, it retains the original copyright and license. The two files are
+ * under slightly different (but compatible) licenses, and are here combined in
+ * one file.
+ *
+ * Credit for the actual porting work goes to:
+ * Devi Mandiri
+ */
+
+/*
+ * The Blowfish portions are under the following license:
+ *
+ * Blowfish block cipher for OpenBSD
+ * Copyright 1997 Niels Provos
+ * All rights reserved.
+ *
+ * Implementation advice by David Mazieres .
+ *
+ * Redistribution and use in source and binary forms, with or without
+ * modification, are permitted provided that the following conditions
+ * are met:
+ * 1. Redistributions of source code must retain the above copyright
+ * notice, this list of conditions and the following disclaimer.
+ * 2. Redistributions in binary form must reproduce the above copyright
+ * notice, this list of conditions and the following disclaimer in the
+ * documentation and/or other materials provided with the distribution.
+ * 3. The name of the author may not be used to endorse or promote products
+ * derived from this software without specific prior written permission.
+ *
+ * THIS SOFTWARE IS PROVIDED BY THE AUTHOR ``AS IS'' AND ANY EXPRESS OR
+ * IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED WARRANTIES
+ * OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE DISCLAIMED.
+ * IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY DIRECT, INDIRECT,
+ * INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT
+ * NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,
+ * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY
+ * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+ * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF
+ * THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
+ */
+
+/*
+ * The bcrypt_pbkdf portions are under the following license:
+ *
+ * Copyright (c) 2013 Ted Unangst
+ *
+ * Permission to use, copy, modify, and distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+ * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+ * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+ * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+ * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+ * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+ */
+
+/*
+ * Performance improvements (Javascript-specific):
+ *
+ * Copyright 2016, Joyent Inc
+ * Author: Alex Wilson
+ *
+ * Permission to use, copy, modify, and distribute this software for any
+ * purpose with or without fee is hereby granted, provided that the above
+ * copyright notice and this permission notice appear in all copies.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES
+ * WITH REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF
+ * MERCHANTABILITY AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR
+ * ANY SPECIAL, DIRECT, INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES
+ * WHATSOEVER RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER IN AN
+ * ACTION OF CONTRACT, NEGLIGENCE OR OTHER TORTIOUS ACTION, ARISING OUT OF
+ * OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+ */
+
+// Ported from OpenBSD bcrypt_pbkdf.c v1.9
+
+var BLF_J = 0;
+
+var Blowfish = function() {
+ this.S = [
+ new Uint32Array([
+ 0xd1310ba6, 0x98dfb5ac, 0x2ffd72db, 0xd01adfb7,
+ 0xb8e1afed, 0x6a267e96, 0xba7c9045, 0xf12c7f99,
+ 0x24a19947, 0xb3916cf7, 0x0801f2e2, 0x858efc16,
+ 0x636920d8, 0x71574e69, 0xa458fea3, 0xf4933d7e,
+ 0x0d95748f, 0x728eb658, 0x718bcd58, 0x82154aee,
+ 0x7b54a41d, 0xc25a59b5, 0x9c30d539, 0x2af26013,
+ 0xc5d1b023, 0x286085f0, 0xca417918, 0xb8db38ef,
+ 0x8e79dcb0, 0x603a180e, 0x6c9e0e8b, 0xb01e8a3e,
+ 0xd71577c1, 0xbd314b27, 0x78af2fda, 0x55605c60,
+ 0xe65525f3, 0xaa55ab94, 0x57489862, 0x63e81440,
+ 0x55ca396a, 0x2aab10b6, 0xb4cc5c34, 0x1141e8ce,
+ 0xa15486af, 0x7c72e993, 0xb3ee1411, 0x636fbc2a,
+ 0x2ba9c55d, 0x741831f6, 0xce5c3e16, 0x9b87931e,
+ 0xafd6ba33, 0x6c24cf5c, 0x7a325381, 0x28958677,
+ 0x3b8f4898, 0x6b4bb9af, 0xc4bfe81b, 0x66282193,
+ 0x61d809cc, 0xfb21a991, 0x487cac60, 0x5dec8032,
+ 0xef845d5d, 0xe98575b1, 0xdc262302, 0xeb651b88,
+ 0x23893e81, 0xd396acc5, 0x0f6d6ff3, 0x83f44239,
+ 0x2e0b4482, 0xa4842004, 0x69c8f04a, 0x9e1f9b5e,
+ 0x21c66842, 0xf6e96c9a, 0x670c9c61, 0xabd388f0,
+ 0x6a51a0d2, 0xd8542f68, 0x960fa728, 0xab5133a3,
+ 0x6eef0b6c, 0x137a3be4, 0xba3bf050, 0x7efb2a98,
+ 0xa1f1651d, 0x39af0176, 0x66ca593e, 0x82430e88,
+ 0x8cee8619, 0x456f9fb4, 0x7d84a5c3, 0x3b8b5ebe,
+ 0xe06f75d8, 0x85c12073, 0x401a449f, 0x56c16aa6,
+ 0x4ed3aa62, 0x363f7706, 0x1bfedf72, 0x429b023d,
+ 0x37d0d724, 0xd00a1248, 0xdb0fead3, 0x49f1c09b,
+ 0x075372c9, 0x80991b7b, 0x25d479d8, 0xf6e8def7,
+ 0xe3fe501a, 0xb6794c3b, 0x976ce0bd, 0x04c006ba,
+ 0xc1a94fb6, 0x409f60c4, 0x5e5c9ec2, 0x196a2463,
+ 0x68fb6faf, 0x3e6c53b5, 0x1339b2eb, 0x3b52ec6f,
+ 0x6dfc511f, 0x9b30952c, 0xcc814544, 0xaf5ebd09,
+ 0xbee3d004, 0xde334afd, 0x660f2807, 0x192e4bb3,
+ 0xc0cba857, 0x45c8740f, 0xd20b5f39, 0xb9d3fbdb,
+ 0x5579c0bd, 0x1a60320a, 0xd6a100c6, 0x402c7279,
+ 0x679f25fe, 0xfb1fa3cc, 0x8ea5e9f8, 0xdb3222f8,
+ 0x3c7516df, 0xfd616b15, 0x2f501ec8, 0xad0552ab,
+ 0x323db5fa, 0xfd238760, 0x53317b48, 0x3e00df82,
+ 0x9e5c57bb, 0xca6f8ca0, 0x1a87562e, 0xdf1769db,
+ 0xd542a8f6, 0x287effc3, 0xac6732c6, 0x8c4f5573,
+ 0x695b27b0, 0xbbca58c8, 0xe1ffa35d, 0xb8f011a0,
+ 0x10fa3d98, 0xfd2183b8, 0x4afcb56c, 0x2dd1d35b,
+ 0x9a53e479, 0xb6f84565, 0xd28e49bc, 0x4bfb9790,
+ 0xe1ddf2da, 0xa4cb7e33, 0x62fb1341, 0xcee4c6e8,
+ 0xef20cada, 0x36774c01, 0xd07e9efe, 0x2bf11fb4,
+ 0x95dbda4d, 0xae909198, 0xeaad8e71, 0x6b93d5a0,
+ 0xd08ed1d0, 0xafc725e0, 0x8e3c5b2f, 0x8e7594b7,
+ 0x8ff6e2fb, 0xf2122b64, 0x8888b812, 0x900df01c,
+ 0x4fad5ea0, 0x688fc31c, 0xd1cff191, 0xb3a8c1ad,
+ 0x2f2f2218, 0xbe0e1777, 0xea752dfe, 0x8b021fa1,
+ 0xe5a0cc0f, 0xb56f74e8, 0x18acf3d6, 0xce89e299,
+ 0xb4a84fe0, 0xfd13e0b7, 0x7cc43b81, 0xd2ada8d9,
+ 0x165fa266, 0x80957705, 0x93cc7314, 0x211a1477,
+ 0xe6ad2065, 0x77b5fa86, 0xc75442f5, 0xfb9d35cf,
+ 0xebcdaf0c, 0x7b3e89a0, 0xd6411bd3, 0xae1e7e49,
+ 0x00250e2d, 0x2071b35e, 0x226800bb, 0x57b8e0af,
+ 0x2464369b, 0xf009b91e, 0x5563911d, 0x59dfa6aa,
+ 0x78c14389, 0xd95a537f, 0x207d5ba2, 0x02e5b9c5,
+ 0x83260376, 0x6295cfa9, 0x11c81968, 0x4e734a41,
+ 0xb3472dca, 0x7b14a94a, 0x1b510052, 0x9a532915,
+ 0xd60f573f, 0xbc9bc6e4, 0x2b60a476, 0x81e67400,
+ 0x08ba6fb5, 0x571be91f, 0xf296ec6b, 0x2a0dd915,
+ 0xb6636521, 0xe7b9f9b6, 0xff34052e, 0xc5855664,
+ 0x53b02d5d, 0xa99f8fa1, 0x08ba4799, 0x6e85076a]),
+ new Uint32Array([
+ 0x4b7a70e9, 0xb5b32944, 0xdb75092e, 0xc4192623,
+ 0xad6ea6b0, 0x49a7df7d, 0x9cee60b8, 0x8fedb266,
+ 0xecaa8c71, 0x699a17ff, 0x5664526c, 0xc2b19ee1,
+ 0x193602a5, 0x75094c29, 0xa0591340, 0xe4183a3e,
+ 0x3f54989a, 0x5b429d65, 0x6b8fe4d6, 0x99f73fd6,
+ 0xa1d29c07, 0xefe830f5, 0x4d2d38e6, 0xf0255dc1,
+ 0x4cdd2086, 0x8470eb26, 0x6382e9c6, 0x021ecc5e,
+ 0x09686b3f, 0x3ebaefc9, 0x3c971814, 0x6b6a70a1,
+ 0x687f3584, 0x52a0e286, 0xb79c5305, 0xaa500737,
+ 0x3e07841c, 0x7fdeae5c, 0x8e7d44ec, 0x5716f2b8,
+ 0xb03ada37, 0xf0500c0d, 0xf01c1f04, 0x0200b3ff,
+ 0xae0cf51a, 0x3cb574b2, 0x25837a58, 0xdc0921bd,
+ 0xd19113f9, 0x7ca92ff6, 0x94324773, 0x22f54701,
+ 0x3ae5e581, 0x37c2dadc, 0xc8b57634, 0x9af3dda7,
+ 0xa9446146, 0x0fd0030e, 0xecc8c73e, 0xa4751e41,
+ 0xe238cd99, 0x3bea0e2f, 0x3280bba1, 0x183eb331,
+ 0x4e548b38, 0x4f6db908, 0x6f420d03, 0xf60a04bf,
+ 0x2cb81290, 0x24977c79, 0x5679b072, 0xbcaf89af,
+ 0xde9a771f, 0xd9930810, 0xb38bae12, 0xdccf3f2e,
+ 0x5512721f, 0x2e6b7124, 0x501adde6, 0x9f84cd87,
+ 0x7a584718, 0x7408da17, 0xbc9f9abc, 0xe94b7d8c,
+ 0xec7aec3a, 0xdb851dfa, 0x63094366, 0xc464c3d2,
+ 0xef1c1847, 0x3215d908, 0xdd433b37, 0x24c2ba16,
+ 0x12a14d43, 0x2a65c451, 0x50940002, 0x133ae4dd,
+ 0x71dff89e, 0x10314e55, 0x81ac77d6, 0x5f11199b,
+ 0x043556f1, 0xd7a3c76b, 0x3c11183b, 0x5924a509,
+ 0xf28fe6ed, 0x97f1fbfa, 0x9ebabf2c, 0x1e153c6e,
+ 0x86e34570, 0xeae96fb1, 0x860e5e0a, 0x5a3e2ab3,
+ 0x771fe71c, 0x4e3d06fa, 0x2965dcb9, 0x99e71d0f,
+ 0x803e89d6, 0x5266c825, 0x2e4cc978, 0x9c10b36a,
+ 0xc6150eba, 0x94e2ea78, 0xa5fc3c53, 0x1e0a2df4,
+ 0xf2f74ea7, 0x361d2b3d, 0x1939260f, 0x19c27960,
+ 0x5223a708, 0xf71312b6, 0xebadfe6e, 0xeac31f66,
+ 0xe3bc4595, 0xa67bc883, 0xb17f37d1, 0x018cff28,
+ 0xc332ddef, 0xbe6c5aa5, 0x65582185, 0x68ab9802,
+ 0xeecea50f, 0xdb2f953b, 0x2aef7dad, 0x5b6e2f84,
+ 0x1521b628, 0x29076170, 0xecdd4775, 0x619f1510,
+ 0x13cca830, 0xeb61bd96, 0x0334fe1e, 0xaa0363cf,
+ 0xb5735c90, 0x4c70a239, 0xd59e9e0b, 0xcbaade14,
+ 0xeecc86bc, 0x60622ca7, 0x9cab5cab, 0xb2f3846e,
+ 0x648b1eaf, 0x19bdf0ca, 0xa02369b9, 0x655abb50,
+ 0x40685a32, 0x3c2ab4b3, 0x319ee9d5, 0xc021b8f7,
+ 0x9b540b19, 0x875fa099, 0x95f7997e, 0x623d7da8,
+ 0xf837889a, 0x97e32d77, 0x11ed935f, 0x16681281,
+ 0x0e358829, 0xc7e61fd6, 0x96dedfa1, 0x7858ba99,
+ 0x57f584a5, 0x1b227263, 0x9b83c3ff, 0x1ac24696,
+ 0xcdb30aeb, 0x532e3054, 0x8fd948e4, 0x6dbc3128,
+ 0x58ebf2ef, 0x34c6ffea, 0xfe28ed61, 0xee7c3c73,
+ 0x5d4a14d9, 0xe864b7e3, 0x42105d14, 0x203e13e0,
+ 0x45eee2b6, 0xa3aaabea, 0xdb6c4f15, 0xfacb4fd0,
+ 0xc742f442, 0xef6abbb5, 0x654f3b1d, 0x41cd2105,
+ 0xd81e799e, 0x86854dc7, 0xe44b476a, 0x3d816250,
+ 0xcf62a1f2, 0x5b8d2646, 0xfc8883a0, 0xc1c7b6a3,
+ 0x7f1524c3, 0x69cb7492, 0x47848a0b, 0x5692b285,
+ 0x095bbf00, 0xad19489d, 0x1462b174, 0x23820e00,
+ 0x58428d2a, 0x0c55f5ea, 0x1dadf43e, 0x233f7061,
+ 0x3372f092, 0x8d937e41, 0xd65fecf1, 0x6c223bdb,
+ 0x7cde3759, 0xcbee7460, 0x4085f2a7, 0xce77326e,
+ 0xa6078084, 0x19f8509e, 0xe8efd855, 0x61d99735,
+ 0xa969a7aa, 0xc50c06c2, 0x5a04abfc, 0x800bcadc,
+ 0x9e447a2e, 0xc3453484, 0xfdd56705, 0x0e1e9ec9,
+ 0xdb73dbd3, 0x105588cd, 0x675fda79, 0xe3674340,
+ 0xc5c43465, 0x713e38d8, 0x3d28f89e, 0xf16dff20,
+ 0x153e21e7, 0x8fb03d4a, 0xe6e39f2b, 0xdb83adf7]),
+ new Uint32Array([
+ 0xe93d5a68, 0x948140f7, 0xf64c261c, 0x94692934,
+ 0x411520f7, 0x7602d4f7, 0xbcf46b2e, 0xd4a20068,
+ 0xd4082471, 0x3320f46a, 0x43b7d4b7, 0x500061af,
+ 0x1e39f62e, 0x97244546, 0x14214f74, 0xbf8b8840,
+ 0x4d95fc1d, 0x96b591af, 0x70f4ddd3, 0x66a02f45,
+ 0xbfbc09ec, 0x03bd9785, 0x7fac6dd0, 0x31cb8504,
+ 0x96eb27b3, 0x55fd3941, 0xda2547e6, 0xabca0a9a,
+ 0x28507825, 0x530429f4, 0x0a2c86da, 0xe9b66dfb,
+ 0x68dc1462, 0xd7486900, 0x680ec0a4, 0x27a18dee,
+ 0x4f3ffea2, 0xe887ad8c, 0xb58ce006, 0x7af4d6b6,
+ 0xaace1e7c, 0xd3375fec, 0xce78a399, 0x406b2a42,
+ 0x20fe9e35, 0xd9f385b9, 0xee39d7ab, 0x3b124e8b,
+ 0x1dc9faf7, 0x4b6d1856, 0x26a36631, 0xeae397b2,
+ 0x3a6efa74, 0xdd5b4332, 0x6841e7f7, 0xca7820fb,
+ 0xfb0af54e, 0xd8feb397, 0x454056ac, 0xba489527,
+ 0x55533a3a, 0x20838d87, 0xfe6ba9b7, 0xd096954b,
+ 0x55a867bc, 0xa1159a58, 0xcca92963, 0x99e1db33,
+ 0xa62a4a56, 0x3f3125f9, 0x5ef47e1c, 0x9029317c,
+ 0xfdf8e802, 0x04272f70, 0x80bb155c, 0x05282ce3,
+ 0x95c11548, 0xe4c66d22, 0x48c1133f, 0xc70f86dc,
+ 0x07f9c9ee, 0x41041f0f, 0x404779a4, 0x5d886e17,
+ 0x325f51eb, 0xd59bc0d1, 0xf2bcc18f, 0x41113564,
+ 0x257b7834, 0x602a9c60, 0xdff8e8a3, 0x1f636c1b,
+ 0x0e12b4c2, 0x02e1329e, 0xaf664fd1, 0xcad18115,
+ 0x6b2395e0, 0x333e92e1, 0x3b240b62, 0xeebeb922,
+ 0x85b2a20e, 0xe6ba0d99, 0xde720c8c, 0x2da2f728,
+ 0xd0127845, 0x95b794fd, 0x647d0862, 0xe7ccf5f0,
+ 0x5449a36f, 0x877d48fa, 0xc39dfd27, 0xf33e8d1e,
+ 0x0a476341, 0x992eff74, 0x3a6f6eab, 0xf4f8fd37,
+ 0xa812dc60, 0xa1ebddf8, 0x991be14c, 0xdb6e6b0d,
+ 0xc67b5510, 0x6d672c37, 0x2765d43b, 0xdcd0e804,
+ 0xf1290dc7, 0xcc00ffa3, 0xb5390f92, 0x690fed0b,
+ 0x667b9ffb, 0xcedb7d9c, 0xa091cf0b, 0xd9155ea3,
+ 0xbb132f88, 0x515bad24, 0x7b9479bf, 0x763bd6eb,
+ 0x37392eb3, 0xcc115979, 0x8026e297, 0xf42e312d,
+ 0x6842ada7, 0xc66a2b3b, 0x12754ccc, 0x782ef11c,
+ 0x6a124237, 0xb79251e7, 0x06a1bbe6, 0x4bfb6350,
+ 0x1a6b1018, 0x11caedfa, 0x3d25bdd8, 0xe2e1c3c9,
+ 0x44421659, 0x0a121386, 0xd90cec6e, 0xd5abea2a,
+ 0x64af674e, 0xda86a85f, 0xbebfe988, 0x64e4c3fe,
+ 0x9dbc8057, 0xf0f7c086, 0x60787bf8, 0x6003604d,
+ 0xd1fd8346, 0xf6381fb0, 0x7745ae04, 0xd736fccc,
+ 0x83426b33, 0xf01eab71, 0xb0804187, 0x3c005e5f,
+ 0x77a057be, 0xbde8ae24, 0x55464299, 0xbf582e61,
+ 0x4e58f48f, 0xf2ddfda2, 0xf474ef38, 0x8789bdc2,
+ 0x5366f9c3, 0xc8b38e74, 0xb475f255, 0x46fcd9b9,
+ 0x7aeb2661, 0x8b1ddf84, 0x846a0e79, 0x915f95e2,
+ 0x466e598e, 0x20b45770, 0x8cd55591, 0xc902de4c,
+ 0xb90bace1, 0xbb8205d0, 0x11a86248, 0x7574a99e,
+ 0xb77f19b6, 0xe0a9dc09, 0x662d09a1, 0xc4324633,
+ 0xe85a1f02, 0x09f0be8c, 0x4a99a025, 0x1d6efe10,
+ 0x1ab93d1d, 0x0ba5a4df, 0xa186f20f, 0x2868f169,
+ 0xdcb7da83, 0x573906fe, 0xa1e2ce9b, 0x4fcd7f52,
+ 0x50115e01, 0xa70683fa, 0xa002b5c4, 0x0de6d027,
+ 0x9af88c27, 0x773f8641, 0xc3604c06, 0x61a806b5,
+ 0xf0177a28, 0xc0f586e0, 0x006058aa, 0x30dc7d62,
+ 0x11e69ed7, 0x2338ea63, 0x53c2dd94, 0xc2c21634,
+ 0xbbcbee56, 0x90bcb6de, 0xebfc7da1, 0xce591d76,
+ 0x6f05e409, 0x4b7c0188, 0x39720a3d, 0x7c927c24,
+ 0x86e3725f, 0x724d9db9, 0x1ac15bb4, 0xd39eb8fc,
+ 0xed545578, 0x08fca5b5, 0xd83d7cd3, 0x4dad0fc4,
+ 0x1e50ef5e, 0xb161e6f8, 0xa28514d9, 0x6c51133c,
+ 0x6fd5c7e7, 0x56e14ec4, 0x362abfce, 0xddc6c837,
+ 0xd79a3234, 0x92638212, 0x670efa8e, 0x406000e0]),
+ new Uint32Array([
+ 0x3a39ce37, 0xd3faf5cf, 0xabc27737, 0x5ac52d1b,
+ 0x5cb0679e, 0x4fa33742, 0xd3822740, 0x99bc9bbe,
+ 0xd5118e9d, 0xbf0f7315, 0xd62d1c7e, 0xc700c47b,
+ 0xb78c1b6b, 0x21a19045, 0xb26eb1be, 0x6a366eb4,
+ 0x5748ab2f, 0xbc946e79, 0xc6a376d2, 0x6549c2c8,
+ 0x530ff8ee, 0x468dde7d, 0xd5730a1d, 0x4cd04dc6,
+ 0x2939bbdb, 0xa9ba4650, 0xac9526e8, 0xbe5ee304,
+ 0xa1fad5f0, 0x6a2d519a, 0x63ef8ce2, 0x9a86ee22,
+ 0xc089c2b8, 0x43242ef6, 0xa51e03aa, 0x9cf2d0a4,
+ 0x83c061ba, 0x9be96a4d, 0x8fe51550, 0xba645bd6,
+ 0x2826a2f9, 0xa73a3ae1, 0x4ba99586, 0xef5562e9,
+ 0xc72fefd3, 0xf752f7da, 0x3f046f69, 0x77fa0a59,
+ 0x80e4a915, 0x87b08601, 0x9b09e6ad, 0x3b3ee593,
+ 0xe990fd5a, 0x9e34d797, 0x2cf0b7d9, 0x022b8b51,
+ 0x96d5ac3a, 0x017da67d, 0xd1cf3ed6, 0x7c7d2d28,
+ 0x1f9f25cf, 0xadf2b89b, 0x5ad6b472, 0x5a88f54c,
+ 0xe029ac71, 0xe019a5e6, 0x47b0acfd, 0xed93fa9b,
+ 0xe8d3c48d, 0x283b57cc, 0xf8d56629, 0x79132e28,
+ 0x785f0191, 0xed756055, 0xf7960e44, 0xe3d35e8c,
+ 0x15056dd4, 0x88f46dba, 0x03a16125, 0x0564f0bd,
+ 0xc3eb9e15, 0x3c9057a2, 0x97271aec, 0xa93a072a,
+ 0x1b3f6d9b, 0x1e6321f5, 0xf59c66fb, 0x26dcf319,
+ 0x7533d928, 0xb155fdf5, 0x03563482, 0x8aba3cbb,
+ 0x28517711, 0xc20ad9f8, 0xabcc5167, 0xccad925f,
+ 0x4de81751, 0x3830dc8e, 0x379d5862, 0x9320f991,
+ 0xea7a90c2, 0xfb3e7bce, 0x5121ce64, 0x774fbe32,
+ 0xa8b6e37e, 0xc3293d46, 0x48de5369, 0x6413e680,
+ 0xa2ae0810, 0xdd6db224, 0x69852dfd, 0x09072166,
+ 0xb39a460a, 0x6445c0dd, 0x586cdecf, 0x1c20c8ae,
+ 0x5bbef7dd, 0x1b588d40, 0xccd2017f, 0x6bb4e3bb,
+ 0xdda26a7e, 0x3a59ff45, 0x3e350a44, 0xbcb4cdd5,
+ 0x72eacea8, 0xfa6484bb, 0x8d6612ae, 0xbf3c6f47,
+ 0xd29be463, 0x542f5d9e, 0xaec2771b, 0xf64e6370,
+ 0x740e0d8d, 0xe75b1357, 0xf8721671, 0xaf537d5d,
+ 0x4040cb08, 0x4eb4e2cc, 0x34d2466a, 0x0115af84,
+ 0xe1b00428, 0x95983a1d, 0x06b89fb4, 0xce6ea048,
+ 0x6f3f3b82, 0x3520ab82, 0x011a1d4b, 0x277227f8,
+ 0x611560b1, 0xe7933fdc, 0xbb3a792b, 0x344525bd,
+ 0xa08839e1, 0x51ce794b, 0x2f32c9b7, 0xa01fbac9,
+ 0xe01cc87e, 0xbcc7d1f6, 0xcf0111c3, 0xa1e8aac7,
+ 0x1a908749, 0xd44fbd9a, 0xd0dadecb, 0xd50ada38,
+ 0x0339c32a, 0xc6913667, 0x8df9317c, 0xe0b12b4f,
+ 0xf79e59b7, 0x43f5bb3a, 0xf2d519ff, 0x27d9459c,
+ 0xbf97222c, 0x15e6fc2a, 0x0f91fc71, 0x9b941525,
+ 0xfae59361, 0xceb69ceb, 0xc2a86459, 0x12baa8d1,
+ 0xb6c1075e, 0xe3056a0c, 0x10d25065, 0xcb03a442,
+ 0xe0ec6e0e, 0x1698db3b, 0x4c98a0be, 0x3278e964,
+ 0x9f1f9532, 0xe0d392df, 0xd3a0342b, 0x8971f21e,
+ 0x1b0a7441, 0x4ba3348c, 0xc5be7120, 0xc37632d8,
+ 0xdf359f8d, 0x9b992f2e, 0xe60b6f47, 0x0fe3f11d,
+ 0xe54cda54, 0x1edad891, 0xce6279cf, 0xcd3e7e6f,
+ 0x1618b166, 0xfd2c1d05, 0x848fd2c5, 0xf6fb2299,
+ 0xf523f357, 0xa6327623, 0x93a83531, 0x56cccd02,
+ 0xacf08162, 0x5a75ebb5, 0x6e163697, 0x88d273cc,
+ 0xde966292, 0x81b949d0, 0x4c50901b, 0x71c65614,
+ 0xe6c6c7bd, 0x327a140a, 0x45e1d006, 0xc3f27b9a,
+ 0xc9aa53fd, 0x62a80f00, 0xbb25bfe2, 0x35bdd2f6,
+ 0x71126905, 0xb2040222, 0xb6cbcf7c, 0xcd769c2b,
+ 0x53113ec0, 0x1640e3d3, 0x38abbd60, 0x2547adf0,
+ 0xba38209c, 0xf746ce76, 0x77afa1c5, 0x20756060,
+ 0x85cbfe4e, 0x8ae88dd8, 0x7aaaf9b0, 0x4cf9aa7e,
+ 0x1948c25c, 0x02fb8a8c, 0x01c36ae4, 0xd6ebe1f9,
+ 0x90d4f869, 0xa65cdea0, 0x3f09252d, 0xc208e69f,
+ 0xb74e6132, 0xce77e25b, 0x578fdfe3, 0x3ac372e6])
+ ];
+ this.P = new Uint32Array([
+ 0x243f6a88, 0x85a308d3, 0x13198a2e, 0x03707344,
+ 0xa4093822, 0x299f31d0, 0x082efa98, 0xec4e6c89,
+ 0x452821e6, 0x38d01377, 0xbe5466cf, 0x34e90c6c,
+ 0xc0ac29b7, 0xc97c50dd, 0x3f84d5b5, 0xb5470917,
+ 0x9216d5d9, 0x8979fb1b]);
+};
+
+function F(S, x8, i) {
+ return (((S[0][x8[i+3]] +
+ S[1][x8[i+2]]) ^
+ S[2][x8[i+1]]) +
+ S[3][x8[i]]);
+};
+
+Blowfish.prototype.encipher = function(x, x8) {
+ if (x8 === undefined) {
+ x8 = new Uint8Array(x.buffer);
+ if (x.byteOffset !== 0)
+ x8 = x8.subarray(x.byteOffset);
+ }
+ x[0] ^= this.P[0];
+ for (var i = 1; i < 16; i += 2) {
+ x[1] ^= F(this.S, x8, 0) ^ this.P[i];
+ x[0] ^= F(this.S, x8, 4) ^ this.P[i+1];
+ }
+ var t = x[0];
+ x[0] = x[1] ^ this.P[17];
+ x[1] = t;
+};
+
+Blowfish.prototype.decipher = function(x) {
+ var x8 = new Uint8Array(x.buffer);
+ if (x.byteOffset !== 0)
+ x8 = x8.subarray(x.byteOffset);
+ x[0] ^= this.P[17];
+ for (var i = 16; i > 0; i -= 2) {
+ x[1] ^= F(this.S, x8, 0) ^ this.P[i];
+ x[0] ^= F(this.S, x8, 4) ^ this.P[i-1];
+ }
+ var t = x[0];
+ x[0] = x[1] ^ this.P[0];
+ x[1] = t;
+};
+
+function stream2word(data, databytes){
+ var i, temp = 0;
+ for (i = 0; i < 4; i++, BLF_J++) {
+ if (BLF_J >= databytes) BLF_J = 0;
+ temp = (temp << 8) | data[BLF_J];
+ }
+ return temp;
+};
+
+Blowfish.prototype.expand0state = function(key, keybytes) {
+ var d = new Uint32Array(2), i, k;
+ var d8 = new Uint8Array(d.buffer);
+
+ for (i = 0, BLF_J = 0; i < 18; i++) {
+ this.P[i] ^= stream2word(key, keybytes);
+ }
+ BLF_J = 0;
+
+ for (i = 0; i < 18; i += 2) {
+ this.encipher(d, d8);
+ this.P[i] = d[0];
+ this.P[i+1] = d[1];
+ }
+
+ for (i = 0; i < 4; i++) {
+ for (k = 0; k < 256; k += 2) {
+ this.encipher(d, d8);
+ this.S[i][k] = d[0];
+ this.S[i][k+1] = d[1];
+ }
+ }
+};
+
+Blowfish.prototype.expandstate = function(data, databytes, key, keybytes) {
+ var d = new Uint32Array(2), i, k;
+
+ for (i = 0, BLF_J = 0; i < 18; i++) {
+ this.P[i] ^= stream2word(key, keybytes);
+ }
+
+ for (i = 0, BLF_J = 0; i < 18; i += 2) {
+ d[0] ^= stream2word(data, databytes);
+ d[1] ^= stream2word(data, databytes);
+ this.encipher(d);
+ this.P[i] = d[0];
+ this.P[i+1] = d[1];
+ }
+
+ for (i = 0; i < 4; i++) {
+ for (k = 0; k < 256; k += 2) {
+ d[0] ^= stream2word(data, databytes);
+ d[1] ^= stream2word(data, databytes);
+ this.encipher(d);
+ this.S[i][k] = d[0];
+ this.S[i][k+1] = d[1];
+ }
+ }
+ BLF_J = 0;
+};
+
+Blowfish.prototype.enc = function(data, blocks) {
+ for (var i = 0; i < blocks; i++) {
+ this.encipher(data.subarray(i*2));
+ }
+};
+
+Blowfish.prototype.dec = function(data, blocks) {
+ for (var i = 0; i < blocks; i++) {
+ this.decipher(data.subarray(i*2));
+ }
+};
+
+var BCRYPT_BLOCKS = 8,
+ BCRYPT_HASHSIZE = 32;
+
+function bcrypt_hash(sha2pass, sha2salt, out) {
+ var state = new Blowfish(),
+ cdata = new Uint32Array(BCRYPT_BLOCKS), i,
+ ciphertext = new Uint8Array([79,120,121,99,104,114,111,109,97,116,105,
+ 99,66,108,111,119,102,105,115,104,83,119,97,116,68,121,110,97,109,
+ 105,116,101]); //"OxychromaticBlowfishSwatDynamite"
+
+ state.expandstate(sha2salt, 64, sha2pass, 64);
+ for (i = 0; i < 64; i++) {
+ state.expand0state(sha2salt, 64);
+ state.expand0state(sha2pass, 64);
+ }
+
+ for (i = 0; i < BCRYPT_BLOCKS; i++)
+ cdata[i] = stream2word(ciphertext, ciphertext.byteLength);
+ for (i = 0; i < 64; i++)
+ state.enc(cdata, cdata.byteLength / 8);
+
+ for (i = 0; i < BCRYPT_BLOCKS; i++) {
+ out[4*i+3] = cdata[i] >>> 24;
+ out[4*i+2] = cdata[i] >>> 16;
+ out[4*i+1] = cdata[i] >>> 8;
+ out[4*i+0] = cdata[i];
+ }
+};
+
+function bcrypt_pbkdf(pass, passlen, salt, saltlen, key, keylen, rounds) {
+ var sha2pass = new Uint8Array(64),
+ sha2salt = new Uint8Array(64),
+ out = new Uint8Array(BCRYPT_HASHSIZE),
+ tmpout = new Uint8Array(BCRYPT_HASHSIZE),
+ countsalt = new Uint8Array(saltlen+4),
+ i, j, amt, stride, dest, count,
+ origkeylen = keylen;
+
+ if (rounds < 1)
+ return -1;
+ if (passlen === 0 || saltlen === 0 || keylen === 0 ||
+ keylen > (out.byteLength * out.byteLength) || saltlen > (1<<20))
+ return -1;
+
+ stride = Math.floor((keylen + out.byteLength - 1) / out.byteLength);
+ amt = Math.floor((keylen + stride - 1) / stride);
+
+ for (i = 0; i < saltlen; i++)
+ countsalt[i] = salt[i];
+
+ crypto_hash_sha512(sha2pass, pass, passlen);
+
+ for (count = 1; keylen > 0; count++) {
+ countsalt[saltlen+0] = count >>> 24;
+ countsalt[saltlen+1] = count >>> 16;
+ countsalt[saltlen+2] = count >>> 8;
+ countsalt[saltlen+3] = count;
+
+ crypto_hash_sha512(sha2salt, countsalt, saltlen + 4);
+ bcrypt_hash(sha2pass, sha2salt, tmpout);
+ for (i = out.byteLength; i--;)
+ out[i] = tmpout[i];
+
+ for (i = 1; i < rounds; i++) {
+ crypto_hash_sha512(sha2salt, tmpout, tmpout.byteLength);
+ bcrypt_hash(sha2pass, sha2salt, tmpout);
+ for (j = 0; j < out.byteLength; j++)
+ out[j] ^= tmpout[j];
+ }
+
+ amt = Math.min(amt, keylen);
+ for (i = 0; i < amt; i++) {
+ dest = i * stride + (count - 1);
+ if (dest >= origkeylen)
+ break;
+ key[dest] = out[i];
+ }
+ keylen -= i;
+ }
+
+ return 0;
+};
+
+module.exports = {
+ BLOCKS: BCRYPT_BLOCKS,
+ HASHSIZE: BCRYPT_HASHSIZE,
+ hash: bcrypt_hash,
+ pbkdf: bcrypt_pbkdf
+};
diff --git a/website_quotation_template/node_modules/bcrypt-pbkdf/package.json b/website_quotation_template/node_modules/bcrypt-pbkdf/package.json
new file mode 100644
index 000000000..45714be08
--- /dev/null
+++ b/website_quotation_template/node_modules/bcrypt-pbkdf/package.json
@@ -0,0 +1,44 @@
+{
+ "_from": "bcrypt-pbkdf@^1.0.0",
+ "_id": "bcrypt-pbkdf@1.0.2",
+ "_inBundle": false,
+ "_integrity": "sha512-qeFIXtP4MSoi6NLqO12WfqARWWuCKi2Rn/9hJLEmtB5yTNr9DqFWkJRCf2qShWzPeAMRnOgCrq0sg/KLv5ES9w==",
+ "_location": "/bcrypt-pbkdf",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "bcrypt-pbkdf@^1.0.0",
+ "name": "bcrypt-pbkdf",
+ "escapedName": "bcrypt-pbkdf",
+ "rawSpec": "^1.0.0",
+ "saveSpec": null,
+ "fetchSpec": "^1.0.0"
+ },
+ "_requiredBy": [
+ "/sshpk"
+ ],
+ "_resolved": "https://registry.npmjs.org/bcrypt-pbkdf/-/bcrypt-pbkdf-1.0.2.tgz",
+ "_shasum": "a4301d389b6a43f9b67ff3ca11a3f6637e360e9e",
+ "_spec": "bcrypt-pbkdf@^1.0.0",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/sshpk",
+ "bugs": {
+ "url": "https://github.com/joyent/node-bcrypt-pbkdf/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {
+ "tweetnacl": "^0.14.3"
+ },
+ "deprecated": false,
+ "description": "Port of the OpenBSD bcrypt_pbkdf function to pure JS",
+ "devDependencies": {},
+ "homepage": "https://github.com/joyent/node-bcrypt-pbkdf#readme",
+ "license": "BSD-3-Clause",
+ "main": "index.js",
+ "name": "bcrypt-pbkdf",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/joyent/node-bcrypt-pbkdf.git"
+ },
+ "version": "1.0.2"
+}
diff --git a/website_quotation_template/node_modules/bluebird/LICENSE b/website_quotation_template/node_modules/bluebird/LICENSE
new file mode 100644
index 000000000..4182a1e1c
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2013-2015 Petka Antonov
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/website_quotation_template/node_modules/bluebird/README.md b/website_quotation_template/node_modules/bluebird/README.md
new file mode 100644
index 000000000..3772161e7
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/README.md
@@ -0,0 +1,51 @@
+
+
+[](https://travis-ci.org/petkaantonov/bluebird)
+[](http://petkaantonov.github.io/bluebird/coverage/debug/index.html)
+
+**Got a question?** Join us on [stackoverflow](http://stackoverflow.com/questions/tagged/bluebird), the [mailing list](https://groups.google.com/forum/#!forum/bluebird-js) or chat on [IRC](https://webchat.freenode.net/?channels=#promises)
+
+# Introduction
+
+Bluebird is a fully featured promise library with focus on innovative features and performance
+
+See the [**bluebird website**](http://bluebirdjs.com/docs/getting-started.html) for further documentation, references and instructions. See the [**API reference**](http://bluebirdjs.com/docs/api-reference.html) here.
+
+For bluebird 2.x documentation and files, see the [2.x tree](https://github.com/petkaantonov/bluebird/tree/2.x).
+
+# Questions and issues
+
+The [github issue tracker](https://github.com/petkaantonov/bluebird/issues) is **_only_** for bug reports and feature requests. Anything else, such as questions for help in using the library, should be posted in [StackOverflow](http://stackoverflow.com/questions/tagged/bluebird) under tags `promise` and `bluebird`.
+
+
+
+## Thanks
+
+Thanks to BrowserStack for providing us with a free account which lets us support old browsers like IE8.
+
+# License
+
+The MIT License (MIT)
+
+Copyright (c) 2013-2016 Petka Antonov
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
+
diff --git a/website_quotation_template/node_modules/bluebird/changelog.md b/website_quotation_template/node_modules/bluebird/changelog.md
new file mode 100644
index 000000000..73b2eb6c7
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/changelog.md
@@ -0,0 +1 @@
+[http://bluebirdjs.com/docs/changelog.html](http://bluebirdjs.com/docs/changelog.html)
diff --git a/website_quotation_template/node_modules/bluebird/js/browser/bluebird.core.js b/website_quotation_template/node_modules/bluebird/js/browser/bluebird.core.js
new file mode 100644
index 000000000..ffb653822
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/browser/bluebird.core.js
@@ -0,0 +1,3739 @@
+/* @preserve
+ * The MIT License (MIT)
+ *
+ * Copyright (c) 2013-2015 Petka Antonov
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in
+ * all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ * THE SOFTWARE.
+ *
+ */
+/**
+ * bluebird build version 3.4.7
+ * Features enabled: core
+ * Features disabled: race, call_get, generators, map, nodeify, promisify, props, reduce, settle, some, using, timers, filter, any, each
+*/
+!function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{var f;"undefined"!=typeof window?f=window:"undefined"!=typeof global?f=global:"undefined"!=typeof self&&(f=self),f.Promise=e()}}(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof _dereq_=="function"&&_dereq_;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof _dereq_=="function"&&_dereq_;for(var o=0;o 0) {
+ var fn = queue.shift();
+ if (typeof fn !== "function") {
+ fn._settlePromises();
+ continue;
+ }
+ var receiver = queue.shift();
+ var arg = queue.shift();
+ fn.call(receiver, arg);
+ }
+};
+
+Async.prototype._drainQueues = function () {
+ this._drainQueue(this._normalQueue);
+ this._reset();
+ this._haveDrainedQueues = true;
+ this._drainQueue(this._lateQueue);
+};
+
+Async.prototype._queueTick = function () {
+ if (!this._isTickUsed) {
+ this._isTickUsed = true;
+ this._schedule(this.drainQueues);
+ }
+};
+
+Async.prototype._reset = function () {
+ this._isTickUsed = false;
+};
+
+module.exports = Async;
+module.exports.firstLineError = firstLineError;
+
+},{"./queue":17,"./schedule":18,"./util":21}],2:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise, debug) {
+var calledBind = false;
+var rejectThis = function(_, e) {
+ this._reject(e);
+};
+
+var targetRejected = function(e, context) {
+ context.promiseRejectionQueued = true;
+ context.bindingPromise._then(rejectThis, rejectThis, null, this, e);
+};
+
+var bindingResolved = function(thisArg, context) {
+ if (((this._bitField & 50397184) === 0)) {
+ this._resolveCallback(context.target);
+ }
+};
+
+var bindingRejected = function(e, context) {
+ if (!context.promiseRejectionQueued) this._reject(e);
+};
+
+Promise.prototype.bind = function (thisArg) {
+ if (!calledBind) {
+ calledBind = true;
+ Promise.prototype._propagateFrom = debug.propagateFromFunction();
+ Promise.prototype._boundValue = debug.boundValueFunction();
+ }
+ var maybePromise = tryConvertToPromise(thisArg);
+ var ret = new Promise(INTERNAL);
+ ret._propagateFrom(this, 1);
+ var target = this._target();
+ ret._setBoundTo(maybePromise);
+ if (maybePromise instanceof Promise) {
+ var context = {
+ promiseRejectionQueued: false,
+ promise: ret,
+ target: target,
+ bindingPromise: maybePromise
+ };
+ target._then(INTERNAL, targetRejected, undefined, ret, context);
+ maybePromise._then(
+ bindingResolved, bindingRejected, undefined, ret, context);
+ ret._setOnCancel(maybePromise);
+ } else {
+ ret._resolveCallback(target);
+ }
+ return ret;
+};
+
+Promise.prototype._setBoundTo = function (obj) {
+ if (obj !== undefined) {
+ this._bitField = this._bitField | 2097152;
+ this._boundTo = obj;
+ } else {
+ this._bitField = this._bitField & (~2097152);
+ }
+};
+
+Promise.prototype._isBound = function () {
+ return (this._bitField & 2097152) === 2097152;
+};
+
+Promise.bind = function (thisArg, value) {
+ return Promise.resolve(value).bind(thisArg);
+};
+};
+
+},{}],3:[function(_dereq_,module,exports){
+"use strict";
+var old;
+if (typeof Promise !== "undefined") old = Promise;
+function noConflict() {
+ try { if (Promise === bluebird) Promise = old; }
+ catch (e) {}
+ return bluebird;
+}
+var bluebird = _dereq_("./promise")();
+bluebird.noConflict = noConflict;
+module.exports = bluebird;
+
+},{"./promise":15}],4:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, PromiseArray, apiRejection, debug) {
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var async = Promise._async;
+
+Promise.prototype["break"] = Promise.prototype.cancel = function() {
+ if (!debug.cancellation()) return this._warn("cancellation is disabled");
+
+ var promise = this;
+ var child = promise;
+ while (promise._isCancellable()) {
+ if (!promise._cancelBy(child)) {
+ if (child._isFollowing()) {
+ child._followee().cancel();
+ } else {
+ child._cancelBranched();
+ }
+ break;
+ }
+
+ var parent = promise._cancellationParent;
+ if (parent == null || !parent._isCancellable()) {
+ if (promise._isFollowing()) {
+ promise._followee().cancel();
+ } else {
+ promise._cancelBranched();
+ }
+ break;
+ } else {
+ if (promise._isFollowing()) promise._followee().cancel();
+ promise._setWillBeCancelled();
+ child = promise;
+ promise = parent;
+ }
+ }
+};
+
+Promise.prototype._branchHasCancelled = function() {
+ this._branchesRemainingToCancel--;
+};
+
+Promise.prototype._enoughBranchesHaveCancelled = function() {
+ return this._branchesRemainingToCancel === undefined ||
+ this._branchesRemainingToCancel <= 0;
+};
+
+Promise.prototype._cancelBy = function(canceller) {
+ if (canceller === this) {
+ this._branchesRemainingToCancel = 0;
+ this._invokeOnCancel();
+ return true;
+ } else {
+ this._branchHasCancelled();
+ if (this._enoughBranchesHaveCancelled()) {
+ this._invokeOnCancel();
+ return true;
+ }
+ }
+ return false;
+};
+
+Promise.prototype._cancelBranched = function() {
+ if (this._enoughBranchesHaveCancelled()) {
+ this._cancel();
+ }
+};
+
+Promise.prototype._cancel = function() {
+ if (!this._isCancellable()) return;
+ this._setCancelled();
+ async.invoke(this._cancelPromises, this, undefined);
+};
+
+Promise.prototype._cancelPromises = function() {
+ if (this._length() > 0) this._settlePromises();
+};
+
+Promise.prototype._unsetOnCancel = function() {
+ this._onCancelField = undefined;
+};
+
+Promise.prototype._isCancellable = function() {
+ return this.isPending() && !this._isCancelled();
+};
+
+Promise.prototype.isCancellable = function() {
+ return this.isPending() && !this.isCancelled();
+};
+
+Promise.prototype._doInvokeOnCancel = function(onCancelCallback, internalOnly) {
+ if (util.isArray(onCancelCallback)) {
+ for (var i = 0; i < onCancelCallback.length; ++i) {
+ this._doInvokeOnCancel(onCancelCallback[i], internalOnly);
+ }
+ } else if (onCancelCallback !== undefined) {
+ if (typeof onCancelCallback === "function") {
+ if (!internalOnly) {
+ var e = tryCatch(onCancelCallback).call(this._boundValue());
+ if (e === errorObj) {
+ this._attachExtraTrace(e.e);
+ async.throwLater(e.e);
+ }
+ }
+ } else {
+ onCancelCallback._resultCancelled(this);
+ }
+ }
+};
+
+Promise.prototype._invokeOnCancel = function() {
+ var onCancelCallback = this._onCancel();
+ this._unsetOnCancel();
+ async.invoke(this._doInvokeOnCancel, this, onCancelCallback);
+};
+
+Promise.prototype._invokeInternalOnCancel = function() {
+ if (this._isCancellable()) {
+ this._doInvokeOnCancel(this._onCancel(), true);
+ this._unsetOnCancel();
+ }
+};
+
+Promise.prototype._resultCancelled = function() {
+ this.cancel();
+};
+
+};
+
+},{"./util":21}],5:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(NEXT_FILTER) {
+var util = _dereq_("./util");
+var getKeys = _dereq_("./es5").keys;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function catchFilter(instances, cb, promise) {
+ return function(e) {
+ var boundTo = promise._boundValue();
+ predicateLoop: for (var i = 0; i < instances.length; ++i) {
+ var item = instances[i];
+
+ if (item === Error ||
+ (item != null && item.prototype instanceof Error)) {
+ if (e instanceof item) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (typeof item === "function") {
+ var matchesPredicate = tryCatch(item).call(boundTo, e);
+ if (matchesPredicate === errorObj) {
+ return matchesPredicate;
+ } else if (matchesPredicate) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (util.isObject(e)) {
+ var keys = getKeys(item);
+ for (var j = 0; j < keys.length; ++j) {
+ var key = keys[j];
+ if (item[key] != e[key]) {
+ continue predicateLoop;
+ }
+ }
+ return tryCatch(cb).call(boundTo, e);
+ }
+ }
+ return NEXT_FILTER;
+ };
+}
+
+return catchFilter;
+};
+
+},{"./es5":10,"./util":21}],6:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+var longStackTraces = false;
+var contextStack = [];
+
+Promise.prototype._promiseCreated = function() {};
+Promise.prototype._pushContext = function() {};
+Promise.prototype._popContext = function() {return null;};
+Promise._peekContext = Promise.prototype._peekContext = function() {};
+
+function Context() {
+ this._trace = new Context.CapturedTrace(peekContext());
+}
+Context.prototype._pushContext = function () {
+ if (this._trace !== undefined) {
+ this._trace._promiseCreated = null;
+ contextStack.push(this._trace);
+ }
+};
+
+Context.prototype._popContext = function () {
+ if (this._trace !== undefined) {
+ var trace = contextStack.pop();
+ var ret = trace._promiseCreated;
+ trace._promiseCreated = null;
+ return ret;
+ }
+ return null;
+};
+
+function createContext() {
+ if (longStackTraces) return new Context();
+}
+
+function peekContext() {
+ var lastIndex = contextStack.length - 1;
+ if (lastIndex >= 0) {
+ return contextStack[lastIndex];
+ }
+ return undefined;
+}
+Context.CapturedTrace = null;
+Context.create = createContext;
+Context.deactivateLongStackTraces = function() {};
+Context.activateLongStackTraces = function() {
+ var Promise_pushContext = Promise.prototype._pushContext;
+ var Promise_popContext = Promise.prototype._popContext;
+ var Promise_PeekContext = Promise._peekContext;
+ var Promise_peekContext = Promise.prototype._peekContext;
+ var Promise_promiseCreated = Promise.prototype._promiseCreated;
+ Context.deactivateLongStackTraces = function() {
+ Promise.prototype._pushContext = Promise_pushContext;
+ Promise.prototype._popContext = Promise_popContext;
+ Promise._peekContext = Promise_PeekContext;
+ Promise.prototype._peekContext = Promise_peekContext;
+ Promise.prototype._promiseCreated = Promise_promiseCreated;
+ longStackTraces = false;
+ };
+ longStackTraces = true;
+ Promise.prototype._pushContext = Context.prototype._pushContext;
+ Promise.prototype._popContext = Context.prototype._popContext;
+ Promise._peekContext = Promise.prototype._peekContext = peekContext;
+ Promise.prototype._promiseCreated = function() {
+ var ctx = this._peekContext();
+ if (ctx && ctx._promiseCreated == null) ctx._promiseCreated = this;
+ };
+};
+return Context;
+};
+
+},{}],7:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, Context) {
+var getDomain = Promise._getDomain;
+var async = Promise._async;
+var Warning = _dereq_("./errors").Warning;
+var util = _dereq_("./util");
+var canAttachTrace = util.canAttachTrace;
+var unhandledRejectionHandled;
+var possiblyUnhandledRejection;
+var bluebirdFramePattern =
+ /[\\\/]bluebird[\\\/]js[\\\/](release|debug|instrumented)/;
+var nodeFramePattern = /\((?:timers\.js):\d+:\d+\)/;
+var parseLinePattern = /[\/<\(](.+?):(\d+):(\d+)\)?\s*$/;
+var stackFramePattern = null;
+var formatStack = null;
+var indentStackFrames = false;
+var printWarning;
+var debugging = !!(util.env("BLUEBIRD_DEBUG") != 0 &&
+ (true ||
+ util.env("BLUEBIRD_DEBUG") ||
+ util.env("NODE_ENV") === "development"));
+
+var warnings = !!(util.env("BLUEBIRD_WARNINGS") != 0 &&
+ (debugging || util.env("BLUEBIRD_WARNINGS")));
+
+var longStackTraces = !!(util.env("BLUEBIRD_LONG_STACK_TRACES") != 0 &&
+ (debugging || util.env("BLUEBIRD_LONG_STACK_TRACES")));
+
+var wForgottenReturn = util.env("BLUEBIRD_W_FORGOTTEN_RETURN") != 0 &&
+ (warnings || !!util.env("BLUEBIRD_W_FORGOTTEN_RETURN"));
+
+Promise.prototype.suppressUnhandledRejections = function() {
+ var target = this._target();
+ target._bitField = ((target._bitField & (~1048576)) |
+ 524288);
+};
+
+Promise.prototype._ensurePossibleRejectionHandled = function () {
+ if ((this._bitField & 524288) !== 0) return;
+ this._setRejectionIsUnhandled();
+ async.invokeLater(this._notifyUnhandledRejection, this, undefined);
+};
+
+Promise.prototype._notifyUnhandledRejectionIsHandled = function () {
+ fireRejectionEvent("rejectionHandled",
+ unhandledRejectionHandled, undefined, this);
+};
+
+Promise.prototype._setReturnedNonUndefined = function() {
+ this._bitField = this._bitField | 268435456;
+};
+
+Promise.prototype._returnedNonUndefined = function() {
+ return (this._bitField & 268435456) !== 0;
+};
+
+Promise.prototype._notifyUnhandledRejection = function () {
+ if (this._isRejectionUnhandled()) {
+ var reason = this._settledValue();
+ this._setUnhandledRejectionIsNotified();
+ fireRejectionEvent("unhandledRejection",
+ possiblyUnhandledRejection, reason, this);
+ }
+};
+
+Promise.prototype._setUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField | 262144;
+};
+
+Promise.prototype._unsetUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField & (~262144);
+};
+
+Promise.prototype._isUnhandledRejectionNotified = function () {
+ return (this._bitField & 262144) > 0;
+};
+
+Promise.prototype._setRejectionIsUnhandled = function () {
+ this._bitField = this._bitField | 1048576;
+};
+
+Promise.prototype._unsetRejectionIsUnhandled = function () {
+ this._bitField = this._bitField & (~1048576);
+ if (this._isUnhandledRejectionNotified()) {
+ this._unsetUnhandledRejectionIsNotified();
+ this._notifyUnhandledRejectionIsHandled();
+ }
+};
+
+Promise.prototype._isRejectionUnhandled = function () {
+ return (this._bitField & 1048576) > 0;
+};
+
+Promise.prototype._warn = function(message, shouldUseOwnTrace, promise) {
+ return warn(message, shouldUseOwnTrace, promise || this);
+};
+
+Promise.onPossiblyUnhandledRejection = function (fn) {
+ var domain = getDomain();
+ possiblyUnhandledRejection =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+Promise.onUnhandledRejectionHandled = function (fn) {
+ var domain = getDomain();
+ unhandledRejectionHandled =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+var disableLongStackTraces = function() {};
+Promise.longStackTraces = function () {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ if (!config.longStackTraces && longStackTracesIsSupported()) {
+ var Promise_captureStackTrace = Promise.prototype._captureStackTrace;
+ var Promise_attachExtraTrace = Promise.prototype._attachExtraTrace;
+ config.longStackTraces = true;
+ disableLongStackTraces = function() {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ Promise.prototype._captureStackTrace = Promise_captureStackTrace;
+ Promise.prototype._attachExtraTrace = Promise_attachExtraTrace;
+ Context.deactivateLongStackTraces();
+ async.enableTrampoline();
+ config.longStackTraces = false;
+ };
+ Promise.prototype._captureStackTrace = longStackTracesCaptureStackTrace;
+ Promise.prototype._attachExtraTrace = longStackTracesAttachExtraTrace;
+ Context.activateLongStackTraces();
+ async.disableTrampolineIfNecessary();
+ }
+};
+
+Promise.hasLongStackTraces = function () {
+ return config.longStackTraces && longStackTracesIsSupported();
+};
+
+var fireDomEvent = (function() {
+ try {
+ if (typeof CustomEvent === "function") {
+ var event = new CustomEvent("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new CustomEvent(name.toLowerCase(), {
+ detail: event,
+ cancelable: true
+ });
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else if (typeof Event === "function") {
+ var event = new Event("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new Event(name.toLowerCase(), {
+ cancelable: true
+ });
+ domEvent.detail = event;
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else {
+ var event = document.createEvent("CustomEvent");
+ event.initCustomEvent("testingtheevent", false, true, {});
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = document.createEvent("CustomEvent");
+ domEvent.initCustomEvent(name.toLowerCase(), false, true,
+ event);
+ return !util.global.dispatchEvent(domEvent);
+ };
+ }
+ } catch (e) {}
+ return function() {
+ return false;
+ };
+})();
+
+var fireGlobalEvent = (function() {
+ if (util.isNode) {
+ return function() {
+ return process.emit.apply(process, arguments);
+ };
+ } else {
+ if (!util.global) {
+ return function() {
+ return false;
+ };
+ }
+ return function(name) {
+ var methodName = "on" + name.toLowerCase();
+ var method = util.global[methodName];
+ if (!method) return false;
+ method.apply(util.global, [].slice.call(arguments, 1));
+ return true;
+ };
+ }
+})();
+
+function generatePromiseLifecycleEventObject(name, promise) {
+ return {promise: promise};
+}
+
+var eventToObjectGenerator = {
+ promiseCreated: generatePromiseLifecycleEventObject,
+ promiseFulfilled: generatePromiseLifecycleEventObject,
+ promiseRejected: generatePromiseLifecycleEventObject,
+ promiseResolved: generatePromiseLifecycleEventObject,
+ promiseCancelled: generatePromiseLifecycleEventObject,
+ promiseChained: function(name, promise, child) {
+ return {promise: promise, child: child};
+ },
+ warning: function(name, warning) {
+ return {warning: warning};
+ },
+ unhandledRejection: function (name, reason, promise) {
+ return {reason: reason, promise: promise};
+ },
+ rejectionHandled: generatePromiseLifecycleEventObject
+};
+
+var activeFireEvent = function (name) {
+ var globalEventFired = false;
+ try {
+ globalEventFired = fireGlobalEvent.apply(null, arguments);
+ } catch (e) {
+ async.throwLater(e);
+ globalEventFired = true;
+ }
+
+ var domEventFired = false;
+ try {
+ domEventFired = fireDomEvent(name,
+ eventToObjectGenerator[name].apply(null, arguments));
+ } catch (e) {
+ async.throwLater(e);
+ domEventFired = true;
+ }
+
+ return domEventFired || globalEventFired;
+};
+
+Promise.config = function(opts) {
+ opts = Object(opts);
+ if ("longStackTraces" in opts) {
+ if (opts.longStackTraces) {
+ Promise.longStackTraces();
+ } else if (!opts.longStackTraces && Promise.hasLongStackTraces()) {
+ disableLongStackTraces();
+ }
+ }
+ if ("warnings" in opts) {
+ var warningsOption = opts.warnings;
+ config.warnings = !!warningsOption;
+ wForgottenReturn = config.warnings;
+
+ if (util.isObject(warningsOption)) {
+ if ("wForgottenReturn" in warningsOption) {
+ wForgottenReturn = !!warningsOption.wForgottenReturn;
+ }
+ }
+ }
+ if ("cancellation" in opts && opts.cancellation && !config.cancellation) {
+ if (async.haveItemsQueued()) {
+ throw new Error(
+ "cannot enable cancellation after promises are in use");
+ }
+ Promise.prototype._clearCancellationData =
+ cancellationClearCancellationData;
+ Promise.prototype._propagateFrom = cancellationPropagateFrom;
+ Promise.prototype._onCancel = cancellationOnCancel;
+ Promise.prototype._setOnCancel = cancellationSetOnCancel;
+ Promise.prototype._attachCancellationCallback =
+ cancellationAttachCancellationCallback;
+ Promise.prototype._execute = cancellationExecute;
+ propagateFromFunction = cancellationPropagateFrom;
+ config.cancellation = true;
+ }
+ if ("monitoring" in opts) {
+ if (opts.monitoring && !config.monitoring) {
+ config.monitoring = true;
+ Promise.prototype._fireEvent = activeFireEvent;
+ } else if (!opts.monitoring && config.monitoring) {
+ config.monitoring = false;
+ Promise.prototype._fireEvent = defaultFireEvent;
+ }
+ }
+ return Promise;
+};
+
+function defaultFireEvent() { return false; }
+
+Promise.prototype._fireEvent = defaultFireEvent;
+Promise.prototype._execute = function(executor, resolve, reject) {
+ try {
+ executor(resolve, reject);
+ } catch (e) {
+ return e;
+ }
+};
+Promise.prototype._onCancel = function () {};
+Promise.prototype._setOnCancel = function (handler) { ; };
+Promise.prototype._attachCancellationCallback = function(onCancel) {
+ ;
+};
+Promise.prototype._captureStackTrace = function () {};
+Promise.prototype._attachExtraTrace = function () {};
+Promise.prototype._clearCancellationData = function() {};
+Promise.prototype._propagateFrom = function (parent, flags) {
+ ;
+ ;
+};
+
+function cancellationExecute(executor, resolve, reject) {
+ var promise = this;
+ try {
+ executor(resolve, reject, function(onCancel) {
+ if (typeof onCancel !== "function") {
+ throw new TypeError("onCancel must be a function, got: " +
+ util.toString(onCancel));
+ }
+ promise._attachCancellationCallback(onCancel);
+ });
+ } catch (e) {
+ return e;
+ }
+}
+
+function cancellationAttachCancellationCallback(onCancel) {
+ if (!this._isCancellable()) return this;
+
+ var previousOnCancel = this._onCancel();
+ if (previousOnCancel !== undefined) {
+ if (util.isArray(previousOnCancel)) {
+ previousOnCancel.push(onCancel);
+ } else {
+ this._setOnCancel([previousOnCancel, onCancel]);
+ }
+ } else {
+ this._setOnCancel(onCancel);
+ }
+}
+
+function cancellationOnCancel() {
+ return this._onCancelField;
+}
+
+function cancellationSetOnCancel(onCancel) {
+ this._onCancelField = onCancel;
+}
+
+function cancellationClearCancellationData() {
+ this._cancellationParent = undefined;
+ this._onCancelField = undefined;
+}
+
+function cancellationPropagateFrom(parent, flags) {
+ if ((flags & 1) !== 0) {
+ this._cancellationParent = parent;
+ var branchesRemainingToCancel = parent._branchesRemainingToCancel;
+ if (branchesRemainingToCancel === undefined) {
+ branchesRemainingToCancel = 0;
+ }
+ parent._branchesRemainingToCancel = branchesRemainingToCancel + 1;
+ }
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+
+function bindingPropagateFrom(parent, flags) {
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+var propagateFromFunction = bindingPropagateFrom;
+
+function boundValueFunction() {
+ var ret = this._boundTo;
+ if (ret !== undefined) {
+ if (ret instanceof Promise) {
+ if (ret.isFulfilled()) {
+ return ret.value();
+ } else {
+ return undefined;
+ }
+ }
+ }
+ return ret;
+}
+
+function longStackTracesCaptureStackTrace() {
+ this._trace = new CapturedTrace(this._peekContext());
+}
+
+function longStackTracesAttachExtraTrace(error, ignoreSelf) {
+ if (canAttachTrace(error)) {
+ var trace = this._trace;
+ if (trace !== undefined) {
+ if (ignoreSelf) trace = trace._parent;
+ }
+ if (trace !== undefined) {
+ trace.attachExtraTrace(error);
+ } else if (!error.__stackCleaned__) {
+ var parsed = parseStackAndMessage(error);
+ util.notEnumerableProp(error, "stack",
+ parsed.message + "\n" + parsed.stack.join("\n"));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+ }
+ }
+}
+
+function checkForgottenReturns(returnValue, promiseCreated, name, promise,
+ parent) {
+ if (returnValue === undefined && promiseCreated !== null &&
+ wForgottenReturn) {
+ if (parent !== undefined && parent._returnedNonUndefined()) return;
+ if ((promise._bitField & 65535) === 0) return;
+
+ if (name) name = name + " ";
+ var handlerLine = "";
+ var creatorLine = "";
+ if (promiseCreated._trace) {
+ var traceLines = promiseCreated._trace.stack.split("\n");
+ var stack = cleanStack(traceLines);
+ for (var i = stack.length - 1; i >= 0; --i) {
+ var line = stack[i];
+ if (!nodeFramePattern.test(line)) {
+ var lineMatches = line.match(parseLinePattern);
+ if (lineMatches) {
+ handlerLine = "at " + lineMatches[1] +
+ ":" + lineMatches[2] + ":" + lineMatches[3] + " ";
+ }
+ break;
+ }
+ }
+
+ if (stack.length > 0) {
+ var firstUserLine = stack[0];
+ for (var i = 0; i < traceLines.length; ++i) {
+
+ if (traceLines[i] === firstUserLine) {
+ if (i > 0) {
+ creatorLine = "\n" + traceLines[i - 1];
+ }
+ break;
+ }
+ }
+
+ }
+ }
+ var msg = "a promise was created in a " + name +
+ "handler " + handlerLine + "but was not returned from it, " +
+ "see http://goo.gl/rRqMUw" +
+ creatorLine;
+ promise._warn(msg, true, promiseCreated);
+ }
+}
+
+function deprecated(name, replacement) {
+ var message = name +
+ " is deprecated and will be removed in a future version.";
+ if (replacement) message += " Use " + replacement + " instead.";
+ return warn(message);
+}
+
+function warn(message, shouldUseOwnTrace, promise) {
+ if (!config.warnings) return;
+ var warning = new Warning(message);
+ var ctx;
+ if (shouldUseOwnTrace) {
+ promise._attachExtraTrace(warning);
+ } else if (config.longStackTraces && (ctx = Promise._peekContext())) {
+ ctx.attachExtraTrace(warning);
+ } else {
+ var parsed = parseStackAndMessage(warning);
+ warning.stack = parsed.message + "\n" + parsed.stack.join("\n");
+ }
+
+ if (!activeFireEvent("warning", warning)) {
+ formatAndLogError(warning, "", true);
+ }
+}
+
+function reconstructStack(message, stacks) {
+ for (var i = 0; i < stacks.length - 1; ++i) {
+ stacks[i].push("From previous event:");
+ stacks[i] = stacks[i].join("\n");
+ }
+ if (i < stacks.length) {
+ stacks[i] = stacks[i].join("\n");
+ }
+ return message + "\n" + stacks.join("\n");
+}
+
+function removeDuplicateOrEmptyJumps(stacks) {
+ for (var i = 0; i < stacks.length; ++i) {
+ if (stacks[i].length === 0 ||
+ ((i + 1 < stacks.length) && stacks[i][0] === stacks[i+1][0])) {
+ stacks.splice(i, 1);
+ i--;
+ }
+ }
+}
+
+function removeCommonRoots(stacks) {
+ var current = stacks[0];
+ for (var i = 1; i < stacks.length; ++i) {
+ var prev = stacks[i];
+ var currentLastIndex = current.length - 1;
+ var currentLastLine = current[currentLastIndex];
+ var commonRootMeetPoint = -1;
+
+ for (var j = prev.length - 1; j >= 0; --j) {
+ if (prev[j] === currentLastLine) {
+ commonRootMeetPoint = j;
+ break;
+ }
+ }
+
+ for (var j = commonRootMeetPoint; j >= 0; --j) {
+ var line = prev[j];
+ if (current[currentLastIndex] === line) {
+ current.pop();
+ currentLastIndex--;
+ } else {
+ break;
+ }
+ }
+ current = prev;
+ }
+}
+
+function cleanStack(stack) {
+ var ret = [];
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ var isTraceLine = " (No stack trace)" === line ||
+ stackFramePattern.test(line);
+ var isInternalFrame = isTraceLine && shouldIgnore(line);
+ if (isTraceLine && !isInternalFrame) {
+ if (indentStackFrames && line.charAt(0) !== " ") {
+ line = " " + line;
+ }
+ ret.push(line);
+ }
+ }
+ return ret;
+}
+
+function stackFramesAsArray(error) {
+ var stack = error.stack.replace(/\s+$/g, "").split("\n");
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ if (" (No stack trace)" === line || stackFramePattern.test(line)) {
+ break;
+ }
+ }
+ if (i > 0 && error.name != "SyntaxError") {
+ stack = stack.slice(i);
+ }
+ return stack;
+}
+
+function parseStackAndMessage(error) {
+ var stack = error.stack;
+ var message = error.toString();
+ stack = typeof stack === "string" && stack.length > 0
+ ? stackFramesAsArray(error) : [" (No stack trace)"];
+ return {
+ message: message,
+ stack: error.name == "SyntaxError" ? stack : cleanStack(stack)
+ };
+}
+
+function formatAndLogError(error, title, isSoft) {
+ if (typeof console !== "undefined") {
+ var message;
+ if (util.isObject(error)) {
+ var stack = error.stack;
+ message = title + formatStack(stack, error);
+ } else {
+ message = title + String(error);
+ }
+ if (typeof printWarning === "function") {
+ printWarning(message, isSoft);
+ } else if (typeof console.log === "function" ||
+ typeof console.log === "object") {
+ console.log(message);
+ }
+ }
+}
+
+function fireRejectionEvent(name, localHandler, reason, promise) {
+ var localEventFired = false;
+ try {
+ if (typeof localHandler === "function") {
+ localEventFired = true;
+ if (name === "rejectionHandled") {
+ localHandler(promise);
+ } else {
+ localHandler(reason, promise);
+ }
+ }
+ } catch (e) {
+ async.throwLater(e);
+ }
+
+ if (name === "unhandledRejection") {
+ if (!activeFireEvent(name, reason, promise) && !localEventFired) {
+ formatAndLogError(reason, "Unhandled rejection ");
+ }
+ } else {
+ activeFireEvent(name, promise);
+ }
+}
+
+function formatNonError(obj) {
+ var str;
+ if (typeof obj === "function") {
+ str = "[function " +
+ (obj.name || "anonymous") +
+ "]";
+ } else {
+ str = obj && typeof obj.toString === "function"
+ ? obj.toString() : util.toString(obj);
+ var ruselessToString = /\[object [a-zA-Z0-9$_]+\]/;
+ if (ruselessToString.test(str)) {
+ try {
+ var newStr = JSON.stringify(obj);
+ str = newStr;
+ }
+ catch(e) {
+
+ }
+ }
+ if (str.length === 0) {
+ str = "(empty array)";
+ }
+ }
+ return ("(<" + snip(str) + ">, no stack trace)");
+}
+
+function snip(str) {
+ var maxChars = 41;
+ if (str.length < maxChars) {
+ return str;
+ }
+ return str.substr(0, maxChars - 3) + "...";
+}
+
+function longStackTracesIsSupported() {
+ return typeof captureStackTrace === "function";
+}
+
+var shouldIgnore = function() { return false; };
+var parseLineInfoRegex = /[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;
+function parseLineInfo(line) {
+ var matches = line.match(parseLineInfoRegex);
+ if (matches) {
+ return {
+ fileName: matches[1],
+ line: parseInt(matches[2], 10)
+ };
+ }
+}
+
+function setBounds(firstLineError, lastLineError) {
+ if (!longStackTracesIsSupported()) return;
+ var firstStackLines = firstLineError.stack.split("\n");
+ var lastStackLines = lastLineError.stack.split("\n");
+ var firstIndex = -1;
+ var lastIndex = -1;
+ var firstFileName;
+ var lastFileName;
+ for (var i = 0; i < firstStackLines.length; ++i) {
+ var result = parseLineInfo(firstStackLines[i]);
+ if (result) {
+ firstFileName = result.fileName;
+ firstIndex = result.line;
+ break;
+ }
+ }
+ for (var i = 0; i < lastStackLines.length; ++i) {
+ var result = parseLineInfo(lastStackLines[i]);
+ if (result) {
+ lastFileName = result.fileName;
+ lastIndex = result.line;
+ break;
+ }
+ }
+ if (firstIndex < 0 || lastIndex < 0 || !firstFileName || !lastFileName ||
+ firstFileName !== lastFileName || firstIndex >= lastIndex) {
+ return;
+ }
+
+ shouldIgnore = function(line) {
+ if (bluebirdFramePattern.test(line)) return true;
+ var info = parseLineInfo(line);
+ if (info) {
+ if (info.fileName === firstFileName &&
+ (firstIndex <= info.line && info.line <= lastIndex)) {
+ return true;
+ }
+ }
+ return false;
+ };
+}
+
+function CapturedTrace(parent) {
+ this._parent = parent;
+ this._promisesCreated = 0;
+ var length = this._length = 1 + (parent === undefined ? 0 : parent._length);
+ captureStackTrace(this, CapturedTrace);
+ if (length > 32) this.uncycle();
+}
+util.inherits(CapturedTrace, Error);
+Context.CapturedTrace = CapturedTrace;
+
+CapturedTrace.prototype.uncycle = function() {
+ var length = this._length;
+ if (length < 2) return;
+ var nodes = [];
+ var stackToIndex = {};
+
+ for (var i = 0, node = this; node !== undefined; ++i) {
+ nodes.push(node);
+ node = node._parent;
+ }
+ length = this._length = i;
+ for (var i = length - 1; i >= 0; --i) {
+ var stack = nodes[i].stack;
+ if (stackToIndex[stack] === undefined) {
+ stackToIndex[stack] = i;
+ }
+ }
+ for (var i = 0; i < length; ++i) {
+ var currentStack = nodes[i].stack;
+ var index = stackToIndex[currentStack];
+ if (index !== undefined && index !== i) {
+ if (index > 0) {
+ nodes[index - 1]._parent = undefined;
+ nodes[index - 1]._length = 1;
+ }
+ nodes[i]._parent = undefined;
+ nodes[i]._length = 1;
+ var cycleEdgeNode = i > 0 ? nodes[i - 1] : this;
+
+ if (index < length - 1) {
+ cycleEdgeNode._parent = nodes[index + 1];
+ cycleEdgeNode._parent.uncycle();
+ cycleEdgeNode._length =
+ cycleEdgeNode._parent._length + 1;
+ } else {
+ cycleEdgeNode._parent = undefined;
+ cycleEdgeNode._length = 1;
+ }
+ var currentChildLength = cycleEdgeNode._length + 1;
+ for (var j = i - 2; j >= 0; --j) {
+ nodes[j]._length = currentChildLength;
+ currentChildLength++;
+ }
+ return;
+ }
+ }
+};
+
+CapturedTrace.prototype.attachExtraTrace = function(error) {
+ if (error.__stackCleaned__) return;
+ this.uncycle();
+ var parsed = parseStackAndMessage(error);
+ var message = parsed.message;
+ var stacks = [parsed.stack];
+
+ var trace = this;
+ while (trace !== undefined) {
+ stacks.push(cleanStack(trace.stack.split("\n")));
+ trace = trace._parent;
+ }
+ removeCommonRoots(stacks);
+ removeDuplicateOrEmptyJumps(stacks);
+ util.notEnumerableProp(error, "stack", reconstructStack(message, stacks));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+};
+
+var captureStackTrace = (function stackDetection() {
+ var v8stackFramePattern = /^\s*at\s*/;
+ var v8stackFormatter = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if (error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ if (typeof Error.stackTraceLimit === "number" &&
+ typeof Error.captureStackTrace === "function") {
+ Error.stackTraceLimit += 6;
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ var captureStackTrace = Error.captureStackTrace;
+
+ shouldIgnore = function(line) {
+ return bluebirdFramePattern.test(line);
+ };
+ return function(receiver, ignoreUntil) {
+ Error.stackTraceLimit += 6;
+ captureStackTrace(receiver, ignoreUntil);
+ Error.stackTraceLimit -= 6;
+ };
+ }
+ var err = new Error();
+
+ if (typeof err.stack === "string" &&
+ err.stack.split("\n")[0].indexOf("stackDetection@") >= 0) {
+ stackFramePattern = /@/;
+ formatStack = v8stackFormatter;
+ indentStackFrames = true;
+ return function captureStackTrace(o) {
+ o.stack = new Error().stack;
+ };
+ }
+
+ var hasStackAfterThrow;
+ try { throw new Error(); }
+ catch(e) {
+ hasStackAfterThrow = ("stack" in e);
+ }
+ if (!("stack" in err) && hasStackAfterThrow &&
+ typeof Error.stackTraceLimit === "number") {
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ return function captureStackTrace(o) {
+ Error.stackTraceLimit += 6;
+ try { throw new Error(); }
+ catch(e) { o.stack = e.stack; }
+ Error.stackTraceLimit -= 6;
+ };
+ }
+
+ formatStack = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if ((typeof error === "object" ||
+ typeof error === "function") &&
+ error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ return null;
+
+})([]);
+
+if (typeof console !== "undefined" && typeof console.warn !== "undefined") {
+ printWarning = function (message) {
+ console.warn(message);
+ };
+ if (util.isNode && process.stderr.isTTY) {
+ printWarning = function(message, isSoft) {
+ var color = isSoft ? "\u001b[33m" : "\u001b[31m";
+ console.warn(color + message + "\u001b[0m\n");
+ };
+ } else if (!util.isNode && typeof (new Error().stack) === "string") {
+ printWarning = function(message, isSoft) {
+ console.warn("%c" + message,
+ isSoft ? "color: darkorange" : "color: red");
+ };
+ }
+}
+
+var config = {
+ warnings: warnings,
+ longStackTraces: false,
+ cancellation: false,
+ monitoring: false
+};
+
+if (longStackTraces) Promise.longStackTraces();
+
+return {
+ longStackTraces: function() {
+ return config.longStackTraces;
+ },
+ warnings: function() {
+ return config.warnings;
+ },
+ cancellation: function() {
+ return config.cancellation;
+ },
+ monitoring: function() {
+ return config.monitoring;
+ },
+ propagateFromFunction: function() {
+ return propagateFromFunction;
+ },
+ boundValueFunction: function() {
+ return boundValueFunction;
+ },
+ checkForgottenReturns: checkForgottenReturns,
+ setBounds: setBounds,
+ warn: warn,
+ deprecated: deprecated,
+ CapturedTrace: CapturedTrace,
+ fireDomEvent: fireDomEvent,
+ fireGlobalEvent: fireGlobalEvent
+};
+};
+
+},{"./errors":9,"./util":21}],8:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+function returner() {
+ return this.value;
+}
+function thrower() {
+ throw this.reason;
+}
+
+Promise.prototype["return"] =
+Promise.prototype.thenReturn = function (value) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ returner, undefined, undefined, {value: value}, undefined);
+};
+
+Promise.prototype["throw"] =
+Promise.prototype.thenThrow = function (reason) {
+ return this._then(
+ thrower, undefined, undefined, {reason: reason}, undefined);
+};
+
+Promise.prototype.catchThrow = function (reason) {
+ if (arguments.length <= 1) {
+ return this._then(
+ undefined, thrower, undefined, {reason: reason}, undefined);
+ } else {
+ var _reason = arguments[1];
+ var handler = function() {throw _reason;};
+ return this.caught(reason, handler);
+ }
+};
+
+Promise.prototype.catchReturn = function (value) {
+ if (arguments.length <= 1) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ undefined, returner, undefined, {value: value}, undefined);
+ } else {
+ var _value = arguments[1];
+ if (_value instanceof Promise) _value.suppressUnhandledRejections();
+ var handler = function() {return _value;};
+ return this.caught(value, handler);
+ }
+};
+};
+
+},{}],9:[function(_dereq_,module,exports){
+"use strict";
+var es5 = _dereq_("./es5");
+var Objectfreeze = es5.freeze;
+var util = _dereq_("./util");
+var inherits = util.inherits;
+var notEnumerableProp = util.notEnumerableProp;
+
+function subError(nameProperty, defaultMessage) {
+ function SubError(message) {
+ if (!(this instanceof SubError)) return new SubError(message);
+ notEnumerableProp(this, "message",
+ typeof message === "string" ? message : defaultMessage);
+ notEnumerableProp(this, "name", nameProperty);
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ } else {
+ Error.call(this);
+ }
+ }
+ inherits(SubError, Error);
+ return SubError;
+}
+
+var _TypeError, _RangeError;
+var Warning = subError("Warning", "warning");
+var CancellationError = subError("CancellationError", "cancellation error");
+var TimeoutError = subError("TimeoutError", "timeout error");
+var AggregateError = subError("AggregateError", "aggregate error");
+try {
+ _TypeError = TypeError;
+ _RangeError = RangeError;
+} catch(e) {
+ _TypeError = subError("TypeError", "type error");
+ _RangeError = subError("RangeError", "range error");
+}
+
+var methods = ("join pop push shift unshift slice filter forEach some " +
+ "every map indexOf lastIndexOf reduce reduceRight sort reverse").split(" ");
+
+for (var i = 0; i < methods.length; ++i) {
+ if (typeof Array.prototype[methods[i]] === "function") {
+ AggregateError.prototype[methods[i]] = Array.prototype[methods[i]];
+ }
+}
+
+es5.defineProperty(AggregateError.prototype, "length", {
+ value: 0,
+ configurable: false,
+ writable: true,
+ enumerable: true
+});
+AggregateError.prototype["isOperational"] = true;
+var level = 0;
+AggregateError.prototype.toString = function() {
+ var indent = Array(level * 4 + 1).join(" ");
+ var ret = "\n" + indent + "AggregateError of:" + "\n";
+ level++;
+ indent = Array(level * 4 + 1).join(" ");
+ for (var i = 0; i < this.length; ++i) {
+ var str = this[i] === this ? "[Circular AggregateError]" : this[i] + "";
+ var lines = str.split("\n");
+ for (var j = 0; j < lines.length; ++j) {
+ lines[j] = indent + lines[j];
+ }
+ str = lines.join("\n");
+ ret += str + "\n";
+ }
+ level--;
+ return ret;
+};
+
+function OperationalError(message) {
+ if (!(this instanceof OperationalError))
+ return new OperationalError(message);
+ notEnumerableProp(this, "name", "OperationalError");
+ notEnumerableProp(this, "message", message);
+ this.cause = message;
+ this["isOperational"] = true;
+
+ if (message instanceof Error) {
+ notEnumerableProp(this, "message", message.message);
+ notEnumerableProp(this, "stack", message.stack);
+ } else if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ }
+
+}
+inherits(OperationalError, Error);
+
+var errorTypes = Error["__BluebirdErrorTypes__"];
+if (!errorTypes) {
+ errorTypes = Objectfreeze({
+ CancellationError: CancellationError,
+ TimeoutError: TimeoutError,
+ OperationalError: OperationalError,
+ RejectionError: OperationalError,
+ AggregateError: AggregateError
+ });
+ es5.defineProperty(Error, "__BluebirdErrorTypes__", {
+ value: errorTypes,
+ writable: false,
+ enumerable: false,
+ configurable: false
+ });
+}
+
+module.exports = {
+ Error: Error,
+ TypeError: _TypeError,
+ RangeError: _RangeError,
+ CancellationError: errorTypes.CancellationError,
+ OperationalError: errorTypes.OperationalError,
+ TimeoutError: errorTypes.TimeoutError,
+ AggregateError: errorTypes.AggregateError,
+ Warning: Warning
+};
+
+},{"./es5":10,"./util":21}],10:[function(_dereq_,module,exports){
+var isES5 = (function(){
+ "use strict";
+ return this === undefined;
+})();
+
+if (isES5) {
+ module.exports = {
+ freeze: Object.freeze,
+ defineProperty: Object.defineProperty,
+ getDescriptor: Object.getOwnPropertyDescriptor,
+ keys: Object.keys,
+ names: Object.getOwnPropertyNames,
+ getPrototypeOf: Object.getPrototypeOf,
+ isArray: Array.isArray,
+ isES5: isES5,
+ propertyIsWritable: function(obj, prop) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop);
+ return !!(!descriptor || descriptor.writable || descriptor.set);
+ }
+ };
+} else {
+ var has = {}.hasOwnProperty;
+ var str = {}.toString;
+ var proto = {}.constructor.prototype;
+
+ var ObjectKeys = function (o) {
+ var ret = [];
+ for (var key in o) {
+ if (has.call(o, key)) {
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+
+ var ObjectGetDescriptor = function(o, key) {
+ return {value: o[key]};
+ };
+
+ var ObjectDefineProperty = function (o, key, desc) {
+ o[key] = desc.value;
+ return o;
+ };
+
+ var ObjectFreeze = function (obj) {
+ return obj;
+ };
+
+ var ObjectGetPrototypeOf = function (obj) {
+ try {
+ return Object(obj).constructor.prototype;
+ }
+ catch (e) {
+ return proto;
+ }
+ };
+
+ var ArrayIsArray = function (obj) {
+ try {
+ return str.call(obj) === "[object Array]";
+ }
+ catch(e) {
+ return false;
+ }
+ };
+
+ module.exports = {
+ isArray: ArrayIsArray,
+ keys: ObjectKeys,
+ names: ObjectKeys,
+ defineProperty: ObjectDefineProperty,
+ getDescriptor: ObjectGetDescriptor,
+ freeze: ObjectFreeze,
+ getPrototypeOf: ObjectGetPrototypeOf,
+ isES5: isES5,
+ propertyIsWritable: function() {
+ return true;
+ }
+ };
+}
+
+},{}],11:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, tryConvertToPromise) {
+var util = _dereq_("./util");
+var CancellationError = Promise.CancellationError;
+var errorObj = util.errorObj;
+
+function PassThroughHandlerContext(promise, type, handler) {
+ this.promise = promise;
+ this.type = type;
+ this.handler = handler;
+ this.called = false;
+ this.cancelPromise = null;
+}
+
+PassThroughHandlerContext.prototype.isFinallyHandler = function() {
+ return this.type === 0;
+};
+
+function FinallyHandlerCancelReaction(finallyHandler) {
+ this.finallyHandler = finallyHandler;
+}
+
+FinallyHandlerCancelReaction.prototype._resultCancelled = function() {
+ checkCancel(this.finallyHandler);
+};
+
+function checkCancel(ctx, reason) {
+ if (ctx.cancelPromise != null) {
+ if (arguments.length > 1) {
+ ctx.cancelPromise._reject(reason);
+ } else {
+ ctx.cancelPromise._cancel();
+ }
+ ctx.cancelPromise = null;
+ return true;
+ }
+ return false;
+}
+
+function succeed() {
+ return finallyHandler.call(this, this.promise._target()._settledValue());
+}
+function fail(reason) {
+ if (checkCancel(this, reason)) return;
+ errorObj.e = reason;
+ return errorObj;
+}
+function finallyHandler(reasonOrValue) {
+ var promise = this.promise;
+ var handler = this.handler;
+
+ if (!this.called) {
+ this.called = true;
+ var ret = this.isFinallyHandler()
+ ? handler.call(promise._boundValue())
+ : handler.call(promise._boundValue(), reasonOrValue);
+ if (ret !== undefined) {
+ promise._setReturnedNonUndefined();
+ var maybePromise = tryConvertToPromise(ret, promise);
+ if (maybePromise instanceof Promise) {
+ if (this.cancelPromise != null) {
+ if (maybePromise._isCancelled()) {
+ var reason =
+ new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ errorObj.e = reason;
+ return errorObj;
+ } else if (maybePromise.isPending()) {
+ maybePromise._attachCancellationCallback(
+ new FinallyHandlerCancelReaction(this));
+ }
+ }
+ return maybePromise._then(
+ succeed, fail, undefined, this, undefined);
+ }
+ }
+ }
+
+ if (promise.isRejected()) {
+ checkCancel(this);
+ errorObj.e = reasonOrValue;
+ return errorObj;
+ } else {
+ checkCancel(this);
+ return reasonOrValue;
+ }
+}
+
+Promise.prototype._passThrough = function(handler, type, success, fail) {
+ if (typeof handler !== "function") return this.then();
+ return this._then(success,
+ fail,
+ undefined,
+ new PassThroughHandlerContext(this, type, handler),
+ undefined);
+};
+
+Promise.prototype.lastly =
+Promise.prototype["finally"] = function (handler) {
+ return this._passThrough(handler,
+ 0,
+ finallyHandler,
+ finallyHandler);
+};
+
+Promise.prototype.tap = function (handler) {
+ return this._passThrough(handler, 1, finallyHandler);
+};
+
+return PassThroughHandlerContext;
+};
+
+},{"./util":21}],12:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, PromiseArray, tryConvertToPromise, INTERNAL, async,
+ getDomain) {
+var util = _dereq_("./util");
+var canEvaluate = util.canEvaluate;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var reject;
+
+if (!true) {
+if (canEvaluate) {
+ var thenCallback = function(i) {
+ return new Function("value", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = value; \n\
+ holder.checkFulfillment(this); \n\
+ ".replace(/Index/g, i));
+ };
+
+ var promiseSetter = function(i) {
+ return new Function("promise", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = promise; \n\
+ ".replace(/Index/g, i));
+ };
+
+ var generateHolderClass = function(total) {
+ var props = new Array(total);
+ for (var i = 0; i < props.length; ++i) {
+ props[i] = "this.p" + (i+1);
+ }
+ var assignment = props.join(" = ") + " = null;";
+ var cancellationCode= "var promise;\n" + props.map(function(prop) {
+ return " \n\
+ promise = " + prop + "; \n\
+ if (promise instanceof Promise) { \n\
+ promise.cancel(); \n\
+ } \n\
+ ";
+ }).join("\n");
+ var passedArguments = props.join(", ");
+ var name = "Holder$" + total;
+
+
+ var code = "return function(tryCatch, errorObj, Promise, async) { \n\
+ 'use strict'; \n\
+ function [TheName](fn) { \n\
+ [TheProperties] \n\
+ this.fn = fn; \n\
+ this.asyncNeeded = true; \n\
+ this.now = 0; \n\
+ } \n\
+ \n\
+ [TheName].prototype._callFunction = function(promise) { \n\
+ promise._pushContext(); \n\
+ var ret = tryCatch(this.fn)([ThePassedArguments]); \n\
+ promise._popContext(); \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(ret.e, false); \n\
+ } else { \n\
+ promise._resolveCallback(ret); \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype.checkFulfillment = function(promise) { \n\
+ var now = ++this.now; \n\
+ if (now === [TheTotal]) { \n\
+ if (this.asyncNeeded) { \n\
+ async.invoke(this._callFunction, this, promise); \n\
+ } else { \n\
+ this._callFunction(promise); \n\
+ } \n\
+ \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype._resultCancelled = function() { \n\
+ [CancellationCode] \n\
+ }; \n\
+ \n\
+ return [TheName]; \n\
+ }(tryCatch, errorObj, Promise, async); \n\
+ ";
+
+ code = code.replace(/\[TheName\]/g, name)
+ .replace(/\[TheTotal\]/g, total)
+ .replace(/\[ThePassedArguments\]/g, passedArguments)
+ .replace(/\[TheProperties\]/g, assignment)
+ .replace(/\[CancellationCode\]/g, cancellationCode);
+
+ return new Function("tryCatch", "errorObj", "Promise", "async", code)
+ (tryCatch, errorObj, Promise, async);
+ };
+
+ var holderClasses = [];
+ var thenCallbacks = [];
+ var promiseSetters = [];
+
+ for (var i = 0; i < 8; ++i) {
+ holderClasses.push(generateHolderClass(i + 1));
+ thenCallbacks.push(thenCallback(i + 1));
+ promiseSetters.push(promiseSetter(i + 1));
+ }
+
+ reject = function (reason) {
+ this._reject(reason);
+ };
+}}
+
+Promise.join = function () {
+ var last = arguments.length - 1;
+ var fn;
+ if (last > 0 && typeof arguments[last] === "function") {
+ fn = arguments[last];
+ if (!true) {
+ if (last <= 8 && canEvaluate) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var HolderClass = holderClasses[last - 1];
+ var holder = new HolderClass(fn);
+ var callbacks = thenCallbacks;
+
+ for (var i = 0; i < last; ++i) {
+ var maybePromise = tryConvertToPromise(arguments[i], ret);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._then(callbacks[i], reject,
+ undefined, ret, holder);
+ promiseSetters[i](maybePromise, holder);
+ holder.asyncNeeded = false;
+ } else if (((bitField & 33554432) !== 0)) {
+ callbacks[i].call(ret,
+ maybePromise._value(), holder);
+ } else if (((bitField & 16777216) !== 0)) {
+ ret._reject(maybePromise._reason());
+ } else {
+ ret._cancel();
+ }
+ } else {
+ callbacks[i].call(ret, maybePromise, holder);
+ }
+ }
+
+ if (!ret._isFateSealed()) {
+ if (holder.asyncNeeded) {
+ var domain = getDomain();
+ if (domain !== null) {
+ holder.fn = util.domainBind(domain, holder.fn);
+ }
+ }
+ ret._setAsyncGuaranteed();
+ ret._setOnCancel(holder);
+ }
+ return ret;
+ }
+ }
+ }
+ var args = [].slice.call(arguments);;
+ if (fn) args.pop();
+ var ret = new PromiseArray(args).promise();
+ return fn !== undefined ? ret.spread(fn) : ret;
+};
+
+};
+
+},{"./util":21}],13:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, INTERNAL, tryConvertToPromise, apiRejection, debug) {
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+
+Promise.method = function (fn) {
+ if (typeof fn !== "function") {
+ throw new Promise.TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return function () {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value = tryCatch(fn).apply(this, arguments);
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.method", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+ };
+};
+
+Promise.attempt = Promise["try"] = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value;
+ if (arguments.length > 1) {
+ debug.deprecated("calling Promise.try with more than 1 argument");
+ var arg = arguments[1];
+ var ctx = arguments[2];
+ value = util.isArray(arg) ? tryCatch(fn).apply(ctx, arg)
+ : tryCatch(fn).call(ctx, arg);
+ } else {
+ value = tryCatch(fn)();
+ }
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.try", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+};
+
+Promise.prototype._resolveFromSyncValue = function (value) {
+ if (value === util.errorObj) {
+ this._rejectCallback(value.e, false);
+ } else {
+ this._resolveCallback(value, true);
+ }
+};
+};
+
+},{"./util":21}],14:[function(_dereq_,module,exports){
+"use strict";
+var util = _dereq_("./util");
+var maybeWrapAsError = util.maybeWrapAsError;
+var errors = _dereq_("./errors");
+var OperationalError = errors.OperationalError;
+var es5 = _dereq_("./es5");
+
+function isUntypedError(obj) {
+ return obj instanceof Error &&
+ es5.getPrototypeOf(obj) === Error.prototype;
+}
+
+var rErrorKey = /^(?:name|message|stack|cause)$/;
+function wrapAsOperationalError(obj) {
+ var ret;
+ if (isUntypedError(obj)) {
+ ret = new OperationalError(obj);
+ ret.name = obj.name;
+ ret.message = obj.message;
+ ret.stack = obj.stack;
+ var keys = es5.keys(obj);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (!rErrorKey.test(key)) {
+ ret[key] = obj[key];
+ }
+ }
+ return ret;
+ }
+ util.markAsOriginatingFromRejection(obj);
+ return obj;
+}
+
+function nodebackForPromise(promise, multiArgs) {
+ return function(err, value) {
+ if (promise === null) return;
+ if (err) {
+ var wrapped = wrapAsOperationalError(maybeWrapAsError(err));
+ promise._attachExtraTrace(wrapped);
+ promise._reject(wrapped);
+ } else if (!multiArgs) {
+ promise._fulfill(value);
+ } else {
+ var args = [].slice.call(arguments, 1);;
+ promise._fulfill(args);
+ }
+ promise = null;
+ };
+}
+
+module.exports = nodebackForPromise;
+
+},{"./errors":9,"./es5":10,"./util":21}],15:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function() {
+var makeSelfResolutionError = function () {
+ return new TypeError("circular promise resolution chain\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var reflectHandler = function() {
+ return new Promise.PromiseInspection(this._target());
+};
+var apiRejection = function(msg) {
+ return Promise.reject(new TypeError(msg));
+};
+function Proxyable() {}
+var UNDEFINED_BINDING = {};
+var util = _dereq_("./util");
+
+var getDomain;
+if (util.isNode) {
+ getDomain = function() {
+ var ret = process.domain;
+ if (ret === undefined) ret = null;
+ return ret;
+ };
+} else {
+ getDomain = function() {
+ return null;
+ };
+}
+util.notEnumerableProp(Promise, "_getDomain", getDomain);
+
+var es5 = _dereq_("./es5");
+var Async = _dereq_("./async");
+var async = new Async();
+es5.defineProperty(Promise, "_async", {value: async});
+var errors = _dereq_("./errors");
+var TypeError = Promise.TypeError = errors.TypeError;
+Promise.RangeError = errors.RangeError;
+var CancellationError = Promise.CancellationError = errors.CancellationError;
+Promise.TimeoutError = errors.TimeoutError;
+Promise.OperationalError = errors.OperationalError;
+Promise.RejectionError = errors.OperationalError;
+Promise.AggregateError = errors.AggregateError;
+var INTERNAL = function(){};
+var APPLY = {};
+var NEXT_FILTER = {};
+var tryConvertToPromise = _dereq_("./thenables")(Promise, INTERNAL);
+var PromiseArray =
+ _dereq_("./promise_array")(Promise, INTERNAL,
+ tryConvertToPromise, apiRejection, Proxyable);
+var Context = _dereq_("./context")(Promise);
+ /*jshint unused:false*/
+var createContext = Context.create;
+var debug = _dereq_("./debuggability")(Promise, Context);
+var CapturedTrace = debug.CapturedTrace;
+var PassThroughHandlerContext =
+ _dereq_("./finally")(Promise, tryConvertToPromise);
+var catchFilter = _dereq_("./catch_filter")(NEXT_FILTER);
+var nodebackForPromise = _dereq_("./nodeback");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+function check(self, executor) {
+ if (typeof executor !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(executor));
+ }
+ if (self.constructor !== Promise) {
+ throw new TypeError("the promise constructor cannot be invoked directly\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+}
+
+function Promise(executor) {
+ this._bitField = 0;
+ this._fulfillmentHandler0 = undefined;
+ this._rejectionHandler0 = undefined;
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ if (executor !== INTERNAL) {
+ check(this, executor);
+ this._resolveFromExecutor(executor);
+ }
+ this._promiseCreated();
+ this._fireEvent("promiseCreated", this);
+}
+
+Promise.prototype.toString = function () {
+ return "[object Promise]";
+};
+
+Promise.prototype.caught = Promise.prototype["catch"] = function (fn) {
+ var len = arguments.length;
+ if (len > 1) {
+ var catchInstances = new Array(len - 1),
+ j = 0, i;
+ for (i = 0; i < len - 1; ++i) {
+ var item = arguments[i];
+ if (util.isObject(item)) {
+ catchInstances[j++] = item;
+ } else {
+ return apiRejection("expecting an object but got " +
+ "A catch statement predicate " + util.classString(item));
+ }
+ }
+ catchInstances.length = j;
+ fn = arguments[i];
+ return this.then(undefined, catchFilter(catchInstances, fn, this));
+ }
+ return this.then(undefined, fn);
+};
+
+Promise.prototype.reflect = function () {
+ return this._then(reflectHandler,
+ reflectHandler, undefined, this, undefined);
+};
+
+Promise.prototype.then = function (didFulfill, didReject) {
+ if (debug.warnings() && arguments.length > 0 &&
+ typeof didFulfill !== "function" &&
+ typeof didReject !== "function") {
+ var msg = ".then() only accepts functions but was passed: " +
+ util.classString(didFulfill);
+ if (arguments.length > 1) {
+ msg += ", " + util.classString(didReject);
+ }
+ this._warn(msg);
+ }
+ return this._then(didFulfill, didReject, undefined, undefined, undefined);
+};
+
+Promise.prototype.done = function (didFulfill, didReject) {
+ var promise =
+ this._then(didFulfill, didReject, undefined, undefined, undefined);
+ promise._setIsFinal();
+};
+
+Promise.prototype.spread = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ return this.all()._then(fn, undefined, undefined, APPLY, undefined);
+};
+
+Promise.prototype.toJSON = function () {
+ var ret = {
+ isFulfilled: false,
+ isRejected: false,
+ fulfillmentValue: undefined,
+ rejectionReason: undefined
+ };
+ if (this.isFulfilled()) {
+ ret.fulfillmentValue = this.value();
+ ret.isFulfilled = true;
+ } else if (this.isRejected()) {
+ ret.rejectionReason = this.reason();
+ ret.isRejected = true;
+ }
+ return ret;
+};
+
+Promise.prototype.all = function () {
+ if (arguments.length > 0) {
+ this._warn(".all() was passed arguments but it does not take any");
+ }
+ return new PromiseArray(this).promise();
+};
+
+Promise.prototype.error = function (fn) {
+ return this.caught(util.originatesFromRejection, fn);
+};
+
+Promise.getNewLibraryCopy = module.exports;
+
+Promise.is = function (val) {
+ return val instanceof Promise;
+};
+
+Promise.fromNode = Promise.fromCallback = function(fn) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var multiArgs = arguments.length > 1 ? !!Object(arguments[1]).multiArgs
+ : false;
+ var result = tryCatch(fn)(nodebackForPromise(ret, multiArgs));
+ if (result === errorObj) {
+ ret._rejectCallback(result.e, true);
+ }
+ if (!ret._isFateSealed()) ret._setAsyncGuaranteed();
+ return ret;
+};
+
+Promise.all = function (promises) {
+ return new PromiseArray(promises).promise();
+};
+
+Promise.cast = function (obj) {
+ var ret = tryConvertToPromise(obj);
+ if (!(ret instanceof Promise)) {
+ ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._setFulfilled();
+ ret._rejectionHandler0 = obj;
+ }
+ return ret;
+};
+
+Promise.resolve = Promise.fulfilled = Promise.cast;
+
+Promise.reject = Promise.rejected = function (reason) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._rejectCallback(reason, true);
+ return ret;
+};
+
+Promise.setScheduler = function(fn) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return async.setScheduler(fn);
+};
+
+Promise.prototype._then = function (
+ didFulfill,
+ didReject,
+ _, receiver,
+ internalData
+) {
+ var haveInternalData = internalData !== undefined;
+ var promise = haveInternalData ? internalData : new Promise(INTERNAL);
+ var target = this._target();
+ var bitField = target._bitField;
+
+ if (!haveInternalData) {
+ promise._propagateFrom(this, 3);
+ promise._captureStackTrace();
+ if (receiver === undefined &&
+ ((this._bitField & 2097152) !== 0)) {
+ if (!((bitField & 50397184) === 0)) {
+ receiver = this._boundValue();
+ } else {
+ receiver = target === this ? undefined : this._boundTo;
+ }
+ }
+ this._fireEvent("promiseChained", this, promise);
+ }
+
+ var domain = getDomain();
+ if (!((bitField & 50397184) === 0)) {
+ var handler, value, settler = target._settlePromiseCtx;
+ if (((bitField & 33554432) !== 0)) {
+ value = target._rejectionHandler0;
+ handler = didFulfill;
+ } else if (((bitField & 16777216) !== 0)) {
+ value = target._fulfillmentHandler0;
+ handler = didReject;
+ target._unsetRejectionIsUnhandled();
+ } else {
+ settler = target._settlePromiseLateCancellationObserver;
+ value = new CancellationError("late cancellation observer");
+ target._attachExtraTrace(value);
+ handler = didReject;
+ }
+
+ async.invoke(settler, target, {
+ handler: domain === null ? handler
+ : (typeof handler === "function" &&
+ util.domainBind(domain, handler)),
+ promise: promise,
+ receiver: receiver,
+ value: value
+ });
+ } else {
+ target._addCallbacks(didFulfill, didReject, promise, receiver, domain);
+ }
+
+ return promise;
+};
+
+Promise.prototype._length = function () {
+ return this._bitField & 65535;
+};
+
+Promise.prototype._isFateSealed = function () {
+ return (this._bitField & 117506048) !== 0;
+};
+
+Promise.prototype._isFollowing = function () {
+ return (this._bitField & 67108864) === 67108864;
+};
+
+Promise.prototype._setLength = function (len) {
+ this._bitField = (this._bitField & -65536) |
+ (len & 65535);
+};
+
+Promise.prototype._setFulfilled = function () {
+ this._bitField = this._bitField | 33554432;
+ this._fireEvent("promiseFulfilled", this);
+};
+
+Promise.prototype._setRejected = function () {
+ this._bitField = this._bitField | 16777216;
+ this._fireEvent("promiseRejected", this);
+};
+
+Promise.prototype._setFollowing = function () {
+ this._bitField = this._bitField | 67108864;
+ this._fireEvent("promiseResolved", this);
+};
+
+Promise.prototype._setIsFinal = function () {
+ this._bitField = this._bitField | 4194304;
+};
+
+Promise.prototype._isFinal = function () {
+ return (this._bitField & 4194304) > 0;
+};
+
+Promise.prototype._unsetCancelled = function() {
+ this._bitField = this._bitField & (~65536);
+};
+
+Promise.prototype._setCancelled = function() {
+ this._bitField = this._bitField | 65536;
+ this._fireEvent("promiseCancelled", this);
+};
+
+Promise.prototype._setWillBeCancelled = function() {
+ this._bitField = this._bitField | 8388608;
+};
+
+Promise.prototype._setAsyncGuaranteed = function() {
+ if (async.hasCustomScheduler()) return;
+ this._bitField = this._bitField | 134217728;
+};
+
+Promise.prototype._receiverAt = function (index) {
+ var ret = index === 0 ? this._receiver0 : this[
+ index * 4 - 4 + 3];
+ if (ret === UNDEFINED_BINDING) {
+ return undefined;
+ } else if (ret === undefined && this._isBound()) {
+ return this._boundValue();
+ }
+ return ret;
+};
+
+Promise.prototype._promiseAt = function (index) {
+ return this[
+ index * 4 - 4 + 2];
+};
+
+Promise.prototype._fulfillmentHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 0];
+};
+
+Promise.prototype._rejectionHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 1];
+};
+
+Promise.prototype._boundValue = function() {};
+
+Promise.prototype._migrateCallback0 = function (follower) {
+ var bitField = follower._bitField;
+ var fulfill = follower._fulfillmentHandler0;
+ var reject = follower._rejectionHandler0;
+ var promise = follower._promise0;
+ var receiver = follower._receiverAt(0);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._migrateCallbackAt = function (follower, index) {
+ var fulfill = follower._fulfillmentHandlerAt(index);
+ var reject = follower._rejectionHandlerAt(index);
+ var promise = follower._promiseAt(index);
+ var receiver = follower._receiverAt(index);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._addCallbacks = function (
+ fulfill,
+ reject,
+ promise,
+ receiver,
+ domain
+) {
+ var index = this._length();
+
+ if (index >= 65535 - 4) {
+ index = 0;
+ this._setLength(0);
+ }
+
+ if (index === 0) {
+ this._promise0 = promise;
+ this._receiver0 = receiver;
+ if (typeof fulfill === "function") {
+ this._fulfillmentHandler0 =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this._rejectionHandler0 =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ } else {
+ var base = index * 4 - 4;
+ this[base + 2] = promise;
+ this[base + 3] = receiver;
+ if (typeof fulfill === "function") {
+ this[base + 0] =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this[base + 1] =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ }
+ this._setLength(index + 1);
+ return index;
+};
+
+Promise.prototype._proxy = function (proxyable, arg) {
+ this._addCallbacks(undefined, undefined, arg, proxyable, null);
+};
+
+Promise.prototype._resolveCallback = function(value, shouldBind) {
+ if (((this._bitField & 117506048) !== 0)) return;
+ if (value === this)
+ return this._rejectCallback(makeSelfResolutionError(), false);
+ var maybePromise = tryConvertToPromise(value, this);
+ if (!(maybePromise instanceof Promise)) return this._fulfill(value);
+
+ if (shouldBind) this._propagateFrom(maybePromise, 2);
+
+ var promise = maybePromise._target();
+
+ if (promise === this) {
+ this._reject(makeSelfResolutionError());
+ return;
+ }
+
+ var bitField = promise._bitField;
+ if (((bitField & 50397184) === 0)) {
+ var len = this._length();
+ if (len > 0) promise._migrateCallback0(this);
+ for (var i = 1; i < len; ++i) {
+ promise._migrateCallbackAt(this, i);
+ }
+ this._setFollowing();
+ this._setLength(0);
+ this._setFollowee(promise);
+ } else if (((bitField & 33554432) !== 0)) {
+ this._fulfill(promise._value());
+ } else if (((bitField & 16777216) !== 0)) {
+ this._reject(promise._reason());
+ } else {
+ var reason = new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ this._reject(reason);
+ }
+};
+
+Promise.prototype._rejectCallback =
+function(reason, synchronous, ignoreNonErrorWarnings) {
+ var trace = util.ensureErrorObject(reason);
+ var hasStack = trace === reason;
+ if (!hasStack && !ignoreNonErrorWarnings && debug.warnings()) {
+ var message = "a promise was rejected with a non-error: " +
+ util.classString(reason);
+ this._warn(message, true);
+ }
+ this._attachExtraTrace(trace, synchronous ? hasStack : false);
+ this._reject(reason);
+};
+
+Promise.prototype._resolveFromExecutor = function (executor) {
+ var promise = this;
+ this._captureStackTrace();
+ this._pushContext();
+ var synchronous = true;
+ var r = this._execute(executor, function(value) {
+ promise._resolveCallback(value);
+ }, function (reason) {
+ promise._rejectCallback(reason, synchronous);
+ });
+ synchronous = false;
+ this._popContext();
+
+ if (r !== undefined) {
+ promise._rejectCallback(r, true);
+ }
+};
+
+Promise.prototype._settlePromiseFromHandler = function (
+ handler, receiver, value, promise
+) {
+ var bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+ promise._pushContext();
+ var x;
+ if (receiver === APPLY) {
+ if (!value || typeof value.length !== "number") {
+ x = errorObj;
+ x.e = new TypeError("cannot .spread() a non-array: " +
+ util.classString(value));
+ } else {
+ x = tryCatch(handler).apply(this._boundValue(), value);
+ }
+ } else {
+ x = tryCatch(handler).call(receiver, value);
+ }
+ var promiseCreated = promise._popContext();
+ bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+
+ if (x === NEXT_FILTER) {
+ promise._reject(value);
+ } else if (x === errorObj) {
+ promise._rejectCallback(x.e, false);
+ } else {
+ debug.checkForgottenReturns(x, promiseCreated, "", promise, this);
+ promise._resolveCallback(x);
+ }
+};
+
+Promise.prototype._target = function() {
+ var ret = this;
+ while (ret._isFollowing()) ret = ret._followee();
+ return ret;
+};
+
+Promise.prototype._followee = function() {
+ return this._rejectionHandler0;
+};
+
+Promise.prototype._setFollowee = function(promise) {
+ this._rejectionHandler0 = promise;
+};
+
+Promise.prototype._settlePromise = function(promise, handler, receiver, value) {
+ var isPromise = promise instanceof Promise;
+ var bitField = this._bitField;
+ var asyncGuaranteed = ((bitField & 134217728) !== 0);
+ if (((bitField & 65536) !== 0)) {
+ if (isPromise) promise._invokeInternalOnCancel();
+
+ if (receiver instanceof PassThroughHandlerContext &&
+ receiver.isFinallyHandler()) {
+ receiver.cancelPromise = promise;
+ if (tryCatch(handler).call(receiver, value) === errorObj) {
+ promise._reject(errorObj.e);
+ }
+ } else if (handler === reflectHandler) {
+ promise._fulfill(reflectHandler.call(receiver));
+ } else if (receiver instanceof Proxyable) {
+ receiver._promiseCancelled(promise);
+ } else if (isPromise || promise instanceof PromiseArray) {
+ promise._cancel();
+ } else {
+ receiver.cancel();
+ }
+ } else if (typeof handler === "function") {
+ if (!isPromise) {
+ handler.call(receiver, value, promise);
+ } else {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (receiver instanceof Proxyable) {
+ if (!receiver._isResolved()) {
+ if (((bitField & 33554432) !== 0)) {
+ receiver._promiseFulfilled(value, promise);
+ } else {
+ receiver._promiseRejected(value, promise);
+ }
+ }
+ } else if (isPromise) {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ if (((bitField & 33554432) !== 0)) {
+ promise._fulfill(value);
+ } else {
+ promise._reject(value);
+ }
+ }
+};
+
+Promise.prototype._settlePromiseLateCancellationObserver = function(ctx) {
+ var handler = ctx.handler;
+ var promise = ctx.promise;
+ var receiver = ctx.receiver;
+ var value = ctx.value;
+ if (typeof handler === "function") {
+ if (!(promise instanceof Promise)) {
+ handler.call(receiver, value, promise);
+ } else {
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (promise instanceof Promise) {
+ promise._reject(value);
+ }
+};
+
+Promise.prototype._settlePromiseCtx = function(ctx) {
+ this._settlePromise(ctx.promise, ctx.handler, ctx.receiver, ctx.value);
+};
+
+Promise.prototype._settlePromise0 = function(handler, value, bitField) {
+ var promise = this._promise0;
+ var receiver = this._receiverAt(0);
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ this._settlePromise(promise, handler, receiver, value);
+};
+
+Promise.prototype._clearCallbackDataAtIndex = function(index) {
+ var base = index * 4 - 4;
+ this[base + 2] =
+ this[base + 3] =
+ this[base + 0] =
+ this[base + 1] = undefined;
+};
+
+Promise.prototype._fulfill = function (value) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ if (value === this) {
+ var err = makeSelfResolutionError();
+ this._attachExtraTrace(err);
+ return this._reject(err);
+ }
+ this._setFulfilled();
+ this._rejectionHandler0 = value;
+
+ if ((bitField & 65535) > 0) {
+ if (((bitField & 134217728) !== 0)) {
+ this._settlePromises();
+ } else {
+ async.settlePromises(this);
+ }
+ }
+};
+
+Promise.prototype._reject = function (reason) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ this._setRejected();
+ this._fulfillmentHandler0 = reason;
+
+ if (this._isFinal()) {
+ return async.fatalError(reason, util.isNode);
+ }
+
+ if ((bitField & 65535) > 0) {
+ async.settlePromises(this);
+ } else {
+ this._ensurePossibleRejectionHandled();
+ }
+};
+
+Promise.prototype._fulfillPromises = function (len, value) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._fulfillmentHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, value);
+ }
+};
+
+Promise.prototype._rejectPromises = function (len, reason) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._rejectionHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, reason);
+ }
+};
+
+Promise.prototype._settlePromises = function () {
+ var bitField = this._bitField;
+ var len = (bitField & 65535);
+
+ if (len > 0) {
+ if (((bitField & 16842752) !== 0)) {
+ var reason = this._fulfillmentHandler0;
+ this._settlePromise0(this._rejectionHandler0, reason, bitField);
+ this._rejectPromises(len, reason);
+ } else {
+ var value = this._rejectionHandler0;
+ this._settlePromise0(this._fulfillmentHandler0, value, bitField);
+ this._fulfillPromises(len, value);
+ }
+ this._setLength(0);
+ }
+ this._clearCancellationData();
+};
+
+Promise.prototype._settledValue = function() {
+ var bitField = this._bitField;
+ if (((bitField & 33554432) !== 0)) {
+ return this._rejectionHandler0;
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._fulfillmentHandler0;
+ }
+};
+
+function deferResolve(v) {this.promise._resolveCallback(v);}
+function deferReject(v) {this.promise._rejectCallback(v, false);}
+
+Promise.defer = Promise.pending = function() {
+ debug.deprecated("Promise.defer", "new Promise");
+ var promise = new Promise(INTERNAL);
+ return {
+ promise: promise,
+ resolve: deferResolve,
+ reject: deferReject
+ };
+};
+
+util.notEnumerableProp(Promise,
+ "_makeSelfResolutionError",
+ makeSelfResolutionError);
+
+_dereq_("./method")(Promise, INTERNAL, tryConvertToPromise, apiRejection,
+ debug);
+_dereq_("./bind")(Promise, INTERNAL, tryConvertToPromise, debug);
+_dereq_("./cancel")(Promise, PromiseArray, apiRejection, debug);
+_dereq_("./direct_resolve")(Promise);
+_dereq_("./synchronous_inspection")(Promise);
+_dereq_("./join")(
+ Promise, PromiseArray, tryConvertToPromise, INTERNAL, async, getDomain);
+Promise.Promise = Promise;
+Promise.version = "3.4.7";
+
+ util.toFastProperties(Promise);
+ util.toFastProperties(Promise.prototype);
+ function fillTypes(value) {
+ var p = new Promise(INTERNAL);
+ p._fulfillmentHandler0 = value;
+ p._rejectionHandler0 = value;
+ p._promise0 = value;
+ p._receiver0 = value;
+ }
+ // Complete slack tracking, opt out of field-type tracking and
+ // stabilize map
+ fillTypes({a: 1});
+ fillTypes({b: 2});
+ fillTypes({c: 3});
+ fillTypes(1);
+ fillTypes(function(){});
+ fillTypes(undefined);
+ fillTypes(false);
+ fillTypes(new Promise(INTERNAL));
+ debug.setBounds(Async.firstLineError, util.lastLineError);
+ return Promise;
+
+};
+
+},{"./async":1,"./bind":2,"./cancel":4,"./catch_filter":5,"./context":6,"./debuggability":7,"./direct_resolve":8,"./errors":9,"./es5":10,"./finally":11,"./join":12,"./method":13,"./nodeback":14,"./promise_array":16,"./synchronous_inspection":19,"./thenables":20,"./util":21}],16:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise,
+ apiRejection, Proxyable) {
+var util = _dereq_("./util");
+var isArray = util.isArray;
+
+function toResolutionValue(val) {
+ switch(val) {
+ case -2: return [];
+ case -3: return {};
+ }
+}
+
+function PromiseArray(values) {
+ var promise = this._promise = new Promise(INTERNAL);
+ if (values instanceof Promise) {
+ promise._propagateFrom(values, 3);
+ }
+ promise._setOnCancel(this);
+ this._values = values;
+ this._length = 0;
+ this._totalResolved = 0;
+ this._init(undefined, -2);
+}
+util.inherits(PromiseArray, Proxyable);
+
+PromiseArray.prototype.length = function () {
+ return this._length;
+};
+
+PromiseArray.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseArray.prototype._init = function init(_, resolveValueIfEmpty) {
+ var values = tryConvertToPromise(this._values, this._promise);
+ if (values instanceof Promise) {
+ values = values._target();
+ var bitField = values._bitField;
+ ;
+ this._values = values;
+
+ if (((bitField & 50397184) === 0)) {
+ this._promise._setAsyncGuaranteed();
+ return values._then(
+ init,
+ this._reject,
+ undefined,
+ this,
+ resolveValueIfEmpty
+ );
+ } else if (((bitField & 33554432) !== 0)) {
+ values = values._value();
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._reject(values._reason());
+ } else {
+ return this._cancel();
+ }
+ }
+ values = util.asArray(values);
+ if (values === null) {
+ var err = apiRejection(
+ "expecting an array or an iterable object but got " + util.classString(values)).reason();
+ this._promise._rejectCallback(err, false);
+ return;
+ }
+
+ if (values.length === 0) {
+ if (resolveValueIfEmpty === -5) {
+ this._resolveEmptyArray();
+ }
+ else {
+ this._resolve(toResolutionValue(resolveValueIfEmpty));
+ }
+ return;
+ }
+ this._iterate(values);
+};
+
+PromiseArray.prototype._iterate = function(values) {
+ var len = this.getActualLength(values.length);
+ this._length = len;
+ this._values = this.shouldCopyValues() ? new Array(len) : this._values;
+ var result = this._promise;
+ var isResolved = false;
+ var bitField = null;
+ for (var i = 0; i < len; ++i) {
+ var maybePromise = tryConvertToPromise(values[i], result);
+
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ bitField = maybePromise._bitField;
+ } else {
+ bitField = null;
+ }
+
+ if (isResolved) {
+ if (bitField !== null) {
+ maybePromise.suppressUnhandledRejections();
+ }
+ } else if (bitField !== null) {
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._proxy(this, i);
+ this._values[i] = maybePromise;
+ } else if (((bitField & 33554432) !== 0)) {
+ isResolved = this._promiseFulfilled(maybePromise._value(), i);
+ } else if (((bitField & 16777216) !== 0)) {
+ isResolved = this._promiseRejected(maybePromise._reason(), i);
+ } else {
+ isResolved = this._promiseCancelled(i);
+ }
+ } else {
+ isResolved = this._promiseFulfilled(maybePromise, i);
+ }
+ }
+ if (!isResolved) result._setAsyncGuaranteed();
+};
+
+PromiseArray.prototype._isResolved = function () {
+ return this._values === null;
+};
+
+PromiseArray.prototype._resolve = function (value) {
+ this._values = null;
+ this._promise._fulfill(value);
+};
+
+PromiseArray.prototype._cancel = function() {
+ if (this._isResolved() || !this._promise._isCancellable()) return;
+ this._values = null;
+ this._promise._cancel();
+};
+
+PromiseArray.prototype._reject = function (reason) {
+ this._values = null;
+ this._promise._rejectCallback(reason, false);
+};
+
+PromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ return true;
+ }
+ return false;
+};
+
+PromiseArray.prototype._promiseCancelled = function() {
+ this._cancel();
+ return true;
+};
+
+PromiseArray.prototype._promiseRejected = function (reason) {
+ this._totalResolved++;
+ this._reject(reason);
+ return true;
+};
+
+PromiseArray.prototype._resultCancelled = function() {
+ if (this._isResolved()) return;
+ var values = this._values;
+ this._cancel();
+ if (values instanceof Promise) {
+ values.cancel();
+ } else {
+ for (var i = 0; i < values.length; ++i) {
+ if (values[i] instanceof Promise) {
+ values[i].cancel();
+ }
+ }
+ }
+};
+
+PromiseArray.prototype.shouldCopyValues = function () {
+ return true;
+};
+
+PromiseArray.prototype.getActualLength = function (len) {
+ return len;
+};
+
+return PromiseArray;
+};
+
+},{"./util":21}],17:[function(_dereq_,module,exports){
+"use strict";
+function arrayMove(src, srcIndex, dst, dstIndex, len) {
+ for (var j = 0; j < len; ++j) {
+ dst[j + dstIndex] = src[j + srcIndex];
+ src[j + srcIndex] = void 0;
+ }
+}
+
+function Queue(capacity) {
+ this._capacity = capacity;
+ this._length = 0;
+ this._front = 0;
+}
+
+Queue.prototype._willBeOverCapacity = function (size) {
+ return this._capacity < size;
+};
+
+Queue.prototype._pushOne = function (arg) {
+ var length = this.length();
+ this._checkCapacity(length + 1);
+ var i = (this._front + length) & (this._capacity - 1);
+ this[i] = arg;
+ this._length = length + 1;
+};
+
+Queue.prototype.push = function (fn, receiver, arg) {
+ var length = this.length() + 3;
+ if (this._willBeOverCapacity(length)) {
+ this._pushOne(fn);
+ this._pushOne(receiver);
+ this._pushOne(arg);
+ return;
+ }
+ var j = this._front + length - 3;
+ this._checkCapacity(length);
+ var wrapMask = this._capacity - 1;
+ this[(j + 0) & wrapMask] = fn;
+ this[(j + 1) & wrapMask] = receiver;
+ this[(j + 2) & wrapMask] = arg;
+ this._length = length;
+};
+
+Queue.prototype.shift = function () {
+ var front = this._front,
+ ret = this[front];
+
+ this[front] = undefined;
+ this._front = (front + 1) & (this._capacity - 1);
+ this._length--;
+ return ret;
+};
+
+Queue.prototype.length = function () {
+ return this._length;
+};
+
+Queue.prototype._checkCapacity = function (size) {
+ if (this._capacity < size) {
+ this._resizeTo(this._capacity << 1);
+ }
+};
+
+Queue.prototype._resizeTo = function (capacity) {
+ var oldCapacity = this._capacity;
+ this._capacity = capacity;
+ var front = this._front;
+ var length = this._length;
+ var moveItemsCount = (front + length) & (oldCapacity - 1);
+ arrayMove(this, 0, this, oldCapacity, moveItemsCount);
+};
+
+module.exports = Queue;
+
+},{}],18:[function(_dereq_,module,exports){
+"use strict";
+var util = _dereq_("./util");
+var schedule;
+var noAsyncScheduler = function() {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var NativePromise = util.getNativePromise();
+if (util.isNode && typeof MutationObserver === "undefined") {
+ var GlobalSetImmediate = global.setImmediate;
+ var ProcessNextTick = process.nextTick;
+ schedule = util.isRecentNode
+ ? function(fn) { GlobalSetImmediate.call(global, fn); }
+ : function(fn) { ProcessNextTick.call(process, fn); };
+} else if (typeof NativePromise === "function" &&
+ typeof NativePromise.resolve === "function") {
+ var nativePromise = NativePromise.resolve();
+ schedule = function(fn) {
+ nativePromise.then(fn);
+ };
+} else if ((typeof MutationObserver !== "undefined") &&
+ !(typeof window !== "undefined" &&
+ window.navigator &&
+ (window.navigator.standalone || window.cordova))) {
+ schedule = (function() {
+ var div = document.createElement("div");
+ var opts = {attributes: true};
+ var toggleScheduled = false;
+ var div2 = document.createElement("div");
+ var o2 = new MutationObserver(function() {
+ div.classList.toggle("foo");
+ toggleScheduled = false;
+ });
+ o2.observe(div2, opts);
+
+ var scheduleToggle = function() {
+ if (toggleScheduled) return;
+ toggleScheduled = true;
+ div2.classList.toggle("foo");
+ };
+
+ return function schedule(fn) {
+ var o = new MutationObserver(function() {
+ o.disconnect();
+ fn();
+ });
+ o.observe(div, opts);
+ scheduleToggle();
+ };
+ })();
+} else if (typeof setImmediate !== "undefined") {
+ schedule = function (fn) {
+ setImmediate(fn);
+ };
+} else if (typeof setTimeout !== "undefined") {
+ schedule = function (fn) {
+ setTimeout(fn, 0);
+ };
+} else {
+ schedule = noAsyncScheduler;
+}
+module.exports = schedule;
+
+},{"./util":21}],19:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+function PromiseInspection(promise) {
+ if (promise !== undefined) {
+ promise = promise._target();
+ this._bitField = promise._bitField;
+ this._settledValueField = promise._isFateSealed()
+ ? promise._settledValue() : undefined;
+ }
+ else {
+ this._bitField = 0;
+ this._settledValueField = undefined;
+ }
+}
+
+PromiseInspection.prototype._settledValue = function() {
+ return this._settledValueField;
+};
+
+var value = PromiseInspection.prototype.value = function () {
+ if (!this.isFulfilled()) {
+ throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var reason = PromiseInspection.prototype.error =
+PromiseInspection.prototype.reason = function () {
+ if (!this.isRejected()) {
+ throw new TypeError("cannot get rejection reason of a non-rejected promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var isFulfilled = PromiseInspection.prototype.isFulfilled = function() {
+ return (this._bitField & 33554432) !== 0;
+};
+
+var isRejected = PromiseInspection.prototype.isRejected = function () {
+ return (this._bitField & 16777216) !== 0;
+};
+
+var isPending = PromiseInspection.prototype.isPending = function () {
+ return (this._bitField & 50397184) === 0;
+};
+
+var isResolved = PromiseInspection.prototype.isResolved = function () {
+ return (this._bitField & 50331648) !== 0;
+};
+
+PromiseInspection.prototype.isCancelled = function() {
+ return (this._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.__isCancelled = function() {
+ return (this._bitField & 65536) === 65536;
+};
+
+Promise.prototype._isCancelled = function() {
+ return this._target().__isCancelled();
+};
+
+Promise.prototype.isCancelled = function() {
+ return (this._target()._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.isPending = function() {
+ return isPending.call(this._target());
+};
+
+Promise.prototype.isRejected = function() {
+ return isRejected.call(this._target());
+};
+
+Promise.prototype.isFulfilled = function() {
+ return isFulfilled.call(this._target());
+};
+
+Promise.prototype.isResolved = function() {
+ return isResolved.call(this._target());
+};
+
+Promise.prototype.value = function() {
+ return value.call(this._target());
+};
+
+Promise.prototype.reason = function() {
+ var target = this._target();
+ target._unsetRejectionIsUnhandled();
+ return reason.call(target);
+};
+
+Promise.prototype._value = function() {
+ return this._settledValue();
+};
+
+Promise.prototype._reason = function() {
+ this._unsetRejectionIsUnhandled();
+ return this._settledValue();
+};
+
+Promise.PromiseInspection = PromiseInspection;
+};
+
+},{}],20:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var util = _dereq_("./util");
+var errorObj = util.errorObj;
+var isObject = util.isObject;
+
+function tryConvertToPromise(obj, context) {
+ if (isObject(obj)) {
+ if (obj instanceof Promise) return obj;
+ var then = getThen(obj);
+ if (then === errorObj) {
+ if (context) context._pushContext();
+ var ret = Promise.reject(then.e);
+ if (context) context._popContext();
+ return ret;
+ } else if (typeof then === "function") {
+ if (isAnyBluebirdPromise(obj)) {
+ var ret = new Promise(INTERNAL);
+ obj._then(
+ ret._fulfill,
+ ret._reject,
+ undefined,
+ ret,
+ null
+ );
+ return ret;
+ }
+ return doThenable(obj, then, context);
+ }
+ }
+ return obj;
+}
+
+function doGetThen(obj) {
+ return obj.then;
+}
+
+function getThen(obj) {
+ try {
+ return doGetThen(obj);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+
+var hasProp = {}.hasOwnProperty;
+function isAnyBluebirdPromise(obj) {
+ try {
+ return hasProp.call(obj, "_promise0");
+ } catch (e) {
+ return false;
+ }
+}
+
+function doThenable(x, then, context) {
+ var promise = new Promise(INTERNAL);
+ var ret = promise;
+ if (context) context._pushContext();
+ promise._captureStackTrace();
+ if (context) context._popContext();
+ var synchronous = true;
+ var result = util.tryCatch(then).call(x, resolve, reject);
+ synchronous = false;
+
+ if (promise && result === errorObj) {
+ promise._rejectCallback(result.e, true, true);
+ promise = null;
+ }
+
+ function resolve(value) {
+ if (!promise) return;
+ promise._resolveCallback(value);
+ promise = null;
+ }
+
+ function reject(reason) {
+ if (!promise) return;
+ promise._rejectCallback(reason, synchronous, true);
+ promise = null;
+ }
+ return ret;
+}
+
+return tryConvertToPromise;
+};
+
+},{"./util":21}],21:[function(_dereq_,module,exports){
+"use strict";
+var es5 = _dereq_("./es5");
+var canEvaluate = typeof navigator == "undefined";
+
+var errorObj = {e: {}};
+var tryCatchTarget;
+var globalObject = typeof self !== "undefined" ? self :
+ typeof window !== "undefined" ? window :
+ typeof global !== "undefined" ? global :
+ this !== undefined ? this : null;
+
+function tryCatcher() {
+ try {
+ var target = tryCatchTarget;
+ tryCatchTarget = null;
+ return target.apply(this, arguments);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+function tryCatch(fn) {
+ tryCatchTarget = fn;
+ return tryCatcher;
+}
+
+var inherits = function(Child, Parent) {
+ var hasProp = {}.hasOwnProperty;
+
+ function T() {
+ this.constructor = Child;
+ this.constructor$ = Parent;
+ for (var propertyName in Parent.prototype) {
+ if (hasProp.call(Parent.prototype, propertyName) &&
+ propertyName.charAt(propertyName.length-1) !== "$"
+ ) {
+ this[propertyName + "$"] = Parent.prototype[propertyName];
+ }
+ }
+ }
+ T.prototype = Parent.prototype;
+ Child.prototype = new T();
+ return Child.prototype;
+};
+
+
+function isPrimitive(val) {
+ return val == null || val === true || val === false ||
+ typeof val === "string" || typeof val === "number";
+
+}
+
+function isObject(value) {
+ return typeof value === "function" ||
+ typeof value === "object" && value !== null;
+}
+
+function maybeWrapAsError(maybeError) {
+ if (!isPrimitive(maybeError)) return maybeError;
+
+ return new Error(safeToString(maybeError));
+}
+
+function withAppended(target, appendee) {
+ var len = target.length;
+ var ret = new Array(len + 1);
+ var i;
+ for (i = 0; i < len; ++i) {
+ ret[i] = target[i];
+ }
+ ret[i] = appendee;
+ return ret;
+}
+
+function getDataPropertyOrDefault(obj, key, defaultValue) {
+ if (es5.isES5) {
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+
+ if (desc != null) {
+ return desc.get == null && desc.set == null
+ ? desc.value
+ : defaultValue;
+ }
+ } else {
+ return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined;
+ }
+}
+
+function notEnumerableProp(obj, name, value) {
+ if (isPrimitive(obj)) return obj;
+ var descriptor = {
+ value: value,
+ configurable: true,
+ enumerable: false,
+ writable: true
+ };
+ es5.defineProperty(obj, name, descriptor);
+ return obj;
+}
+
+function thrower(r) {
+ throw r;
+}
+
+var inheritedDataKeys = (function() {
+ var excludedPrototypes = [
+ Array.prototype,
+ Object.prototype,
+ Function.prototype
+ ];
+
+ var isExcludedProto = function(val) {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (excludedPrototypes[i] === val) {
+ return true;
+ }
+ }
+ return false;
+ };
+
+ if (es5.isES5) {
+ var getKeys = Object.getOwnPropertyNames;
+ return function(obj) {
+ var ret = [];
+ var visitedKeys = Object.create(null);
+ while (obj != null && !isExcludedProto(obj)) {
+ var keys;
+ try {
+ keys = getKeys(obj);
+ } catch (e) {
+ return ret;
+ }
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (visitedKeys[key]) continue;
+ visitedKeys[key] = true;
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+ if (desc != null && desc.get == null && desc.set == null) {
+ ret.push(key);
+ }
+ }
+ obj = es5.getPrototypeOf(obj);
+ }
+ return ret;
+ };
+ } else {
+ var hasProp = {}.hasOwnProperty;
+ return function(obj) {
+ if (isExcludedProto(obj)) return [];
+ var ret = [];
+
+ /*jshint forin:false */
+ enumeration: for (var key in obj) {
+ if (hasProp.call(obj, key)) {
+ ret.push(key);
+ } else {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (hasProp.call(excludedPrototypes[i], key)) {
+ continue enumeration;
+ }
+ }
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+ }
+
+})();
+
+var thisAssignmentPattern = /this\s*\.\s*\S+\s*=/;
+function isClass(fn) {
+ try {
+ if (typeof fn === "function") {
+ var keys = es5.names(fn.prototype);
+
+ var hasMethods = es5.isES5 && keys.length > 1;
+ var hasMethodsOtherThanConstructor = keys.length > 0 &&
+ !(keys.length === 1 && keys[0] === "constructor");
+ var hasThisAssignmentAndStaticMethods =
+ thisAssignmentPattern.test(fn + "") && es5.names(fn).length > 0;
+
+ if (hasMethods || hasMethodsOtherThanConstructor ||
+ hasThisAssignmentAndStaticMethods) {
+ return true;
+ }
+ }
+ return false;
+ } catch (e) {
+ return false;
+ }
+}
+
+function toFastProperties(obj) {
+ /*jshint -W027,-W055,-W031*/
+ function FakeConstructor() {}
+ FakeConstructor.prototype = obj;
+ var l = 8;
+ while (l--) new FakeConstructor();
+ return obj;
+ eval(obj);
+}
+
+var rident = /^[a-z$_][a-z$_0-9]*$/i;
+function isIdentifier(str) {
+ return rident.test(str);
+}
+
+function filledRange(count, prefix, suffix) {
+ var ret = new Array(count);
+ for(var i = 0; i < count; ++i) {
+ ret[i] = prefix + i + suffix;
+ }
+ return ret;
+}
+
+function safeToString(obj) {
+ try {
+ return obj + "";
+ } catch (e) {
+ return "[no string representation]";
+ }
+}
+
+function isError(obj) {
+ return obj !== null &&
+ typeof obj === "object" &&
+ typeof obj.message === "string" &&
+ typeof obj.name === "string";
+}
+
+function markAsOriginatingFromRejection(e) {
+ try {
+ notEnumerableProp(e, "isOperational", true);
+ }
+ catch(ignore) {}
+}
+
+function originatesFromRejection(e) {
+ if (e == null) return false;
+ return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) ||
+ e["isOperational"] === true);
+}
+
+function canAttachTrace(obj) {
+ return isError(obj) && es5.propertyIsWritable(obj, "stack");
+}
+
+var ensureErrorObject = (function() {
+ if (!("stack" in new Error())) {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ try {throw new Error(safeToString(value));}
+ catch(err) {return err;}
+ };
+ } else {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ return new Error(safeToString(value));
+ };
+ }
+})();
+
+function classString(obj) {
+ return {}.toString.call(obj);
+}
+
+function copyDescriptors(from, to, filter) {
+ var keys = es5.names(from);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (filter(key)) {
+ try {
+ es5.defineProperty(to, key, es5.getDescriptor(from, key));
+ } catch (ignore) {}
+ }
+ }
+}
+
+var asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ }
+ return null;
+};
+
+if (typeof Symbol !== "undefined" && Symbol.iterator) {
+ var ArrayFrom = typeof Array.from === "function" ? function(v) {
+ return Array.from(v);
+ } : function(v) {
+ var ret = [];
+ var it = v[Symbol.iterator]();
+ var itResult;
+ while (!((itResult = it.next()).done)) {
+ ret.push(itResult.value);
+ }
+ return ret;
+ };
+
+ asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ } else if (v != null && typeof v[Symbol.iterator] === "function") {
+ return ArrayFrom(v);
+ }
+ return null;
+ };
+}
+
+var isNode = typeof process !== "undefined" &&
+ classString(process).toLowerCase() === "[object process]";
+
+var hasEnvVariables = typeof process !== "undefined" &&
+ typeof process.env !== "undefined";
+
+function env(key) {
+ return hasEnvVariables ? process.env[key] : undefined;
+}
+
+function getNativePromise() {
+ if (typeof Promise === "function") {
+ try {
+ var promise = new Promise(function(){});
+ if ({}.toString.call(promise) === "[object Promise]") {
+ return Promise;
+ }
+ } catch (e) {}
+ }
+}
+
+function domainBind(self, cb) {
+ return self.bind(cb);
+}
+
+var ret = {
+ isClass: isClass,
+ isIdentifier: isIdentifier,
+ inheritedDataKeys: inheritedDataKeys,
+ getDataPropertyOrDefault: getDataPropertyOrDefault,
+ thrower: thrower,
+ isArray: es5.isArray,
+ asArray: asArray,
+ notEnumerableProp: notEnumerableProp,
+ isPrimitive: isPrimitive,
+ isObject: isObject,
+ isError: isError,
+ canEvaluate: canEvaluate,
+ errorObj: errorObj,
+ tryCatch: tryCatch,
+ inherits: inherits,
+ withAppended: withAppended,
+ maybeWrapAsError: maybeWrapAsError,
+ toFastProperties: toFastProperties,
+ filledRange: filledRange,
+ toString: safeToString,
+ canAttachTrace: canAttachTrace,
+ ensureErrorObject: ensureErrorObject,
+ originatesFromRejection: originatesFromRejection,
+ markAsOriginatingFromRejection: markAsOriginatingFromRejection,
+ classString: classString,
+ copyDescriptors: copyDescriptors,
+ hasDevTools: typeof chrome !== "undefined" && chrome &&
+ typeof chrome.loadTimes === "function",
+ isNode: isNode,
+ hasEnvVariables: hasEnvVariables,
+ env: env,
+ global: globalObject,
+ getNativePromise: getNativePromise,
+ domainBind: domainBind
+};
+ret.isRecentNode = ret.isNode && (function() {
+ var version = process.versions.node.split(".").map(Number);
+ return (version[0] === 0 && version[1] > 10) || (version[0] > 0);
+})();
+
+if (ret.isNode) ret.toFastProperties(process);
+
+try {throw new Error(); } catch (e) {ret.lastLineError = e;}
+module.exports = ret;
+
+},{"./es5":10}]},{},[3])(3)
+}); ;if (typeof window !== 'undefined' && window !== null) { window.P = window.Promise; } else if (typeof self !== 'undefined' && self !== null) { self.P = self.Promise; }
\ No newline at end of file
diff --git a/website_quotation_template/node_modules/bluebird/js/browser/bluebird.core.min.js b/website_quotation_template/node_modules/bluebird/js/browser/bluebird.core.min.js
new file mode 100644
index 000000000..84bc422c9
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/browser/bluebird.core.min.js
@@ -0,0 +1,31 @@
+/* @preserve
+ * The MIT License (MIT)
+ *
+ * Copyright (c) 2013-2015 Petka Antonov
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in
+ * all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ * THE SOFTWARE.
+ *
+ */
+/**
+ * bluebird build version 3.4.7
+ * Features enabled: core
+ * Features disabled: race, call_get, generators, map, nodeify, promisify, props, reduce, settle, some, using, timers, filter, any, each
+*/
+!function(t){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=t();else if("function"==typeof define&&define.amd)define([],t);else{var e;"undefined"!=typeof window?e=window:"undefined"!=typeof global?e=global:"undefined"!=typeof self&&(e=self),e.Promise=t()}}(function(){var t,e,n;return function r(t,e,n){function i(a,s){if(!e[a]){if(!t[a]){var c="function"==typeof _dereq_&&_dereq_;if(!s&&c)return c(a,!0);if(o)return o(a,!0);var l=new Error("Cannot find module '"+a+"'");throw l.code="MODULE_NOT_FOUND",l}var u=e[a]={exports:{}};t[a][0].call(u.exports,function(e){var n=t[a][1][e];return i(n?n:e)},u,u.exports,r,t,e,n)}return e[a].exports}for(var o="function"==typeof _dereq_&&_dereq_,a=0;a0;){var e=t.shift();if("function"==typeof e){var n=t.shift(),r=t.shift();e.call(n,r)}else e._settlePromises()}},r.prototype._drainQueues=function(){this._drainQueue(this._normalQueue),this._reset(),this._haveDrainedQueues=!0,this._drainQueue(this._lateQueue)},r.prototype._queueTick=function(){this._isTickUsed||(this._isTickUsed=!0,this._schedule(this.drainQueues))},r.prototype._reset=function(){this._isTickUsed=!1},e.exports=r,e.exports.firstLineError=s},{"./queue":17,"./schedule":18,"./util":21}],2:[function(t,e,n){"use strict";e.exports=function(t,e,n,r){var i=!1,o=function(t,e){this._reject(e)},a=function(t,e){e.promiseRejectionQueued=!0,e.bindingPromise._then(o,o,null,this,t)},s=function(t,e){0===(50397184&this._bitField)&&this._resolveCallback(e.target)},c=function(t,e){e.promiseRejectionQueued||this._reject(t)};t.prototype.bind=function(o){i||(i=!0,t.prototype._propagateFrom=r.propagateFromFunction(),t.prototype._boundValue=r.boundValueFunction());var l=n(o),u=new t(e);u._propagateFrom(this,1);var p=this._target();if(u._setBoundTo(l),l instanceof t){var f={promiseRejectionQueued:!1,promise:u,target:p,bindingPromise:l};p._then(e,a,void 0,u,f),l._then(s,c,void 0,u,f),u._setOnCancel(l)}else u._resolveCallback(p);return u},t.prototype._setBoundTo=function(t){void 0!==t?(this._bitField=2097152|this._bitField,this._boundTo=t):this._bitField=-2097153&this._bitField},t.prototype._isBound=function(){return 2097152===(2097152&this._bitField)},t.bind=function(e,n){return t.resolve(n).bind(e)}}},{}],3:[function(t,e,n){"use strict";function r(){try{Promise===o&&(Promise=i)}catch(t){}return o}var i;"undefined"!=typeof Promise&&(i=Promise);var o=t("./promise")();o.noConflict=r,e.exports=o},{"./promise":15}],4:[function(t,e,n){"use strict";e.exports=function(e,n,r,i){var o=t("./util"),a=o.tryCatch,s=o.errorObj,c=e._async;e.prototype["break"]=e.prototype.cancel=function(){if(!i.cancellation())return this._warn("cancellation is disabled");for(var t=this,e=t;t._isCancellable();){if(!t._cancelBy(e)){e._isFollowing()?e._followee().cancel():e._cancelBranched();break}var n=t._cancellationParent;if(null==n||!n._isCancellable()){t._isFollowing()?t._followee().cancel():t._cancelBranched();break}t._isFollowing()&&t._followee().cancel(),t._setWillBeCancelled(),e=t,t=n}},e.prototype._branchHasCancelled=function(){this._branchesRemainingToCancel--},e.prototype._enoughBranchesHaveCancelled=function(){return void 0===this._branchesRemainingToCancel||this._branchesRemainingToCancel<=0},e.prototype._cancelBy=function(t){return t===this?(this._branchesRemainingToCancel=0,this._invokeOnCancel(),!0):(this._branchHasCancelled(),this._enoughBranchesHaveCancelled()?(this._invokeOnCancel(),!0):!1)},e.prototype._cancelBranched=function(){this._enoughBranchesHaveCancelled()&&this._cancel()},e.prototype._cancel=function(){this._isCancellable()&&(this._setCancelled(),c.invoke(this._cancelPromises,this,void 0))},e.prototype._cancelPromises=function(){this._length()>0&&this._settlePromises()},e.prototype._unsetOnCancel=function(){this._onCancelField=void 0},e.prototype._isCancellable=function(){return this.isPending()&&!this._isCancelled()},e.prototype.isCancellable=function(){return this.isPending()&&!this.isCancelled()},e.prototype._doInvokeOnCancel=function(t,e){if(o.isArray(t))for(var n=0;n=0?o[t]:void 0}var i=!1,o=[];return t.prototype._promiseCreated=function(){},t.prototype._pushContext=function(){},t.prototype._popContext=function(){return null},t._peekContext=t.prototype._peekContext=function(){},e.prototype._pushContext=function(){void 0!==this._trace&&(this._trace._promiseCreated=null,o.push(this._trace))},e.prototype._popContext=function(){if(void 0!==this._trace){var t=o.pop(),e=t._promiseCreated;return t._promiseCreated=null,e}return null},e.CapturedTrace=null,e.create=n,e.deactivateLongStackTraces=function(){},e.activateLongStackTraces=function(){var n=t.prototype._pushContext,o=t.prototype._popContext,a=t._peekContext,s=t.prototype._peekContext,c=t.prototype._promiseCreated;e.deactivateLongStackTraces=function(){t.prototype._pushContext=n,t.prototype._popContext=o,t._peekContext=a,t.prototype._peekContext=s,t.prototype._promiseCreated=c,i=!1},i=!0,t.prototype._pushContext=e.prototype._pushContext,t.prototype._popContext=e.prototype._popContext,t._peekContext=t.prototype._peekContext=r,t.prototype._promiseCreated=function(){var t=this._peekContext();t&&null==t._promiseCreated&&(t._promiseCreated=this)}},e}},{}],7:[function(t,e,n){"use strict";e.exports=function(e,n){function r(t,e){return{promise:e}}function i(){return!1}function o(t,e,n){var r=this;try{t(e,n,function(t){if("function"!=typeof t)throw new TypeError("onCancel must be a function, got: "+I.toString(t));r._attachCancellationCallback(t)})}catch(i){return i}}function a(t){if(!this._isCancellable())return this;var e=this._onCancel();void 0!==e?I.isArray(e)?e.push(t):this._setOnCancel([e,t]):this._setOnCancel(t)}function s(){return this._onCancelField}function c(t){this._onCancelField=t}function l(){this._cancellationParent=void 0,this._onCancelField=void 0}function u(t,e){if(0!==(1&e)){this._cancellationParent=t;var n=t._branchesRemainingToCancel;void 0===n&&(n=0),t._branchesRemainingToCancel=n+1}0!==(2&e)&&t._isBound()&&this._setBoundTo(t._boundTo)}function p(t,e){0!==(2&e)&&t._isBound()&&this._setBoundTo(t._boundTo)}function f(){var t=this._boundTo;return void 0!==t&&t instanceof e?t.isFulfilled()?t.value():void 0:t}function h(){this._trace=new x(this._peekContext())}function _(t,e){if(H(t)){var n=this._trace;if(void 0!==n&&e&&(n=n._parent),void 0!==n)n.attachExtraTrace(t);else if(!t.__stackCleaned__){var r=E(t);I.notEnumerableProp(t,"stack",r.message+"\n"+r.stack.join("\n")),I.notEnumerableProp(t,"__stackCleaned__",!0)}}}function d(t,e,n,r,i){if(void 0===t&&null!==e&&X){if(void 0!==i&&i._returnedNonUndefined())return;if(0===(65535&r._bitField))return;n&&(n+=" ");var o="",a="";if(e._trace){for(var s=e._trace.stack.split("\n"),c=C(s),l=c.length-1;l>=0;--l){var u=c[l];if(!V.test(u)){var p=u.match(Q);p&&(o="at "+p[1]+":"+p[2]+":"+p[3]+" ");break}}if(c.length>0)for(var f=c[0],l=0;l0&&(a="\n"+s[l-1]);break}}var h="a promise was created in a "+n+"handler "+o+"but was not returned from it, see http://goo.gl/rRqMUw"+a;r._warn(h,!0,e)}}function v(t,e){var n=t+" is deprecated and will be removed in a future version.";return e&&(n+=" Use "+e+" instead."),y(n)}function y(t,n,r){if(ot.warnings){var i,o=new U(t);if(n)r._attachExtraTrace(o);else if(ot.longStackTraces&&(i=e._peekContext()))i.attachExtraTrace(o);else{var a=E(o);o.stack=a.message+"\n"+a.stack.join("\n")}tt("warning",o)||k(o,"",!0)}}function g(t,e){for(var n=0;n=0;--s)if(r[s]===o){a=s;break}for(var s=a;s>=0;--s){var c=r[s];if(e[i]!==c)break;e.pop(),i--}e=r}}function C(t){for(var e=[],n=0;n0&&"SyntaxError"!=t.name&&(e=e.slice(n)),e}function E(t){var e=t.stack,n=t.toString();return e="string"==typeof e&&e.length>0?w(t):[" (No stack trace)"],{message:n,stack:"SyntaxError"==t.name?e:C(e)}}function k(t,e,n){if("undefined"!=typeof console){var r;if(I.isObject(t)){var i=t.stack;r=e+G(i,t)}else r=e+String(t);"function"==typeof L?L(r,n):("function"==typeof console.log||"object"==typeof console.log)&&console.log(r)}}function j(t,e,n,r){var i=!1;try{"function"==typeof e&&(i=!0,"rejectionHandled"===t?e(r):e(n,r))}catch(o){B.throwLater(o)}"unhandledRejection"===t?tt(t,n,r)||i||k(n,"Unhandled rejection "):tt(t,r)}function F(t){var e;if("function"==typeof t)e="[function "+(t.name||"anonymous")+"]";else{e=t&&"function"==typeof t.toString?t.toString():I.toString(t);var n=/\[object [a-zA-Z0-9$_]+\]/;if(n.test(e))try{var r=JSON.stringify(t);e=r}catch(i){}0===e.length&&(e="(empty array)")}return"(<"+T(e)+">, no stack trace)"}function T(t){var e=41;return t.lengtha||0>s||!n||!r||n!==r||a>=s||(nt=function(t){if(D.test(t))return!0;var e=R(t);return e&&e.fileName===n&&a<=e.line&&e.line<=s?!0:!1})}}function x(t){this._parent=t,this._promisesCreated=0;var e=this._length=1+(void 0===t?0:t._length);it(this,x),e>32&&this.uncycle()}var O,A,L,N=e._getDomain,B=e._async,U=t("./errors").Warning,I=t("./util"),H=I.canAttachTrace,D=/[\\\/]bluebird[\\\/]js[\\\/](release|debug|instrumented)/,V=/\((?:timers\.js):\d+:\d+\)/,Q=/[\/<\(](.+?):(\d+):(\d+)\)?\s*$/,q=null,G=null,M=!1,W=!(0==I.env("BLUEBIRD_DEBUG")||!I.env("BLUEBIRD_DEBUG")&&"development"!==I.env("NODE_ENV")),$=!(0==I.env("BLUEBIRD_WARNINGS")||!W&&!I.env("BLUEBIRD_WARNINGS")),z=!(0==I.env("BLUEBIRD_LONG_STACK_TRACES")||!W&&!I.env("BLUEBIRD_LONG_STACK_TRACES")),X=0!=I.env("BLUEBIRD_W_FORGOTTEN_RETURN")&&($||!!I.env("BLUEBIRD_W_FORGOTTEN_RETURN"));e.prototype.suppressUnhandledRejections=function(){var t=this._target();t._bitField=-1048577&t._bitField|524288},e.prototype._ensurePossibleRejectionHandled=function(){0===(524288&this._bitField)&&(this._setRejectionIsUnhandled(),B.invokeLater(this._notifyUnhandledRejection,this,void 0))},e.prototype._notifyUnhandledRejectionIsHandled=function(){j("rejectionHandled",O,void 0,this)},e.prototype._setReturnedNonUndefined=function(){this._bitField=268435456|this._bitField},e.prototype._returnedNonUndefined=function(){return 0!==(268435456&this._bitField)},e.prototype._notifyUnhandledRejection=function(){if(this._isRejectionUnhandled()){var t=this._settledValue();this._setUnhandledRejectionIsNotified(),j("unhandledRejection",A,t,this)}},e.prototype._setUnhandledRejectionIsNotified=function(){this._bitField=262144|this._bitField},e.prototype._unsetUnhandledRejectionIsNotified=function(){this._bitField=-262145&this._bitField},e.prototype._isUnhandledRejectionNotified=function(){return(262144&this._bitField)>0},e.prototype._setRejectionIsUnhandled=function(){this._bitField=1048576|this._bitField},e.prototype._unsetRejectionIsUnhandled=function(){this._bitField=-1048577&this._bitField,this._isUnhandledRejectionNotified()&&(this._unsetUnhandledRejectionIsNotified(),this._notifyUnhandledRejectionIsHandled())},e.prototype._isRejectionUnhandled=function(){return(1048576&this._bitField)>0},e.prototype._warn=function(t,e,n){return y(t,e,n||this)},e.onPossiblyUnhandledRejection=function(t){var e=N();A="function"==typeof t?null===e?t:I.domainBind(e,t):void 0},e.onUnhandledRejectionHandled=function(t){var e=N();O="function"==typeof t?null===e?t:I.domainBind(e,t):void 0};var K=function(){};e.longStackTraces=function(){if(B.haveItemsQueued()&&!ot.longStackTraces)throw new Error("cannot enable long stack traces after promises have been created\n\n See http://goo.gl/MqrFmX\n");if(!ot.longStackTraces&&P()){var t=e.prototype._captureStackTrace,r=e.prototype._attachExtraTrace;ot.longStackTraces=!0,K=function(){if(B.haveItemsQueued()&&!ot.longStackTraces)throw new Error("cannot enable long stack traces after promises have been created\n\n See http://goo.gl/MqrFmX\n");e.prototype._captureStackTrace=t,e.prototype._attachExtraTrace=r,n.deactivateLongStackTraces(),B.enableTrampoline(),ot.longStackTraces=!1},e.prototype._captureStackTrace=h,e.prototype._attachExtraTrace=_,n.activateLongStackTraces(),B.disableTrampolineIfNecessary()}},e.hasLongStackTraces=function(){return ot.longStackTraces&&P()};var J=function(){try{if("function"==typeof CustomEvent){var t=new CustomEvent("CustomEvent");return I.global.dispatchEvent(t),function(t,e){var n=new CustomEvent(t.toLowerCase(),{detail:e,cancelable:!0});return!I.global.dispatchEvent(n)}}if("function"==typeof Event){var t=new Event("CustomEvent");return I.global.dispatchEvent(t),function(t,e){var n=new Event(t.toLowerCase(),{cancelable:!0});return n.detail=e,!I.global.dispatchEvent(n)}}var t=document.createEvent("CustomEvent");return t.initCustomEvent("testingtheevent",!1,!0,{}),I.global.dispatchEvent(t),function(t,e){var n=document.createEvent("CustomEvent");return n.initCustomEvent(t.toLowerCase(),!1,!0,e),!I.global.dispatchEvent(n)}}catch(e){}return function(){return!1}}(),Y=function(){return I.isNode?function(){return process.emit.apply(process,arguments)}:I.global?function(t){var e="on"+t.toLowerCase(),n=I.global[e];return n?(n.apply(I.global,[].slice.call(arguments,1)),!0):!1}:function(){return!1}}(),Z={promiseCreated:r,promiseFulfilled:r,promiseRejected:r,promiseResolved:r,promiseCancelled:r,promiseChained:function(t,e,n){return{promise:e,child:n}},warning:function(t,e){return{warning:e}},unhandledRejection:function(t,e,n){return{reason:e,promise:n}},rejectionHandled:r},tt=function(t){var e=!1;try{e=Y.apply(null,arguments)}catch(n){B.throwLater(n),e=!0}var r=!1;try{r=J(t,Z[t].apply(null,arguments))}catch(n){B.throwLater(n),r=!0}return r||e};e.config=function(t){if(t=Object(t),"longStackTraces"in t&&(t.longStackTraces?e.longStackTraces():!t.longStackTraces&&e.hasLongStackTraces()&&K()),"warnings"in t){var n=t.warnings;ot.warnings=!!n,X=ot.warnings,I.isObject(n)&&"wForgottenReturn"in n&&(X=!!n.wForgottenReturn)}if("cancellation"in t&&t.cancellation&&!ot.cancellation){if(B.haveItemsQueued())throw new Error("cannot enable cancellation after promises are in use");e.prototype._clearCancellationData=l,e.prototype._propagateFrom=u,e.prototype._onCancel=s,e.prototype._setOnCancel=c,e.prototype._attachCancellationCallback=a,e.prototype._execute=o,et=u,ot.cancellation=!0}return"monitoring"in t&&(t.monitoring&&!ot.monitoring?(ot.monitoring=!0,e.prototype._fireEvent=tt):!t.monitoring&&ot.monitoring&&(ot.monitoring=!1,e.prototype._fireEvent=i)),e},e.prototype._fireEvent=i,e.prototype._execute=function(t,e,n){try{t(e,n)}catch(r){return r}},e.prototype._onCancel=function(){},e.prototype._setOnCancel=function(t){},e.prototype._attachCancellationCallback=function(t){},e.prototype._captureStackTrace=function(){},e.prototype._attachExtraTrace=function(){},e.prototype._clearCancellationData=function(){},e.prototype._propagateFrom=function(t,e){};var et=p,nt=function(){return!1},rt=/[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;I.inherits(x,Error),n.CapturedTrace=x,x.prototype.uncycle=function(){var t=this._length;if(!(2>t)){for(var e=[],n={},r=0,i=this;void 0!==i;++r)e.push(i),i=i._parent;t=this._length=r;for(var r=t-1;r>=0;--r){var o=e[r].stack;void 0===n[o]&&(n[o]=r)}for(var r=0;t>r;++r){var a=e[r].stack,s=n[a];if(void 0!==s&&s!==r){s>0&&(e[s-1]._parent=void 0,e[s-1]._length=1),e[r]._parent=void 0,e[r]._length=1;var c=r>0?e[r-1]:this;t-1>s?(c._parent=e[s+1],c._parent.uncycle(),c._length=c._parent._length+1):(c._parent=void 0,c._length=1);for(var l=c._length+1,u=r-2;u>=0;--u)e[u]._length=l,l++;return}}}},x.prototype.attachExtraTrace=function(t){if(!t.__stackCleaned__){this.uncycle();for(var e=E(t),n=e.message,r=[e.stack],i=this;void 0!==i;)r.push(C(i.stack.split("\n"))),i=i._parent;b(r),m(r),I.notEnumerableProp(t,"stack",g(n,r)),I.notEnumerableProp(t,"__stackCleaned__",!0)}};var it=function(){var t=/^\s*at\s*/,e=function(t,e){return"string"==typeof t?t:void 0!==e.name&&void 0!==e.message?e.toString():F(e)};if("number"==typeof Error.stackTraceLimit&&"function"==typeof Error.captureStackTrace){Error.stackTraceLimit+=6,q=t,G=e;var n=Error.captureStackTrace;return nt=function(t){return D.test(t)},function(t,e){Error.stackTraceLimit+=6,n(t,e),Error.stackTraceLimit-=6}}var r=new Error;if("string"==typeof r.stack&&r.stack.split("\n")[0].indexOf("stackDetection@")>=0)return q=/@/,G=e,M=!0,function(t){t.stack=(new Error).stack};var i;try{throw new Error}catch(o){i="stack"in o}return"stack"in r||!i||"number"!=typeof Error.stackTraceLimit?(G=function(t,e){return"string"==typeof t?t:"object"!=typeof e&&"function"!=typeof e||void 0===e.name||void 0===e.message?F(e):e.toString()},null):(q=t,G=e,function(t){Error.stackTraceLimit+=6;try{throw new Error}catch(e){t.stack=e.stack}Error.stackTraceLimit-=6})}([]);"undefined"!=typeof console&&"undefined"!=typeof console.warn&&(L=function(t){console.warn(t)},I.isNode&&process.stderr.isTTY?L=function(t,e){var n=e?"[33m":"[31m";console.warn(n+t+"[0m\n")}:I.isNode||"string"!=typeof(new Error).stack||(L=function(t,e){console.warn("%c"+t,e?"color: darkorange":"color: red")}));var ot={warnings:$,longStackTraces:!1,cancellation:!1,monitoring:!1};return z&&e.longStackTraces(),{longStackTraces:function(){return ot.longStackTraces},warnings:function(){return ot.warnings},cancellation:function(){return ot.cancellation},monitoring:function(){return ot.monitoring},propagateFromFunction:function(){return et},boundValueFunction:function(){return f},checkForgottenReturns:d,setBounds:S,warn:y,deprecated:v,CapturedTrace:x,fireDomEvent:J,fireGlobalEvent:Y}}},{"./errors":9,"./util":21}],8:[function(t,e,n){"use strict";e.exports=function(t){function e(){return this.value}function n(){throw this.reason}t.prototype["return"]=t.prototype.thenReturn=function(n){return n instanceof t&&n.suppressUnhandledRejections(),this._then(e,void 0,void 0,{value:n},void 0)},t.prototype["throw"]=t.prototype.thenThrow=function(t){return this._then(n,void 0,void 0,{reason:t},void 0)},t.prototype.catchThrow=function(t){if(arguments.length<=1)return this._then(void 0,n,void 0,{reason:t},void 0);var e=arguments[1],r=function(){throw e};return this.caught(t,r)},t.prototype.catchReturn=function(n){if(arguments.length<=1)return n instanceof t&&n.suppressUnhandledRejections(),this._then(void 0,e,void 0,{value:n},void 0);var r=arguments[1];r instanceof t&&r.suppressUnhandledRejections();var i=function(){return r};return this.caught(n,i)}}},{}],9:[function(t,e,n){"use strict";function r(t,e){function n(r){return this instanceof n?(p(this,"message","string"==typeof r?r:e),p(this,"name",t),void(Error.captureStackTrace?Error.captureStackTrace(this,this.constructor):Error.call(this))):new n(r)}return u(n,Error),n}function i(t){return this instanceof i?(p(this,"name","OperationalError"),p(this,"message",t),this.cause=t,this.isOperational=!0,void(t instanceof Error?(p(this,"message",t.message),p(this,"stack",t.stack)):Error.captureStackTrace&&Error.captureStackTrace(this,this.constructor))):new i(t)}var o,a,s=t("./es5"),c=s.freeze,l=t("./util"),u=l.inherits,p=l.notEnumerableProp,f=r("Warning","warning"),h=r("CancellationError","cancellation error"),_=r("TimeoutError","timeout error"),d=r("AggregateError","aggregate error");try{o=TypeError,a=RangeError}catch(v){o=r("TypeError","type error"),a=r("RangeError","range error")}for(var y="join pop push shift unshift slice filter forEach some every map indexOf lastIndexOf reduce reduceRight sort reverse".split(" "),g=0;g1?t.cancelPromise._reject(e):t.cancelPromise._cancel(),t.cancelPromise=null,!0):!1}function a(){return c.call(this,this.promise._target()._settledValue())}function s(t){return o(this,t)?void 0:(p.e=t,p)}function c(t){var r=this.promise,c=this.handler;if(!this.called){this.called=!0;var l=this.isFinallyHandler()?c.call(r._boundValue()):c.call(r._boundValue(),t);if(void 0!==l){r._setReturnedNonUndefined();var f=n(l,r);if(f instanceof e){if(null!=this.cancelPromise){if(f._isCancelled()){var h=new u("late cancellation observer");return r._attachExtraTrace(h),p.e=h,p}f.isPending()&&f._attachCancellationCallback(new i(this))}return f._then(a,s,void 0,this,void 0)}}}return r.isRejected()?(o(this),p.e=t,p):(o(this),t)}var l=t("./util"),u=e.CancellationError,p=l.errorObj;return r.prototype.isFinallyHandler=function(){return 0===this.type},i.prototype._resultCancelled=function(){o(this.finallyHandler)},e.prototype._passThrough=function(t,e,n,i){return"function"!=typeof t?this.then():this._then(n,i,void 0,new r(this,e,t),void 0)},e.prototype.lastly=e.prototype["finally"]=function(t){return this._passThrough(t,0,c,c)},e.prototype.tap=function(t){return this._passThrough(t,1,c)},r}},{"./util":21}],12:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o,a){var s=t("./util");s.canEvaluate,s.tryCatch,s.errorObj;e.join=function(){var t,e=arguments.length-1;if(e>0&&"function"==typeof arguments[e]){t=arguments[e];var r}var i=[].slice.call(arguments);t&&i.pop();var r=new n(i).promise();return void 0!==t?r.spread(t):r}}},{"./util":21}],13:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o){var a=t("./util"),s=a.tryCatch;e.method=function(t){if("function"!=typeof t)throw new e.TypeError("expecting a function but got "+a.classString(t));return function(){var r=new e(n);r._captureStackTrace(),r._pushContext();var i=s(t).apply(this,arguments),a=r._popContext();return o.checkForgottenReturns(i,a,"Promise.method",r),r._resolveFromSyncValue(i),r}},e.attempt=e["try"]=function(t){if("function"!=typeof t)return i("expecting a function but got "+a.classString(t));var r=new e(n);r._captureStackTrace(),r._pushContext();var c;if(arguments.length>1){o.deprecated("calling Promise.try with more than 1 argument");var l=arguments[1],u=arguments[2];c=a.isArray(l)?s(t).apply(u,l):s(t).call(u,l)}else c=s(t)();var p=r._popContext();return o.checkForgottenReturns(c,p,"Promise.try",r),r._resolveFromSyncValue(c),r},e.prototype._resolveFromSyncValue=function(t){t===a.errorObj?this._rejectCallback(t.e,!1):this._resolveCallback(t,!0)}}},{"./util":21}],14:[function(t,e,n){"use strict";function r(t){return t instanceof Error&&u.getPrototypeOf(t)===Error.prototype}function i(t){var e;if(r(t)){e=new l(t),e.name=t.name,e.message=t.message,e.stack=t.stack;for(var n=u.keys(t),i=0;i1){var n,r=new Array(e-1),i=0;for(n=0;e-1>n;++n){var o=arguments[n];if(!h.isObject(o))return p("expecting an object but got A catch statement predicate "+h.classString(o));r[i++]=o}return r.length=i,t=arguments[n],this.then(void 0,P(r,t,this))}return this.then(void 0,t)},i.prototype.reflect=function(){return this._then(u,u,void 0,this,void 0)},i.prototype.then=function(t,e){if(F.warnings()&&arguments.length>0&&"function"!=typeof t&&"function"!=typeof e){var n=".then() only accepts functions but was passed: "+h.classString(t);arguments.length>1&&(n+=", "+h.classString(e)),this._warn(n)}return this._then(t,e,void 0,void 0,void 0)},i.prototype.done=function(t,e){var n=this._then(t,e,void 0,void 0,void 0);n._setIsFinal()},i.prototype.spread=function(t){return"function"!=typeof t?p("expecting a function but got "+h.classString(t)):this.all()._then(t,void 0,void 0,C,void 0)},i.prototype.toJSON=function(){var t={isFulfilled:!1,isRejected:!1,fulfillmentValue:void 0,rejectionReason:void 0};return this.isFulfilled()?(t.fulfillmentValue=this.value(),t.isFulfilled=!0):this.isRejected()&&(t.rejectionReason=this.reason(),t.isRejected=!0),t},i.prototype.all=function(){return arguments.length>0&&this._warn(".all() was passed arguments but it does not take any"),new k(this).promise();
+},i.prototype.error=function(t){return this.caught(h.originatesFromRejection,t)},i.getNewLibraryCopy=e.exports,i.is=function(t){return t instanceof i},i.fromNode=i.fromCallback=function(t){var e=new i(b);e._captureStackTrace();var n=arguments.length>1?!!Object(arguments[1]).multiArgs:!1,r=x(t)(R(e,n));return r===S&&e._rejectCallback(r.e,!0),e._isFateSealed()||e._setAsyncGuaranteed(),e},i.all=function(t){return new k(t).promise()},i.cast=function(t){var e=E(t);return e instanceof i||(e=new i(b),e._captureStackTrace(),e._setFulfilled(),e._rejectionHandler0=t),e},i.resolve=i.fulfilled=i.cast,i.reject=i.rejected=function(t){var e=new i(b);return e._captureStackTrace(),e._rejectCallback(t,!0),e},i.setScheduler=function(t){if("function"!=typeof t)throw new g("expecting a function but got "+h.classString(t));return v.setScheduler(t)},i.prototype._then=function(t,e,n,r,o){var a=void 0!==o,s=a?o:new i(b),l=this._target(),u=l._bitField;a||(s._propagateFrom(this,3),s._captureStackTrace(),void 0===r&&0!==(2097152&this._bitField)&&(r=0!==(50397184&u)?this._boundValue():l===this?void 0:this._boundTo),this._fireEvent("promiseChained",this,s));var p=c();if(0!==(50397184&u)){var f,_,d=l._settlePromiseCtx;0!==(33554432&u)?(_=l._rejectionHandler0,f=t):0!==(16777216&u)?(_=l._fulfillmentHandler0,f=e,l._unsetRejectionIsUnhandled()):(d=l._settlePromiseLateCancellationObserver,_=new m("late cancellation observer"),l._attachExtraTrace(_),f=e),v.invoke(d,l,{handler:null===p?f:"function"==typeof f&&h.domainBind(p,f),promise:s,receiver:r,value:_})}else l._addCallbacks(t,e,s,r,p);return s},i.prototype._length=function(){return 65535&this._bitField},i.prototype._isFateSealed=function(){return 0!==(117506048&this._bitField)},i.prototype._isFollowing=function(){return 67108864===(67108864&this._bitField)},i.prototype._setLength=function(t){this._bitField=-65536&this._bitField|65535&t},i.prototype._setFulfilled=function(){this._bitField=33554432|this._bitField,this._fireEvent("promiseFulfilled",this)},i.prototype._setRejected=function(){this._bitField=16777216|this._bitField,this._fireEvent("promiseRejected",this)},i.prototype._setFollowing=function(){this._bitField=67108864|this._bitField,this._fireEvent("promiseResolved",this)},i.prototype._setIsFinal=function(){this._bitField=4194304|this._bitField},i.prototype._isFinal=function(){return(4194304&this._bitField)>0},i.prototype._unsetCancelled=function(){this._bitField=-65537&this._bitField},i.prototype._setCancelled=function(){this._bitField=65536|this._bitField,this._fireEvent("promiseCancelled",this)},i.prototype._setWillBeCancelled=function(){this._bitField=8388608|this._bitField},i.prototype._setAsyncGuaranteed=function(){v.hasCustomScheduler()||(this._bitField=134217728|this._bitField)},i.prototype._receiverAt=function(t){var e=0===t?this._receiver0:this[4*t-4+3];return e===f?void 0:void 0===e&&this._isBound()?this._boundValue():e},i.prototype._promiseAt=function(t){return this[4*t-4+2]},i.prototype._fulfillmentHandlerAt=function(t){return this[4*t-4+0]},i.prototype._rejectionHandlerAt=function(t){return this[4*t-4+1]},i.prototype._boundValue=function(){},i.prototype._migrateCallback0=function(t){var e=(t._bitField,t._fulfillmentHandler0),n=t._rejectionHandler0,r=t._promise0,i=t._receiverAt(0);void 0===i&&(i=f),this._addCallbacks(e,n,r,i,null)},i.prototype._migrateCallbackAt=function(t,e){var n=t._fulfillmentHandlerAt(e),r=t._rejectionHandlerAt(e),i=t._promiseAt(e),o=t._receiverAt(e);void 0===o&&(o=f),this._addCallbacks(n,r,i,o,null)},i.prototype._addCallbacks=function(t,e,n,r,i){var o=this._length();if(o>=65531&&(o=0,this._setLength(0)),0===o)this._promise0=n,this._receiver0=r,"function"==typeof t&&(this._fulfillmentHandler0=null===i?t:h.domainBind(i,t)),"function"==typeof e&&(this._rejectionHandler0=null===i?e:h.domainBind(i,e));else{var a=4*o-4;this[a+2]=n,this[a+3]=r,"function"==typeof t&&(this[a+0]=null===i?t:h.domainBind(i,t)),"function"==typeof e&&(this[a+1]=null===i?e:h.domainBind(i,e))}return this._setLength(o+1),o},i.prototype._proxy=function(t,e){this._addCallbacks(void 0,void 0,e,t,null)},i.prototype._resolveCallback=function(t,e){if(0===(117506048&this._bitField)){if(t===this)return this._rejectCallback(l(),!1);var n=E(t,this);if(!(n instanceof i))return this._fulfill(t);e&&this._propagateFrom(n,2);var r=n._target();if(r===this)return void this._reject(l());var o=r._bitField;if(0===(50397184&o)){var a=this._length();a>0&&r._migrateCallback0(this);for(var s=1;a>s;++s)r._migrateCallbackAt(this,s);this._setFollowing(),this._setLength(0),this._setFollowee(r)}else if(0!==(33554432&o))this._fulfill(r._value());else if(0!==(16777216&o))this._reject(r._reason());else{var c=new m("late cancellation observer");r._attachExtraTrace(c),this._reject(c)}}},i.prototype._rejectCallback=function(t,e,n){var r=h.ensureErrorObject(t),i=r===t;if(!i&&!n&&F.warnings()){var o="a promise was rejected with a non-error: "+h.classString(t);this._warn(o,!0)}this._attachExtraTrace(r,e?i:!1),this._reject(t)},i.prototype._resolveFromExecutor=function(t){var e=this;this._captureStackTrace(),this._pushContext();var n=!0,r=this._execute(t,function(t){e._resolveCallback(t)},function(t){e._rejectCallback(t,n)});n=!1,this._popContext(),void 0!==r&&e._rejectCallback(r,!0)},i.prototype._settlePromiseFromHandler=function(t,e,n,r){var i=r._bitField;if(0===(65536&i)){r._pushContext();var o;e===C?n&&"number"==typeof n.length?o=x(t).apply(this._boundValue(),n):(o=S,o.e=new g("cannot .spread() a non-array: "+h.classString(n))):o=x(t).call(e,n);var a=r._popContext();i=r._bitField,0===(65536&i)&&(o===w?r._reject(n):o===S?r._rejectCallback(o.e,!1):(F.checkForgottenReturns(o,a,"",r,this),r._resolveCallback(o)))}},i.prototype._target=function(){for(var t=this;t._isFollowing();)t=t._followee();return t},i.prototype._followee=function(){return this._rejectionHandler0},i.prototype._setFollowee=function(t){this._rejectionHandler0=t},i.prototype._settlePromise=function(t,e,r,o){var a=t instanceof i,s=this._bitField,c=0!==(134217728&s);0!==(65536&s)?(a&&t._invokeInternalOnCancel(),r instanceof T&&r.isFinallyHandler()?(r.cancelPromise=t,x(e).call(r,o)===S&&t._reject(S.e)):e===u?t._fulfill(u.call(r)):r instanceof n?r._promiseCancelled(t):a||t instanceof k?t._cancel():r.cancel()):"function"==typeof e?a?(c&&t._setAsyncGuaranteed(),this._settlePromiseFromHandler(e,r,o,t)):e.call(r,o,t):r instanceof n?r._isResolved()||(0!==(33554432&s)?r._promiseFulfilled(o,t):r._promiseRejected(o,t)):a&&(c&&t._setAsyncGuaranteed(),0!==(33554432&s)?t._fulfill(o):t._reject(o))},i.prototype._settlePromiseLateCancellationObserver=function(t){var e=t.handler,n=t.promise,r=t.receiver,o=t.value;"function"==typeof e?n instanceof i?this._settlePromiseFromHandler(e,r,o,n):e.call(r,o,n):n instanceof i&&n._reject(o)},i.prototype._settlePromiseCtx=function(t){this._settlePromise(t.promise,t.handler,t.receiver,t.value)},i.prototype._settlePromise0=function(t,e,n){var r=this._promise0,i=this._receiverAt(0);this._promise0=void 0,this._receiver0=void 0,this._settlePromise(r,t,i,e)},i.prototype._clearCallbackDataAtIndex=function(t){var e=4*t-4;this[e+2]=this[e+3]=this[e+0]=this[e+1]=void 0},i.prototype._fulfill=function(t){var e=this._bitField;if(!((117506048&e)>>>16)){if(t===this){var n=l();return this._attachExtraTrace(n),this._reject(n)}this._setFulfilled(),this._rejectionHandler0=t,(65535&e)>0&&(0!==(134217728&e)?this._settlePromises():v.settlePromises(this))}},i.prototype._reject=function(t){var e=this._bitField;if(!((117506048&e)>>>16))return this._setRejected(),this._fulfillmentHandler0=t,this._isFinal()?v.fatalError(t,h.isNode):void((65535&e)>0?v.settlePromises(this):this._ensurePossibleRejectionHandled())},i.prototype._fulfillPromises=function(t,e){for(var n=1;t>n;n++){var r=this._fulfillmentHandlerAt(n),i=this._promiseAt(n),o=this._receiverAt(n);this._clearCallbackDataAtIndex(n),this._settlePromise(i,r,o,e)}},i.prototype._rejectPromises=function(t,e){for(var n=1;t>n;n++){var r=this._rejectionHandlerAt(n),i=this._promiseAt(n),o=this._receiverAt(n);this._clearCallbackDataAtIndex(n),this._settlePromise(i,r,o,e)}},i.prototype._settlePromises=function(){var t=this._bitField,e=65535&t;if(e>0){if(0!==(16842752&t)){var n=this._fulfillmentHandler0;this._settlePromise0(this._rejectionHandler0,n,t),this._rejectPromises(e,n)}else{var r=this._rejectionHandler0;this._settlePromise0(this._fulfillmentHandler0,r,t),this._fulfillPromises(e,r)}this._setLength(0)}this._clearCancellationData()},i.prototype._settledValue=function(){var t=this._bitField;return 0!==(33554432&t)?this._rejectionHandler0:0!==(16777216&t)?this._fulfillmentHandler0:void 0},i.defer=i.pending=function(){F.deprecated("Promise.defer","new Promise");var t=new i(b);return{promise:t,resolve:o,reject:a}},h.notEnumerableProp(i,"_makeSelfResolutionError",l),t("./method")(i,b,E,p,F),t("./bind")(i,b,E,F),t("./cancel")(i,k,p,F),t("./direct_resolve")(i),t("./synchronous_inspection")(i),t("./join")(i,k,E,b,v,c),i.Promise=i,i.version="3.4.7",h.toFastProperties(i),h.toFastProperties(i.prototype),s({a:1}),s({b:2}),s({c:3}),s(1),s(function(){}),s(void 0),s(!1),s(new i(b)),F.setBounds(d.firstLineError,h.lastLineError),i}},{"./async":1,"./bind":2,"./cancel":4,"./catch_filter":5,"./context":6,"./debuggability":7,"./direct_resolve":8,"./errors":9,"./es5":10,"./finally":11,"./join":12,"./method":13,"./nodeback":14,"./promise_array":16,"./synchronous_inspection":19,"./thenables":20,"./util":21}],16:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o){function a(t){switch(t){case-2:return[];case-3:return{}}}function s(t){var r=this._promise=new e(n);t instanceof e&&r._propagateFrom(t,3),r._setOnCancel(this),this._values=t,this._length=0,this._totalResolved=0,this._init(void 0,-2)}var c=t("./util");c.isArray;return c.inherits(s,o),s.prototype.length=function(){return this._length},s.prototype.promise=function(){return this._promise},s.prototype._init=function l(t,n){var o=r(this._values,this._promise);if(o instanceof e){o=o._target();var s=o._bitField;if(this._values=o,0===(50397184&s))return this._promise._setAsyncGuaranteed(),o._then(l,this._reject,void 0,this,n);if(0===(33554432&s))return 0!==(16777216&s)?this._reject(o._reason()):this._cancel();o=o._value()}if(o=c.asArray(o),null===o){var u=i("expecting an array or an iterable object but got "+c.classString(o)).reason();return void this._promise._rejectCallback(u,!1)}return 0===o.length?void(-5===n?this._resolveEmptyArray():this._resolve(a(n))):void this._iterate(o)},s.prototype._iterate=function(t){var n=this.getActualLength(t.length);this._length=n,this._values=this.shouldCopyValues()?new Array(n):this._values;for(var i=this._promise,o=!1,a=null,s=0;n>s;++s){var c=r(t[s],i);c instanceof e?(c=c._target(),a=c._bitField):a=null,o?null!==a&&c.suppressUnhandledRejections():null!==a?0===(50397184&a)?(c._proxy(this,s),this._values[s]=c):o=0!==(33554432&a)?this._promiseFulfilled(c._value(),s):0!==(16777216&a)?this._promiseRejected(c._reason(),s):this._promiseCancelled(s):o=this._promiseFulfilled(c,s)}o||i._setAsyncGuaranteed()},s.prototype._isResolved=function(){return null===this._values},s.prototype._resolve=function(t){this._values=null,this._promise._fulfill(t)},s.prototype._cancel=function(){!this._isResolved()&&this._promise._isCancellable()&&(this._values=null,this._promise._cancel())},s.prototype._reject=function(t){this._values=null,this._promise._rejectCallback(t,!1)},s.prototype._promiseFulfilled=function(t,e){this._values[e]=t;var n=++this._totalResolved;return n>=this._length?(this._resolve(this._values),!0):!1},s.prototype._promiseCancelled=function(){return this._cancel(),!0},s.prototype._promiseRejected=function(t){return this._totalResolved++,this._reject(t),!0},s.prototype._resultCancelled=function(){if(!this._isResolved()){var t=this._values;if(this._cancel(),t instanceof e)t.cancel();else for(var n=0;no;++o)n[o+r]=t[o+e],t[o+e]=void 0}function i(t){this._capacity=t,this._length=0,this._front=0}i.prototype._willBeOverCapacity=function(t){return this._capacityn;++n)i[n]=t[n];return i[n]=e,i}function l(t,e,n){if(!F.isES5)return{}.hasOwnProperty.call(t,e)?t[e]:void 0;var r=Object.getOwnPropertyDescriptor(t,e);return null!=r?null==r.get&&null==r.set?r.value:n:void 0}function u(t,e,n){if(o(t))return t;var r={value:n,configurable:!0,enumerable:!1,writable:!0};return F.defineProperty(t,e,r),t}function p(t){throw t}function f(t){try{if("function"==typeof t){var e=F.names(t.prototype),n=F.isES5&&e.length>1,r=e.length>0&&!(1===e.length&&"constructor"===e[0]),i=A.test(t+"")&&F.names(t).length>0;if(n||r||i)return!0}return!1}catch(o){return!1}}function h(t){function e(){}e.prototype=t;for(var n=8;n--;)new e;return t}function _(t){return L.test(t)}function d(t,e,n){for(var r=new Array(t),i=0;t>i;++i)r[i]=e+i+n;return r}function v(t){try{return t+""}catch(e){return"[no string representation]"}}function y(t){return null!==t&&"object"==typeof t&&"string"==typeof t.message&&"string"==typeof t.name}function g(t){try{u(t,"isOperational",!0)}catch(e){}}function m(t){return null==t?!1:t instanceof Error.__BluebirdErrorTypes__.OperationalError||t.isOperational===!0}function b(t){return y(t)&&F.propertyIsWritable(t,"stack")}function C(t){return{}.toString.call(t)}function w(t,e,n){for(var r=F.names(t),i=0;i10||t[0]>0}(),D.isNode&&D.toFastProperties(process);try{throw new Error}catch(V){D.lastLineError=V}e.exports=D},{"./es5":10}]},{},[3])(3)}),"undefined"!=typeof window&&null!==window?window.P=window.Promise:"undefined"!=typeof self&&null!==self&&(self.P=self.Promise);
\ No newline at end of file
diff --git a/website_quotation_template/node_modules/bluebird/js/browser/bluebird.js b/website_quotation_template/node_modules/bluebird/js/browser/bluebird.js
new file mode 100644
index 000000000..dc80cb6a8
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/browser/bluebird.js
@@ -0,0 +1,5581 @@
+/* @preserve
+ * The MIT License (MIT)
+ *
+ * Copyright (c) 2013-2015 Petka Antonov
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in
+ * all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ * THE SOFTWARE.
+ *
+ */
+/**
+ * bluebird build version 3.4.7
+ * Features enabled: core, race, call_get, generators, map, nodeify, promisify, props, reduce, settle, some, using, timers, filter, any, each
+*/
+!function(e){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=e();else if("function"==typeof define&&define.amd)define([],e);else{var f;"undefined"!=typeof window?f=window:"undefined"!=typeof global?f=global:"undefined"!=typeof self&&(f=self),f.Promise=e()}}(function(){var define,module,exports;return (function e(t,n,r){function s(o,u){if(!n[o]){if(!t[o]){var a=typeof _dereq_=="function"&&_dereq_;if(!u&&a)return a(o,!0);if(i)return i(o,!0);var f=new Error("Cannot find module '"+o+"'");throw f.code="MODULE_NOT_FOUND",f}var l=n[o]={exports:{}};t[o][0].call(l.exports,function(e){var n=t[o][1][e];return s(n?n:e)},l,l.exports,e,t,n,r)}return n[o].exports}var i=typeof _dereq_=="function"&&_dereq_;for(var o=0;o 0) {
+ var fn = queue.shift();
+ if (typeof fn !== "function") {
+ fn._settlePromises();
+ continue;
+ }
+ var receiver = queue.shift();
+ var arg = queue.shift();
+ fn.call(receiver, arg);
+ }
+};
+
+Async.prototype._drainQueues = function () {
+ this._drainQueue(this._normalQueue);
+ this._reset();
+ this._haveDrainedQueues = true;
+ this._drainQueue(this._lateQueue);
+};
+
+Async.prototype._queueTick = function () {
+ if (!this._isTickUsed) {
+ this._isTickUsed = true;
+ this._schedule(this.drainQueues);
+ }
+};
+
+Async.prototype._reset = function () {
+ this._isTickUsed = false;
+};
+
+module.exports = Async;
+module.exports.firstLineError = firstLineError;
+
+},{"./queue":26,"./schedule":29,"./util":36}],3:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise, debug) {
+var calledBind = false;
+var rejectThis = function(_, e) {
+ this._reject(e);
+};
+
+var targetRejected = function(e, context) {
+ context.promiseRejectionQueued = true;
+ context.bindingPromise._then(rejectThis, rejectThis, null, this, e);
+};
+
+var bindingResolved = function(thisArg, context) {
+ if (((this._bitField & 50397184) === 0)) {
+ this._resolveCallback(context.target);
+ }
+};
+
+var bindingRejected = function(e, context) {
+ if (!context.promiseRejectionQueued) this._reject(e);
+};
+
+Promise.prototype.bind = function (thisArg) {
+ if (!calledBind) {
+ calledBind = true;
+ Promise.prototype._propagateFrom = debug.propagateFromFunction();
+ Promise.prototype._boundValue = debug.boundValueFunction();
+ }
+ var maybePromise = tryConvertToPromise(thisArg);
+ var ret = new Promise(INTERNAL);
+ ret._propagateFrom(this, 1);
+ var target = this._target();
+ ret._setBoundTo(maybePromise);
+ if (maybePromise instanceof Promise) {
+ var context = {
+ promiseRejectionQueued: false,
+ promise: ret,
+ target: target,
+ bindingPromise: maybePromise
+ };
+ target._then(INTERNAL, targetRejected, undefined, ret, context);
+ maybePromise._then(
+ bindingResolved, bindingRejected, undefined, ret, context);
+ ret._setOnCancel(maybePromise);
+ } else {
+ ret._resolveCallback(target);
+ }
+ return ret;
+};
+
+Promise.prototype._setBoundTo = function (obj) {
+ if (obj !== undefined) {
+ this._bitField = this._bitField | 2097152;
+ this._boundTo = obj;
+ } else {
+ this._bitField = this._bitField & (~2097152);
+ }
+};
+
+Promise.prototype._isBound = function () {
+ return (this._bitField & 2097152) === 2097152;
+};
+
+Promise.bind = function (thisArg, value) {
+ return Promise.resolve(value).bind(thisArg);
+};
+};
+
+},{}],4:[function(_dereq_,module,exports){
+"use strict";
+var old;
+if (typeof Promise !== "undefined") old = Promise;
+function noConflict() {
+ try { if (Promise === bluebird) Promise = old; }
+ catch (e) {}
+ return bluebird;
+}
+var bluebird = _dereq_("./promise")();
+bluebird.noConflict = noConflict;
+module.exports = bluebird;
+
+},{"./promise":22}],5:[function(_dereq_,module,exports){
+"use strict";
+var cr = Object.create;
+if (cr) {
+ var callerCache = cr(null);
+ var getterCache = cr(null);
+ callerCache[" size"] = getterCache[" size"] = 0;
+}
+
+module.exports = function(Promise) {
+var util = _dereq_("./util");
+var canEvaluate = util.canEvaluate;
+var isIdentifier = util.isIdentifier;
+
+var getMethodCaller;
+var getGetter;
+if (!true) {
+var makeMethodCaller = function (methodName) {
+ return new Function("ensureMethod", " \n\
+ return function(obj) { \n\
+ 'use strict' \n\
+ var len = this.length; \n\
+ ensureMethod(obj, 'methodName'); \n\
+ switch(len) { \n\
+ case 1: return obj.methodName(this[0]); \n\
+ case 2: return obj.methodName(this[0], this[1]); \n\
+ case 3: return obj.methodName(this[0], this[1], this[2]); \n\
+ case 0: return obj.methodName(); \n\
+ default: \n\
+ return obj.methodName.apply(obj, this); \n\
+ } \n\
+ }; \n\
+ ".replace(/methodName/g, methodName))(ensureMethod);
+};
+
+var makeGetter = function (propertyName) {
+ return new Function("obj", " \n\
+ 'use strict'; \n\
+ return obj.propertyName; \n\
+ ".replace("propertyName", propertyName));
+};
+
+var getCompiled = function(name, compiler, cache) {
+ var ret = cache[name];
+ if (typeof ret !== "function") {
+ if (!isIdentifier(name)) {
+ return null;
+ }
+ ret = compiler(name);
+ cache[name] = ret;
+ cache[" size"]++;
+ if (cache[" size"] > 512) {
+ var keys = Object.keys(cache);
+ for (var i = 0; i < 256; ++i) delete cache[keys[i]];
+ cache[" size"] = keys.length - 256;
+ }
+ }
+ return ret;
+};
+
+getMethodCaller = function(name) {
+ return getCompiled(name, makeMethodCaller, callerCache);
+};
+
+getGetter = function(name) {
+ return getCompiled(name, makeGetter, getterCache);
+};
+}
+
+function ensureMethod(obj, methodName) {
+ var fn;
+ if (obj != null) fn = obj[methodName];
+ if (typeof fn !== "function") {
+ var message = "Object " + util.classString(obj) + " has no method '" +
+ util.toString(methodName) + "'";
+ throw new Promise.TypeError(message);
+ }
+ return fn;
+}
+
+function caller(obj) {
+ var methodName = this.pop();
+ var fn = ensureMethod(obj, methodName);
+ return fn.apply(obj, this);
+}
+Promise.prototype.call = function (methodName) {
+ var args = [].slice.call(arguments, 1);;
+ if (!true) {
+ if (canEvaluate) {
+ var maybeCaller = getMethodCaller(methodName);
+ if (maybeCaller !== null) {
+ return this._then(
+ maybeCaller, undefined, undefined, args, undefined);
+ }
+ }
+ }
+ args.push(methodName);
+ return this._then(caller, undefined, undefined, args, undefined);
+};
+
+function namedGetter(obj) {
+ return obj[this];
+}
+function indexedGetter(obj) {
+ var index = +this;
+ if (index < 0) index = Math.max(0, index + obj.length);
+ return obj[index];
+}
+Promise.prototype.get = function (propertyName) {
+ var isIndex = (typeof propertyName === "number");
+ var getter;
+ if (!isIndex) {
+ if (canEvaluate) {
+ var maybeGetter = getGetter(propertyName);
+ getter = maybeGetter !== null ? maybeGetter : namedGetter;
+ } else {
+ getter = namedGetter;
+ }
+ } else {
+ getter = indexedGetter;
+ }
+ return this._then(getter, undefined, undefined, propertyName, undefined);
+};
+};
+
+},{"./util":36}],6:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, PromiseArray, apiRejection, debug) {
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var async = Promise._async;
+
+Promise.prototype["break"] = Promise.prototype.cancel = function() {
+ if (!debug.cancellation()) return this._warn("cancellation is disabled");
+
+ var promise = this;
+ var child = promise;
+ while (promise._isCancellable()) {
+ if (!promise._cancelBy(child)) {
+ if (child._isFollowing()) {
+ child._followee().cancel();
+ } else {
+ child._cancelBranched();
+ }
+ break;
+ }
+
+ var parent = promise._cancellationParent;
+ if (parent == null || !parent._isCancellable()) {
+ if (promise._isFollowing()) {
+ promise._followee().cancel();
+ } else {
+ promise._cancelBranched();
+ }
+ break;
+ } else {
+ if (promise._isFollowing()) promise._followee().cancel();
+ promise._setWillBeCancelled();
+ child = promise;
+ promise = parent;
+ }
+ }
+};
+
+Promise.prototype._branchHasCancelled = function() {
+ this._branchesRemainingToCancel--;
+};
+
+Promise.prototype._enoughBranchesHaveCancelled = function() {
+ return this._branchesRemainingToCancel === undefined ||
+ this._branchesRemainingToCancel <= 0;
+};
+
+Promise.prototype._cancelBy = function(canceller) {
+ if (canceller === this) {
+ this._branchesRemainingToCancel = 0;
+ this._invokeOnCancel();
+ return true;
+ } else {
+ this._branchHasCancelled();
+ if (this._enoughBranchesHaveCancelled()) {
+ this._invokeOnCancel();
+ return true;
+ }
+ }
+ return false;
+};
+
+Promise.prototype._cancelBranched = function() {
+ if (this._enoughBranchesHaveCancelled()) {
+ this._cancel();
+ }
+};
+
+Promise.prototype._cancel = function() {
+ if (!this._isCancellable()) return;
+ this._setCancelled();
+ async.invoke(this._cancelPromises, this, undefined);
+};
+
+Promise.prototype._cancelPromises = function() {
+ if (this._length() > 0) this._settlePromises();
+};
+
+Promise.prototype._unsetOnCancel = function() {
+ this._onCancelField = undefined;
+};
+
+Promise.prototype._isCancellable = function() {
+ return this.isPending() && !this._isCancelled();
+};
+
+Promise.prototype.isCancellable = function() {
+ return this.isPending() && !this.isCancelled();
+};
+
+Promise.prototype._doInvokeOnCancel = function(onCancelCallback, internalOnly) {
+ if (util.isArray(onCancelCallback)) {
+ for (var i = 0; i < onCancelCallback.length; ++i) {
+ this._doInvokeOnCancel(onCancelCallback[i], internalOnly);
+ }
+ } else if (onCancelCallback !== undefined) {
+ if (typeof onCancelCallback === "function") {
+ if (!internalOnly) {
+ var e = tryCatch(onCancelCallback).call(this._boundValue());
+ if (e === errorObj) {
+ this._attachExtraTrace(e.e);
+ async.throwLater(e.e);
+ }
+ }
+ } else {
+ onCancelCallback._resultCancelled(this);
+ }
+ }
+};
+
+Promise.prototype._invokeOnCancel = function() {
+ var onCancelCallback = this._onCancel();
+ this._unsetOnCancel();
+ async.invoke(this._doInvokeOnCancel, this, onCancelCallback);
+};
+
+Promise.prototype._invokeInternalOnCancel = function() {
+ if (this._isCancellable()) {
+ this._doInvokeOnCancel(this._onCancel(), true);
+ this._unsetOnCancel();
+ }
+};
+
+Promise.prototype._resultCancelled = function() {
+ this.cancel();
+};
+
+};
+
+},{"./util":36}],7:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(NEXT_FILTER) {
+var util = _dereq_("./util");
+var getKeys = _dereq_("./es5").keys;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function catchFilter(instances, cb, promise) {
+ return function(e) {
+ var boundTo = promise._boundValue();
+ predicateLoop: for (var i = 0; i < instances.length; ++i) {
+ var item = instances[i];
+
+ if (item === Error ||
+ (item != null && item.prototype instanceof Error)) {
+ if (e instanceof item) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (typeof item === "function") {
+ var matchesPredicate = tryCatch(item).call(boundTo, e);
+ if (matchesPredicate === errorObj) {
+ return matchesPredicate;
+ } else if (matchesPredicate) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (util.isObject(e)) {
+ var keys = getKeys(item);
+ for (var j = 0; j < keys.length; ++j) {
+ var key = keys[j];
+ if (item[key] != e[key]) {
+ continue predicateLoop;
+ }
+ }
+ return tryCatch(cb).call(boundTo, e);
+ }
+ }
+ return NEXT_FILTER;
+ };
+}
+
+return catchFilter;
+};
+
+},{"./es5":13,"./util":36}],8:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+var longStackTraces = false;
+var contextStack = [];
+
+Promise.prototype._promiseCreated = function() {};
+Promise.prototype._pushContext = function() {};
+Promise.prototype._popContext = function() {return null;};
+Promise._peekContext = Promise.prototype._peekContext = function() {};
+
+function Context() {
+ this._trace = new Context.CapturedTrace(peekContext());
+}
+Context.prototype._pushContext = function () {
+ if (this._trace !== undefined) {
+ this._trace._promiseCreated = null;
+ contextStack.push(this._trace);
+ }
+};
+
+Context.prototype._popContext = function () {
+ if (this._trace !== undefined) {
+ var trace = contextStack.pop();
+ var ret = trace._promiseCreated;
+ trace._promiseCreated = null;
+ return ret;
+ }
+ return null;
+};
+
+function createContext() {
+ if (longStackTraces) return new Context();
+}
+
+function peekContext() {
+ var lastIndex = contextStack.length - 1;
+ if (lastIndex >= 0) {
+ return contextStack[lastIndex];
+ }
+ return undefined;
+}
+Context.CapturedTrace = null;
+Context.create = createContext;
+Context.deactivateLongStackTraces = function() {};
+Context.activateLongStackTraces = function() {
+ var Promise_pushContext = Promise.prototype._pushContext;
+ var Promise_popContext = Promise.prototype._popContext;
+ var Promise_PeekContext = Promise._peekContext;
+ var Promise_peekContext = Promise.prototype._peekContext;
+ var Promise_promiseCreated = Promise.prototype._promiseCreated;
+ Context.deactivateLongStackTraces = function() {
+ Promise.prototype._pushContext = Promise_pushContext;
+ Promise.prototype._popContext = Promise_popContext;
+ Promise._peekContext = Promise_PeekContext;
+ Promise.prototype._peekContext = Promise_peekContext;
+ Promise.prototype._promiseCreated = Promise_promiseCreated;
+ longStackTraces = false;
+ };
+ longStackTraces = true;
+ Promise.prototype._pushContext = Context.prototype._pushContext;
+ Promise.prototype._popContext = Context.prototype._popContext;
+ Promise._peekContext = Promise.prototype._peekContext = peekContext;
+ Promise.prototype._promiseCreated = function() {
+ var ctx = this._peekContext();
+ if (ctx && ctx._promiseCreated == null) ctx._promiseCreated = this;
+ };
+};
+return Context;
+};
+
+},{}],9:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, Context) {
+var getDomain = Promise._getDomain;
+var async = Promise._async;
+var Warning = _dereq_("./errors").Warning;
+var util = _dereq_("./util");
+var canAttachTrace = util.canAttachTrace;
+var unhandledRejectionHandled;
+var possiblyUnhandledRejection;
+var bluebirdFramePattern =
+ /[\\\/]bluebird[\\\/]js[\\\/](release|debug|instrumented)/;
+var nodeFramePattern = /\((?:timers\.js):\d+:\d+\)/;
+var parseLinePattern = /[\/<\(](.+?):(\d+):(\d+)\)?\s*$/;
+var stackFramePattern = null;
+var formatStack = null;
+var indentStackFrames = false;
+var printWarning;
+var debugging = !!(util.env("BLUEBIRD_DEBUG") != 0 &&
+ (true ||
+ util.env("BLUEBIRD_DEBUG") ||
+ util.env("NODE_ENV") === "development"));
+
+var warnings = !!(util.env("BLUEBIRD_WARNINGS") != 0 &&
+ (debugging || util.env("BLUEBIRD_WARNINGS")));
+
+var longStackTraces = !!(util.env("BLUEBIRD_LONG_STACK_TRACES") != 0 &&
+ (debugging || util.env("BLUEBIRD_LONG_STACK_TRACES")));
+
+var wForgottenReturn = util.env("BLUEBIRD_W_FORGOTTEN_RETURN") != 0 &&
+ (warnings || !!util.env("BLUEBIRD_W_FORGOTTEN_RETURN"));
+
+Promise.prototype.suppressUnhandledRejections = function() {
+ var target = this._target();
+ target._bitField = ((target._bitField & (~1048576)) |
+ 524288);
+};
+
+Promise.prototype._ensurePossibleRejectionHandled = function () {
+ if ((this._bitField & 524288) !== 0) return;
+ this._setRejectionIsUnhandled();
+ async.invokeLater(this._notifyUnhandledRejection, this, undefined);
+};
+
+Promise.prototype._notifyUnhandledRejectionIsHandled = function () {
+ fireRejectionEvent("rejectionHandled",
+ unhandledRejectionHandled, undefined, this);
+};
+
+Promise.prototype._setReturnedNonUndefined = function() {
+ this._bitField = this._bitField | 268435456;
+};
+
+Promise.prototype._returnedNonUndefined = function() {
+ return (this._bitField & 268435456) !== 0;
+};
+
+Promise.prototype._notifyUnhandledRejection = function () {
+ if (this._isRejectionUnhandled()) {
+ var reason = this._settledValue();
+ this._setUnhandledRejectionIsNotified();
+ fireRejectionEvent("unhandledRejection",
+ possiblyUnhandledRejection, reason, this);
+ }
+};
+
+Promise.prototype._setUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField | 262144;
+};
+
+Promise.prototype._unsetUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField & (~262144);
+};
+
+Promise.prototype._isUnhandledRejectionNotified = function () {
+ return (this._bitField & 262144) > 0;
+};
+
+Promise.prototype._setRejectionIsUnhandled = function () {
+ this._bitField = this._bitField | 1048576;
+};
+
+Promise.prototype._unsetRejectionIsUnhandled = function () {
+ this._bitField = this._bitField & (~1048576);
+ if (this._isUnhandledRejectionNotified()) {
+ this._unsetUnhandledRejectionIsNotified();
+ this._notifyUnhandledRejectionIsHandled();
+ }
+};
+
+Promise.prototype._isRejectionUnhandled = function () {
+ return (this._bitField & 1048576) > 0;
+};
+
+Promise.prototype._warn = function(message, shouldUseOwnTrace, promise) {
+ return warn(message, shouldUseOwnTrace, promise || this);
+};
+
+Promise.onPossiblyUnhandledRejection = function (fn) {
+ var domain = getDomain();
+ possiblyUnhandledRejection =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+Promise.onUnhandledRejectionHandled = function (fn) {
+ var domain = getDomain();
+ unhandledRejectionHandled =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+var disableLongStackTraces = function() {};
+Promise.longStackTraces = function () {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ if (!config.longStackTraces && longStackTracesIsSupported()) {
+ var Promise_captureStackTrace = Promise.prototype._captureStackTrace;
+ var Promise_attachExtraTrace = Promise.prototype._attachExtraTrace;
+ config.longStackTraces = true;
+ disableLongStackTraces = function() {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ Promise.prototype._captureStackTrace = Promise_captureStackTrace;
+ Promise.prototype._attachExtraTrace = Promise_attachExtraTrace;
+ Context.deactivateLongStackTraces();
+ async.enableTrampoline();
+ config.longStackTraces = false;
+ };
+ Promise.prototype._captureStackTrace = longStackTracesCaptureStackTrace;
+ Promise.prototype._attachExtraTrace = longStackTracesAttachExtraTrace;
+ Context.activateLongStackTraces();
+ async.disableTrampolineIfNecessary();
+ }
+};
+
+Promise.hasLongStackTraces = function () {
+ return config.longStackTraces && longStackTracesIsSupported();
+};
+
+var fireDomEvent = (function() {
+ try {
+ if (typeof CustomEvent === "function") {
+ var event = new CustomEvent("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new CustomEvent(name.toLowerCase(), {
+ detail: event,
+ cancelable: true
+ });
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else if (typeof Event === "function") {
+ var event = new Event("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new Event(name.toLowerCase(), {
+ cancelable: true
+ });
+ domEvent.detail = event;
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else {
+ var event = document.createEvent("CustomEvent");
+ event.initCustomEvent("testingtheevent", false, true, {});
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = document.createEvent("CustomEvent");
+ domEvent.initCustomEvent(name.toLowerCase(), false, true,
+ event);
+ return !util.global.dispatchEvent(domEvent);
+ };
+ }
+ } catch (e) {}
+ return function() {
+ return false;
+ };
+})();
+
+var fireGlobalEvent = (function() {
+ if (util.isNode) {
+ return function() {
+ return process.emit.apply(process, arguments);
+ };
+ } else {
+ if (!util.global) {
+ return function() {
+ return false;
+ };
+ }
+ return function(name) {
+ var methodName = "on" + name.toLowerCase();
+ var method = util.global[methodName];
+ if (!method) return false;
+ method.apply(util.global, [].slice.call(arguments, 1));
+ return true;
+ };
+ }
+})();
+
+function generatePromiseLifecycleEventObject(name, promise) {
+ return {promise: promise};
+}
+
+var eventToObjectGenerator = {
+ promiseCreated: generatePromiseLifecycleEventObject,
+ promiseFulfilled: generatePromiseLifecycleEventObject,
+ promiseRejected: generatePromiseLifecycleEventObject,
+ promiseResolved: generatePromiseLifecycleEventObject,
+ promiseCancelled: generatePromiseLifecycleEventObject,
+ promiseChained: function(name, promise, child) {
+ return {promise: promise, child: child};
+ },
+ warning: function(name, warning) {
+ return {warning: warning};
+ },
+ unhandledRejection: function (name, reason, promise) {
+ return {reason: reason, promise: promise};
+ },
+ rejectionHandled: generatePromiseLifecycleEventObject
+};
+
+var activeFireEvent = function (name) {
+ var globalEventFired = false;
+ try {
+ globalEventFired = fireGlobalEvent.apply(null, arguments);
+ } catch (e) {
+ async.throwLater(e);
+ globalEventFired = true;
+ }
+
+ var domEventFired = false;
+ try {
+ domEventFired = fireDomEvent(name,
+ eventToObjectGenerator[name].apply(null, arguments));
+ } catch (e) {
+ async.throwLater(e);
+ domEventFired = true;
+ }
+
+ return domEventFired || globalEventFired;
+};
+
+Promise.config = function(opts) {
+ opts = Object(opts);
+ if ("longStackTraces" in opts) {
+ if (opts.longStackTraces) {
+ Promise.longStackTraces();
+ } else if (!opts.longStackTraces && Promise.hasLongStackTraces()) {
+ disableLongStackTraces();
+ }
+ }
+ if ("warnings" in opts) {
+ var warningsOption = opts.warnings;
+ config.warnings = !!warningsOption;
+ wForgottenReturn = config.warnings;
+
+ if (util.isObject(warningsOption)) {
+ if ("wForgottenReturn" in warningsOption) {
+ wForgottenReturn = !!warningsOption.wForgottenReturn;
+ }
+ }
+ }
+ if ("cancellation" in opts && opts.cancellation && !config.cancellation) {
+ if (async.haveItemsQueued()) {
+ throw new Error(
+ "cannot enable cancellation after promises are in use");
+ }
+ Promise.prototype._clearCancellationData =
+ cancellationClearCancellationData;
+ Promise.prototype._propagateFrom = cancellationPropagateFrom;
+ Promise.prototype._onCancel = cancellationOnCancel;
+ Promise.prototype._setOnCancel = cancellationSetOnCancel;
+ Promise.prototype._attachCancellationCallback =
+ cancellationAttachCancellationCallback;
+ Promise.prototype._execute = cancellationExecute;
+ propagateFromFunction = cancellationPropagateFrom;
+ config.cancellation = true;
+ }
+ if ("monitoring" in opts) {
+ if (opts.monitoring && !config.monitoring) {
+ config.monitoring = true;
+ Promise.prototype._fireEvent = activeFireEvent;
+ } else if (!opts.monitoring && config.monitoring) {
+ config.monitoring = false;
+ Promise.prototype._fireEvent = defaultFireEvent;
+ }
+ }
+ return Promise;
+};
+
+function defaultFireEvent() { return false; }
+
+Promise.prototype._fireEvent = defaultFireEvent;
+Promise.prototype._execute = function(executor, resolve, reject) {
+ try {
+ executor(resolve, reject);
+ } catch (e) {
+ return e;
+ }
+};
+Promise.prototype._onCancel = function () {};
+Promise.prototype._setOnCancel = function (handler) { ; };
+Promise.prototype._attachCancellationCallback = function(onCancel) {
+ ;
+};
+Promise.prototype._captureStackTrace = function () {};
+Promise.prototype._attachExtraTrace = function () {};
+Promise.prototype._clearCancellationData = function() {};
+Promise.prototype._propagateFrom = function (parent, flags) {
+ ;
+ ;
+};
+
+function cancellationExecute(executor, resolve, reject) {
+ var promise = this;
+ try {
+ executor(resolve, reject, function(onCancel) {
+ if (typeof onCancel !== "function") {
+ throw new TypeError("onCancel must be a function, got: " +
+ util.toString(onCancel));
+ }
+ promise._attachCancellationCallback(onCancel);
+ });
+ } catch (e) {
+ return e;
+ }
+}
+
+function cancellationAttachCancellationCallback(onCancel) {
+ if (!this._isCancellable()) return this;
+
+ var previousOnCancel = this._onCancel();
+ if (previousOnCancel !== undefined) {
+ if (util.isArray(previousOnCancel)) {
+ previousOnCancel.push(onCancel);
+ } else {
+ this._setOnCancel([previousOnCancel, onCancel]);
+ }
+ } else {
+ this._setOnCancel(onCancel);
+ }
+}
+
+function cancellationOnCancel() {
+ return this._onCancelField;
+}
+
+function cancellationSetOnCancel(onCancel) {
+ this._onCancelField = onCancel;
+}
+
+function cancellationClearCancellationData() {
+ this._cancellationParent = undefined;
+ this._onCancelField = undefined;
+}
+
+function cancellationPropagateFrom(parent, flags) {
+ if ((flags & 1) !== 0) {
+ this._cancellationParent = parent;
+ var branchesRemainingToCancel = parent._branchesRemainingToCancel;
+ if (branchesRemainingToCancel === undefined) {
+ branchesRemainingToCancel = 0;
+ }
+ parent._branchesRemainingToCancel = branchesRemainingToCancel + 1;
+ }
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+
+function bindingPropagateFrom(parent, flags) {
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+var propagateFromFunction = bindingPropagateFrom;
+
+function boundValueFunction() {
+ var ret = this._boundTo;
+ if (ret !== undefined) {
+ if (ret instanceof Promise) {
+ if (ret.isFulfilled()) {
+ return ret.value();
+ } else {
+ return undefined;
+ }
+ }
+ }
+ return ret;
+}
+
+function longStackTracesCaptureStackTrace() {
+ this._trace = new CapturedTrace(this._peekContext());
+}
+
+function longStackTracesAttachExtraTrace(error, ignoreSelf) {
+ if (canAttachTrace(error)) {
+ var trace = this._trace;
+ if (trace !== undefined) {
+ if (ignoreSelf) trace = trace._parent;
+ }
+ if (trace !== undefined) {
+ trace.attachExtraTrace(error);
+ } else if (!error.__stackCleaned__) {
+ var parsed = parseStackAndMessage(error);
+ util.notEnumerableProp(error, "stack",
+ parsed.message + "\n" + parsed.stack.join("\n"));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+ }
+ }
+}
+
+function checkForgottenReturns(returnValue, promiseCreated, name, promise,
+ parent) {
+ if (returnValue === undefined && promiseCreated !== null &&
+ wForgottenReturn) {
+ if (parent !== undefined && parent._returnedNonUndefined()) return;
+ if ((promise._bitField & 65535) === 0) return;
+
+ if (name) name = name + " ";
+ var handlerLine = "";
+ var creatorLine = "";
+ if (promiseCreated._trace) {
+ var traceLines = promiseCreated._trace.stack.split("\n");
+ var stack = cleanStack(traceLines);
+ for (var i = stack.length - 1; i >= 0; --i) {
+ var line = stack[i];
+ if (!nodeFramePattern.test(line)) {
+ var lineMatches = line.match(parseLinePattern);
+ if (lineMatches) {
+ handlerLine = "at " + lineMatches[1] +
+ ":" + lineMatches[2] + ":" + lineMatches[3] + " ";
+ }
+ break;
+ }
+ }
+
+ if (stack.length > 0) {
+ var firstUserLine = stack[0];
+ for (var i = 0; i < traceLines.length; ++i) {
+
+ if (traceLines[i] === firstUserLine) {
+ if (i > 0) {
+ creatorLine = "\n" + traceLines[i - 1];
+ }
+ break;
+ }
+ }
+
+ }
+ }
+ var msg = "a promise was created in a " + name +
+ "handler " + handlerLine + "but was not returned from it, " +
+ "see http://goo.gl/rRqMUw" +
+ creatorLine;
+ promise._warn(msg, true, promiseCreated);
+ }
+}
+
+function deprecated(name, replacement) {
+ var message = name +
+ " is deprecated and will be removed in a future version.";
+ if (replacement) message += " Use " + replacement + " instead.";
+ return warn(message);
+}
+
+function warn(message, shouldUseOwnTrace, promise) {
+ if (!config.warnings) return;
+ var warning = new Warning(message);
+ var ctx;
+ if (shouldUseOwnTrace) {
+ promise._attachExtraTrace(warning);
+ } else if (config.longStackTraces && (ctx = Promise._peekContext())) {
+ ctx.attachExtraTrace(warning);
+ } else {
+ var parsed = parseStackAndMessage(warning);
+ warning.stack = parsed.message + "\n" + parsed.stack.join("\n");
+ }
+
+ if (!activeFireEvent("warning", warning)) {
+ formatAndLogError(warning, "", true);
+ }
+}
+
+function reconstructStack(message, stacks) {
+ for (var i = 0; i < stacks.length - 1; ++i) {
+ stacks[i].push("From previous event:");
+ stacks[i] = stacks[i].join("\n");
+ }
+ if (i < stacks.length) {
+ stacks[i] = stacks[i].join("\n");
+ }
+ return message + "\n" + stacks.join("\n");
+}
+
+function removeDuplicateOrEmptyJumps(stacks) {
+ for (var i = 0; i < stacks.length; ++i) {
+ if (stacks[i].length === 0 ||
+ ((i + 1 < stacks.length) && stacks[i][0] === stacks[i+1][0])) {
+ stacks.splice(i, 1);
+ i--;
+ }
+ }
+}
+
+function removeCommonRoots(stacks) {
+ var current = stacks[0];
+ for (var i = 1; i < stacks.length; ++i) {
+ var prev = stacks[i];
+ var currentLastIndex = current.length - 1;
+ var currentLastLine = current[currentLastIndex];
+ var commonRootMeetPoint = -1;
+
+ for (var j = prev.length - 1; j >= 0; --j) {
+ if (prev[j] === currentLastLine) {
+ commonRootMeetPoint = j;
+ break;
+ }
+ }
+
+ for (var j = commonRootMeetPoint; j >= 0; --j) {
+ var line = prev[j];
+ if (current[currentLastIndex] === line) {
+ current.pop();
+ currentLastIndex--;
+ } else {
+ break;
+ }
+ }
+ current = prev;
+ }
+}
+
+function cleanStack(stack) {
+ var ret = [];
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ var isTraceLine = " (No stack trace)" === line ||
+ stackFramePattern.test(line);
+ var isInternalFrame = isTraceLine && shouldIgnore(line);
+ if (isTraceLine && !isInternalFrame) {
+ if (indentStackFrames && line.charAt(0) !== " ") {
+ line = " " + line;
+ }
+ ret.push(line);
+ }
+ }
+ return ret;
+}
+
+function stackFramesAsArray(error) {
+ var stack = error.stack.replace(/\s+$/g, "").split("\n");
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ if (" (No stack trace)" === line || stackFramePattern.test(line)) {
+ break;
+ }
+ }
+ if (i > 0 && error.name != "SyntaxError") {
+ stack = stack.slice(i);
+ }
+ return stack;
+}
+
+function parseStackAndMessage(error) {
+ var stack = error.stack;
+ var message = error.toString();
+ stack = typeof stack === "string" && stack.length > 0
+ ? stackFramesAsArray(error) : [" (No stack trace)"];
+ return {
+ message: message,
+ stack: error.name == "SyntaxError" ? stack : cleanStack(stack)
+ };
+}
+
+function formatAndLogError(error, title, isSoft) {
+ if (typeof console !== "undefined") {
+ var message;
+ if (util.isObject(error)) {
+ var stack = error.stack;
+ message = title + formatStack(stack, error);
+ } else {
+ message = title + String(error);
+ }
+ if (typeof printWarning === "function") {
+ printWarning(message, isSoft);
+ } else if (typeof console.log === "function" ||
+ typeof console.log === "object") {
+ console.log(message);
+ }
+ }
+}
+
+function fireRejectionEvent(name, localHandler, reason, promise) {
+ var localEventFired = false;
+ try {
+ if (typeof localHandler === "function") {
+ localEventFired = true;
+ if (name === "rejectionHandled") {
+ localHandler(promise);
+ } else {
+ localHandler(reason, promise);
+ }
+ }
+ } catch (e) {
+ async.throwLater(e);
+ }
+
+ if (name === "unhandledRejection") {
+ if (!activeFireEvent(name, reason, promise) && !localEventFired) {
+ formatAndLogError(reason, "Unhandled rejection ");
+ }
+ } else {
+ activeFireEvent(name, promise);
+ }
+}
+
+function formatNonError(obj) {
+ var str;
+ if (typeof obj === "function") {
+ str = "[function " +
+ (obj.name || "anonymous") +
+ "]";
+ } else {
+ str = obj && typeof obj.toString === "function"
+ ? obj.toString() : util.toString(obj);
+ var ruselessToString = /\[object [a-zA-Z0-9$_]+\]/;
+ if (ruselessToString.test(str)) {
+ try {
+ var newStr = JSON.stringify(obj);
+ str = newStr;
+ }
+ catch(e) {
+
+ }
+ }
+ if (str.length === 0) {
+ str = "(empty array)";
+ }
+ }
+ return ("(<" + snip(str) + ">, no stack trace)");
+}
+
+function snip(str) {
+ var maxChars = 41;
+ if (str.length < maxChars) {
+ return str;
+ }
+ return str.substr(0, maxChars - 3) + "...";
+}
+
+function longStackTracesIsSupported() {
+ return typeof captureStackTrace === "function";
+}
+
+var shouldIgnore = function() { return false; };
+var parseLineInfoRegex = /[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;
+function parseLineInfo(line) {
+ var matches = line.match(parseLineInfoRegex);
+ if (matches) {
+ return {
+ fileName: matches[1],
+ line: parseInt(matches[2], 10)
+ };
+ }
+}
+
+function setBounds(firstLineError, lastLineError) {
+ if (!longStackTracesIsSupported()) return;
+ var firstStackLines = firstLineError.stack.split("\n");
+ var lastStackLines = lastLineError.stack.split("\n");
+ var firstIndex = -1;
+ var lastIndex = -1;
+ var firstFileName;
+ var lastFileName;
+ for (var i = 0; i < firstStackLines.length; ++i) {
+ var result = parseLineInfo(firstStackLines[i]);
+ if (result) {
+ firstFileName = result.fileName;
+ firstIndex = result.line;
+ break;
+ }
+ }
+ for (var i = 0; i < lastStackLines.length; ++i) {
+ var result = parseLineInfo(lastStackLines[i]);
+ if (result) {
+ lastFileName = result.fileName;
+ lastIndex = result.line;
+ break;
+ }
+ }
+ if (firstIndex < 0 || lastIndex < 0 || !firstFileName || !lastFileName ||
+ firstFileName !== lastFileName || firstIndex >= lastIndex) {
+ return;
+ }
+
+ shouldIgnore = function(line) {
+ if (bluebirdFramePattern.test(line)) return true;
+ var info = parseLineInfo(line);
+ if (info) {
+ if (info.fileName === firstFileName &&
+ (firstIndex <= info.line && info.line <= lastIndex)) {
+ return true;
+ }
+ }
+ return false;
+ };
+}
+
+function CapturedTrace(parent) {
+ this._parent = parent;
+ this._promisesCreated = 0;
+ var length = this._length = 1 + (parent === undefined ? 0 : parent._length);
+ captureStackTrace(this, CapturedTrace);
+ if (length > 32) this.uncycle();
+}
+util.inherits(CapturedTrace, Error);
+Context.CapturedTrace = CapturedTrace;
+
+CapturedTrace.prototype.uncycle = function() {
+ var length = this._length;
+ if (length < 2) return;
+ var nodes = [];
+ var stackToIndex = {};
+
+ for (var i = 0, node = this; node !== undefined; ++i) {
+ nodes.push(node);
+ node = node._parent;
+ }
+ length = this._length = i;
+ for (var i = length - 1; i >= 0; --i) {
+ var stack = nodes[i].stack;
+ if (stackToIndex[stack] === undefined) {
+ stackToIndex[stack] = i;
+ }
+ }
+ for (var i = 0; i < length; ++i) {
+ var currentStack = nodes[i].stack;
+ var index = stackToIndex[currentStack];
+ if (index !== undefined && index !== i) {
+ if (index > 0) {
+ nodes[index - 1]._parent = undefined;
+ nodes[index - 1]._length = 1;
+ }
+ nodes[i]._parent = undefined;
+ nodes[i]._length = 1;
+ var cycleEdgeNode = i > 0 ? nodes[i - 1] : this;
+
+ if (index < length - 1) {
+ cycleEdgeNode._parent = nodes[index + 1];
+ cycleEdgeNode._parent.uncycle();
+ cycleEdgeNode._length =
+ cycleEdgeNode._parent._length + 1;
+ } else {
+ cycleEdgeNode._parent = undefined;
+ cycleEdgeNode._length = 1;
+ }
+ var currentChildLength = cycleEdgeNode._length + 1;
+ for (var j = i - 2; j >= 0; --j) {
+ nodes[j]._length = currentChildLength;
+ currentChildLength++;
+ }
+ return;
+ }
+ }
+};
+
+CapturedTrace.prototype.attachExtraTrace = function(error) {
+ if (error.__stackCleaned__) return;
+ this.uncycle();
+ var parsed = parseStackAndMessage(error);
+ var message = parsed.message;
+ var stacks = [parsed.stack];
+
+ var trace = this;
+ while (trace !== undefined) {
+ stacks.push(cleanStack(trace.stack.split("\n")));
+ trace = trace._parent;
+ }
+ removeCommonRoots(stacks);
+ removeDuplicateOrEmptyJumps(stacks);
+ util.notEnumerableProp(error, "stack", reconstructStack(message, stacks));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+};
+
+var captureStackTrace = (function stackDetection() {
+ var v8stackFramePattern = /^\s*at\s*/;
+ var v8stackFormatter = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if (error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ if (typeof Error.stackTraceLimit === "number" &&
+ typeof Error.captureStackTrace === "function") {
+ Error.stackTraceLimit += 6;
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ var captureStackTrace = Error.captureStackTrace;
+
+ shouldIgnore = function(line) {
+ return bluebirdFramePattern.test(line);
+ };
+ return function(receiver, ignoreUntil) {
+ Error.stackTraceLimit += 6;
+ captureStackTrace(receiver, ignoreUntil);
+ Error.stackTraceLimit -= 6;
+ };
+ }
+ var err = new Error();
+
+ if (typeof err.stack === "string" &&
+ err.stack.split("\n")[0].indexOf("stackDetection@") >= 0) {
+ stackFramePattern = /@/;
+ formatStack = v8stackFormatter;
+ indentStackFrames = true;
+ return function captureStackTrace(o) {
+ o.stack = new Error().stack;
+ };
+ }
+
+ var hasStackAfterThrow;
+ try { throw new Error(); }
+ catch(e) {
+ hasStackAfterThrow = ("stack" in e);
+ }
+ if (!("stack" in err) && hasStackAfterThrow &&
+ typeof Error.stackTraceLimit === "number") {
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ return function captureStackTrace(o) {
+ Error.stackTraceLimit += 6;
+ try { throw new Error(); }
+ catch(e) { o.stack = e.stack; }
+ Error.stackTraceLimit -= 6;
+ };
+ }
+
+ formatStack = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if ((typeof error === "object" ||
+ typeof error === "function") &&
+ error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ return null;
+
+})([]);
+
+if (typeof console !== "undefined" && typeof console.warn !== "undefined") {
+ printWarning = function (message) {
+ console.warn(message);
+ };
+ if (util.isNode && process.stderr.isTTY) {
+ printWarning = function(message, isSoft) {
+ var color = isSoft ? "\u001b[33m" : "\u001b[31m";
+ console.warn(color + message + "\u001b[0m\n");
+ };
+ } else if (!util.isNode && typeof (new Error().stack) === "string") {
+ printWarning = function(message, isSoft) {
+ console.warn("%c" + message,
+ isSoft ? "color: darkorange" : "color: red");
+ };
+ }
+}
+
+var config = {
+ warnings: warnings,
+ longStackTraces: false,
+ cancellation: false,
+ monitoring: false
+};
+
+if (longStackTraces) Promise.longStackTraces();
+
+return {
+ longStackTraces: function() {
+ return config.longStackTraces;
+ },
+ warnings: function() {
+ return config.warnings;
+ },
+ cancellation: function() {
+ return config.cancellation;
+ },
+ monitoring: function() {
+ return config.monitoring;
+ },
+ propagateFromFunction: function() {
+ return propagateFromFunction;
+ },
+ boundValueFunction: function() {
+ return boundValueFunction;
+ },
+ checkForgottenReturns: checkForgottenReturns,
+ setBounds: setBounds,
+ warn: warn,
+ deprecated: deprecated,
+ CapturedTrace: CapturedTrace,
+ fireDomEvent: fireDomEvent,
+ fireGlobalEvent: fireGlobalEvent
+};
+};
+
+},{"./errors":12,"./util":36}],10:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+function returner() {
+ return this.value;
+}
+function thrower() {
+ throw this.reason;
+}
+
+Promise.prototype["return"] =
+Promise.prototype.thenReturn = function (value) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ returner, undefined, undefined, {value: value}, undefined);
+};
+
+Promise.prototype["throw"] =
+Promise.prototype.thenThrow = function (reason) {
+ return this._then(
+ thrower, undefined, undefined, {reason: reason}, undefined);
+};
+
+Promise.prototype.catchThrow = function (reason) {
+ if (arguments.length <= 1) {
+ return this._then(
+ undefined, thrower, undefined, {reason: reason}, undefined);
+ } else {
+ var _reason = arguments[1];
+ var handler = function() {throw _reason;};
+ return this.caught(reason, handler);
+ }
+};
+
+Promise.prototype.catchReturn = function (value) {
+ if (arguments.length <= 1) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ undefined, returner, undefined, {value: value}, undefined);
+ } else {
+ var _value = arguments[1];
+ if (_value instanceof Promise) _value.suppressUnhandledRejections();
+ var handler = function() {return _value;};
+ return this.caught(value, handler);
+ }
+};
+};
+
+},{}],11:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseReduce = Promise.reduce;
+var PromiseAll = Promise.all;
+
+function promiseAllThis() {
+ return PromiseAll(this);
+}
+
+function PromiseMapSeries(promises, fn) {
+ return PromiseReduce(promises, fn, INTERNAL, INTERNAL);
+}
+
+Promise.prototype.each = function (fn) {
+ return PromiseReduce(this, fn, INTERNAL, 0)
+ ._then(promiseAllThis, undefined, undefined, this, undefined);
+};
+
+Promise.prototype.mapSeries = function (fn) {
+ return PromiseReduce(this, fn, INTERNAL, INTERNAL);
+};
+
+Promise.each = function (promises, fn) {
+ return PromiseReduce(promises, fn, INTERNAL, 0)
+ ._then(promiseAllThis, undefined, undefined, promises, undefined);
+};
+
+Promise.mapSeries = PromiseMapSeries;
+};
+
+
+},{}],12:[function(_dereq_,module,exports){
+"use strict";
+var es5 = _dereq_("./es5");
+var Objectfreeze = es5.freeze;
+var util = _dereq_("./util");
+var inherits = util.inherits;
+var notEnumerableProp = util.notEnumerableProp;
+
+function subError(nameProperty, defaultMessage) {
+ function SubError(message) {
+ if (!(this instanceof SubError)) return new SubError(message);
+ notEnumerableProp(this, "message",
+ typeof message === "string" ? message : defaultMessage);
+ notEnumerableProp(this, "name", nameProperty);
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ } else {
+ Error.call(this);
+ }
+ }
+ inherits(SubError, Error);
+ return SubError;
+}
+
+var _TypeError, _RangeError;
+var Warning = subError("Warning", "warning");
+var CancellationError = subError("CancellationError", "cancellation error");
+var TimeoutError = subError("TimeoutError", "timeout error");
+var AggregateError = subError("AggregateError", "aggregate error");
+try {
+ _TypeError = TypeError;
+ _RangeError = RangeError;
+} catch(e) {
+ _TypeError = subError("TypeError", "type error");
+ _RangeError = subError("RangeError", "range error");
+}
+
+var methods = ("join pop push shift unshift slice filter forEach some " +
+ "every map indexOf lastIndexOf reduce reduceRight sort reverse").split(" ");
+
+for (var i = 0; i < methods.length; ++i) {
+ if (typeof Array.prototype[methods[i]] === "function") {
+ AggregateError.prototype[methods[i]] = Array.prototype[methods[i]];
+ }
+}
+
+es5.defineProperty(AggregateError.prototype, "length", {
+ value: 0,
+ configurable: false,
+ writable: true,
+ enumerable: true
+});
+AggregateError.prototype["isOperational"] = true;
+var level = 0;
+AggregateError.prototype.toString = function() {
+ var indent = Array(level * 4 + 1).join(" ");
+ var ret = "\n" + indent + "AggregateError of:" + "\n";
+ level++;
+ indent = Array(level * 4 + 1).join(" ");
+ for (var i = 0; i < this.length; ++i) {
+ var str = this[i] === this ? "[Circular AggregateError]" : this[i] + "";
+ var lines = str.split("\n");
+ for (var j = 0; j < lines.length; ++j) {
+ lines[j] = indent + lines[j];
+ }
+ str = lines.join("\n");
+ ret += str + "\n";
+ }
+ level--;
+ return ret;
+};
+
+function OperationalError(message) {
+ if (!(this instanceof OperationalError))
+ return new OperationalError(message);
+ notEnumerableProp(this, "name", "OperationalError");
+ notEnumerableProp(this, "message", message);
+ this.cause = message;
+ this["isOperational"] = true;
+
+ if (message instanceof Error) {
+ notEnumerableProp(this, "message", message.message);
+ notEnumerableProp(this, "stack", message.stack);
+ } else if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ }
+
+}
+inherits(OperationalError, Error);
+
+var errorTypes = Error["__BluebirdErrorTypes__"];
+if (!errorTypes) {
+ errorTypes = Objectfreeze({
+ CancellationError: CancellationError,
+ TimeoutError: TimeoutError,
+ OperationalError: OperationalError,
+ RejectionError: OperationalError,
+ AggregateError: AggregateError
+ });
+ es5.defineProperty(Error, "__BluebirdErrorTypes__", {
+ value: errorTypes,
+ writable: false,
+ enumerable: false,
+ configurable: false
+ });
+}
+
+module.exports = {
+ Error: Error,
+ TypeError: _TypeError,
+ RangeError: _RangeError,
+ CancellationError: errorTypes.CancellationError,
+ OperationalError: errorTypes.OperationalError,
+ TimeoutError: errorTypes.TimeoutError,
+ AggregateError: errorTypes.AggregateError,
+ Warning: Warning
+};
+
+},{"./es5":13,"./util":36}],13:[function(_dereq_,module,exports){
+var isES5 = (function(){
+ "use strict";
+ return this === undefined;
+})();
+
+if (isES5) {
+ module.exports = {
+ freeze: Object.freeze,
+ defineProperty: Object.defineProperty,
+ getDescriptor: Object.getOwnPropertyDescriptor,
+ keys: Object.keys,
+ names: Object.getOwnPropertyNames,
+ getPrototypeOf: Object.getPrototypeOf,
+ isArray: Array.isArray,
+ isES5: isES5,
+ propertyIsWritable: function(obj, prop) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop);
+ return !!(!descriptor || descriptor.writable || descriptor.set);
+ }
+ };
+} else {
+ var has = {}.hasOwnProperty;
+ var str = {}.toString;
+ var proto = {}.constructor.prototype;
+
+ var ObjectKeys = function (o) {
+ var ret = [];
+ for (var key in o) {
+ if (has.call(o, key)) {
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+
+ var ObjectGetDescriptor = function(o, key) {
+ return {value: o[key]};
+ };
+
+ var ObjectDefineProperty = function (o, key, desc) {
+ o[key] = desc.value;
+ return o;
+ };
+
+ var ObjectFreeze = function (obj) {
+ return obj;
+ };
+
+ var ObjectGetPrototypeOf = function (obj) {
+ try {
+ return Object(obj).constructor.prototype;
+ }
+ catch (e) {
+ return proto;
+ }
+ };
+
+ var ArrayIsArray = function (obj) {
+ try {
+ return str.call(obj) === "[object Array]";
+ }
+ catch(e) {
+ return false;
+ }
+ };
+
+ module.exports = {
+ isArray: ArrayIsArray,
+ keys: ObjectKeys,
+ names: ObjectKeys,
+ defineProperty: ObjectDefineProperty,
+ getDescriptor: ObjectGetDescriptor,
+ freeze: ObjectFreeze,
+ getPrototypeOf: ObjectGetPrototypeOf,
+ isES5: isES5,
+ propertyIsWritable: function() {
+ return true;
+ }
+ };
+}
+
+},{}],14:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseMap = Promise.map;
+
+Promise.prototype.filter = function (fn, options) {
+ return PromiseMap(this, fn, options, INTERNAL);
+};
+
+Promise.filter = function (promises, fn, options) {
+ return PromiseMap(promises, fn, options, INTERNAL);
+};
+};
+
+},{}],15:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, tryConvertToPromise) {
+var util = _dereq_("./util");
+var CancellationError = Promise.CancellationError;
+var errorObj = util.errorObj;
+
+function PassThroughHandlerContext(promise, type, handler) {
+ this.promise = promise;
+ this.type = type;
+ this.handler = handler;
+ this.called = false;
+ this.cancelPromise = null;
+}
+
+PassThroughHandlerContext.prototype.isFinallyHandler = function() {
+ return this.type === 0;
+};
+
+function FinallyHandlerCancelReaction(finallyHandler) {
+ this.finallyHandler = finallyHandler;
+}
+
+FinallyHandlerCancelReaction.prototype._resultCancelled = function() {
+ checkCancel(this.finallyHandler);
+};
+
+function checkCancel(ctx, reason) {
+ if (ctx.cancelPromise != null) {
+ if (arguments.length > 1) {
+ ctx.cancelPromise._reject(reason);
+ } else {
+ ctx.cancelPromise._cancel();
+ }
+ ctx.cancelPromise = null;
+ return true;
+ }
+ return false;
+}
+
+function succeed() {
+ return finallyHandler.call(this, this.promise._target()._settledValue());
+}
+function fail(reason) {
+ if (checkCancel(this, reason)) return;
+ errorObj.e = reason;
+ return errorObj;
+}
+function finallyHandler(reasonOrValue) {
+ var promise = this.promise;
+ var handler = this.handler;
+
+ if (!this.called) {
+ this.called = true;
+ var ret = this.isFinallyHandler()
+ ? handler.call(promise._boundValue())
+ : handler.call(promise._boundValue(), reasonOrValue);
+ if (ret !== undefined) {
+ promise._setReturnedNonUndefined();
+ var maybePromise = tryConvertToPromise(ret, promise);
+ if (maybePromise instanceof Promise) {
+ if (this.cancelPromise != null) {
+ if (maybePromise._isCancelled()) {
+ var reason =
+ new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ errorObj.e = reason;
+ return errorObj;
+ } else if (maybePromise.isPending()) {
+ maybePromise._attachCancellationCallback(
+ new FinallyHandlerCancelReaction(this));
+ }
+ }
+ return maybePromise._then(
+ succeed, fail, undefined, this, undefined);
+ }
+ }
+ }
+
+ if (promise.isRejected()) {
+ checkCancel(this);
+ errorObj.e = reasonOrValue;
+ return errorObj;
+ } else {
+ checkCancel(this);
+ return reasonOrValue;
+ }
+}
+
+Promise.prototype._passThrough = function(handler, type, success, fail) {
+ if (typeof handler !== "function") return this.then();
+ return this._then(success,
+ fail,
+ undefined,
+ new PassThroughHandlerContext(this, type, handler),
+ undefined);
+};
+
+Promise.prototype.lastly =
+Promise.prototype["finally"] = function (handler) {
+ return this._passThrough(handler,
+ 0,
+ finallyHandler,
+ finallyHandler);
+};
+
+Promise.prototype.tap = function (handler) {
+ return this._passThrough(handler, 1, finallyHandler);
+};
+
+return PassThroughHandlerContext;
+};
+
+},{"./util":36}],16:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise,
+ apiRejection,
+ INTERNAL,
+ tryConvertToPromise,
+ Proxyable,
+ debug) {
+var errors = _dereq_("./errors");
+var TypeError = errors.TypeError;
+var util = _dereq_("./util");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+var yieldHandlers = [];
+
+function promiseFromYieldHandler(value, yieldHandlers, traceParent) {
+ for (var i = 0; i < yieldHandlers.length; ++i) {
+ traceParent._pushContext();
+ var result = tryCatch(yieldHandlers[i])(value);
+ traceParent._popContext();
+ if (result === errorObj) {
+ traceParent._pushContext();
+ var ret = Promise.reject(errorObj.e);
+ traceParent._popContext();
+ return ret;
+ }
+ var maybePromise = tryConvertToPromise(result, traceParent);
+ if (maybePromise instanceof Promise) return maybePromise;
+ }
+ return null;
+}
+
+function PromiseSpawn(generatorFunction, receiver, yieldHandler, stack) {
+ if (debug.cancellation()) {
+ var internal = new Promise(INTERNAL);
+ var _finallyPromise = this._finallyPromise = new Promise(INTERNAL);
+ this._promise = internal.lastly(function() {
+ return _finallyPromise;
+ });
+ internal._captureStackTrace();
+ internal._setOnCancel(this);
+ } else {
+ var promise = this._promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ }
+ this._stack = stack;
+ this._generatorFunction = generatorFunction;
+ this._receiver = receiver;
+ this._generator = undefined;
+ this._yieldHandlers = typeof yieldHandler === "function"
+ ? [yieldHandler].concat(yieldHandlers)
+ : yieldHandlers;
+ this._yieldedPromise = null;
+ this._cancellationPhase = false;
+}
+util.inherits(PromiseSpawn, Proxyable);
+
+PromiseSpawn.prototype._isResolved = function() {
+ return this._promise === null;
+};
+
+PromiseSpawn.prototype._cleanup = function() {
+ this._promise = this._generator = null;
+ if (debug.cancellation() && this._finallyPromise !== null) {
+ this._finallyPromise._fulfill();
+ this._finallyPromise = null;
+ }
+};
+
+PromiseSpawn.prototype._promiseCancelled = function() {
+ if (this._isResolved()) return;
+ var implementsReturn = typeof this._generator["return"] !== "undefined";
+
+ var result;
+ if (!implementsReturn) {
+ var reason = new Promise.CancellationError(
+ "generator .return() sentinel");
+ Promise.coroutine.returnSentinel = reason;
+ this._promise._attachExtraTrace(reason);
+ this._promise._pushContext();
+ result = tryCatch(this._generator["throw"]).call(this._generator,
+ reason);
+ this._promise._popContext();
+ } else {
+ this._promise._pushContext();
+ result = tryCatch(this._generator["return"]).call(this._generator,
+ undefined);
+ this._promise._popContext();
+ }
+ this._cancellationPhase = true;
+ this._yieldedPromise = null;
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._promiseFulfilled = function(value) {
+ this._yieldedPromise = null;
+ this._promise._pushContext();
+ var result = tryCatch(this._generator.next).call(this._generator, value);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._promiseRejected = function(reason) {
+ this._yieldedPromise = null;
+ this._promise._attachExtraTrace(reason);
+ this._promise._pushContext();
+ var result = tryCatch(this._generator["throw"])
+ .call(this._generator, reason);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._resultCancelled = function() {
+ if (this._yieldedPromise instanceof Promise) {
+ var promise = this._yieldedPromise;
+ this._yieldedPromise = null;
+ promise.cancel();
+ }
+};
+
+PromiseSpawn.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseSpawn.prototype._run = function () {
+ this._generator = this._generatorFunction.call(this._receiver);
+ this._receiver =
+ this._generatorFunction = undefined;
+ this._promiseFulfilled(undefined);
+};
+
+PromiseSpawn.prototype._continue = function (result) {
+ var promise = this._promise;
+ if (result === errorObj) {
+ this._cleanup();
+ if (this._cancellationPhase) {
+ return promise.cancel();
+ } else {
+ return promise._rejectCallback(result.e, false);
+ }
+ }
+
+ var value = result.value;
+ if (result.done === true) {
+ this._cleanup();
+ if (this._cancellationPhase) {
+ return promise.cancel();
+ } else {
+ return promise._resolveCallback(value);
+ }
+ } else {
+ var maybePromise = tryConvertToPromise(value, this._promise);
+ if (!(maybePromise instanceof Promise)) {
+ maybePromise =
+ promiseFromYieldHandler(maybePromise,
+ this._yieldHandlers,
+ this._promise);
+ if (maybePromise === null) {
+ this._promiseRejected(
+ new TypeError(
+ "A value %s was yielded that could not be treated as a promise\u000a\u000a See http://goo.gl/MqrFmX\u000a\u000a".replace("%s", value) +
+ "From coroutine:\u000a" +
+ this._stack.split("\n").slice(1, -7).join("\n")
+ )
+ );
+ return;
+ }
+ }
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ this._yieldedPromise = maybePromise;
+ maybePromise._proxy(this, null);
+ } else if (((bitField & 33554432) !== 0)) {
+ Promise._async.invoke(
+ this._promiseFulfilled, this, maybePromise._value()
+ );
+ } else if (((bitField & 16777216) !== 0)) {
+ Promise._async.invoke(
+ this._promiseRejected, this, maybePromise._reason()
+ );
+ } else {
+ this._promiseCancelled();
+ }
+ }
+};
+
+Promise.coroutine = function (generatorFunction, options) {
+ if (typeof generatorFunction !== "function") {
+ throw new TypeError("generatorFunction must be a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var yieldHandler = Object(options).yieldHandler;
+ var PromiseSpawn$ = PromiseSpawn;
+ var stack = new Error().stack;
+ return function () {
+ var generator = generatorFunction.apply(this, arguments);
+ var spawn = new PromiseSpawn$(undefined, undefined, yieldHandler,
+ stack);
+ var ret = spawn.promise();
+ spawn._generator = generator;
+ spawn._promiseFulfilled(undefined);
+ return ret;
+ };
+};
+
+Promise.coroutine.addYieldHandler = function(fn) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ yieldHandlers.push(fn);
+};
+
+Promise.spawn = function (generatorFunction) {
+ debug.deprecated("Promise.spawn()", "Promise.coroutine()");
+ if (typeof generatorFunction !== "function") {
+ return apiRejection("generatorFunction must be a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var spawn = new PromiseSpawn(generatorFunction, this);
+ var ret = spawn.promise();
+ spawn._run(Promise.spawn);
+ return ret;
+};
+};
+
+},{"./errors":12,"./util":36}],17:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, PromiseArray, tryConvertToPromise, INTERNAL, async,
+ getDomain) {
+var util = _dereq_("./util");
+var canEvaluate = util.canEvaluate;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var reject;
+
+if (!true) {
+if (canEvaluate) {
+ var thenCallback = function(i) {
+ return new Function("value", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = value; \n\
+ holder.checkFulfillment(this); \n\
+ ".replace(/Index/g, i));
+ };
+
+ var promiseSetter = function(i) {
+ return new Function("promise", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = promise; \n\
+ ".replace(/Index/g, i));
+ };
+
+ var generateHolderClass = function(total) {
+ var props = new Array(total);
+ for (var i = 0; i < props.length; ++i) {
+ props[i] = "this.p" + (i+1);
+ }
+ var assignment = props.join(" = ") + " = null;";
+ var cancellationCode= "var promise;\n" + props.map(function(prop) {
+ return " \n\
+ promise = " + prop + "; \n\
+ if (promise instanceof Promise) { \n\
+ promise.cancel(); \n\
+ } \n\
+ ";
+ }).join("\n");
+ var passedArguments = props.join(", ");
+ var name = "Holder$" + total;
+
+
+ var code = "return function(tryCatch, errorObj, Promise, async) { \n\
+ 'use strict'; \n\
+ function [TheName](fn) { \n\
+ [TheProperties] \n\
+ this.fn = fn; \n\
+ this.asyncNeeded = true; \n\
+ this.now = 0; \n\
+ } \n\
+ \n\
+ [TheName].prototype._callFunction = function(promise) { \n\
+ promise._pushContext(); \n\
+ var ret = tryCatch(this.fn)([ThePassedArguments]); \n\
+ promise._popContext(); \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(ret.e, false); \n\
+ } else { \n\
+ promise._resolveCallback(ret); \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype.checkFulfillment = function(promise) { \n\
+ var now = ++this.now; \n\
+ if (now === [TheTotal]) { \n\
+ if (this.asyncNeeded) { \n\
+ async.invoke(this._callFunction, this, promise); \n\
+ } else { \n\
+ this._callFunction(promise); \n\
+ } \n\
+ \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype._resultCancelled = function() { \n\
+ [CancellationCode] \n\
+ }; \n\
+ \n\
+ return [TheName]; \n\
+ }(tryCatch, errorObj, Promise, async); \n\
+ ";
+
+ code = code.replace(/\[TheName\]/g, name)
+ .replace(/\[TheTotal\]/g, total)
+ .replace(/\[ThePassedArguments\]/g, passedArguments)
+ .replace(/\[TheProperties\]/g, assignment)
+ .replace(/\[CancellationCode\]/g, cancellationCode);
+
+ return new Function("tryCatch", "errorObj", "Promise", "async", code)
+ (tryCatch, errorObj, Promise, async);
+ };
+
+ var holderClasses = [];
+ var thenCallbacks = [];
+ var promiseSetters = [];
+
+ for (var i = 0; i < 8; ++i) {
+ holderClasses.push(generateHolderClass(i + 1));
+ thenCallbacks.push(thenCallback(i + 1));
+ promiseSetters.push(promiseSetter(i + 1));
+ }
+
+ reject = function (reason) {
+ this._reject(reason);
+ };
+}}
+
+Promise.join = function () {
+ var last = arguments.length - 1;
+ var fn;
+ if (last > 0 && typeof arguments[last] === "function") {
+ fn = arguments[last];
+ if (!true) {
+ if (last <= 8 && canEvaluate) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var HolderClass = holderClasses[last - 1];
+ var holder = new HolderClass(fn);
+ var callbacks = thenCallbacks;
+
+ for (var i = 0; i < last; ++i) {
+ var maybePromise = tryConvertToPromise(arguments[i], ret);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._then(callbacks[i], reject,
+ undefined, ret, holder);
+ promiseSetters[i](maybePromise, holder);
+ holder.asyncNeeded = false;
+ } else if (((bitField & 33554432) !== 0)) {
+ callbacks[i].call(ret,
+ maybePromise._value(), holder);
+ } else if (((bitField & 16777216) !== 0)) {
+ ret._reject(maybePromise._reason());
+ } else {
+ ret._cancel();
+ }
+ } else {
+ callbacks[i].call(ret, maybePromise, holder);
+ }
+ }
+
+ if (!ret._isFateSealed()) {
+ if (holder.asyncNeeded) {
+ var domain = getDomain();
+ if (domain !== null) {
+ holder.fn = util.domainBind(domain, holder.fn);
+ }
+ }
+ ret._setAsyncGuaranteed();
+ ret._setOnCancel(holder);
+ }
+ return ret;
+ }
+ }
+ }
+ var args = [].slice.call(arguments);;
+ if (fn) args.pop();
+ var ret = new PromiseArray(args).promise();
+ return fn !== undefined ? ret.spread(fn) : ret;
+};
+
+};
+
+},{"./util":36}],18:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL,
+ debug) {
+var getDomain = Promise._getDomain;
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var async = Promise._async;
+
+function MappingPromiseArray(promises, fn, limit, _filter) {
+ this.constructor$(promises);
+ this._promise._captureStackTrace();
+ var domain = getDomain();
+ this._callback = domain === null ? fn : util.domainBind(domain, fn);
+ this._preservedValues = _filter === INTERNAL
+ ? new Array(this.length())
+ : null;
+ this._limit = limit;
+ this._inFlight = 0;
+ this._queue = [];
+ async.invoke(this._asyncInit, this, undefined);
+}
+util.inherits(MappingPromiseArray, PromiseArray);
+
+MappingPromiseArray.prototype._asyncInit = function() {
+ this._init$(undefined, -2);
+};
+
+MappingPromiseArray.prototype._init = function () {};
+
+MappingPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var values = this._values;
+ var length = this.length();
+ var preservedValues = this._preservedValues;
+ var limit = this._limit;
+
+ if (index < 0) {
+ index = (index * -1) - 1;
+ values[index] = value;
+ if (limit >= 1) {
+ this._inFlight--;
+ this._drainQueue();
+ if (this._isResolved()) return true;
+ }
+ } else {
+ if (limit >= 1 && this._inFlight >= limit) {
+ values[index] = value;
+ this._queue.push(index);
+ return false;
+ }
+ if (preservedValues !== null) preservedValues[index] = value;
+
+ var promise = this._promise;
+ var callback = this._callback;
+ var receiver = promise._boundValue();
+ promise._pushContext();
+ var ret = tryCatch(callback).call(receiver, value, index, length);
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret,
+ promiseCreated,
+ preservedValues !== null ? "Promise.filter" : "Promise.map",
+ promise
+ );
+ if (ret === errorObj) {
+ this._reject(ret.e);
+ return true;
+ }
+
+ var maybePromise = tryConvertToPromise(ret, this._promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ if (limit >= 1) this._inFlight++;
+ values[index] = maybePromise;
+ maybePromise._proxy(this, (index + 1) * -1);
+ return false;
+ } else if (((bitField & 33554432) !== 0)) {
+ ret = maybePromise._value();
+ } else if (((bitField & 16777216) !== 0)) {
+ this._reject(maybePromise._reason());
+ return true;
+ } else {
+ this._cancel();
+ return true;
+ }
+ }
+ values[index] = ret;
+ }
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= length) {
+ if (preservedValues !== null) {
+ this._filter(values, preservedValues);
+ } else {
+ this._resolve(values);
+ }
+ return true;
+ }
+ return false;
+};
+
+MappingPromiseArray.prototype._drainQueue = function () {
+ var queue = this._queue;
+ var limit = this._limit;
+ var values = this._values;
+ while (queue.length > 0 && this._inFlight < limit) {
+ if (this._isResolved()) return;
+ var index = queue.pop();
+ this._promiseFulfilled(values[index], index);
+ }
+};
+
+MappingPromiseArray.prototype._filter = function (booleans, values) {
+ var len = values.length;
+ var ret = new Array(len);
+ var j = 0;
+ for (var i = 0; i < len; ++i) {
+ if (booleans[i]) ret[j++] = values[i];
+ }
+ ret.length = j;
+ this._resolve(ret);
+};
+
+MappingPromiseArray.prototype.preservedValues = function () {
+ return this._preservedValues;
+};
+
+function map(promises, fn, options, _filter) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+
+ var limit = 0;
+ if (options !== undefined) {
+ if (typeof options === "object" && options !== null) {
+ if (typeof options.concurrency !== "number") {
+ return Promise.reject(
+ new TypeError("'concurrency' must be a number but it is " +
+ util.classString(options.concurrency)));
+ }
+ limit = options.concurrency;
+ } else {
+ return Promise.reject(new TypeError(
+ "options argument must be an object but it is " +
+ util.classString(options)));
+ }
+ }
+ limit = typeof limit === "number" &&
+ isFinite(limit) && limit >= 1 ? limit : 0;
+ return new MappingPromiseArray(promises, fn, limit, _filter).promise();
+}
+
+Promise.prototype.map = function (fn, options) {
+ return map(this, fn, options, null);
+};
+
+Promise.map = function (promises, fn, options, _filter) {
+ return map(promises, fn, options, _filter);
+};
+
+
+};
+
+},{"./util":36}],19:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, INTERNAL, tryConvertToPromise, apiRejection, debug) {
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+
+Promise.method = function (fn) {
+ if (typeof fn !== "function") {
+ throw new Promise.TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return function () {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value = tryCatch(fn).apply(this, arguments);
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.method", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+ };
+};
+
+Promise.attempt = Promise["try"] = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value;
+ if (arguments.length > 1) {
+ debug.deprecated("calling Promise.try with more than 1 argument");
+ var arg = arguments[1];
+ var ctx = arguments[2];
+ value = util.isArray(arg) ? tryCatch(fn).apply(ctx, arg)
+ : tryCatch(fn).call(ctx, arg);
+ } else {
+ value = tryCatch(fn)();
+ }
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.try", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+};
+
+Promise.prototype._resolveFromSyncValue = function (value) {
+ if (value === util.errorObj) {
+ this._rejectCallback(value.e, false);
+ } else {
+ this._resolveCallback(value, true);
+ }
+};
+};
+
+},{"./util":36}],20:[function(_dereq_,module,exports){
+"use strict";
+var util = _dereq_("./util");
+var maybeWrapAsError = util.maybeWrapAsError;
+var errors = _dereq_("./errors");
+var OperationalError = errors.OperationalError;
+var es5 = _dereq_("./es5");
+
+function isUntypedError(obj) {
+ return obj instanceof Error &&
+ es5.getPrototypeOf(obj) === Error.prototype;
+}
+
+var rErrorKey = /^(?:name|message|stack|cause)$/;
+function wrapAsOperationalError(obj) {
+ var ret;
+ if (isUntypedError(obj)) {
+ ret = new OperationalError(obj);
+ ret.name = obj.name;
+ ret.message = obj.message;
+ ret.stack = obj.stack;
+ var keys = es5.keys(obj);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (!rErrorKey.test(key)) {
+ ret[key] = obj[key];
+ }
+ }
+ return ret;
+ }
+ util.markAsOriginatingFromRejection(obj);
+ return obj;
+}
+
+function nodebackForPromise(promise, multiArgs) {
+ return function(err, value) {
+ if (promise === null) return;
+ if (err) {
+ var wrapped = wrapAsOperationalError(maybeWrapAsError(err));
+ promise._attachExtraTrace(wrapped);
+ promise._reject(wrapped);
+ } else if (!multiArgs) {
+ promise._fulfill(value);
+ } else {
+ var args = [].slice.call(arguments, 1);;
+ promise._fulfill(args);
+ }
+ promise = null;
+ };
+}
+
+module.exports = nodebackForPromise;
+
+},{"./errors":12,"./es5":13,"./util":36}],21:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+var util = _dereq_("./util");
+var async = Promise._async;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function spreadAdapter(val, nodeback) {
+ var promise = this;
+ if (!util.isArray(val)) return successAdapter.call(promise, val, nodeback);
+ var ret =
+ tryCatch(nodeback).apply(promise._boundValue(), [null].concat(val));
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+function successAdapter(val, nodeback) {
+ var promise = this;
+ var receiver = promise._boundValue();
+ var ret = val === undefined
+ ? tryCatch(nodeback).call(receiver, null)
+ : tryCatch(nodeback).call(receiver, null, val);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+function errorAdapter(reason, nodeback) {
+ var promise = this;
+ if (!reason) {
+ var newReason = new Error(reason + "");
+ newReason.cause = reason;
+ reason = newReason;
+ }
+ var ret = tryCatch(nodeback).call(promise._boundValue(), reason);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+Promise.prototype.asCallback = Promise.prototype.nodeify = function (nodeback,
+ options) {
+ if (typeof nodeback == "function") {
+ var adapter = successAdapter;
+ if (options !== undefined && Object(options).spread) {
+ adapter = spreadAdapter;
+ }
+ this._then(
+ adapter,
+ errorAdapter,
+ undefined,
+ this,
+ nodeback
+ );
+ }
+ return this;
+};
+};
+
+},{"./util":36}],22:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function() {
+var makeSelfResolutionError = function () {
+ return new TypeError("circular promise resolution chain\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var reflectHandler = function() {
+ return new Promise.PromiseInspection(this._target());
+};
+var apiRejection = function(msg) {
+ return Promise.reject(new TypeError(msg));
+};
+function Proxyable() {}
+var UNDEFINED_BINDING = {};
+var util = _dereq_("./util");
+
+var getDomain;
+if (util.isNode) {
+ getDomain = function() {
+ var ret = process.domain;
+ if (ret === undefined) ret = null;
+ return ret;
+ };
+} else {
+ getDomain = function() {
+ return null;
+ };
+}
+util.notEnumerableProp(Promise, "_getDomain", getDomain);
+
+var es5 = _dereq_("./es5");
+var Async = _dereq_("./async");
+var async = new Async();
+es5.defineProperty(Promise, "_async", {value: async});
+var errors = _dereq_("./errors");
+var TypeError = Promise.TypeError = errors.TypeError;
+Promise.RangeError = errors.RangeError;
+var CancellationError = Promise.CancellationError = errors.CancellationError;
+Promise.TimeoutError = errors.TimeoutError;
+Promise.OperationalError = errors.OperationalError;
+Promise.RejectionError = errors.OperationalError;
+Promise.AggregateError = errors.AggregateError;
+var INTERNAL = function(){};
+var APPLY = {};
+var NEXT_FILTER = {};
+var tryConvertToPromise = _dereq_("./thenables")(Promise, INTERNAL);
+var PromiseArray =
+ _dereq_("./promise_array")(Promise, INTERNAL,
+ tryConvertToPromise, apiRejection, Proxyable);
+var Context = _dereq_("./context")(Promise);
+ /*jshint unused:false*/
+var createContext = Context.create;
+var debug = _dereq_("./debuggability")(Promise, Context);
+var CapturedTrace = debug.CapturedTrace;
+var PassThroughHandlerContext =
+ _dereq_("./finally")(Promise, tryConvertToPromise);
+var catchFilter = _dereq_("./catch_filter")(NEXT_FILTER);
+var nodebackForPromise = _dereq_("./nodeback");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+function check(self, executor) {
+ if (typeof executor !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(executor));
+ }
+ if (self.constructor !== Promise) {
+ throw new TypeError("the promise constructor cannot be invoked directly\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+}
+
+function Promise(executor) {
+ this._bitField = 0;
+ this._fulfillmentHandler0 = undefined;
+ this._rejectionHandler0 = undefined;
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ if (executor !== INTERNAL) {
+ check(this, executor);
+ this._resolveFromExecutor(executor);
+ }
+ this._promiseCreated();
+ this._fireEvent("promiseCreated", this);
+}
+
+Promise.prototype.toString = function () {
+ return "[object Promise]";
+};
+
+Promise.prototype.caught = Promise.prototype["catch"] = function (fn) {
+ var len = arguments.length;
+ if (len > 1) {
+ var catchInstances = new Array(len - 1),
+ j = 0, i;
+ for (i = 0; i < len - 1; ++i) {
+ var item = arguments[i];
+ if (util.isObject(item)) {
+ catchInstances[j++] = item;
+ } else {
+ return apiRejection("expecting an object but got " +
+ "A catch statement predicate " + util.classString(item));
+ }
+ }
+ catchInstances.length = j;
+ fn = arguments[i];
+ return this.then(undefined, catchFilter(catchInstances, fn, this));
+ }
+ return this.then(undefined, fn);
+};
+
+Promise.prototype.reflect = function () {
+ return this._then(reflectHandler,
+ reflectHandler, undefined, this, undefined);
+};
+
+Promise.prototype.then = function (didFulfill, didReject) {
+ if (debug.warnings() && arguments.length > 0 &&
+ typeof didFulfill !== "function" &&
+ typeof didReject !== "function") {
+ var msg = ".then() only accepts functions but was passed: " +
+ util.classString(didFulfill);
+ if (arguments.length > 1) {
+ msg += ", " + util.classString(didReject);
+ }
+ this._warn(msg);
+ }
+ return this._then(didFulfill, didReject, undefined, undefined, undefined);
+};
+
+Promise.prototype.done = function (didFulfill, didReject) {
+ var promise =
+ this._then(didFulfill, didReject, undefined, undefined, undefined);
+ promise._setIsFinal();
+};
+
+Promise.prototype.spread = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ return this.all()._then(fn, undefined, undefined, APPLY, undefined);
+};
+
+Promise.prototype.toJSON = function () {
+ var ret = {
+ isFulfilled: false,
+ isRejected: false,
+ fulfillmentValue: undefined,
+ rejectionReason: undefined
+ };
+ if (this.isFulfilled()) {
+ ret.fulfillmentValue = this.value();
+ ret.isFulfilled = true;
+ } else if (this.isRejected()) {
+ ret.rejectionReason = this.reason();
+ ret.isRejected = true;
+ }
+ return ret;
+};
+
+Promise.prototype.all = function () {
+ if (arguments.length > 0) {
+ this._warn(".all() was passed arguments but it does not take any");
+ }
+ return new PromiseArray(this).promise();
+};
+
+Promise.prototype.error = function (fn) {
+ return this.caught(util.originatesFromRejection, fn);
+};
+
+Promise.getNewLibraryCopy = module.exports;
+
+Promise.is = function (val) {
+ return val instanceof Promise;
+};
+
+Promise.fromNode = Promise.fromCallback = function(fn) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var multiArgs = arguments.length > 1 ? !!Object(arguments[1]).multiArgs
+ : false;
+ var result = tryCatch(fn)(nodebackForPromise(ret, multiArgs));
+ if (result === errorObj) {
+ ret._rejectCallback(result.e, true);
+ }
+ if (!ret._isFateSealed()) ret._setAsyncGuaranteed();
+ return ret;
+};
+
+Promise.all = function (promises) {
+ return new PromiseArray(promises).promise();
+};
+
+Promise.cast = function (obj) {
+ var ret = tryConvertToPromise(obj);
+ if (!(ret instanceof Promise)) {
+ ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._setFulfilled();
+ ret._rejectionHandler0 = obj;
+ }
+ return ret;
+};
+
+Promise.resolve = Promise.fulfilled = Promise.cast;
+
+Promise.reject = Promise.rejected = function (reason) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._rejectCallback(reason, true);
+ return ret;
+};
+
+Promise.setScheduler = function(fn) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return async.setScheduler(fn);
+};
+
+Promise.prototype._then = function (
+ didFulfill,
+ didReject,
+ _, receiver,
+ internalData
+) {
+ var haveInternalData = internalData !== undefined;
+ var promise = haveInternalData ? internalData : new Promise(INTERNAL);
+ var target = this._target();
+ var bitField = target._bitField;
+
+ if (!haveInternalData) {
+ promise._propagateFrom(this, 3);
+ promise._captureStackTrace();
+ if (receiver === undefined &&
+ ((this._bitField & 2097152) !== 0)) {
+ if (!((bitField & 50397184) === 0)) {
+ receiver = this._boundValue();
+ } else {
+ receiver = target === this ? undefined : this._boundTo;
+ }
+ }
+ this._fireEvent("promiseChained", this, promise);
+ }
+
+ var domain = getDomain();
+ if (!((bitField & 50397184) === 0)) {
+ var handler, value, settler = target._settlePromiseCtx;
+ if (((bitField & 33554432) !== 0)) {
+ value = target._rejectionHandler0;
+ handler = didFulfill;
+ } else if (((bitField & 16777216) !== 0)) {
+ value = target._fulfillmentHandler0;
+ handler = didReject;
+ target._unsetRejectionIsUnhandled();
+ } else {
+ settler = target._settlePromiseLateCancellationObserver;
+ value = new CancellationError("late cancellation observer");
+ target._attachExtraTrace(value);
+ handler = didReject;
+ }
+
+ async.invoke(settler, target, {
+ handler: domain === null ? handler
+ : (typeof handler === "function" &&
+ util.domainBind(domain, handler)),
+ promise: promise,
+ receiver: receiver,
+ value: value
+ });
+ } else {
+ target._addCallbacks(didFulfill, didReject, promise, receiver, domain);
+ }
+
+ return promise;
+};
+
+Promise.prototype._length = function () {
+ return this._bitField & 65535;
+};
+
+Promise.prototype._isFateSealed = function () {
+ return (this._bitField & 117506048) !== 0;
+};
+
+Promise.prototype._isFollowing = function () {
+ return (this._bitField & 67108864) === 67108864;
+};
+
+Promise.prototype._setLength = function (len) {
+ this._bitField = (this._bitField & -65536) |
+ (len & 65535);
+};
+
+Promise.prototype._setFulfilled = function () {
+ this._bitField = this._bitField | 33554432;
+ this._fireEvent("promiseFulfilled", this);
+};
+
+Promise.prototype._setRejected = function () {
+ this._bitField = this._bitField | 16777216;
+ this._fireEvent("promiseRejected", this);
+};
+
+Promise.prototype._setFollowing = function () {
+ this._bitField = this._bitField | 67108864;
+ this._fireEvent("promiseResolved", this);
+};
+
+Promise.prototype._setIsFinal = function () {
+ this._bitField = this._bitField | 4194304;
+};
+
+Promise.prototype._isFinal = function () {
+ return (this._bitField & 4194304) > 0;
+};
+
+Promise.prototype._unsetCancelled = function() {
+ this._bitField = this._bitField & (~65536);
+};
+
+Promise.prototype._setCancelled = function() {
+ this._bitField = this._bitField | 65536;
+ this._fireEvent("promiseCancelled", this);
+};
+
+Promise.prototype._setWillBeCancelled = function() {
+ this._bitField = this._bitField | 8388608;
+};
+
+Promise.prototype._setAsyncGuaranteed = function() {
+ if (async.hasCustomScheduler()) return;
+ this._bitField = this._bitField | 134217728;
+};
+
+Promise.prototype._receiverAt = function (index) {
+ var ret = index === 0 ? this._receiver0 : this[
+ index * 4 - 4 + 3];
+ if (ret === UNDEFINED_BINDING) {
+ return undefined;
+ } else if (ret === undefined && this._isBound()) {
+ return this._boundValue();
+ }
+ return ret;
+};
+
+Promise.prototype._promiseAt = function (index) {
+ return this[
+ index * 4 - 4 + 2];
+};
+
+Promise.prototype._fulfillmentHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 0];
+};
+
+Promise.prototype._rejectionHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 1];
+};
+
+Promise.prototype._boundValue = function() {};
+
+Promise.prototype._migrateCallback0 = function (follower) {
+ var bitField = follower._bitField;
+ var fulfill = follower._fulfillmentHandler0;
+ var reject = follower._rejectionHandler0;
+ var promise = follower._promise0;
+ var receiver = follower._receiverAt(0);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._migrateCallbackAt = function (follower, index) {
+ var fulfill = follower._fulfillmentHandlerAt(index);
+ var reject = follower._rejectionHandlerAt(index);
+ var promise = follower._promiseAt(index);
+ var receiver = follower._receiverAt(index);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._addCallbacks = function (
+ fulfill,
+ reject,
+ promise,
+ receiver,
+ domain
+) {
+ var index = this._length();
+
+ if (index >= 65535 - 4) {
+ index = 0;
+ this._setLength(0);
+ }
+
+ if (index === 0) {
+ this._promise0 = promise;
+ this._receiver0 = receiver;
+ if (typeof fulfill === "function") {
+ this._fulfillmentHandler0 =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this._rejectionHandler0 =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ } else {
+ var base = index * 4 - 4;
+ this[base + 2] = promise;
+ this[base + 3] = receiver;
+ if (typeof fulfill === "function") {
+ this[base + 0] =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this[base + 1] =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ }
+ this._setLength(index + 1);
+ return index;
+};
+
+Promise.prototype._proxy = function (proxyable, arg) {
+ this._addCallbacks(undefined, undefined, arg, proxyable, null);
+};
+
+Promise.prototype._resolveCallback = function(value, shouldBind) {
+ if (((this._bitField & 117506048) !== 0)) return;
+ if (value === this)
+ return this._rejectCallback(makeSelfResolutionError(), false);
+ var maybePromise = tryConvertToPromise(value, this);
+ if (!(maybePromise instanceof Promise)) return this._fulfill(value);
+
+ if (shouldBind) this._propagateFrom(maybePromise, 2);
+
+ var promise = maybePromise._target();
+
+ if (promise === this) {
+ this._reject(makeSelfResolutionError());
+ return;
+ }
+
+ var bitField = promise._bitField;
+ if (((bitField & 50397184) === 0)) {
+ var len = this._length();
+ if (len > 0) promise._migrateCallback0(this);
+ for (var i = 1; i < len; ++i) {
+ promise._migrateCallbackAt(this, i);
+ }
+ this._setFollowing();
+ this._setLength(0);
+ this._setFollowee(promise);
+ } else if (((bitField & 33554432) !== 0)) {
+ this._fulfill(promise._value());
+ } else if (((bitField & 16777216) !== 0)) {
+ this._reject(promise._reason());
+ } else {
+ var reason = new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ this._reject(reason);
+ }
+};
+
+Promise.prototype._rejectCallback =
+function(reason, synchronous, ignoreNonErrorWarnings) {
+ var trace = util.ensureErrorObject(reason);
+ var hasStack = trace === reason;
+ if (!hasStack && !ignoreNonErrorWarnings && debug.warnings()) {
+ var message = "a promise was rejected with a non-error: " +
+ util.classString(reason);
+ this._warn(message, true);
+ }
+ this._attachExtraTrace(trace, synchronous ? hasStack : false);
+ this._reject(reason);
+};
+
+Promise.prototype._resolveFromExecutor = function (executor) {
+ var promise = this;
+ this._captureStackTrace();
+ this._pushContext();
+ var synchronous = true;
+ var r = this._execute(executor, function(value) {
+ promise._resolveCallback(value);
+ }, function (reason) {
+ promise._rejectCallback(reason, synchronous);
+ });
+ synchronous = false;
+ this._popContext();
+
+ if (r !== undefined) {
+ promise._rejectCallback(r, true);
+ }
+};
+
+Promise.prototype._settlePromiseFromHandler = function (
+ handler, receiver, value, promise
+) {
+ var bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+ promise._pushContext();
+ var x;
+ if (receiver === APPLY) {
+ if (!value || typeof value.length !== "number") {
+ x = errorObj;
+ x.e = new TypeError("cannot .spread() a non-array: " +
+ util.classString(value));
+ } else {
+ x = tryCatch(handler).apply(this._boundValue(), value);
+ }
+ } else {
+ x = tryCatch(handler).call(receiver, value);
+ }
+ var promiseCreated = promise._popContext();
+ bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+
+ if (x === NEXT_FILTER) {
+ promise._reject(value);
+ } else if (x === errorObj) {
+ promise._rejectCallback(x.e, false);
+ } else {
+ debug.checkForgottenReturns(x, promiseCreated, "", promise, this);
+ promise._resolveCallback(x);
+ }
+};
+
+Promise.prototype._target = function() {
+ var ret = this;
+ while (ret._isFollowing()) ret = ret._followee();
+ return ret;
+};
+
+Promise.prototype._followee = function() {
+ return this._rejectionHandler0;
+};
+
+Promise.prototype._setFollowee = function(promise) {
+ this._rejectionHandler0 = promise;
+};
+
+Promise.prototype._settlePromise = function(promise, handler, receiver, value) {
+ var isPromise = promise instanceof Promise;
+ var bitField = this._bitField;
+ var asyncGuaranteed = ((bitField & 134217728) !== 0);
+ if (((bitField & 65536) !== 0)) {
+ if (isPromise) promise._invokeInternalOnCancel();
+
+ if (receiver instanceof PassThroughHandlerContext &&
+ receiver.isFinallyHandler()) {
+ receiver.cancelPromise = promise;
+ if (tryCatch(handler).call(receiver, value) === errorObj) {
+ promise._reject(errorObj.e);
+ }
+ } else if (handler === reflectHandler) {
+ promise._fulfill(reflectHandler.call(receiver));
+ } else if (receiver instanceof Proxyable) {
+ receiver._promiseCancelled(promise);
+ } else if (isPromise || promise instanceof PromiseArray) {
+ promise._cancel();
+ } else {
+ receiver.cancel();
+ }
+ } else if (typeof handler === "function") {
+ if (!isPromise) {
+ handler.call(receiver, value, promise);
+ } else {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (receiver instanceof Proxyable) {
+ if (!receiver._isResolved()) {
+ if (((bitField & 33554432) !== 0)) {
+ receiver._promiseFulfilled(value, promise);
+ } else {
+ receiver._promiseRejected(value, promise);
+ }
+ }
+ } else if (isPromise) {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ if (((bitField & 33554432) !== 0)) {
+ promise._fulfill(value);
+ } else {
+ promise._reject(value);
+ }
+ }
+};
+
+Promise.prototype._settlePromiseLateCancellationObserver = function(ctx) {
+ var handler = ctx.handler;
+ var promise = ctx.promise;
+ var receiver = ctx.receiver;
+ var value = ctx.value;
+ if (typeof handler === "function") {
+ if (!(promise instanceof Promise)) {
+ handler.call(receiver, value, promise);
+ } else {
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (promise instanceof Promise) {
+ promise._reject(value);
+ }
+};
+
+Promise.prototype._settlePromiseCtx = function(ctx) {
+ this._settlePromise(ctx.promise, ctx.handler, ctx.receiver, ctx.value);
+};
+
+Promise.prototype._settlePromise0 = function(handler, value, bitField) {
+ var promise = this._promise0;
+ var receiver = this._receiverAt(0);
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ this._settlePromise(promise, handler, receiver, value);
+};
+
+Promise.prototype._clearCallbackDataAtIndex = function(index) {
+ var base = index * 4 - 4;
+ this[base + 2] =
+ this[base + 3] =
+ this[base + 0] =
+ this[base + 1] = undefined;
+};
+
+Promise.prototype._fulfill = function (value) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ if (value === this) {
+ var err = makeSelfResolutionError();
+ this._attachExtraTrace(err);
+ return this._reject(err);
+ }
+ this._setFulfilled();
+ this._rejectionHandler0 = value;
+
+ if ((bitField & 65535) > 0) {
+ if (((bitField & 134217728) !== 0)) {
+ this._settlePromises();
+ } else {
+ async.settlePromises(this);
+ }
+ }
+};
+
+Promise.prototype._reject = function (reason) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ this._setRejected();
+ this._fulfillmentHandler0 = reason;
+
+ if (this._isFinal()) {
+ return async.fatalError(reason, util.isNode);
+ }
+
+ if ((bitField & 65535) > 0) {
+ async.settlePromises(this);
+ } else {
+ this._ensurePossibleRejectionHandled();
+ }
+};
+
+Promise.prototype._fulfillPromises = function (len, value) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._fulfillmentHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, value);
+ }
+};
+
+Promise.prototype._rejectPromises = function (len, reason) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._rejectionHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, reason);
+ }
+};
+
+Promise.prototype._settlePromises = function () {
+ var bitField = this._bitField;
+ var len = (bitField & 65535);
+
+ if (len > 0) {
+ if (((bitField & 16842752) !== 0)) {
+ var reason = this._fulfillmentHandler0;
+ this._settlePromise0(this._rejectionHandler0, reason, bitField);
+ this._rejectPromises(len, reason);
+ } else {
+ var value = this._rejectionHandler0;
+ this._settlePromise0(this._fulfillmentHandler0, value, bitField);
+ this._fulfillPromises(len, value);
+ }
+ this._setLength(0);
+ }
+ this._clearCancellationData();
+};
+
+Promise.prototype._settledValue = function() {
+ var bitField = this._bitField;
+ if (((bitField & 33554432) !== 0)) {
+ return this._rejectionHandler0;
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._fulfillmentHandler0;
+ }
+};
+
+function deferResolve(v) {this.promise._resolveCallback(v);}
+function deferReject(v) {this.promise._rejectCallback(v, false);}
+
+Promise.defer = Promise.pending = function() {
+ debug.deprecated("Promise.defer", "new Promise");
+ var promise = new Promise(INTERNAL);
+ return {
+ promise: promise,
+ resolve: deferResolve,
+ reject: deferReject
+ };
+};
+
+util.notEnumerableProp(Promise,
+ "_makeSelfResolutionError",
+ makeSelfResolutionError);
+
+_dereq_("./method")(Promise, INTERNAL, tryConvertToPromise, apiRejection,
+ debug);
+_dereq_("./bind")(Promise, INTERNAL, tryConvertToPromise, debug);
+_dereq_("./cancel")(Promise, PromiseArray, apiRejection, debug);
+_dereq_("./direct_resolve")(Promise);
+_dereq_("./synchronous_inspection")(Promise);
+_dereq_("./join")(
+ Promise, PromiseArray, tryConvertToPromise, INTERNAL, async, getDomain);
+Promise.Promise = Promise;
+Promise.version = "3.4.7";
+_dereq_('./map.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL, debug);
+_dereq_('./call_get.js')(Promise);
+_dereq_('./using.js')(Promise, apiRejection, tryConvertToPromise, createContext, INTERNAL, debug);
+_dereq_('./timers.js')(Promise, INTERNAL, debug);
+_dereq_('./generators.js')(Promise, apiRejection, INTERNAL, tryConvertToPromise, Proxyable, debug);
+_dereq_('./nodeify.js')(Promise);
+_dereq_('./promisify.js')(Promise, INTERNAL);
+_dereq_('./props.js')(Promise, PromiseArray, tryConvertToPromise, apiRejection);
+_dereq_('./race.js')(Promise, INTERNAL, tryConvertToPromise, apiRejection);
+_dereq_('./reduce.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL, debug);
+_dereq_('./settle.js')(Promise, PromiseArray, debug);
+_dereq_('./some.js')(Promise, PromiseArray, apiRejection);
+_dereq_('./filter.js')(Promise, INTERNAL);
+_dereq_('./each.js')(Promise, INTERNAL);
+_dereq_('./any.js')(Promise);
+
+ util.toFastProperties(Promise);
+ util.toFastProperties(Promise.prototype);
+ function fillTypes(value) {
+ var p = new Promise(INTERNAL);
+ p._fulfillmentHandler0 = value;
+ p._rejectionHandler0 = value;
+ p._promise0 = value;
+ p._receiver0 = value;
+ }
+ // Complete slack tracking, opt out of field-type tracking and
+ // stabilize map
+ fillTypes({a: 1});
+ fillTypes({b: 2});
+ fillTypes({c: 3});
+ fillTypes(1);
+ fillTypes(function(){});
+ fillTypes(undefined);
+ fillTypes(false);
+ fillTypes(new Promise(INTERNAL));
+ debug.setBounds(Async.firstLineError, util.lastLineError);
+ return Promise;
+
+};
+
+},{"./any.js":1,"./async":2,"./bind":3,"./call_get.js":5,"./cancel":6,"./catch_filter":7,"./context":8,"./debuggability":9,"./direct_resolve":10,"./each.js":11,"./errors":12,"./es5":13,"./filter.js":14,"./finally":15,"./generators.js":16,"./join":17,"./map.js":18,"./method":19,"./nodeback":20,"./nodeify.js":21,"./promise_array":23,"./promisify.js":24,"./props.js":25,"./race.js":27,"./reduce.js":28,"./settle.js":30,"./some.js":31,"./synchronous_inspection":32,"./thenables":33,"./timers.js":34,"./using.js":35,"./util":36}],23:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise,
+ apiRejection, Proxyable) {
+var util = _dereq_("./util");
+var isArray = util.isArray;
+
+function toResolutionValue(val) {
+ switch(val) {
+ case -2: return [];
+ case -3: return {};
+ }
+}
+
+function PromiseArray(values) {
+ var promise = this._promise = new Promise(INTERNAL);
+ if (values instanceof Promise) {
+ promise._propagateFrom(values, 3);
+ }
+ promise._setOnCancel(this);
+ this._values = values;
+ this._length = 0;
+ this._totalResolved = 0;
+ this._init(undefined, -2);
+}
+util.inherits(PromiseArray, Proxyable);
+
+PromiseArray.prototype.length = function () {
+ return this._length;
+};
+
+PromiseArray.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseArray.prototype._init = function init(_, resolveValueIfEmpty) {
+ var values = tryConvertToPromise(this._values, this._promise);
+ if (values instanceof Promise) {
+ values = values._target();
+ var bitField = values._bitField;
+ ;
+ this._values = values;
+
+ if (((bitField & 50397184) === 0)) {
+ this._promise._setAsyncGuaranteed();
+ return values._then(
+ init,
+ this._reject,
+ undefined,
+ this,
+ resolveValueIfEmpty
+ );
+ } else if (((bitField & 33554432) !== 0)) {
+ values = values._value();
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._reject(values._reason());
+ } else {
+ return this._cancel();
+ }
+ }
+ values = util.asArray(values);
+ if (values === null) {
+ var err = apiRejection(
+ "expecting an array or an iterable object but got " + util.classString(values)).reason();
+ this._promise._rejectCallback(err, false);
+ return;
+ }
+
+ if (values.length === 0) {
+ if (resolveValueIfEmpty === -5) {
+ this._resolveEmptyArray();
+ }
+ else {
+ this._resolve(toResolutionValue(resolveValueIfEmpty));
+ }
+ return;
+ }
+ this._iterate(values);
+};
+
+PromiseArray.prototype._iterate = function(values) {
+ var len = this.getActualLength(values.length);
+ this._length = len;
+ this._values = this.shouldCopyValues() ? new Array(len) : this._values;
+ var result = this._promise;
+ var isResolved = false;
+ var bitField = null;
+ for (var i = 0; i < len; ++i) {
+ var maybePromise = tryConvertToPromise(values[i], result);
+
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ bitField = maybePromise._bitField;
+ } else {
+ bitField = null;
+ }
+
+ if (isResolved) {
+ if (bitField !== null) {
+ maybePromise.suppressUnhandledRejections();
+ }
+ } else if (bitField !== null) {
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._proxy(this, i);
+ this._values[i] = maybePromise;
+ } else if (((bitField & 33554432) !== 0)) {
+ isResolved = this._promiseFulfilled(maybePromise._value(), i);
+ } else if (((bitField & 16777216) !== 0)) {
+ isResolved = this._promiseRejected(maybePromise._reason(), i);
+ } else {
+ isResolved = this._promiseCancelled(i);
+ }
+ } else {
+ isResolved = this._promiseFulfilled(maybePromise, i);
+ }
+ }
+ if (!isResolved) result._setAsyncGuaranteed();
+};
+
+PromiseArray.prototype._isResolved = function () {
+ return this._values === null;
+};
+
+PromiseArray.prototype._resolve = function (value) {
+ this._values = null;
+ this._promise._fulfill(value);
+};
+
+PromiseArray.prototype._cancel = function() {
+ if (this._isResolved() || !this._promise._isCancellable()) return;
+ this._values = null;
+ this._promise._cancel();
+};
+
+PromiseArray.prototype._reject = function (reason) {
+ this._values = null;
+ this._promise._rejectCallback(reason, false);
+};
+
+PromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ return true;
+ }
+ return false;
+};
+
+PromiseArray.prototype._promiseCancelled = function() {
+ this._cancel();
+ return true;
+};
+
+PromiseArray.prototype._promiseRejected = function (reason) {
+ this._totalResolved++;
+ this._reject(reason);
+ return true;
+};
+
+PromiseArray.prototype._resultCancelled = function() {
+ if (this._isResolved()) return;
+ var values = this._values;
+ this._cancel();
+ if (values instanceof Promise) {
+ values.cancel();
+ } else {
+ for (var i = 0; i < values.length; ++i) {
+ if (values[i] instanceof Promise) {
+ values[i].cancel();
+ }
+ }
+ }
+};
+
+PromiseArray.prototype.shouldCopyValues = function () {
+ return true;
+};
+
+PromiseArray.prototype.getActualLength = function (len) {
+ return len;
+};
+
+return PromiseArray;
+};
+
+},{"./util":36}],24:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var THIS = {};
+var util = _dereq_("./util");
+var nodebackForPromise = _dereq_("./nodeback");
+var withAppended = util.withAppended;
+var maybeWrapAsError = util.maybeWrapAsError;
+var canEvaluate = util.canEvaluate;
+var TypeError = _dereq_("./errors").TypeError;
+var defaultSuffix = "Async";
+var defaultPromisified = {__isPromisified__: true};
+var noCopyProps = [
+ "arity", "length",
+ "name",
+ "arguments",
+ "caller",
+ "callee",
+ "prototype",
+ "__isPromisified__"
+];
+var noCopyPropsPattern = new RegExp("^(?:" + noCopyProps.join("|") + ")$");
+
+var defaultFilter = function(name) {
+ return util.isIdentifier(name) &&
+ name.charAt(0) !== "_" &&
+ name !== "constructor";
+};
+
+function propsFilter(key) {
+ return !noCopyPropsPattern.test(key);
+}
+
+function isPromisified(fn) {
+ try {
+ return fn.__isPromisified__ === true;
+ }
+ catch (e) {
+ return false;
+ }
+}
+
+function hasPromisified(obj, key, suffix) {
+ var val = util.getDataPropertyOrDefault(obj, key + suffix,
+ defaultPromisified);
+ return val ? isPromisified(val) : false;
+}
+function checkValid(ret, suffix, suffixRegexp) {
+ for (var i = 0; i < ret.length; i += 2) {
+ var key = ret[i];
+ if (suffixRegexp.test(key)) {
+ var keyWithoutAsyncSuffix = key.replace(suffixRegexp, "");
+ for (var j = 0; j < ret.length; j += 2) {
+ if (ret[j] === keyWithoutAsyncSuffix) {
+ throw new TypeError("Cannot promisify an API that has normal methods with '%s'-suffix\u000a\u000a See http://goo.gl/MqrFmX\u000a"
+ .replace("%s", suffix));
+ }
+ }
+ }
+ }
+}
+
+function promisifiableMethods(obj, suffix, suffixRegexp, filter) {
+ var keys = util.inheritedDataKeys(obj);
+ var ret = [];
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ var value = obj[key];
+ var passesDefaultFilter = filter === defaultFilter
+ ? true : defaultFilter(key, value, obj);
+ if (typeof value === "function" &&
+ !isPromisified(value) &&
+ !hasPromisified(obj, key, suffix) &&
+ filter(key, value, obj, passesDefaultFilter)) {
+ ret.push(key, value);
+ }
+ }
+ checkValid(ret, suffix, suffixRegexp);
+ return ret;
+}
+
+var escapeIdentRegex = function(str) {
+ return str.replace(/([$])/, "\\$");
+};
+
+var makeNodePromisifiedEval;
+if (!true) {
+var switchCaseArgumentOrder = function(likelyArgumentCount) {
+ var ret = [likelyArgumentCount];
+ var min = Math.max(0, likelyArgumentCount - 1 - 3);
+ for(var i = likelyArgumentCount - 1; i >= min; --i) {
+ ret.push(i);
+ }
+ for(var i = likelyArgumentCount + 1; i <= 3; ++i) {
+ ret.push(i);
+ }
+ return ret;
+};
+
+var argumentSequence = function(argumentCount) {
+ return util.filledRange(argumentCount, "_arg", "");
+};
+
+var parameterDeclaration = function(parameterCount) {
+ return util.filledRange(
+ Math.max(parameterCount, 3), "_arg", "");
+};
+
+var parameterCount = function(fn) {
+ if (typeof fn.length === "number") {
+ return Math.max(Math.min(fn.length, 1023 + 1), 0);
+ }
+ return 0;
+};
+
+makeNodePromisifiedEval =
+function(callback, receiver, originalName, fn, _, multiArgs) {
+ var newParameterCount = Math.max(0, parameterCount(fn) - 1);
+ var argumentOrder = switchCaseArgumentOrder(newParameterCount);
+ var shouldProxyThis = typeof callback === "string" || receiver === THIS;
+
+ function generateCallForArgumentCount(count) {
+ var args = argumentSequence(count).join(", ");
+ var comma = count > 0 ? ", " : "";
+ var ret;
+ if (shouldProxyThis) {
+ ret = "ret = callback.call(this, {{args}}, nodeback); break;\n";
+ } else {
+ ret = receiver === undefined
+ ? "ret = callback({{args}}, nodeback); break;\n"
+ : "ret = callback.call(receiver, {{args}}, nodeback); break;\n";
+ }
+ return ret.replace("{{args}}", args).replace(", ", comma);
+ }
+
+ function generateArgumentSwitchCase() {
+ var ret = "";
+ for (var i = 0; i < argumentOrder.length; ++i) {
+ ret += "case " + argumentOrder[i] +":" +
+ generateCallForArgumentCount(argumentOrder[i]);
+ }
+
+ ret += " \n\
+ default: \n\
+ var args = new Array(len + 1); \n\
+ var i = 0; \n\
+ for (var i = 0; i < len; ++i) { \n\
+ args[i] = arguments[i]; \n\
+ } \n\
+ args[i] = nodeback; \n\
+ [CodeForCall] \n\
+ break; \n\
+ ".replace("[CodeForCall]", (shouldProxyThis
+ ? "ret = callback.apply(this, args);\n"
+ : "ret = callback.apply(receiver, args);\n"));
+ return ret;
+ }
+
+ var getFunctionCode = typeof callback === "string"
+ ? ("this != null ? this['"+callback+"'] : fn")
+ : "fn";
+ var body = "'use strict'; \n\
+ var ret = function (Parameters) { \n\
+ 'use strict'; \n\
+ var len = arguments.length; \n\
+ var promise = new Promise(INTERNAL); \n\
+ promise._captureStackTrace(); \n\
+ var nodeback = nodebackForPromise(promise, " + multiArgs + "); \n\
+ var ret; \n\
+ var callback = tryCatch([GetFunctionCode]); \n\
+ switch(len) { \n\
+ [CodeForSwitchCase] \n\
+ } \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(maybeWrapAsError(ret.e), true, true);\n\
+ } \n\
+ if (!promise._isFateSealed()) promise._setAsyncGuaranteed(); \n\
+ return promise; \n\
+ }; \n\
+ notEnumerableProp(ret, '__isPromisified__', true); \n\
+ return ret; \n\
+ ".replace("[CodeForSwitchCase]", generateArgumentSwitchCase())
+ .replace("[GetFunctionCode]", getFunctionCode);
+ body = body.replace("Parameters", parameterDeclaration(newParameterCount));
+ return new Function("Promise",
+ "fn",
+ "receiver",
+ "withAppended",
+ "maybeWrapAsError",
+ "nodebackForPromise",
+ "tryCatch",
+ "errorObj",
+ "notEnumerableProp",
+ "INTERNAL",
+ body)(
+ Promise,
+ fn,
+ receiver,
+ withAppended,
+ maybeWrapAsError,
+ nodebackForPromise,
+ util.tryCatch,
+ util.errorObj,
+ util.notEnumerableProp,
+ INTERNAL);
+};
+}
+
+function makeNodePromisifiedClosure(callback, receiver, _, fn, __, multiArgs) {
+ var defaultThis = (function() {return this;})();
+ var method = callback;
+ if (typeof method === "string") {
+ callback = fn;
+ }
+ function promisified() {
+ var _receiver = receiver;
+ if (receiver === THIS) _receiver = this;
+ var promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ var cb = typeof method === "string" && this !== defaultThis
+ ? this[method] : callback;
+ var fn = nodebackForPromise(promise, multiArgs);
+ try {
+ cb.apply(_receiver, withAppended(arguments, fn));
+ } catch(e) {
+ promise._rejectCallback(maybeWrapAsError(e), true, true);
+ }
+ if (!promise._isFateSealed()) promise._setAsyncGuaranteed();
+ return promise;
+ }
+ util.notEnumerableProp(promisified, "__isPromisified__", true);
+ return promisified;
+}
+
+var makeNodePromisified = canEvaluate
+ ? makeNodePromisifiedEval
+ : makeNodePromisifiedClosure;
+
+function promisifyAll(obj, suffix, filter, promisifier, multiArgs) {
+ var suffixRegexp = new RegExp(escapeIdentRegex(suffix) + "$");
+ var methods =
+ promisifiableMethods(obj, suffix, suffixRegexp, filter);
+
+ for (var i = 0, len = methods.length; i < len; i+= 2) {
+ var key = methods[i];
+ var fn = methods[i+1];
+ var promisifiedKey = key + suffix;
+ if (promisifier === makeNodePromisified) {
+ obj[promisifiedKey] =
+ makeNodePromisified(key, THIS, key, fn, suffix, multiArgs);
+ } else {
+ var promisified = promisifier(fn, function() {
+ return makeNodePromisified(key, THIS, key,
+ fn, suffix, multiArgs);
+ });
+ util.notEnumerableProp(promisified, "__isPromisified__", true);
+ obj[promisifiedKey] = promisified;
+ }
+ }
+ util.toFastProperties(obj);
+ return obj;
+}
+
+function promisify(callback, receiver, multiArgs) {
+ return makeNodePromisified(callback, receiver, undefined,
+ callback, null, multiArgs);
+}
+
+Promise.promisify = function (fn, options) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ if (isPromisified(fn)) {
+ return fn;
+ }
+ options = Object(options);
+ var receiver = options.context === undefined ? THIS : options.context;
+ var multiArgs = !!options.multiArgs;
+ var ret = promisify(fn, receiver, multiArgs);
+ util.copyDescriptors(fn, ret, propsFilter);
+ return ret;
+};
+
+Promise.promisifyAll = function (target, options) {
+ if (typeof target !== "function" && typeof target !== "object") {
+ throw new TypeError("the target of promisifyAll must be an object or a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ options = Object(options);
+ var multiArgs = !!options.multiArgs;
+ var suffix = options.suffix;
+ if (typeof suffix !== "string") suffix = defaultSuffix;
+ var filter = options.filter;
+ if (typeof filter !== "function") filter = defaultFilter;
+ var promisifier = options.promisifier;
+ if (typeof promisifier !== "function") promisifier = makeNodePromisified;
+
+ if (!util.isIdentifier(suffix)) {
+ throw new RangeError("suffix must be a valid identifier\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+
+ var keys = util.inheritedDataKeys(target);
+ for (var i = 0; i < keys.length; ++i) {
+ var value = target[keys[i]];
+ if (keys[i] !== "constructor" &&
+ util.isClass(value)) {
+ promisifyAll(value.prototype, suffix, filter, promisifier,
+ multiArgs);
+ promisifyAll(value, suffix, filter, promisifier, multiArgs);
+ }
+ }
+
+ return promisifyAll(target, suffix, filter, promisifier, multiArgs);
+};
+};
+
+
+},{"./errors":12,"./nodeback":20,"./util":36}],25:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(
+ Promise, PromiseArray, tryConvertToPromise, apiRejection) {
+var util = _dereq_("./util");
+var isObject = util.isObject;
+var es5 = _dereq_("./es5");
+var Es6Map;
+if (typeof Map === "function") Es6Map = Map;
+
+var mapToEntries = (function() {
+ var index = 0;
+ var size = 0;
+
+ function extractEntry(value, key) {
+ this[index] = value;
+ this[index + size] = key;
+ index++;
+ }
+
+ return function mapToEntries(map) {
+ size = map.size;
+ index = 0;
+ var ret = new Array(map.size * 2);
+ map.forEach(extractEntry, ret);
+ return ret;
+ };
+})();
+
+var entriesToMap = function(entries) {
+ var ret = new Es6Map();
+ var length = entries.length / 2 | 0;
+ for (var i = 0; i < length; ++i) {
+ var key = entries[length + i];
+ var value = entries[i];
+ ret.set(key, value);
+ }
+ return ret;
+};
+
+function PropertiesPromiseArray(obj) {
+ var isMap = false;
+ var entries;
+ if (Es6Map !== undefined && obj instanceof Es6Map) {
+ entries = mapToEntries(obj);
+ isMap = true;
+ } else {
+ var keys = es5.keys(obj);
+ var len = keys.length;
+ entries = new Array(len * 2);
+ for (var i = 0; i < len; ++i) {
+ var key = keys[i];
+ entries[i] = obj[key];
+ entries[i + len] = key;
+ }
+ }
+ this.constructor$(entries);
+ this._isMap = isMap;
+ this._init$(undefined, -3);
+}
+util.inherits(PropertiesPromiseArray, PromiseArray);
+
+PropertiesPromiseArray.prototype._init = function () {};
+
+PropertiesPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ var val;
+ if (this._isMap) {
+ val = entriesToMap(this._values);
+ } else {
+ val = {};
+ var keyOffset = this.length();
+ for (var i = 0, len = this.length(); i < len; ++i) {
+ val[this._values[i + keyOffset]] = this._values[i];
+ }
+ }
+ this._resolve(val);
+ return true;
+ }
+ return false;
+};
+
+PropertiesPromiseArray.prototype.shouldCopyValues = function () {
+ return false;
+};
+
+PropertiesPromiseArray.prototype.getActualLength = function (len) {
+ return len >> 1;
+};
+
+function props(promises) {
+ var ret;
+ var castValue = tryConvertToPromise(promises);
+
+ if (!isObject(castValue)) {
+ return apiRejection("cannot await properties of a non-object\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ } else if (castValue instanceof Promise) {
+ ret = castValue._then(
+ Promise.props, undefined, undefined, undefined, undefined);
+ } else {
+ ret = new PropertiesPromiseArray(castValue).promise();
+ }
+
+ if (castValue instanceof Promise) {
+ ret._propagateFrom(castValue, 2);
+ }
+ return ret;
+}
+
+Promise.prototype.props = function () {
+ return props(this);
+};
+
+Promise.props = function (promises) {
+ return props(promises);
+};
+};
+
+},{"./es5":13,"./util":36}],26:[function(_dereq_,module,exports){
+"use strict";
+function arrayMove(src, srcIndex, dst, dstIndex, len) {
+ for (var j = 0; j < len; ++j) {
+ dst[j + dstIndex] = src[j + srcIndex];
+ src[j + srcIndex] = void 0;
+ }
+}
+
+function Queue(capacity) {
+ this._capacity = capacity;
+ this._length = 0;
+ this._front = 0;
+}
+
+Queue.prototype._willBeOverCapacity = function (size) {
+ return this._capacity < size;
+};
+
+Queue.prototype._pushOne = function (arg) {
+ var length = this.length();
+ this._checkCapacity(length + 1);
+ var i = (this._front + length) & (this._capacity - 1);
+ this[i] = arg;
+ this._length = length + 1;
+};
+
+Queue.prototype.push = function (fn, receiver, arg) {
+ var length = this.length() + 3;
+ if (this._willBeOverCapacity(length)) {
+ this._pushOne(fn);
+ this._pushOne(receiver);
+ this._pushOne(arg);
+ return;
+ }
+ var j = this._front + length - 3;
+ this._checkCapacity(length);
+ var wrapMask = this._capacity - 1;
+ this[(j + 0) & wrapMask] = fn;
+ this[(j + 1) & wrapMask] = receiver;
+ this[(j + 2) & wrapMask] = arg;
+ this._length = length;
+};
+
+Queue.prototype.shift = function () {
+ var front = this._front,
+ ret = this[front];
+
+ this[front] = undefined;
+ this._front = (front + 1) & (this._capacity - 1);
+ this._length--;
+ return ret;
+};
+
+Queue.prototype.length = function () {
+ return this._length;
+};
+
+Queue.prototype._checkCapacity = function (size) {
+ if (this._capacity < size) {
+ this._resizeTo(this._capacity << 1);
+ }
+};
+
+Queue.prototype._resizeTo = function (capacity) {
+ var oldCapacity = this._capacity;
+ this._capacity = capacity;
+ var front = this._front;
+ var length = this._length;
+ var moveItemsCount = (front + length) & (oldCapacity - 1);
+ arrayMove(this, 0, this, oldCapacity, moveItemsCount);
+};
+
+module.exports = Queue;
+
+},{}],27:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(
+ Promise, INTERNAL, tryConvertToPromise, apiRejection) {
+var util = _dereq_("./util");
+
+var raceLater = function (promise) {
+ return promise.then(function(array) {
+ return race(array, promise);
+ });
+};
+
+function race(promises, parent) {
+ var maybePromise = tryConvertToPromise(promises);
+
+ if (maybePromise instanceof Promise) {
+ return raceLater(maybePromise);
+ } else {
+ promises = util.asArray(promises);
+ if (promises === null)
+ return apiRejection("expecting an array or an iterable object but got " + util.classString(promises));
+ }
+
+ var ret = new Promise(INTERNAL);
+ if (parent !== undefined) {
+ ret._propagateFrom(parent, 3);
+ }
+ var fulfill = ret._fulfill;
+ var reject = ret._reject;
+ for (var i = 0, len = promises.length; i < len; ++i) {
+ var val = promises[i];
+
+ if (val === undefined && !(i in promises)) {
+ continue;
+ }
+
+ Promise.cast(val)._then(fulfill, reject, undefined, ret, null);
+ }
+ return ret;
+}
+
+Promise.race = function (promises) {
+ return race(promises, undefined);
+};
+
+Promise.prototype.race = function () {
+ return race(this, undefined);
+};
+
+};
+
+},{"./util":36}],28:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL,
+ debug) {
+var getDomain = Promise._getDomain;
+var util = _dereq_("./util");
+var tryCatch = util.tryCatch;
+
+function ReductionPromiseArray(promises, fn, initialValue, _each) {
+ this.constructor$(promises);
+ var domain = getDomain();
+ this._fn = domain === null ? fn : util.domainBind(domain, fn);
+ if (initialValue !== undefined) {
+ initialValue = Promise.resolve(initialValue);
+ initialValue._attachCancellationCallback(this);
+ }
+ this._initialValue = initialValue;
+ this._currentCancellable = null;
+ if(_each === INTERNAL) {
+ this._eachValues = Array(this._length);
+ } else if (_each === 0) {
+ this._eachValues = null;
+ } else {
+ this._eachValues = undefined;
+ }
+ this._promise._captureStackTrace();
+ this._init$(undefined, -5);
+}
+util.inherits(ReductionPromiseArray, PromiseArray);
+
+ReductionPromiseArray.prototype._gotAccum = function(accum) {
+ if (this._eachValues !== undefined &&
+ this._eachValues !== null &&
+ accum !== INTERNAL) {
+ this._eachValues.push(accum);
+ }
+};
+
+ReductionPromiseArray.prototype._eachComplete = function(value) {
+ if (this._eachValues !== null) {
+ this._eachValues.push(value);
+ }
+ return this._eachValues;
+};
+
+ReductionPromiseArray.prototype._init = function() {};
+
+ReductionPromiseArray.prototype._resolveEmptyArray = function() {
+ this._resolve(this._eachValues !== undefined ? this._eachValues
+ : this._initialValue);
+};
+
+ReductionPromiseArray.prototype.shouldCopyValues = function () {
+ return false;
+};
+
+ReductionPromiseArray.prototype._resolve = function(value) {
+ this._promise._resolveCallback(value);
+ this._values = null;
+};
+
+ReductionPromiseArray.prototype._resultCancelled = function(sender) {
+ if (sender === this._initialValue) return this._cancel();
+ if (this._isResolved()) return;
+ this._resultCancelled$();
+ if (this._currentCancellable instanceof Promise) {
+ this._currentCancellable.cancel();
+ }
+ if (this._initialValue instanceof Promise) {
+ this._initialValue.cancel();
+ }
+};
+
+ReductionPromiseArray.prototype._iterate = function (values) {
+ this._values = values;
+ var value;
+ var i;
+ var length = values.length;
+ if (this._initialValue !== undefined) {
+ value = this._initialValue;
+ i = 0;
+ } else {
+ value = Promise.resolve(values[0]);
+ i = 1;
+ }
+
+ this._currentCancellable = value;
+
+ if (!value.isRejected()) {
+ for (; i < length; ++i) {
+ var ctx = {
+ accum: null,
+ value: values[i],
+ index: i,
+ length: length,
+ array: this
+ };
+ value = value._then(gotAccum, undefined, undefined, ctx, undefined);
+ }
+ }
+
+ if (this._eachValues !== undefined) {
+ value = value
+ ._then(this._eachComplete, undefined, undefined, this, undefined);
+ }
+ value._then(completed, completed, undefined, value, this);
+};
+
+Promise.prototype.reduce = function (fn, initialValue) {
+ return reduce(this, fn, initialValue, null);
+};
+
+Promise.reduce = function (promises, fn, initialValue, _each) {
+ return reduce(promises, fn, initialValue, _each);
+};
+
+function completed(valueOrReason, array) {
+ if (this.isFulfilled()) {
+ array._resolve(valueOrReason);
+ } else {
+ array._reject(valueOrReason);
+ }
+}
+
+function reduce(promises, fn, initialValue, _each) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var array = new ReductionPromiseArray(promises, fn, initialValue, _each);
+ return array.promise();
+}
+
+function gotAccum(accum) {
+ this.accum = accum;
+ this.array._gotAccum(accum);
+ var value = tryConvertToPromise(this.value, this.array._promise);
+ if (value instanceof Promise) {
+ this.array._currentCancellable = value;
+ return value._then(gotValue, undefined, undefined, this, undefined);
+ } else {
+ return gotValue.call(this, value);
+ }
+}
+
+function gotValue(value) {
+ var array = this.array;
+ var promise = array._promise;
+ var fn = tryCatch(array._fn);
+ promise._pushContext();
+ var ret;
+ if (array._eachValues !== undefined) {
+ ret = fn.call(promise._boundValue(), value, this.index, this.length);
+ } else {
+ ret = fn.call(promise._boundValue(),
+ this.accum, value, this.index, this.length);
+ }
+ if (ret instanceof Promise) {
+ array._currentCancellable = ret;
+ }
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret,
+ promiseCreated,
+ array._eachValues !== undefined ? "Promise.each" : "Promise.reduce",
+ promise
+ );
+ return ret;
+}
+};
+
+},{"./util":36}],29:[function(_dereq_,module,exports){
+"use strict";
+var util = _dereq_("./util");
+var schedule;
+var noAsyncScheduler = function() {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var NativePromise = util.getNativePromise();
+if (util.isNode && typeof MutationObserver === "undefined") {
+ var GlobalSetImmediate = global.setImmediate;
+ var ProcessNextTick = process.nextTick;
+ schedule = util.isRecentNode
+ ? function(fn) { GlobalSetImmediate.call(global, fn); }
+ : function(fn) { ProcessNextTick.call(process, fn); };
+} else if (typeof NativePromise === "function" &&
+ typeof NativePromise.resolve === "function") {
+ var nativePromise = NativePromise.resolve();
+ schedule = function(fn) {
+ nativePromise.then(fn);
+ };
+} else if ((typeof MutationObserver !== "undefined") &&
+ !(typeof window !== "undefined" &&
+ window.navigator &&
+ (window.navigator.standalone || window.cordova))) {
+ schedule = (function() {
+ var div = document.createElement("div");
+ var opts = {attributes: true};
+ var toggleScheduled = false;
+ var div2 = document.createElement("div");
+ var o2 = new MutationObserver(function() {
+ div.classList.toggle("foo");
+ toggleScheduled = false;
+ });
+ o2.observe(div2, opts);
+
+ var scheduleToggle = function() {
+ if (toggleScheduled) return;
+ toggleScheduled = true;
+ div2.classList.toggle("foo");
+ };
+
+ return function schedule(fn) {
+ var o = new MutationObserver(function() {
+ o.disconnect();
+ fn();
+ });
+ o.observe(div, opts);
+ scheduleToggle();
+ };
+ })();
+} else if (typeof setImmediate !== "undefined") {
+ schedule = function (fn) {
+ setImmediate(fn);
+ };
+} else if (typeof setTimeout !== "undefined") {
+ schedule = function (fn) {
+ setTimeout(fn, 0);
+ };
+} else {
+ schedule = noAsyncScheduler;
+}
+module.exports = schedule;
+
+},{"./util":36}],30:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+ function(Promise, PromiseArray, debug) {
+var PromiseInspection = Promise.PromiseInspection;
+var util = _dereq_("./util");
+
+function SettledPromiseArray(values) {
+ this.constructor$(values);
+}
+util.inherits(SettledPromiseArray, PromiseArray);
+
+SettledPromiseArray.prototype._promiseResolved = function (index, inspection) {
+ this._values[index] = inspection;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ return true;
+ }
+ return false;
+};
+
+SettledPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 33554432;
+ ret._settledValueField = value;
+ return this._promiseResolved(index, ret);
+};
+SettledPromiseArray.prototype._promiseRejected = function (reason, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 16777216;
+ ret._settledValueField = reason;
+ return this._promiseResolved(index, ret);
+};
+
+Promise.settle = function (promises) {
+ debug.deprecated(".settle()", ".reflect()");
+ return new SettledPromiseArray(promises).promise();
+};
+
+Promise.prototype.settle = function () {
+ return Promise.settle(this);
+};
+};
+
+},{"./util":36}],31:[function(_dereq_,module,exports){
+"use strict";
+module.exports =
+function(Promise, PromiseArray, apiRejection) {
+var util = _dereq_("./util");
+var RangeError = _dereq_("./errors").RangeError;
+var AggregateError = _dereq_("./errors").AggregateError;
+var isArray = util.isArray;
+var CANCELLATION = {};
+
+
+function SomePromiseArray(values) {
+ this.constructor$(values);
+ this._howMany = 0;
+ this._unwrap = false;
+ this._initialized = false;
+}
+util.inherits(SomePromiseArray, PromiseArray);
+
+SomePromiseArray.prototype._init = function () {
+ if (!this._initialized) {
+ return;
+ }
+ if (this._howMany === 0) {
+ this._resolve([]);
+ return;
+ }
+ this._init$(undefined, -5);
+ var isArrayResolved = isArray(this._values);
+ if (!this._isResolved() &&
+ isArrayResolved &&
+ this._howMany > this._canPossiblyFulfill()) {
+ this._reject(this._getRangeError(this.length()));
+ }
+};
+
+SomePromiseArray.prototype.init = function () {
+ this._initialized = true;
+ this._init();
+};
+
+SomePromiseArray.prototype.setUnwrap = function () {
+ this._unwrap = true;
+};
+
+SomePromiseArray.prototype.howMany = function () {
+ return this._howMany;
+};
+
+SomePromiseArray.prototype.setHowMany = function (count) {
+ this._howMany = count;
+};
+
+SomePromiseArray.prototype._promiseFulfilled = function (value) {
+ this._addFulfilled(value);
+ if (this._fulfilled() === this.howMany()) {
+ this._values.length = this.howMany();
+ if (this.howMany() === 1 && this._unwrap) {
+ this._resolve(this._values[0]);
+ } else {
+ this._resolve(this._values);
+ }
+ return true;
+ }
+ return false;
+
+};
+SomePromiseArray.prototype._promiseRejected = function (reason) {
+ this._addRejected(reason);
+ return this._checkOutcome();
+};
+
+SomePromiseArray.prototype._promiseCancelled = function () {
+ if (this._values instanceof Promise || this._values == null) {
+ return this._cancel();
+ }
+ this._addRejected(CANCELLATION);
+ return this._checkOutcome();
+};
+
+SomePromiseArray.prototype._checkOutcome = function() {
+ if (this.howMany() > this._canPossiblyFulfill()) {
+ var e = new AggregateError();
+ for (var i = this.length(); i < this._values.length; ++i) {
+ if (this._values[i] !== CANCELLATION) {
+ e.push(this._values[i]);
+ }
+ }
+ if (e.length > 0) {
+ this._reject(e);
+ } else {
+ this._cancel();
+ }
+ return true;
+ }
+ return false;
+};
+
+SomePromiseArray.prototype._fulfilled = function () {
+ return this._totalResolved;
+};
+
+SomePromiseArray.prototype._rejected = function () {
+ return this._values.length - this.length();
+};
+
+SomePromiseArray.prototype._addRejected = function (reason) {
+ this._values.push(reason);
+};
+
+SomePromiseArray.prototype._addFulfilled = function (value) {
+ this._values[this._totalResolved++] = value;
+};
+
+SomePromiseArray.prototype._canPossiblyFulfill = function () {
+ return this.length() - this._rejected();
+};
+
+SomePromiseArray.prototype._getRangeError = function (count) {
+ var message = "Input array must contain at least " +
+ this._howMany + " items but contains only " + count + " items";
+ return new RangeError(message);
+};
+
+SomePromiseArray.prototype._resolveEmptyArray = function () {
+ this._reject(this._getRangeError(0));
+};
+
+function some(promises, howMany) {
+ if ((howMany | 0) !== howMany || howMany < 0) {
+ return apiRejection("expecting a positive integer\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var ret = new SomePromiseArray(promises);
+ var promise = ret.promise();
+ ret.setHowMany(howMany);
+ ret.init();
+ return promise;
+}
+
+Promise.some = function (promises, howMany) {
+ return some(promises, howMany);
+};
+
+Promise.prototype.some = function (howMany) {
+ return some(this, howMany);
+};
+
+Promise._SomePromiseArray = SomePromiseArray;
+};
+
+},{"./errors":12,"./util":36}],32:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise) {
+function PromiseInspection(promise) {
+ if (promise !== undefined) {
+ promise = promise._target();
+ this._bitField = promise._bitField;
+ this._settledValueField = promise._isFateSealed()
+ ? promise._settledValue() : undefined;
+ }
+ else {
+ this._bitField = 0;
+ this._settledValueField = undefined;
+ }
+}
+
+PromiseInspection.prototype._settledValue = function() {
+ return this._settledValueField;
+};
+
+var value = PromiseInspection.prototype.value = function () {
+ if (!this.isFulfilled()) {
+ throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var reason = PromiseInspection.prototype.error =
+PromiseInspection.prototype.reason = function () {
+ if (!this.isRejected()) {
+ throw new TypeError("cannot get rejection reason of a non-rejected promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var isFulfilled = PromiseInspection.prototype.isFulfilled = function() {
+ return (this._bitField & 33554432) !== 0;
+};
+
+var isRejected = PromiseInspection.prototype.isRejected = function () {
+ return (this._bitField & 16777216) !== 0;
+};
+
+var isPending = PromiseInspection.prototype.isPending = function () {
+ return (this._bitField & 50397184) === 0;
+};
+
+var isResolved = PromiseInspection.prototype.isResolved = function () {
+ return (this._bitField & 50331648) !== 0;
+};
+
+PromiseInspection.prototype.isCancelled = function() {
+ return (this._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.__isCancelled = function() {
+ return (this._bitField & 65536) === 65536;
+};
+
+Promise.prototype._isCancelled = function() {
+ return this._target().__isCancelled();
+};
+
+Promise.prototype.isCancelled = function() {
+ return (this._target()._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.isPending = function() {
+ return isPending.call(this._target());
+};
+
+Promise.prototype.isRejected = function() {
+ return isRejected.call(this._target());
+};
+
+Promise.prototype.isFulfilled = function() {
+ return isFulfilled.call(this._target());
+};
+
+Promise.prototype.isResolved = function() {
+ return isResolved.call(this._target());
+};
+
+Promise.prototype.value = function() {
+ return value.call(this._target());
+};
+
+Promise.prototype.reason = function() {
+ var target = this._target();
+ target._unsetRejectionIsUnhandled();
+ return reason.call(target);
+};
+
+Promise.prototype._value = function() {
+ return this._settledValue();
+};
+
+Promise.prototype._reason = function() {
+ this._unsetRejectionIsUnhandled();
+ return this._settledValue();
+};
+
+Promise.PromiseInspection = PromiseInspection;
+};
+
+},{}],33:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var util = _dereq_("./util");
+var errorObj = util.errorObj;
+var isObject = util.isObject;
+
+function tryConvertToPromise(obj, context) {
+ if (isObject(obj)) {
+ if (obj instanceof Promise) return obj;
+ var then = getThen(obj);
+ if (then === errorObj) {
+ if (context) context._pushContext();
+ var ret = Promise.reject(then.e);
+ if (context) context._popContext();
+ return ret;
+ } else if (typeof then === "function") {
+ if (isAnyBluebirdPromise(obj)) {
+ var ret = new Promise(INTERNAL);
+ obj._then(
+ ret._fulfill,
+ ret._reject,
+ undefined,
+ ret,
+ null
+ );
+ return ret;
+ }
+ return doThenable(obj, then, context);
+ }
+ }
+ return obj;
+}
+
+function doGetThen(obj) {
+ return obj.then;
+}
+
+function getThen(obj) {
+ try {
+ return doGetThen(obj);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+
+var hasProp = {}.hasOwnProperty;
+function isAnyBluebirdPromise(obj) {
+ try {
+ return hasProp.call(obj, "_promise0");
+ } catch (e) {
+ return false;
+ }
+}
+
+function doThenable(x, then, context) {
+ var promise = new Promise(INTERNAL);
+ var ret = promise;
+ if (context) context._pushContext();
+ promise._captureStackTrace();
+ if (context) context._popContext();
+ var synchronous = true;
+ var result = util.tryCatch(then).call(x, resolve, reject);
+ synchronous = false;
+
+ if (promise && result === errorObj) {
+ promise._rejectCallback(result.e, true, true);
+ promise = null;
+ }
+
+ function resolve(value) {
+ if (!promise) return;
+ promise._resolveCallback(value);
+ promise = null;
+ }
+
+ function reject(reason) {
+ if (!promise) return;
+ promise._rejectCallback(reason, synchronous, true);
+ promise = null;
+ }
+ return ret;
+}
+
+return tryConvertToPromise;
+};
+
+},{"./util":36}],34:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function(Promise, INTERNAL, debug) {
+var util = _dereq_("./util");
+var TimeoutError = Promise.TimeoutError;
+
+function HandleWrapper(handle) {
+ this.handle = handle;
+}
+
+HandleWrapper.prototype._resultCancelled = function() {
+ clearTimeout(this.handle);
+};
+
+var afterValue = function(value) { return delay(+this).thenReturn(value); };
+var delay = Promise.delay = function (ms, value) {
+ var ret;
+ var handle;
+ if (value !== undefined) {
+ ret = Promise.resolve(value)
+ ._then(afterValue, null, null, ms, undefined);
+ if (debug.cancellation() && value instanceof Promise) {
+ ret._setOnCancel(value);
+ }
+ } else {
+ ret = new Promise(INTERNAL);
+ handle = setTimeout(function() { ret._fulfill(); }, +ms);
+ if (debug.cancellation()) {
+ ret._setOnCancel(new HandleWrapper(handle));
+ }
+ ret._captureStackTrace();
+ }
+ ret._setAsyncGuaranteed();
+ return ret;
+};
+
+Promise.prototype.delay = function (ms) {
+ return delay(ms, this);
+};
+
+var afterTimeout = function (promise, message, parent) {
+ var err;
+ if (typeof message !== "string") {
+ if (message instanceof Error) {
+ err = message;
+ } else {
+ err = new TimeoutError("operation timed out");
+ }
+ } else {
+ err = new TimeoutError(message);
+ }
+ util.markAsOriginatingFromRejection(err);
+ promise._attachExtraTrace(err);
+ promise._reject(err);
+
+ if (parent != null) {
+ parent.cancel();
+ }
+};
+
+function successClear(value) {
+ clearTimeout(this.handle);
+ return value;
+}
+
+function failureClear(reason) {
+ clearTimeout(this.handle);
+ throw reason;
+}
+
+Promise.prototype.timeout = function (ms, message) {
+ ms = +ms;
+ var ret, parent;
+
+ var handleWrapper = new HandleWrapper(setTimeout(function timeoutTimeout() {
+ if (ret.isPending()) {
+ afterTimeout(ret, message, parent);
+ }
+ }, ms));
+
+ if (debug.cancellation()) {
+ parent = this.then();
+ ret = parent._then(successClear, failureClear,
+ undefined, handleWrapper, undefined);
+ ret._setOnCancel(handleWrapper);
+ } else {
+ ret = this._then(successClear, failureClear,
+ undefined, handleWrapper, undefined);
+ }
+
+ return ret;
+};
+
+};
+
+},{"./util":36}],35:[function(_dereq_,module,exports){
+"use strict";
+module.exports = function (Promise, apiRejection, tryConvertToPromise,
+ createContext, INTERNAL, debug) {
+ var util = _dereq_("./util");
+ var TypeError = _dereq_("./errors").TypeError;
+ var inherits = _dereq_("./util").inherits;
+ var errorObj = util.errorObj;
+ var tryCatch = util.tryCatch;
+ var NULL = {};
+
+ function thrower(e) {
+ setTimeout(function(){throw e;}, 0);
+ }
+
+ function castPreservingDisposable(thenable) {
+ var maybePromise = tryConvertToPromise(thenable);
+ if (maybePromise !== thenable &&
+ typeof thenable._isDisposable === "function" &&
+ typeof thenable._getDisposer === "function" &&
+ thenable._isDisposable()) {
+ maybePromise._setDisposable(thenable._getDisposer());
+ }
+ return maybePromise;
+ }
+ function dispose(resources, inspection) {
+ var i = 0;
+ var len = resources.length;
+ var ret = new Promise(INTERNAL);
+ function iterator() {
+ if (i >= len) return ret._fulfill();
+ var maybePromise = castPreservingDisposable(resources[i++]);
+ if (maybePromise instanceof Promise &&
+ maybePromise._isDisposable()) {
+ try {
+ maybePromise = tryConvertToPromise(
+ maybePromise._getDisposer().tryDispose(inspection),
+ resources.promise);
+ } catch (e) {
+ return thrower(e);
+ }
+ if (maybePromise instanceof Promise) {
+ return maybePromise._then(iterator, thrower,
+ null, null, null);
+ }
+ }
+ iterator();
+ }
+ iterator();
+ return ret;
+ }
+
+ function Disposer(data, promise, context) {
+ this._data = data;
+ this._promise = promise;
+ this._context = context;
+ }
+
+ Disposer.prototype.data = function () {
+ return this._data;
+ };
+
+ Disposer.prototype.promise = function () {
+ return this._promise;
+ };
+
+ Disposer.prototype.resource = function () {
+ if (this.promise().isFulfilled()) {
+ return this.promise().value();
+ }
+ return NULL;
+ };
+
+ Disposer.prototype.tryDispose = function(inspection) {
+ var resource = this.resource();
+ var context = this._context;
+ if (context !== undefined) context._pushContext();
+ var ret = resource !== NULL
+ ? this.doDispose(resource, inspection) : null;
+ if (context !== undefined) context._popContext();
+ this._promise._unsetDisposable();
+ this._data = null;
+ return ret;
+ };
+
+ Disposer.isDisposer = function (d) {
+ return (d != null &&
+ typeof d.resource === "function" &&
+ typeof d.tryDispose === "function");
+ };
+
+ function FunctionDisposer(fn, promise, context) {
+ this.constructor$(fn, promise, context);
+ }
+ inherits(FunctionDisposer, Disposer);
+
+ FunctionDisposer.prototype.doDispose = function (resource, inspection) {
+ var fn = this.data();
+ return fn.call(resource, resource, inspection);
+ };
+
+ function maybeUnwrapDisposer(value) {
+ if (Disposer.isDisposer(value)) {
+ this.resources[this.index]._setDisposable(value);
+ return value.promise();
+ }
+ return value;
+ }
+
+ function ResourceList(length) {
+ this.length = length;
+ this.promise = null;
+ this[length-1] = null;
+ }
+
+ ResourceList.prototype._resultCancelled = function() {
+ var len = this.length;
+ for (var i = 0; i < len; ++i) {
+ var item = this[i];
+ if (item instanceof Promise) {
+ item.cancel();
+ }
+ }
+ };
+
+ Promise.using = function () {
+ var len = arguments.length;
+ if (len < 2) return apiRejection(
+ "you must pass at least 2 arguments to Promise.using");
+ var fn = arguments[len - 1];
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var input;
+ var spreadArgs = true;
+ if (len === 2 && Array.isArray(arguments[0])) {
+ input = arguments[0];
+ len = input.length;
+ spreadArgs = false;
+ } else {
+ input = arguments;
+ len--;
+ }
+ var resources = new ResourceList(len);
+ for (var i = 0; i < len; ++i) {
+ var resource = input[i];
+ if (Disposer.isDisposer(resource)) {
+ var disposer = resource;
+ resource = resource.promise();
+ resource._setDisposable(disposer);
+ } else {
+ var maybePromise = tryConvertToPromise(resource);
+ if (maybePromise instanceof Promise) {
+ resource =
+ maybePromise._then(maybeUnwrapDisposer, null, null, {
+ resources: resources,
+ index: i
+ }, undefined);
+ }
+ }
+ resources[i] = resource;
+ }
+
+ var reflectedResources = new Array(resources.length);
+ for (var i = 0; i < reflectedResources.length; ++i) {
+ reflectedResources[i] = Promise.resolve(resources[i]).reflect();
+ }
+
+ var resultPromise = Promise.all(reflectedResources)
+ .then(function(inspections) {
+ for (var i = 0; i < inspections.length; ++i) {
+ var inspection = inspections[i];
+ if (inspection.isRejected()) {
+ errorObj.e = inspection.error();
+ return errorObj;
+ } else if (!inspection.isFulfilled()) {
+ resultPromise.cancel();
+ return;
+ }
+ inspections[i] = inspection.value();
+ }
+ promise._pushContext();
+
+ fn = tryCatch(fn);
+ var ret = spreadArgs
+ ? fn.apply(undefined, inspections) : fn(inspections);
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret, promiseCreated, "Promise.using", promise);
+ return ret;
+ });
+
+ var promise = resultPromise.lastly(function() {
+ var inspection = new Promise.PromiseInspection(resultPromise);
+ return dispose(resources, inspection);
+ });
+ resources.promise = promise;
+ promise._setOnCancel(resources);
+ return promise;
+ };
+
+ Promise.prototype._setDisposable = function (disposer) {
+ this._bitField = this._bitField | 131072;
+ this._disposer = disposer;
+ };
+
+ Promise.prototype._isDisposable = function () {
+ return (this._bitField & 131072) > 0;
+ };
+
+ Promise.prototype._getDisposer = function () {
+ return this._disposer;
+ };
+
+ Promise.prototype._unsetDisposable = function () {
+ this._bitField = this._bitField & (~131072);
+ this._disposer = undefined;
+ };
+
+ Promise.prototype.disposer = function (fn) {
+ if (typeof fn === "function") {
+ return new FunctionDisposer(fn, this, createContext());
+ }
+ throw new TypeError();
+ };
+
+};
+
+},{"./errors":12,"./util":36}],36:[function(_dereq_,module,exports){
+"use strict";
+var es5 = _dereq_("./es5");
+var canEvaluate = typeof navigator == "undefined";
+
+var errorObj = {e: {}};
+var tryCatchTarget;
+var globalObject = typeof self !== "undefined" ? self :
+ typeof window !== "undefined" ? window :
+ typeof global !== "undefined" ? global :
+ this !== undefined ? this : null;
+
+function tryCatcher() {
+ try {
+ var target = tryCatchTarget;
+ tryCatchTarget = null;
+ return target.apply(this, arguments);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+function tryCatch(fn) {
+ tryCatchTarget = fn;
+ return tryCatcher;
+}
+
+var inherits = function(Child, Parent) {
+ var hasProp = {}.hasOwnProperty;
+
+ function T() {
+ this.constructor = Child;
+ this.constructor$ = Parent;
+ for (var propertyName in Parent.prototype) {
+ if (hasProp.call(Parent.prototype, propertyName) &&
+ propertyName.charAt(propertyName.length-1) !== "$"
+ ) {
+ this[propertyName + "$"] = Parent.prototype[propertyName];
+ }
+ }
+ }
+ T.prototype = Parent.prototype;
+ Child.prototype = new T();
+ return Child.prototype;
+};
+
+
+function isPrimitive(val) {
+ return val == null || val === true || val === false ||
+ typeof val === "string" || typeof val === "number";
+
+}
+
+function isObject(value) {
+ return typeof value === "function" ||
+ typeof value === "object" && value !== null;
+}
+
+function maybeWrapAsError(maybeError) {
+ if (!isPrimitive(maybeError)) return maybeError;
+
+ return new Error(safeToString(maybeError));
+}
+
+function withAppended(target, appendee) {
+ var len = target.length;
+ var ret = new Array(len + 1);
+ var i;
+ for (i = 0; i < len; ++i) {
+ ret[i] = target[i];
+ }
+ ret[i] = appendee;
+ return ret;
+}
+
+function getDataPropertyOrDefault(obj, key, defaultValue) {
+ if (es5.isES5) {
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+
+ if (desc != null) {
+ return desc.get == null && desc.set == null
+ ? desc.value
+ : defaultValue;
+ }
+ } else {
+ return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined;
+ }
+}
+
+function notEnumerableProp(obj, name, value) {
+ if (isPrimitive(obj)) return obj;
+ var descriptor = {
+ value: value,
+ configurable: true,
+ enumerable: false,
+ writable: true
+ };
+ es5.defineProperty(obj, name, descriptor);
+ return obj;
+}
+
+function thrower(r) {
+ throw r;
+}
+
+var inheritedDataKeys = (function() {
+ var excludedPrototypes = [
+ Array.prototype,
+ Object.prototype,
+ Function.prototype
+ ];
+
+ var isExcludedProto = function(val) {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (excludedPrototypes[i] === val) {
+ return true;
+ }
+ }
+ return false;
+ };
+
+ if (es5.isES5) {
+ var getKeys = Object.getOwnPropertyNames;
+ return function(obj) {
+ var ret = [];
+ var visitedKeys = Object.create(null);
+ while (obj != null && !isExcludedProto(obj)) {
+ var keys;
+ try {
+ keys = getKeys(obj);
+ } catch (e) {
+ return ret;
+ }
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (visitedKeys[key]) continue;
+ visitedKeys[key] = true;
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+ if (desc != null && desc.get == null && desc.set == null) {
+ ret.push(key);
+ }
+ }
+ obj = es5.getPrototypeOf(obj);
+ }
+ return ret;
+ };
+ } else {
+ var hasProp = {}.hasOwnProperty;
+ return function(obj) {
+ if (isExcludedProto(obj)) return [];
+ var ret = [];
+
+ /*jshint forin:false */
+ enumeration: for (var key in obj) {
+ if (hasProp.call(obj, key)) {
+ ret.push(key);
+ } else {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (hasProp.call(excludedPrototypes[i], key)) {
+ continue enumeration;
+ }
+ }
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+ }
+
+})();
+
+var thisAssignmentPattern = /this\s*\.\s*\S+\s*=/;
+function isClass(fn) {
+ try {
+ if (typeof fn === "function") {
+ var keys = es5.names(fn.prototype);
+
+ var hasMethods = es5.isES5 && keys.length > 1;
+ var hasMethodsOtherThanConstructor = keys.length > 0 &&
+ !(keys.length === 1 && keys[0] === "constructor");
+ var hasThisAssignmentAndStaticMethods =
+ thisAssignmentPattern.test(fn + "") && es5.names(fn).length > 0;
+
+ if (hasMethods || hasMethodsOtherThanConstructor ||
+ hasThisAssignmentAndStaticMethods) {
+ return true;
+ }
+ }
+ return false;
+ } catch (e) {
+ return false;
+ }
+}
+
+function toFastProperties(obj) {
+ /*jshint -W027,-W055,-W031*/
+ function FakeConstructor() {}
+ FakeConstructor.prototype = obj;
+ var l = 8;
+ while (l--) new FakeConstructor();
+ return obj;
+ eval(obj);
+}
+
+var rident = /^[a-z$_][a-z$_0-9]*$/i;
+function isIdentifier(str) {
+ return rident.test(str);
+}
+
+function filledRange(count, prefix, suffix) {
+ var ret = new Array(count);
+ for(var i = 0; i < count; ++i) {
+ ret[i] = prefix + i + suffix;
+ }
+ return ret;
+}
+
+function safeToString(obj) {
+ try {
+ return obj + "";
+ } catch (e) {
+ return "[no string representation]";
+ }
+}
+
+function isError(obj) {
+ return obj !== null &&
+ typeof obj === "object" &&
+ typeof obj.message === "string" &&
+ typeof obj.name === "string";
+}
+
+function markAsOriginatingFromRejection(e) {
+ try {
+ notEnumerableProp(e, "isOperational", true);
+ }
+ catch(ignore) {}
+}
+
+function originatesFromRejection(e) {
+ if (e == null) return false;
+ return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) ||
+ e["isOperational"] === true);
+}
+
+function canAttachTrace(obj) {
+ return isError(obj) && es5.propertyIsWritable(obj, "stack");
+}
+
+var ensureErrorObject = (function() {
+ if (!("stack" in new Error())) {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ try {throw new Error(safeToString(value));}
+ catch(err) {return err;}
+ };
+ } else {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ return new Error(safeToString(value));
+ };
+ }
+})();
+
+function classString(obj) {
+ return {}.toString.call(obj);
+}
+
+function copyDescriptors(from, to, filter) {
+ var keys = es5.names(from);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (filter(key)) {
+ try {
+ es5.defineProperty(to, key, es5.getDescriptor(from, key));
+ } catch (ignore) {}
+ }
+ }
+}
+
+var asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ }
+ return null;
+};
+
+if (typeof Symbol !== "undefined" && Symbol.iterator) {
+ var ArrayFrom = typeof Array.from === "function" ? function(v) {
+ return Array.from(v);
+ } : function(v) {
+ var ret = [];
+ var it = v[Symbol.iterator]();
+ var itResult;
+ while (!((itResult = it.next()).done)) {
+ ret.push(itResult.value);
+ }
+ return ret;
+ };
+
+ asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ } else if (v != null && typeof v[Symbol.iterator] === "function") {
+ return ArrayFrom(v);
+ }
+ return null;
+ };
+}
+
+var isNode = typeof process !== "undefined" &&
+ classString(process).toLowerCase() === "[object process]";
+
+var hasEnvVariables = typeof process !== "undefined" &&
+ typeof process.env !== "undefined";
+
+function env(key) {
+ return hasEnvVariables ? process.env[key] : undefined;
+}
+
+function getNativePromise() {
+ if (typeof Promise === "function") {
+ try {
+ var promise = new Promise(function(){});
+ if ({}.toString.call(promise) === "[object Promise]") {
+ return Promise;
+ }
+ } catch (e) {}
+ }
+}
+
+function domainBind(self, cb) {
+ return self.bind(cb);
+}
+
+var ret = {
+ isClass: isClass,
+ isIdentifier: isIdentifier,
+ inheritedDataKeys: inheritedDataKeys,
+ getDataPropertyOrDefault: getDataPropertyOrDefault,
+ thrower: thrower,
+ isArray: es5.isArray,
+ asArray: asArray,
+ notEnumerableProp: notEnumerableProp,
+ isPrimitive: isPrimitive,
+ isObject: isObject,
+ isError: isError,
+ canEvaluate: canEvaluate,
+ errorObj: errorObj,
+ tryCatch: tryCatch,
+ inherits: inherits,
+ withAppended: withAppended,
+ maybeWrapAsError: maybeWrapAsError,
+ toFastProperties: toFastProperties,
+ filledRange: filledRange,
+ toString: safeToString,
+ canAttachTrace: canAttachTrace,
+ ensureErrorObject: ensureErrorObject,
+ originatesFromRejection: originatesFromRejection,
+ markAsOriginatingFromRejection: markAsOriginatingFromRejection,
+ classString: classString,
+ copyDescriptors: copyDescriptors,
+ hasDevTools: typeof chrome !== "undefined" && chrome &&
+ typeof chrome.loadTimes === "function",
+ isNode: isNode,
+ hasEnvVariables: hasEnvVariables,
+ env: env,
+ global: globalObject,
+ getNativePromise: getNativePromise,
+ domainBind: domainBind
+};
+ret.isRecentNode = ret.isNode && (function() {
+ var version = process.versions.node.split(".").map(Number);
+ return (version[0] === 0 && version[1] > 10) || (version[0] > 0);
+})();
+
+if (ret.isNode) ret.toFastProperties(process);
+
+try {throw new Error(); } catch (e) {ret.lastLineError = e;}
+module.exports = ret;
+
+},{"./es5":13}]},{},[4])(4)
+}); ;if (typeof window !== 'undefined' && window !== null) { window.P = window.Promise; } else if (typeof self !== 'undefined' && self !== null) { self.P = self.Promise; }
\ No newline at end of file
diff --git a/website_quotation_template/node_modules/bluebird/js/browser/bluebird.min.js b/website_quotation_template/node_modules/bluebird/js/browser/bluebird.min.js
new file mode 100644
index 000000000..242bbfeca
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/browser/bluebird.min.js
@@ -0,0 +1,31 @@
+/* @preserve
+ * The MIT License (MIT)
+ *
+ * Copyright (c) 2013-2015 Petka Antonov
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in
+ * all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ * THE SOFTWARE.
+ *
+ */
+/**
+ * bluebird build version 3.4.7
+ * Features enabled: core, race, call_get, generators, map, nodeify, promisify, props, reduce, settle, some, using, timers, filter, any, each
+*/
+!function(t){if("object"==typeof exports&&"undefined"!=typeof module)module.exports=t();else if("function"==typeof define&&define.amd)define([],t);else{var e;"undefined"!=typeof window?e=window:"undefined"!=typeof global?e=global:"undefined"!=typeof self&&(e=self),e.Promise=t()}}(function(){var t,e,n;return function r(t,e,n){function i(s,a){if(!e[s]){if(!t[s]){var c="function"==typeof _dereq_&&_dereq_;if(!a&&c)return c(s,!0);if(o)return o(s,!0);var l=new Error("Cannot find module '"+s+"'");throw l.code="MODULE_NOT_FOUND",l}var u=e[s]={exports:{}};t[s][0].call(u.exports,function(e){var n=t[s][1][e];return i(n?n:e)},u,u.exports,r,t,e,n)}return e[s].exports}for(var o="function"==typeof _dereq_&&_dereq_,s=0;s0;){var e=t.shift();if("function"==typeof e){var n=t.shift(),r=t.shift();e.call(n,r)}else e._settlePromises()}},r.prototype._drainQueues=function(){this._drainQueue(this._normalQueue),this._reset(),this._haveDrainedQueues=!0,this._drainQueue(this._lateQueue)},r.prototype._queueTick=function(){this._isTickUsed||(this._isTickUsed=!0,this._schedule(this.drainQueues))},r.prototype._reset=function(){this._isTickUsed=!1},e.exports=r,e.exports.firstLineError=a},{"./queue":26,"./schedule":29,"./util":36}],3:[function(t,e,n){"use strict";e.exports=function(t,e,n,r){var i=!1,o=function(t,e){this._reject(e)},s=function(t,e){e.promiseRejectionQueued=!0,e.bindingPromise._then(o,o,null,this,t)},a=function(t,e){0===(50397184&this._bitField)&&this._resolveCallback(e.target)},c=function(t,e){e.promiseRejectionQueued||this._reject(t)};t.prototype.bind=function(o){i||(i=!0,t.prototype._propagateFrom=r.propagateFromFunction(),t.prototype._boundValue=r.boundValueFunction());var l=n(o),u=new t(e);u._propagateFrom(this,1);var p=this._target();if(u._setBoundTo(l),l instanceof t){var h={promiseRejectionQueued:!1,promise:u,target:p,bindingPromise:l};p._then(e,s,void 0,u,h),l._then(a,c,void 0,u,h),u._setOnCancel(l)}else u._resolveCallback(p);return u},t.prototype._setBoundTo=function(t){void 0!==t?(this._bitField=2097152|this._bitField,this._boundTo=t):this._bitField=-2097153&this._bitField},t.prototype._isBound=function(){return 2097152===(2097152&this._bitField)},t.bind=function(e,n){return t.resolve(n).bind(e)}}},{}],4:[function(t,e,n){"use strict";function r(){try{Promise===o&&(Promise=i)}catch(t){}return o}var i;"undefined"!=typeof Promise&&(i=Promise);var o=t("./promise")();o.noConflict=r,e.exports=o},{"./promise":22}],5:[function(t,e,n){"use strict";var r=Object.create;if(r){var i=r(null),o=r(null);i[" size"]=o[" size"]=0}e.exports=function(e){function n(t,n){var r;if(null!=t&&(r=t[n]),"function"!=typeof r){var i="Object "+a.classString(t)+" has no method '"+a.toString(n)+"'";throw new e.TypeError(i)}return r}function r(t){var e=this.pop(),r=n(t,e);return r.apply(t,this)}function i(t){return t[this]}function o(t){var e=+this;return 0>e&&(e=Math.max(0,e+t.length)),t[e]}var s,a=t("./util"),c=a.canEvaluate;a.isIdentifier;e.prototype.call=function(t){var e=[].slice.call(arguments,1);return e.push(t),this._then(r,void 0,void 0,e,void 0)},e.prototype.get=function(t){var e,n="number"==typeof t;if(n)e=o;else if(c){var r=s(t);e=null!==r?r:i}else e=i;return this._then(e,void 0,void 0,t,void 0)}}},{"./util":36}],6:[function(t,e,n){"use strict";e.exports=function(e,n,r,i){var o=t("./util"),s=o.tryCatch,a=o.errorObj,c=e._async;e.prototype["break"]=e.prototype.cancel=function(){if(!i.cancellation())return this._warn("cancellation is disabled");for(var t=this,e=t;t._isCancellable();){if(!t._cancelBy(e)){e._isFollowing()?e._followee().cancel():e._cancelBranched();break}var n=t._cancellationParent;if(null==n||!n._isCancellable()){t._isFollowing()?t._followee().cancel():t._cancelBranched();break}t._isFollowing()&&t._followee().cancel(),t._setWillBeCancelled(),e=t,t=n}},e.prototype._branchHasCancelled=function(){this._branchesRemainingToCancel--},e.prototype._enoughBranchesHaveCancelled=function(){return void 0===this._branchesRemainingToCancel||this._branchesRemainingToCancel<=0},e.prototype._cancelBy=function(t){return t===this?(this._branchesRemainingToCancel=0,this._invokeOnCancel(),!0):(this._branchHasCancelled(),this._enoughBranchesHaveCancelled()?(this._invokeOnCancel(),!0):!1)},e.prototype._cancelBranched=function(){this._enoughBranchesHaveCancelled()&&this._cancel()},e.prototype._cancel=function(){this._isCancellable()&&(this._setCancelled(),c.invoke(this._cancelPromises,this,void 0))},e.prototype._cancelPromises=function(){this._length()>0&&this._settlePromises()},e.prototype._unsetOnCancel=function(){this._onCancelField=void 0},e.prototype._isCancellable=function(){return this.isPending()&&!this._isCancelled()},e.prototype.isCancellable=function(){return this.isPending()&&!this.isCancelled()},e.prototype._doInvokeOnCancel=function(t,e){if(o.isArray(t))for(var n=0;n=0?o[t]:void 0}var i=!1,o=[];return t.prototype._promiseCreated=function(){},t.prototype._pushContext=function(){},t.prototype._popContext=function(){return null},t._peekContext=t.prototype._peekContext=function(){},e.prototype._pushContext=function(){void 0!==this._trace&&(this._trace._promiseCreated=null,o.push(this._trace))},e.prototype._popContext=function(){if(void 0!==this._trace){var t=o.pop(),e=t._promiseCreated;return t._promiseCreated=null,e}return null},e.CapturedTrace=null,e.create=n,e.deactivateLongStackTraces=function(){},e.activateLongStackTraces=function(){var n=t.prototype._pushContext,o=t.prototype._popContext,s=t._peekContext,a=t.prototype._peekContext,c=t.prototype._promiseCreated;e.deactivateLongStackTraces=function(){t.prototype._pushContext=n,t.prototype._popContext=o,t._peekContext=s,t.prototype._peekContext=a,t.prototype._promiseCreated=c,i=!1},i=!0,t.prototype._pushContext=e.prototype._pushContext,t.prototype._popContext=e.prototype._popContext,t._peekContext=t.prototype._peekContext=r,t.prototype._promiseCreated=function(){var t=this._peekContext();t&&null==t._promiseCreated&&(t._promiseCreated=this)}},e}},{}],9:[function(t,e,n){"use strict";e.exports=function(e,n){function r(t,e){return{promise:e}}function i(){return!1}function o(t,e,n){var r=this;try{t(e,n,function(t){if("function"!=typeof t)throw new TypeError("onCancel must be a function, got: "+H.toString(t));r._attachCancellationCallback(t)})}catch(i){return i}}function s(t){if(!this._isCancellable())return this;var e=this._onCancel();void 0!==e?H.isArray(e)?e.push(t):this._setOnCancel([e,t]):this._setOnCancel(t)}function a(){return this._onCancelField}function c(t){this._onCancelField=t}function l(){this._cancellationParent=void 0,this._onCancelField=void 0}function u(t,e){if(0!==(1&e)){this._cancellationParent=t;var n=t._branchesRemainingToCancel;void 0===n&&(n=0),t._branchesRemainingToCancel=n+1}0!==(2&e)&&t._isBound()&&this._setBoundTo(t._boundTo)}function p(t,e){0!==(2&e)&&t._isBound()&&this._setBoundTo(t._boundTo)}function h(){var t=this._boundTo;return void 0!==t&&t instanceof e?t.isFulfilled()?t.value():void 0:t}function f(){this._trace=new S(this._peekContext())}function _(t,e){if(N(t)){var n=this._trace;if(void 0!==n&&e&&(n=n._parent),void 0!==n)n.attachExtraTrace(t);else if(!t.__stackCleaned__){var r=j(t);H.notEnumerableProp(t,"stack",r.message+"\n"+r.stack.join("\n")),H.notEnumerableProp(t,"__stackCleaned__",!0)}}}function d(t,e,n,r,i){if(void 0===t&&null!==e&&W){if(void 0!==i&&i._returnedNonUndefined())return;if(0===(65535&r._bitField))return;n&&(n+=" ");var o="",s="";if(e._trace){for(var a=e._trace.stack.split("\n"),c=w(a),l=c.length-1;l>=0;--l){var u=c[l];if(!U.test(u)){var p=u.match(M);p&&(o="at "+p[1]+":"+p[2]+":"+p[3]+" ");break}}if(c.length>0)for(var h=c[0],l=0;l0&&(s="\n"+a[l-1]);break}}var f="a promise was created in a "+n+"handler "+o+"but was not returned from it, see http://goo.gl/rRqMUw"+s;r._warn(f,!0,e)}}function v(t,e){var n=t+" is deprecated and will be removed in a future version.";return e&&(n+=" Use "+e+" instead."),y(n)}function y(t,n,r){if(ot.warnings){var i,o=new L(t);if(n)r._attachExtraTrace(o);else if(ot.longStackTraces&&(i=e._peekContext()))i.attachExtraTrace(o);else{var s=j(o);o.stack=s.message+"\n"+s.stack.join("\n")}tt("warning",o)||E(o,"",!0)}}function m(t,e){for(var n=0;n=0;--a)if(r[a]===o){s=a;break}for(var a=s;a>=0;--a){var c=r[a];if(e[i]!==c)break;e.pop(),i--}e=r}}function w(t){for(var e=[],n=0;n0&&"SyntaxError"!=t.name&&(e=e.slice(n)),e}function j(t){var e=t.stack,n=t.toString();return e="string"==typeof e&&e.length>0?C(t):[" (No stack trace)"],{message:n,stack:"SyntaxError"==t.name?e:w(e)}}function E(t,e,n){if("undefined"!=typeof console){var r;if(H.isObject(t)){var i=t.stack;r=e+Q(i,t)}else r=e+String(t);"function"==typeof D?D(r,n):("function"==typeof console.log||"object"==typeof console.log)&&console.log(r)}}function k(t,e,n,r){var i=!1;try{"function"==typeof e&&(i=!0,"rejectionHandled"===t?e(r):e(n,r))}catch(o){I.throwLater(o)}"unhandledRejection"===t?tt(t,n,r)||i||E(n,"Unhandled rejection "):tt(t,r)}function F(t){var e;if("function"==typeof t)e="[function "+(t.name||"anonymous")+"]";else{e=t&&"function"==typeof t.toString?t.toString():H.toString(t);var n=/\[object [a-zA-Z0-9$_]+\]/;if(n.test(e))try{var r=JSON.stringify(t);e=r}catch(i){}0===e.length&&(e="(empty array)")}return"(<"+x(e)+">, no stack trace)"}function x(t){var e=41;return t.lengths||0>a||!n||!r||n!==r||s>=a||(nt=function(t){if(B.test(t))return!0;var e=P(t);return e&&e.fileName===n&&s<=e.line&&e.line<=a?!0:!1})}}function S(t){this._parent=t,this._promisesCreated=0;var e=this._length=1+(void 0===t?0:t._length);it(this,S),e>32&&this.uncycle()}var O,A,D,V=e._getDomain,I=e._async,L=t("./errors").Warning,H=t("./util"),N=H.canAttachTrace,B=/[\\\/]bluebird[\\\/]js[\\\/](release|debug|instrumented)/,U=/\((?:timers\.js):\d+:\d+\)/,M=/[\/<\(](.+?):(\d+):(\d+)\)?\s*$/,q=null,Q=null,$=!1,G=!(0==H.env("BLUEBIRD_DEBUG")||!H.env("BLUEBIRD_DEBUG")&&"development"!==H.env("NODE_ENV")),z=!(0==H.env("BLUEBIRD_WARNINGS")||!G&&!H.env("BLUEBIRD_WARNINGS")),X=!(0==H.env("BLUEBIRD_LONG_STACK_TRACES")||!G&&!H.env("BLUEBIRD_LONG_STACK_TRACES")),W=0!=H.env("BLUEBIRD_W_FORGOTTEN_RETURN")&&(z||!!H.env("BLUEBIRD_W_FORGOTTEN_RETURN"));e.prototype.suppressUnhandledRejections=function(){var t=this._target();t._bitField=-1048577&t._bitField|524288},e.prototype._ensurePossibleRejectionHandled=function(){0===(524288&this._bitField)&&(this._setRejectionIsUnhandled(),I.invokeLater(this._notifyUnhandledRejection,this,void 0))},e.prototype._notifyUnhandledRejectionIsHandled=function(){k("rejectionHandled",O,void 0,this)},e.prototype._setReturnedNonUndefined=function(){this._bitField=268435456|this._bitField},e.prototype._returnedNonUndefined=function(){return 0!==(268435456&this._bitField)},e.prototype._notifyUnhandledRejection=function(){if(this._isRejectionUnhandled()){var t=this._settledValue();this._setUnhandledRejectionIsNotified(),k("unhandledRejection",A,t,this)}},e.prototype._setUnhandledRejectionIsNotified=function(){this._bitField=262144|this._bitField},e.prototype._unsetUnhandledRejectionIsNotified=function(){this._bitField=-262145&this._bitField},e.prototype._isUnhandledRejectionNotified=function(){return(262144&this._bitField)>0},e.prototype._setRejectionIsUnhandled=function(){this._bitField=1048576|this._bitField},e.prototype._unsetRejectionIsUnhandled=function(){this._bitField=-1048577&this._bitField,this._isUnhandledRejectionNotified()&&(this._unsetUnhandledRejectionIsNotified(),this._notifyUnhandledRejectionIsHandled())},e.prototype._isRejectionUnhandled=function(){return(1048576&this._bitField)>0},e.prototype._warn=function(t,e,n){return y(t,e,n||this)},e.onPossiblyUnhandledRejection=function(t){var e=V();A="function"==typeof t?null===e?t:H.domainBind(e,t):void 0},e.onUnhandledRejectionHandled=function(t){var e=V();O="function"==typeof t?null===e?t:H.domainBind(e,t):void 0};var K=function(){};e.longStackTraces=function(){if(I.haveItemsQueued()&&!ot.longStackTraces)throw new Error("cannot enable long stack traces after promises have been created\n\n See http://goo.gl/MqrFmX\n");if(!ot.longStackTraces&&T()){var t=e.prototype._captureStackTrace,r=e.prototype._attachExtraTrace;ot.longStackTraces=!0,K=function(){if(I.haveItemsQueued()&&!ot.longStackTraces)throw new Error("cannot enable long stack traces after promises have been created\n\n See http://goo.gl/MqrFmX\n");e.prototype._captureStackTrace=t,e.prototype._attachExtraTrace=r,n.deactivateLongStackTraces(),I.enableTrampoline(),ot.longStackTraces=!1},e.prototype._captureStackTrace=f,e.prototype._attachExtraTrace=_,n.activateLongStackTraces(),I.disableTrampolineIfNecessary()}},e.hasLongStackTraces=function(){return ot.longStackTraces&&T()};var J=function(){try{if("function"==typeof CustomEvent){var t=new CustomEvent("CustomEvent");return H.global.dispatchEvent(t),function(t,e){var n=new CustomEvent(t.toLowerCase(),{detail:e,cancelable:!0});return!H.global.dispatchEvent(n)}}if("function"==typeof Event){var t=new Event("CustomEvent");return H.global.dispatchEvent(t),function(t,e){var n=new Event(t.toLowerCase(),{cancelable:!0});return n.detail=e,!H.global.dispatchEvent(n)}}var t=document.createEvent("CustomEvent");return t.initCustomEvent("testingtheevent",!1,!0,{}),H.global.dispatchEvent(t),function(t,e){var n=document.createEvent("CustomEvent");return n.initCustomEvent(t.toLowerCase(),!1,!0,e),!H.global.dispatchEvent(n)}}catch(e){}return function(){return!1}}(),Y=function(){return H.isNode?function(){return process.emit.apply(process,arguments)}:H.global?function(t){var e="on"+t.toLowerCase(),n=H.global[e];return n?(n.apply(H.global,[].slice.call(arguments,1)),!0):!1}:function(){return!1}}(),Z={promiseCreated:r,promiseFulfilled:r,promiseRejected:r,promiseResolved:r,promiseCancelled:r,promiseChained:function(t,e,n){return{promise:e,child:n}},warning:function(t,e){return{warning:e}},unhandledRejection:function(t,e,n){return{reason:e,promise:n}},rejectionHandled:r},tt=function(t){var e=!1;try{e=Y.apply(null,arguments)}catch(n){I.throwLater(n),e=!0}var r=!1;try{r=J(t,Z[t].apply(null,arguments))}catch(n){I.throwLater(n),r=!0}return r||e};e.config=function(t){if(t=Object(t),"longStackTraces"in t&&(t.longStackTraces?e.longStackTraces():!t.longStackTraces&&e.hasLongStackTraces()&&K()),"warnings"in t){var n=t.warnings;ot.warnings=!!n,W=ot.warnings,H.isObject(n)&&"wForgottenReturn"in n&&(W=!!n.wForgottenReturn)}if("cancellation"in t&&t.cancellation&&!ot.cancellation){if(I.haveItemsQueued())throw new Error("cannot enable cancellation after promises are in use");e.prototype._clearCancellationData=l,e.prototype._propagateFrom=u,e.prototype._onCancel=a,e.prototype._setOnCancel=c,e.prototype._attachCancellationCallback=s,e.prototype._execute=o,et=u,ot.cancellation=!0}return"monitoring"in t&&(t.monitoring&&!ot.monitoring?(ot.monitoring=!0,e.prototype._fireEvent=tt):!t.monitoring&&ot.monitoring&&(ot.monitoring=!1,e.prototype._fireEvent=i)),e},e.prototype._fireEvent=i,e.prototype._execute=function(t,e,n){try{t(e,n)}catch(r){return r}},e.prototype._onCancel=function(){},e.prototype._setOnCancel=function(t){},e.prototype._attachCancellationCallback=function(t){},e.prototype._captureStackTrace=function(){},e.prototype._attachExtraTrace=function(){},e.prototype._clearCancellationData=function(){},e.prototype._propagateFrom=function(t,e){};var et=p,nt=function(){return!1},rt=/[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;H.inherits(S,Error),n.CapturedTrace=S,S.prototype.uncycle=function(){var t=this._length;if(!(2>t)){for(var e=[],n={},r=0,i=this;void 0!==i;++r)e.push(i),i=i._parent;t=this._length=r;for(var r=t-1;r>=0;--r){var o=e[r].stack;void 0===n[o]&&(n[o]=r)}for(var r=0;t>r;++r){var s=e[r].stack,a=n[s];if(void 0!==a&&a!==r){a>0&&(e[a-1]._parent=void 0,e[a-1]._length=1),e[r]._parent=void 0,e[r]._length=1;var c=r>0?e[r-1]:this;t-1>a?(c._parent=e[a+1],c._parent.uncycle(),c._length=c._parent._length+1):(c._parent=void 0,c._length=1);for(var l=c._length+1,u=r-2;u>=0;--u)e[u]._length=l,l++;return}}}},S.prototype.attachExtraTrace=function(t){if(!t.__stackCleaned__){this.uncycle();for(var e=j(t),n=e.message,r=[e.stack],i=this;void 0!==i;)r.push(w(i.stack.split("\n"))),i=i._parent;b(r),g(r),H.notEnumerableProp(t,"stack",m(n,r)),H.notEnumerableProp(t,"__stackCleaned__",!0)}};var it=function(){var t=/^\s*at\s*/,e=function(t,e){return"string"==typeof t?t:void 0!==e.name&&void 0!==e.message?e.toString():F(e)};if("number"==typeof Error.stackTraceLimit&&"function"==typeof Error.captureStackTrace){Error.stackTraceLimit+=6,q=t,Q=e;var n=Error.captureStackTrace;return nt=function(t){return B.test(t)},function(t,e){Error.stackTraceLimit+=6,n(t,e),Error.stackTraceLimit-=6}}var r=new Error;if("string"==typeof r.stack&&r.stack.split("\n")[0].indexOf("stackDetection@")>=0)return q=/@/,Q=e,$=!0,function(t){t.stack=(new Error).stack};var i;try{throw new Error}catch(o){i="stack"in o}return"stack"in r||!i||"number"!=typeof Error.stackTraceLimit?(Q=function(t,e){return"string"==typeof t?t:"object"!=typeof e&&"function"!=typeof e||void 0===e.name||void 0===e.message?F(e):e.toString()},null):(q=t,Q=e,function(t){Error.stackTraceLimit+=6;try{throw new Error}catch(e){t.stack=e.stack}Error.stackTraceLimit-=6})}([]);"undefined"!=typeof console&&"undefined"!=typeof console.warn&&(D=function(t){console.warn(t)},H.isNode&&process.stderr.isTTY?D=function(t,e){var n=e?"[33m":"[31m";console.warn(n+t+"[0m\n")}:H.isNode||"string"!=typeof(new Error).stack||(D=function(t,e){console.warn("%c"+t,e?"color: darkorange":"color: red")}));var ot={warnings:z,longStackTraces:!1,cancellation:!1,monitoring:!1};return X&&e.longStackTraces(),{longStackTraces:function(){return ot.longStackTraces},warnings:function(){return ot.warnings},cancellation:function(){return ot.cancellation},monitoring:function(){return ot.monitoring},propagateFromFunction:function(){return et},boundValueFunction:function(){return h},checkForgottenReturns:d,setBounds:R,warn:y,deprecated:v,CapturedTrace:S,fireDomEvent:J,fireGlobalEvent:Y}}},{"./errors":12,"./util":36}],10:[function(t,e,n){"use strict";e.exports=function(t){function e(){return this.value}function n(){throw this.reason}t.prototype["return"]=t.prototype.thenReturn=function(n){return n instanceof t&&n.suppressUnhandledRejections(),this._then(e,void 0,void 0,{value:n},void 0)},t.prototype["throw"]=t.prototype.thenThrow=function(t){return this._then(n,void 0,void 0,{reason:t},void 0)},t.prototype.catchThrow=function(t){if(arguments.length<=1)return this._then(void 0,n,void 0,{reason:t},void 0);var e=arguments[1],r=function(){throw e};return this.caught(t,r)},t.prototype.catchReturn=function(n){if(arguments.length<=1)return n instanceof t&&n.suppressUnhandledRejections(),this._then(void 0,e,void 0,{value:n},void 0);var r=arguments[1];r instanceof t&&r.suppressUnhandledRejections();var i=function(){return r};return this.caught(n,i)}}},{}],11:[function(t,e,n){"use strict";e.exports=function(t,e){function n(){return o(this)}function r(t,n){return i(t,n,e,e)}var i=t.reduce,o=t.all;t.prototype.each=function(t){return i(this,t,e,0)._then(n,void 0,void 0,this,void 0)},t.prototype.mapSeries=function(t){return i(this,t,e,e)},t.each=function(t,r){return i(t,r,e,0)._then(n,void 0,void 0,t,void 0)},t.mapSeries=r}},{}],12:[function(t,e,n){"use strict";function r(t,e){function n(r){return this instanceof n?(p(this,"message","string"==typeof r?r:e),p(this,"name",t),void(Error.captureStackTrace?Error.captureStackTrace(this,this.constructor):Error.call(this))):new n(r)}return u(n,Error),n}function i(t){return this instanceof i?(p(this,"name","OperationalError"),p(this,"message",t),this.cause=t,this.isOperational=!0,void(t instanceof Error?(p(this,"message",t.message),p(this,"stack",t.stack)):Error.captureStackTrace&&Error.captureStackTrace(this,this.constructor))):new i(t)}var o,s,a=t("./es5"),c=a.freeze,l=t("./util"),u=l.inherits,p=l.notEnumerableProp,h=r("Warning","warning"),f=r("CancellationError","cancellation error"),_=r("TimeoutError","timeout error"),d=r("AggregateError","aggregate error");try{o=TypeError,s=RangeError}catch(v){o=r("TypeError","type error"),s=r("RangeError","range error")}for(var y="join pop push shift unshift slice filter forEach some every map indexOf lastIndexOf reduce reduceRight sort reverse".split(" "),m=0;m1?t.cancelPromise._reject(e):t.cancelPromise._cancel(),t.cancelPromise=null,!0):!1}function s(){return c.call(this,this.promise._target()._settledValue())}function a(t){return o(this,t)?void 0:(p.e=t,p)}function c(t){var r=this.promise,c=this.handler;if(!this.called){this.called=!0;var l=this.isFinallyHandler()?c.call(r._boundValue()):c.call(r._boundValue(),t);if(void 0!==l){r._setReturnedNonUndefined();var h=n(l,r);if(h instanceof e){if(null!=this.cancelPromise){if(h._isCancelled()){var f=new u("late cancellation observer");return r._attachExtraTrace(f),p.e=f,p}h.isPending()&&h._attachCancellationCallback(new i(this))}return h._then(s,a,void 0,this,void 0)}}}return r.isRejected()?(o(this),p.e=t,p):(o(this),t)}var l=t("./util"),u=e.CancellationError,p=l.errorObj;return r.prototype.isFinallyHandler=function(){return 0===this.type},i.prototype._resultCancelled=function(){o(this.finallyHandler)},e.prototype._passThrough=function(t,e,n,i){return"function"!=typeof t?this.then():this._then(n,i,void 0,new r(this,e,t),void 0)},e.prototype.lastly=e.prototype["finally"]=function(t){return this._passThrough(t,0,c,c)},e.prototype.tap=function(t){return this._passThrough(t,1,c)},r}},{"./util":36}],16:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o,s){function a(t,n,r){for(var o=0;o0&&"function"==typeof arguments[e]){t=arguments[e];var r}var i=[].slice.call(arguments);t&&i.pop();var r=new n(i).promise();return void 0!==t?r.spread(t):r}}},{"./util":36}],18:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o,s){function a(t,e,n,r){this.constructor$(t),this._promise._captureStackTrace();var i=l();this._callback=null===i?e:u.domainBind(i,e),this._preservedValues=r===o?new Array(this.length()):null,this._limit=n,this._inFlight=0,this._queue=[],f.invoke(this._asyncInit,this,void 0)}function c(t,n,i,o){if("function"!=typeof n)return r("expecting a function but got "+u.classString(n));var s=0;if(void 0!==i){if("object"!=typeof i||null===i)return e.reject(new TypeError("options argument must be an object but it is "+u.classString(i)));if("number"!=typeof i.concurrency)return e.reject(new TypeError("'concurrency' must be a number but it is "+u.classString(i.concurrency)));s=i.concurrency}return s="number"==typeof s&&isFinite(s)&&s>=1?s:0,new a(t,n,s,o).promise()}var l=e._getDomain,u=t("./util"),p=u.tryCatch,h=u.errorObj,f=e._async;u.inherits(a,n),a.prototype._asyncInit=function(){this._init$(void 0,-2)},a.prototype._init=function(){},a.prototype._promiseFulfilled=function(t,n){var r=this._values,o=this.length(),a=this._preservedValues,c=this._limit;if(0>n){if(n=-1*n-1,r[n]=t,c>=1&&(this._inFlight--,this._drainQueue(),this._isResolved()))return!0}else{if(c>=1&&this._inFlight>=c)return r[n]=t,this._queue.push(n),!1;null!==a&&(a[n]=t);var l=this._promise,u=this._callback,f=l._boundValue();l._pushContext();var _=p(u).call(f,t,n,o),d=l._popContext();if(s.checkForgottenReturns(_,d,null!==a?"Promise.filter":"Promise.map",l),_===h)return this._reject(_.e),!0;var v=i(_,this._promise);if(v instanceof e){v=v._target();var y=v._bitField;if(0===(50397184&y))return c>=1&&this._inFlight++,r[n]=v,v._proxy(this,-1*(n+1)),!1;if(0===(33554432&y))return 0!==(16777216&y)?(this._reject(v._reason()),!0):(this._cancel(),!0);_=v._value()}r[n]=_}var m=++this._totalResolved;return m>=o?(null!==a?this._filter(r,a):this._resolve(r),!0):!1},a.prototype._drainQueue=function(){for(var t=this._queue,e=this._limit,n=this._values;t.length>0&&this._inFlighto;++o)t[o]&&(r[i++]=e[o]);r.length=i,this._resolve(r)},a.prototype.preservedValues=function(){return this._preservedValues},e.prototype.map=function(t,e){return c(this,t,e,null)},e.map=function(t,e,n,r){return c(t,e,n,r)}}},{"./util":36}],19:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o){var s=t("./util"),a=s.tryCatch;e.method=function(t){if("function"!=typeof t)throw new e.TypeError("expecting a function but got "+s.classString(t));return function(){var r=new e(n);r._captureStackTrace(),r._pushContext();var i=a(t).apply(this,arguments),s=r._popContext();return o.checkForgottenReturns(i,s,"Promise.method",r),r._resolveFromSyncValue(i),r}},e.attempt=e["try"]=function(t){if("function"!=typeof t)return i("expecting a function but got "+s.classString(t));var r=new e(n);r._captureStackTrace(),r._pushContext();var c;if(arguments.length>1){o.deprecated("calling Promise.try with more than 1 argument");var l=arguments[1],u=arguments[2];c=s.isArray(l)?a(t).apply(u,l):a(t).call(u,l)}else c=a(t)();var p=r._popContext();return o.checkForgottenReturns(c,p,"Promise.try",r),r._resolveFromSyncValue(c),r},e.prototype._resolveFromSyncValue=function(t){t===s.errorObj?this._rejectCallback(t.e,!1):this._resolveCallback(t,!0)}}},{"./util":36}],20:[function(t,e,n){"use strict";function r(t){return t instanceof Error&&u.getPrototypeOf(t)===Error.prototype}function i(t){var e;if(r(t)){e=new l(t),e.name=t.name,e.message=t.message,e.stack=t.stack;for(var n=u.keys(t),i=0;i1){var n,r=new Array(e-1),i=0;for(n=0;e-1>n;++n){var o=arguments[n];if(!f.isObject(o))return p("expecting an object but got A catch statement predicate "+f.classString(o));r[i++]=o}return r.length=i,t=arguments[n],this.then(void 0,P(r,t,this))}return this.then(void 0,t)},i.prototype.reflect=function(){return this._then(u,u,void 0,this,void 0)},i.prototype.then=function(t,e){if(x.warnings()&&arguments.length>0&&"function"!=typeof t&&"function"!=typeof e){var n=".then() only accepts functions but was passed: "+f.classString(t);arguments.length>1&&(n+=", "+f.classString(e)),this._warn(n)}return this._then(t,e,void 0,void 0,void 0)},i.prototype.done=function(t,e){var n=this._then(t,e,void 0,void 0,void 0);n._setIsFinal()},i.prototype.spread=function(t){return"function"!=typeof t?p("expecting a function but got "+f.classString(t)):this.all()._then(t,void 0,void 0,w,void 0)},i.prototype.toJSON=function(){var t={isFulfilled:!1,isRejected:!1,fulfillmentValue:void 0,rejectionReason:void 0};return this.isFulfilled()?(t.fulfillmentValue=this.value(),t.isFulfilled=!0):this.isRejected()&&(t.rejectionReason=this.reason(),t.isRejected=!0),t},i.prototype.all=function(){return arguments.length>0&&this._warn(".all() was passed arguments but it does not take any"),new E(this).promise()},i.prototype.error=function(t){return this.caught(f.originatesFromRejection,t)},i.getNewLibraryCopy=e.exports,i.is=function(t){return t instanceof i},i.fromNode=i.fromCallback=function(t){var e=new i(b);e._captureStackTrace();var n=arguments.length>1?!!Object(arguments[1]).multiArgs:!1,r=O(t)(R(e,n));return r===S&&e._rejectCallback(r.e,!0),e._isFateSealed()||e._setAsyncGuaranteed(),e},i.all=function(t){return new E(t).promise()},i.cast=function(t){var e=j(t);return e instanceof i||(e=new i(b),e._captureStackTrace(),e._setFulfilled(),e._rejectionHandler0=t),e},i.resolve=i.fulfilled=i.cast,i.reject=i.rejected=function(t){var e=new i(b);return e._captureStackTrace(),e._rejectCallback(t,!0),e},i.setScheduler=function(t){if("function"!=typeof t)throw new m("expecting a function but got "+f.classString(t));return v.setScheduler(t)},i.prototype._then=function(t,e,n,r,o){var s=void 0!==o,a=s?o:new i(b),l=this._target(),u=l._bitField;s||(a._propagateFrom(this,3),a._captureStackTrace(),void 0===r&&0!==(2097152&this._bitField)&&(r=0!==(50397184&u)?this._boundValue():l===this?void 0:this._boundTo),this._fireEvent("promiseChained",this,a));var p=c();if(0!==(50397184&u)){var h,_,d=l._settlePromiseCtx;0!==(33554432&u)?(_=l._rejectionHandler0,h=t):0!==(16777216&u)?(_=l._fulfillmentHandler0,h=e,l._unsetRejectionIsUnhandled()):(d=l._settlePromiseLateCancellationObserver,_=new g("late cancellation observer"),l._attachExtraTrace(_),h=e),v.invoke(d,l,{handler:null===p?h:"function"==typeof h&&f.domainBind(p,h),promise:a,receiver:r,value:_})}else l._addCallbacks(t,e,a,r,p);return a},i.prototype._length=function(){return 65535&this._bitField},i.prototype._isFateSealed=function(){return 0!==(117506048&this._bitField)},i.prototype._isFollowing=function(){return 67108864===(67108864&this._bitField)},i.prototype._setLength=function(t){this._bitField=-65536&this._bitField|65535&t},i.prototype._setFulfilled=function(){this._bitField=33554432|this._bitField,this._fireEvent("promiseFulfilled",this)},i.prototype._setRejected=function(){this._bitField=16777216|this._bitField,this._fireEvent("promiseRejected",this)},i.prototype._setFollowing=function(){this._bitField=67108864|this._bitField,this._fireEvent("promiseResolved",this)},i.prototype._setIsFinal=function(){this._bitField=4194304|this._bitField},i.prototype._isFinal=function(){return(4194304&this._bitField)>0},i.prototype._unsetCancelled=function(){this._bitField=-65537&this._bitField},i.prototype._setCancelled=function(){this._bitField=65536|this._bitField,this._fireEvent("promiseCancelled",this)},i.prototype._setWillBeCancelled=function(){this._bitField=8388608|this._bitField},i.prototype._setAsyncGuaranteed=function(){v.hasCustomScheduler()||(this._bitField=134217728|this._bitField)},i.prototype._receiverAt=function(t){var e=0===t?this._receiver0:this[4*t-4+3];return e===h?void 0:void 0===e&&this._isBound()?this._boundValue():e},i.prototype._promiseAt=function(t){return this[4*t-4+2]},i.prototype._fulfillmentHandlerAt=function(t){return this[4*t-4+0]},i.prototype._rejectionHandlerAt=function(t){return this[4*t-4+1]},i.prototype._boundValue=function(){},i.prototype._migrateCallback0=function(t){var e=(t._bitField,t._fulfillmentHandler0),n=t._rejectionHandler0,r=t._promise0,i=t._receiverAt(0);void 0===i&&(i=h),this._addCallbacks(e,n,r,i,null)},i.prototype._migrateCallbackAt=function(t,e){var n=t._fulfillmentHandlerAt(e),r=t._rejectionHandlerAt(e),i=t._promiseAt(e),o=t._receiverAt(e);void 0===o&&(o=h),this._addCallbacks(n,r,i,o,null)},i.prototype._addCallbacks=function(t,e,n,r,i){var o=this._length();if(o>=65531&&(o=0,this._setLength(0)),0===o)this._promise0=n,this._receiver0=r,"function"==typeof t&&(this._fulfillmentHandler0=null===i?t:f.domainBind(i,t)),"function"==typeof e&&(this._rejectionHandler0=null===i?e:f.domainBind(i,e));else{var s=4*o-4;this[s+2]=n,this[s+3]=r,"function"==typeof t&&(this[s+0]=null===i?t:f.domainBind(i,t)),"function"==typeof e&&(this[s+1]=null===i?e:f.domainBind(i,e))}return this._setLength(o+1),o},i.prototype._proxy=function(t,e){this._addCallbacks(void 0,void 0,e,t,null)},i.prototype._resolveCallback=function(t,e){if(0===(117506048&this._bitField)){if(t===this)return this._rejectCallback(l(),!1);var n=j(t,this);if(!(n instanceof i))return this._fulfill(t);e&&this._propagateFrom(n,2);var r=n._target();if(r===this)return void this._reject(l());var o=r._bitField;if(0===(50397184&o)){var s=this._length();s>0&&r._migrateCallback0(this);for(var a=1;s>a;++a)r._migrateCallbackAt(this,a);this._setFollowing(),this._setLength(0),this._setFollowee(r)}else if(0!==(33554432&o))this._fulfill(r._value());else if(0!==(16777216&o))this._reject(r._reason());else{var c=new g("late cancellation observer");r._attachExtraTrace(c),this._reject(c)}}},i.prototype._rejectCallback=function(t,e,n){var r=f.ensureErrorObject(t),i=r===t;if(!i&&!n&&x.warnings()){var o="a promise was rejected with a non-error: "+f.classString(t);this._warn(o,!0)}this._attachExtraTrace(r,e?i:!1),this._reject(t)},i.prototype._resolveFromExecutor=function(t){var e=this;this._captureStackTrace(),this._pushContext();var n=!0,r=this._execute(t,function(t){e._resolveCallback(t)},function(t){e._rejectCallback(t,n)});n=!1,this._popContext(),void 0!==r&&e._rejectCallback(r,!0)},i.prototype._settlePromiseFromHandler=function(t,e,n,r){var i=r._bitField;if(0===(65536&i)){r._pushContext();var o;e===w?n&&"number"==typeof n.length?o=O(t).apply(this._boundValue(),n):(o=S,o.e=new m("cannot .spread() a non-array: "+f.classString(n))):o=O(t).call(e,n);var s=r._popContext();i=r._bitField,0===(65536&i)&&(o===C?r._reject(n):o===S?r._rejectCallback(o.e,!1):(x.checkForgottenReturns(o,s,"",r,this),r._resolveCallback(o)))}},i.prototype._target=function(){for(var t=this;t._isFollowing();)t=t._followee();return t},i.prototype._followee=function(){return this._rejectionHandler0},i.prototype._setFollowee=function(t){this._rejectionHandler0=t},i.prototype._settlePromise=function(t,e,r,o){var s=t instanceof i,a=this._bitField,c=0!==(134217728&a);0!==(65536&a)?(s&&t._invokeInternalOnCancel(),r instanceof T&&r.isFinallyHandler()?(r.cancelPromise=t,O(e).call(r,o)===S&&t._reject(S.e)):e===u?t._fulfill(u.call(r)):r instanceof n?r._promiseCancelled(t):s||t instanceof E?t._cancel():r.cancel()):"function"==typeof e?s?(c&&t._setAsyncGuaranteed(),this._settlePromiseFromHandler(e,r,o,t)):e.call(r,o,t):r instanceof n?r._isResolved()||(0!==(33554432&a)?r._promiseFulfilled(o,t):r._promiseRejected(o,t)):s&&(c&&t._setAsyncGuaranteed(),0!==(33554432&a)?t._fulfill(o):t._reject(o))},i.prototype._settlePromiseLateCancellationObserver=function(t){var e=t.handler,n=t.promise,r=t.receiver,o=t.value;"function"==typeof e?n instanceof i?this._settlePromiseFromHandler(e,r,o,n):e.call(r,o,n):n instanceof i&&n._reject(o)},i.prototype._settlePromiseCtx=function(t){this._settlePromise(t.promise,t.handler,t.receiver,t.value)},i.prototype._settlePromise0=function(t,e,n){var r=this._promise0,i=this._receiverAt(0);this._promise0=void 0,this._receiver0=void 0,this._settlePromise(r,t,i,e)},i.prototype._clearCallbackDataAtIndex=function(t){var e=4*t-4;this[e+2]=this[e+3]=this[e+0]=this[e+1]=void 0},i.prototype._fulfill=function(t){var e=this._bitField;if(!((117506048&e)>>>16)){if(t===this){var n=l();return this._attachExtraTrace(n),this._reject(n)}this._setFulfilled(),this._rejectionHandler0=t,(65535&e)>0&&(0!==(134217728&e)?this._settlePromises():v.settlePromises(this))}},i.prototype._reject=function(t){var e=this._bitField;if(!((117506048&e)>>>16))return this._setRejected(),this._fulfillmentHandler0=t,this._isFinal()?v.fatalError(t,f.isNode):void((65535&e)>0?v.settlePromises(this):this._ensurePossibleRejectionHandled())},i.prototype._fulfillPromises=function(t,e){for(var n=1;t>n;n++){var r=this._fulfillmentHandlerAt(n),i=this._promiseAt(n),o=this._receiverAt(n);this._clearCallbackDataAtIndex(n),this._settlePromise(i,r,o,e)}},i.prototype._rejectPromises=function(t,e){for(var n=1;t>n;n++){var r=this._rejectionHandlerAt(n),i=this._promiseAt(n),o=this._receiverAt(n);this._clearCallbackDataAtIndex(n),this._settlePromise(i,r,o,e)}},i.prototype._settlePromises=function(){var t=this._bitField,e=65535&t;if(e>0){if(0!==(16842752&t)){var n=this._fulfillmentHandler0;this._settlePromise0(this._rejectionHandler0,n,t),this._rejectPromises(e,n)}else{var r=this._rejectionHandler0;this._settlePromise0(this._fulfillmentHandler0,r,t),this._fulfillPromises(e,r)}this._setLength(0)}this._clearCancellationData()},i.prototype._settledValue=function(){var t=this._bitField;return 0!==(33554432&t)?this._rejectionHandler0:0!==(16777216&t)?this._fulfillmentHandler0:void 0},i.defer=i.pending=function(){x.deprecated("Promise.defer","new Promise");var t=new i(b);return{promise:t,resolve:o,reject:s}},f.notEnumerableProp(i,"_makeSelfResolutionError",l),t("./method")(i,b,j,p,x),t("./bind")(i,b,j,x),t("./cancel")(i,E,p,x),t("./direct_resolve")(i),t("./synchronous_inspection")(i),t("./join")(i,E,j,b,v,c),i.Promise=i,i.version="3.4.7",t("./map.js")(i,E,p,j,b,x),t("./call_get.js")(i),t("./using.js")(i,p,j,F,b,x),t("./timers.js")(i,b,x),t("./generators.js")(i,p,b,j,n,x),t("./nodeify.js")(i),t("./promisify.js")(i,b),t("./props.js")(i,E,j,p),t("./race.js")(i,b,j,p),t("./reduce.js")(i,E,p,j,b,x),t("./settle.js")(i,E,x),t("./some.js")(i,E,p),t("./filter.js")(i,b),t("./each.js")(i,b),t("./any.js")(i),f.toFastProperties(i),f.toFastProperties(i.prototype),a({a:1}),a({b:2}),a({c:3}),a(1),a(function(){}),a(void 0),a(!1),a(new i(b)),x.setBounds(d.firstLineError,f.lastLineError),i}},{"./any.js":1,"./async":2,"./bind":3,"./call_get.js":5,"./cancel":6,"./catch_filter":7,"./context":8,"./debuggability":9,"./direct_resolve":10,"./each.js":11,"./errors":12,"./es5":13,"./filter.js":14,"./finally":15,"./generators.js":16,"./join":17,"./map.js":18,"./method":19,"./nodeback":20,"./nodeify.js":21,"./promise_array":23,"./promisify.js":24,"./props.js":25,"./race.js":27,"./reduce.js":28,"./settle.js":30,"./some.js":31,"./synchronous_inspection":32,"./thenables":33,"./timers.js":34,"./using.js":35,"./util":36}],23:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o){function s(t){switch(t){case-2:return[];case-3:return{}}}function a(t){var r=this._promise=new e(n);t instanceof e&&r._propagateFrom(t,3),r._setOnCancel(this),this._values=t,this._length=0,this._totalResolved=0,this._init(void 0,-2)}var c=t("./util");c.isArray;return c.inherits(a,o),a.prototype.length=function(){return this._length},a.prototype.promise=function(){return this._promise},a.prototype._init=function l(t,n){var o=r(this._values,this._promise);if(o instanceof e){o=o._target();var a=o._bitField;if(this._values=o,0===(50397184&a))return this._promise._setAsyncGuaranteed(),o._then(l,this._reject,void 0,this,n);if(0===(33554432&a))return 0!==(16777216&a)?this._reject(o._reason()):this._cancel();o=o._value()}if(o=c.asArray(o),null===o){var u=i("expecting an array or an iterable object but got "+c.classString(o)).reason();return void this._promise._rejectCallback(u,!1)}return 0===o.length?void(-5===n?this._resolveEmptyArray():this._resolve(s(n))):void this._iterate(o)},a.prototype._iterate=function(t){var n=this.getActualLength(t.length);this._length=n,this._values=this.shouldCopyValues()?new Array(n):this._values;for(var i=this._promise,o=!1,s=null,a=0;n>a;++a){var c=r(t[a],i);c instanceof e?(c=c._target(),s=c._bitField):s=null,o?null!==s&&c.suppressUnhandledRejections():null!==s?0===(50397184&s)?(c._proxy(this,a),this._values[a]=c):o=0!==(33554432&s)?this._promiseFulfilled(c._value(),a):0!==(16777216&s)?this._promiseRejected(c._reason(),a):this._promiseCancelled(a):o=this._promiseFulfilled(c,a)}o||i._setAsyncGuaranteed()},a.prototype._isResolved=function(){return null===this._values},a.prototype._resolve=function(t){this._values=null,this._promise._fulfill(t)},a.prototype._cancel=function(){!this._isResolved()&&this._promise._isCancellable()&&(this._values=null,this._promise._cancel())},a.prototype._reject=function(t){this._values=null,this._promise._rejectCallback(t,!1)},a.prototype._promiseFulfilled=function(t,e){this._values[e]=t;var n=++this._totalResolved;return n>=this._length?(this._resolve(this._values),!0):!1},a.prototype._promiseCancelled=function(){return this._cancel(),!0},a.prototype._promiseRejected=function(t){return this._totalResolved++,this._reject(t),!0},a.prototype._resultCancelled=function(){if(!this._isResolved()){var t=this._values;if(this._cancel(),t instanceof e)t.cancel();else for(var n=0;nc;c+=2){var u=s[c],p=s[c+1],_=u+e;if(r===k)t[_]=k(u,h,u,p,e,i);else{var d=r(p,function(){return k(u,h,u,p,e,i)});f.notEnumerableProp(d,"__isPromisified__",!0),t[_]=d}}return f.toFastProperties(t),t}function u(t,e,n){return k(t,e,void 0,t,null,n)}var p,h={},f=t("./util"),_=t("./nodeback"),d=f.withAppended,v=f.maybeWrapAsError,y=f.canEvaluate,m=t("./errors").TypeError,g="Async",b={__isPromisified__:!0},w=["arity","length","name","arguments","caller","callee","prototype","__isPromisified__"],C=new RegExp("^(?:"+w.join("|")+")$"),j=function(t){return f.isIdentifier(t)&&"_"!==t.charAt(0)&&"constructor"!==t},E=function(t){return t.replace(/([$])/,"\\$")},k=y?p:c;e.promisify=function(t,e){if("function"!=typeof t)throw new m("expecting a function but got "+f.classString(t));if(i(t))return t;e=Object(e);var n=void 0===e.context?h:e.context,o=!!e.multiArgs,s=u(t,n,o);return f.copyDescriptors(t,s,r),s},e.promisifyAll=function(t,e){if("function"!=typeof t&&"object"!=typeof t)throw new m("the target of promisifyAll must be an object or a function\n\n See http://goo.gl/MqrFmX\n");e=Object(e);var n=!!e.multiArgs,r=e.suffix;"string"!=typeof r&&(r=g);var i=e.filter;"function"!=typeof i&&(i=j);var o=e.promisifier;if("function"!=typeof o&&(o=k),!f.isIdentifier(r))throw new RangeError("suffix must be a valid identifier\n\n See http://goo.gl/MqrFmX\n");for(var s=f.inheritedDataKeys(t),a=0;ao;++o){var s=r[o];e[o]=t[s],e[o+i]=s}}this.constructor$(e),this._isMap=n,this._init$(void 0,-3)}function s(t){var n,s=r(t);return l(s)?(n=s instanceof e?s._then(e.props,void 0,void 0,void 0,void 0):new o(s).promise(),s instanceof e&&n._propagateFrom(s,2),n):i("cannot await properties of a non-object\n\n See http://goo.gl/MqrFmX\n")}var a,c=t("./util"),l=c.isObject,u=t("./es5");"function"==typeof Map&&(a=Map);var p=function(){function t(t,r){this[e]=t,this[e+n]=r,e++}var e=0,n=0;return function(r){n=r.size,e=0;var i=new Array(2*r.size);return r.forEach(t,i),i}}(),h=function(t){for(var e=new a,n=t.length/2|0,r=0;n>r;++r){var i=t[n+r],o=t[r];e.set(i,o)}return e};c.inherits(o,n),o.prototype._init=function(){},o.prototype._promiseFulfilled=function(t,e){this._values[e]=t;var n=++this._totalResolved;if(n>=this._length){var r;if(this._isMap)r=h(this._values);else{r={};for(var i=this.length(),o=0,s=this.length();s>o;++o)r[this._values[o+i]]=this._values[o]}return this._resolve(r),!0}return!1},o.prototype.shouldCopyValues=function(){return!1},o.prototype.getActualLength=function(t){return t>>1},e.prototype.props=function(){return s(this)},e.props=function(t){return s(t)}}},{"./es5":13,"./util":36}],26:[function(t,e,n){"use strict";function r(t,e,n,r,i){for(var o=0;i>o;++o)n[o+r]=t[o+e],t[o+e]=void 0}function i(t){this._capacity=t,this._length=0,this._front=0}i.prototype._willBeOverCapacity=function(t){return this._capacityh;++h){var _=t[h];(void 0!==_||h in t)&&e.cast(_)._then(u,p,void 0,l,null)}return l}var s=t("./util"),a=function(t){return t.then(function(e){return o(e,t)})};e.race=function(t){return o(t,void 0)},e.prototype.race=function(){return o(this,void 0)}}},{"./util":36}],28:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o,s){function a(t,n,r,i){this.constructor$(t);var s=h();this._fn=null===s?n:f.domainBind(s,n),void 0!==r&&(r=e.resolve(r),r._attachCancellationCallback(this)),this._initialValue=r,this._currentCancellable=null,i===o?this._eachValues=Array(this._length):0===i?this._eachValues=null:this._eachValues=void 0,this._promise._captureStackTrace(),this._init$(void 0,-5)}function c(t,e){this.isFulfilled()?e._resolve(t):e._reject(t)}function l(t,e,n,i){if("function"!=typeof e)return r("expecting a function but got "+f.classString(e));var o=new a(t,e,n,i);return o.promise()}function u(t){this.accum=t,this.array._gotAccum(t);var n=i(this.value,this.array._promise);return n instanceof e?(this.array._currentCancellable=n,n._then(p,void 0,void 0,this,void 0)):p.call(this,n)}function p(t){var n=this.array,r=n._promise,i=_(n._fn);r._pushContext();var o;o=void 0!==n._eachValues?i.call(r._boundValue(),t,this.index,this.length):i.call(r._boundValue(),this.accum,t,this.index,this.length),o instanceof e&&(n._currentCancellable=o);var a=r._popContext();return s.checkForgottenReturns(o,a,void 0!==n._eachValues?"Promise.each":"Promise.reduce",r),o}var h=e._getDomain,f=t("./util"),_=f.tryCatch;f.inherits(a,n),a.prototype._gotAccum=function(t){void 0!==this._eachValues&&null!==this._eachValues&&t!==o&&this._eachValues.push(t)},a.prototype._eachComplete=function(t){return null!==this._eachValues&&this._eachValues.push(t),this._eachValues},a.prototype._init=function(){},a.prototype._resolveEmptyArray=function(){this._resolve(void 0!==this._eachValues?this._eachValues:this._initialValue)},a.prototype.shouldCopyValues=function(){return!1},a.prototype._resolve=function(t){this._promise._resolveCallback(t),this._values=null},a.prototype._resultCancelled=function(t){return t===this._initialValue?this._cancel():void(this._isResolved()||(this._resultCancelled$(),this._currentCancellable instanceof e&&this._currentCancellable.cancel(),this._initialValue instanceof e&&this._initialValue.cancel()))},a.prototype._iterate=function(t){this._values=t;var n,r,i=t.length;if(void 0!==this._initialValue?(n=this._initialValue,r=0):(n=e.resolve(t[0]),r=1),this._currentCancellable=n,!n.isRejected())for(;i>r;++r){var o={accum:null,value:t[r],index:r,length:i,array:this};n=n._then(u,void 0,void 0,o,void 0)}void 0!==this._eachValues&&(n=n._then(this._eachComplete,void 0,void 0,this,void 0)),n._then(c,c,void 0,n,this)},e.prototype.reduce=function(t,e){return l(this,t,e,null)},e.reduce=function(t,e,n,r){return l(t,e,n,r)}}},{"./util":36}],29:[function(t,e,n){"use strict";var r,i=t("./util"),o=function(){throw new Error("No async scheduler available\n\n See http://goo.gl/MqrFmX\n")},s=i.getNativePromise();if(i.isNode&&"undefined"==typeof MutationObserver){var a=global.setImmediate,c=process.nextTick;r=i.isRecentNode?function(t){a.call(global,t)}:function(t){c.call(process,t)}}else if("function"==typeof s&&"function"==typeof s.resolve){var l=s.resolve();r=function(t){l.then(t)}}else r="undefined"==typeof MutationObserver||"undefined"!=typeof window&&window.navigator&&(window.navigator.standalone||window.cordova)?"undefined"!=typeof setImmediate?function(t){setImmediate(t)}:"undefined"!=typeof setTimeout?function(t){setTimeout(t,0)}:o:function(){var t=document.createElement("div"),e={attributes:!0},n=!1,r=document.createElement("div"),i=new MutationObserver(function(){t.classList.toggle("foo"),n=!1});i.observe(r,e);var o=function(){n||(n=!0,r.classList.toggle("foo"))};return function(n){var r=new MutationObserver(function(){r.disconnect(),n()});r.observe(t,e),o()}}();e.exports=r},{"./util":36}],30:[function(t,e,n){"use strict";e.exports=function(e,n,r){function i(t){this.constructor$(t)}var o=e.PromiseInspection,s=t("./util");s.inherits(i,n),i.prototype._promiseResolved=function(t,e){this._values[t]=e;var n=++this._totalResolved;return n>=this._length?(this._resolve(this._values),!0):!1},i.prototype._promiseFulfilled=function(t,e){var n=new o;return n._bitField=33554432,n._settledValueField=t,this._promiseResolved(e,n)},i.prototype._promiseRejected=function(t,e){var n=new o;return n._bitField=16777216,n._settledValueField=t,this._promiseResolved(e,n)},e.settle=function(t){return r.deprecated(".settle()",".reflect()"),new i(t).promise()},e.prototype.settle=function(){return e.settle(this)}}},{"./util":36}],31:[function(t,e,n){"use strict";e.exports=function(e,n,r){function i(t){this.constructor$(t),this._howMany=0,this._unwrap=!1,this._initialized=!1}function o(t,e){if((0|e)!==e||0>e)return r("expecting a positive integer\n\n See http://goo.gl/MqrFmX\n");var n=new i(t),o=n.promise();return n.setHowMany(e),n.init(),o}var s=t("./util"),a=t("./errors").RangeError,c=t("./errors").AggregateError,l=s.isArray,u={};s.inherits(i,n),i.prototype._init=function(){
+if(this._initialized){if(0===this._howMany)return void this._resolve([]);this._init$(void 0,-5);var t=l(this._values);!this._isResolved()&&t&&this._howMany>this._canPossiblyFulfill()&&this._reject(this._getRangeError(this.length()))}},i.prototype.init=function(){this._initialized=!0,this._init()},i.prototype.setUnwrap=function(){this._unwrap=!0},i.prototype.howMany=function(){return this._howMany},i.prototype.setHowMany=function(t){this._howMany=t},i.prototype._promiseFulfilled=function(t){return this._addFulfilled(t),this._fulfilled()===this.howMany()?(this._values.length=this.howMany(),1===this.howMany()&&this._unwrap?this._resolve(this._values[0]):this._resolve(this._values),!0):!1},i.prototype._promiseRejected=function(t){return this._addRejected(t),this._checkOutcome()},i.prototype._promiseCancelled=function(){return this._values instanceof e||null==this._values?this._cancel():(this._addRejected(u),this._checkOutcome())},i.prototype._checkOutcome=function(){if(this.howMany()>this._canPossiblyFulfill()){for(var t=new c,e=this.length();e0?this._reject(t):this._cancel(),!0}return!1},i.prototype._fulfilled=function(){return this._totalResolved},i.prototype._rejected=function(){return this._values.length-this.length()},i.prototype._addRejected=function(t){this._values.push(t)},i.prototype._addFulfilled=function(t){this._values[this._totalResolved++]=t},i.prototype._canPossiblyFulfill=function(){return this.length()-this._rejected()},i.prototype._getRangeError=function(t){var e="Input array must contain at least "+this._howMany+" items but contains only "+t+" items";return new a(e)},i.prototype._resolveEmptyArray=function(){this._reject(this._getRangeError(0))},e.some=function(t,e){return o(t,e)},e.prototype.some=function(t){return o(this,t)},e._SomePromiseArray=i}},{"./errors":12,"./util":36}],32:[function(t,e,n){"use strict";e.exports=function(t){function e(t){void 0!==t?(t=t._target(),this._bitField=t._bitField,this._settledValueField=t._isFateSealed()?t._settledValue():void 0):(this._bitField=0,this._settledValueField=void 0)}e.prototype._settledValue=function(){return this._settledValueField};var n=e.prototype.value=function(){if(!this.isFulfilled())throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\n\n See http://goo.gl/MqrFmX\n");return this._settledValue()},r=e.prototype.error=e.prototype.reason=function(){if(!this.isRejected())throw new TypeError("cannot get rejection reason of a non-rejected promise\n\n See http://goo.gl/MqrFmX\n");return this._settledValue()},i=e.prototype.isFulfilled=function(){return 0!==(33554432&this._bitField)},o=e.prototype.isRejected=function(){return 0!==(16777216&this._bitField)},s=e.prototype.isPending=function(){return 0===(50397184&this._bitField)},a=e.prototype.isResolved=function(){return 0!==(50331648&this._bitField)};e.prototype.isCancelled=function(){return 0!==(8454144&this._bitField)},t.prototype.__isCancelled=function(){return 65536===(65536&this._bitField)},t.prototype._isCancelled=function(){return this._target().__isCancelled()},t.prototype.isCancelled=function(){return 0!==(8454144&this._target()._bitField)},t.prototype.isPending=function(){return s.call(this._target())},t.prototype.isRejected=function(){return o.call(this._target())},t.prototype.isFulfilled=function(){return i.call(this._target())},t.prototype.isResolved=function(){return a.call(this._target())},t.prototype.value=function(){return n.call(this._target())},t.prototype.reason=function(){var t=this._target();return t._unsetRejectionIsUnhandled(),r.call(t)},t.prototype._value=function(){return this._settledValue()},t.prototype._reason=function(){return this._unsetRejectionIsUnhandled(),this._settledValue()},t.PromiseInspection=e}},{}],33:[function(t,e,n){"use strict";e.exports=function(e,n){function r(t,r){if(u(t)){if(t instanceof e)return t;var i=o(t);if(i===l){r&&r._pushContext();var c=e.reject(i.e);return r&&r._popContext(),c}if("function"==typeof i){if(s(t)){var c=new e(n);return t._then(c._fulfill,c._reject,void 0,c,null),c}return a(t,i,r)}}return t}function i(t){return t.then}function o(t){try{return i(t)}catch(e){return l.e=e,l}}function s(t){try{return p.call(t,"_promise0")}catch(e){return!1}}function a(t,r,i){function o(t){a&&(a._resolveCallback(t),a=null)}function s(t){a&&(a._rejectCallback(t,p,!0),a=null)}var a=new e(n),u=a;i&&i._pushContext(),a._captureStackTrace(),i&&i._popContext();var p=!0,h=c.tryCatch(r).call(t,o,s);return p=!1,a&&h===l&&(a._rejectCallback(h.e,!0,!0),a=null),u}var c=t("./util"),l=c.errorObj,u=c.isObject,p={}.hasOwnProperty;return r}},{"./util":36}],34:[function(t,e,n){"use strict";e.exports=function(e,n,r){function i(t){this.handle=t}function o(t){return clearTimeout(this.handle),t}function s(t){throw clearTimeout(this.handle),t}var a=t("./util"),c=e.TimeoutError;i.prototype._resultCancelled=function(){clearTimeout(this.handle)};var l=function(t){return u(+this).thenReturn(t)},u=e.delay=function(t,o){var s,a;return void 0!==o?(s=e.resolve(o)._then(l,null,null,t,void 0),r.cancellation()&&o instanceof e&&s._setOnCancel(o)):(s=new e(n),a=setTimeout(function(){s._fulfill()},+t),r.cancellation()&&s._setOnCancel(new i(a)),s._captureStackTrace()),s._setAsyncGuaranteed(),s};e.prototype.delay=function(t){return u(t,this)};var p=function(t,e,n){var r;r="string"!=typeof e?e instanceof Error?e:new c("operation timed out"):new c(e),a.markAsOriginatingFromRejection(r),t._attachExtraTrace(r),t._reject(r),null!=n&&n.cancel()};e.prototype.timeout=function(t,e){t=+t;var n,a,c=new i(setTimeout(function(){n.isPending()&&p(n,e,a)},t));return r.cancellation()?(a=this.then(),n=a._then(o,s,void 0,c,void 0),n._setOnCancel(c)):n=this._then(o,s,void 0,c,void 0),n}}},{"./util":36}],35:[function(t,e,n){"use strict";e.exports=function(e,n,r,i,o,s){function a(t){setTimeout(function(){throw t},0)}function c(t){var e=r(t);return e!==t&&"function"==typeof t._isDisposable&&"function"==typeof t._getDisposer&&t._isDisposable()&&e._setDisposable(t._getDisposer()),e}function l(t,n){function i(){if(s>=l)return u._fulfill();var o=c(t[s++]);if(o instanceof e&&o._isDisposable()){try{o=r(o._getDisposer().tryDispose(n),t.promise)}catch(p){return a(p)}if(o instanceof e)return o._then(i,a,null,null,null)}i()}var s=0,l=t.length,u=new e(o);return i(),u}function u(t,e,n){this._data=t,this._promise=e,this._context=n}function p(t,e,n){this.constructor$(t,e,n)}function h(t){return u.isDisposer(t)?(this.resources[this.index]._setDisposable(t),t.promise()):t}function f(t){this.length=t,this.promise=null,this[t-1]=null}var _=t("./util"),d=t("./errors").TypeError,v=t("./util").inherits,y=_.errorObj,m=_.tryCatch,g={};u.prototype.data=function(){return this._data},u.prototype.promise=function(){return this._promise},u.prototype.resource=function(){return this.promise().isFulfilled()?this.promise().value():g},u.prototype.tryDispose=function(t){var e=this.resource(),n=this._context;void 0!==n&&n._pushContext();var r=e!==g?this.doDispose(e,t):null;return void 0!==n&&n._popContext(),this._promise._unsetDisposable(),this._data=null,r},u.isDisposer=function(t){return null!=t&&"function"==typeof t.resource&&"function"==typeof t.tryDispose},v(p,u),p.prototype.doDispose=function(t,e){var n=this.data();return n.call(t,t,e)},f.prototype._resultCancelled=function(){for(var t=this.length,n=0;t>n;++n){var r=this[n];r instanceof e&&r.cancel()}},e.using=function(){var t=arguments.length;if(2>t)return n("you must pass at least 2 arguments to Promise.using");var i=arguments[t-1];if("function"!=typeof i)return n("expecting a function but got "+_.classString(i));var o,a=!0;2===t&&Array.isArray(arguments[0])?(o=arguments[0],t=o.length,a=!1):(o=arguments,t--);for(var c=new f(t),p=0;t>p;++p){var d=o[p];if(u.isDisposer(d)){var v=d;d=d.promise(),d._setDisposable(v)}else{var g=r(d);g instanceof e&&(d=g._then(h,null,null,{resources:c,index:p},void 0))}c[p]=d}for(var b=new Array(c.length),p=0;p0},e.prototype._getDisposer=function(){return this._disposer},e.prototype._unsetDisposable=function(){this._bitField=-131073&this._bitField,this._disposer=void 0},e.prototype.disposer=function(t){if("function"==typeof t)return new p(t,this,i());throw new d}}},{"./errors":12,"./util":36}],36:[function(t,e,n){"use strict";function r(){try{var t=P;return P=null,t.apply(this,arguments)}catch(e){return T.e=e,T}}function i(t){return P=t,r}function o(t){return null==t||t===!0||t===!1||"string"==typeof t||"number"==typeof t}function s(t){return"function"==typeof t||"object"==typeof t&&null!==t}function a(t){return o(t)?new Error(v(t)):t}function c(t,e){var n,r=t.length,i=new Array(r+1);for(n=0;r>n;++n)i[n]=t[n];return i[n]=e,i}function l(t,e,n){if(!F.isES5)return{}.hasOwnProperty.call(t,e)?t[e]:void 0;var r=Object.getOwnPropertyDescriptor(t,e);return null!=r?null==r.get&&null==r.set?r.value:n:void 0}function u(t,e,n){if(o(t))return t;var r={value:n,configurable:!0,enumerable:!1,writable:!0};return F.defineProperty(t,e,r),t}function p(t){throw t}function h(t){try{if("function"==typeof t){var e=F.names(t.prototype),n=F.isES5&&e.length>1,r=e.length>0&&!(1===e.length&&"constructor"===e[0]),i=A.test(t+"")&&F.names(t).length>0;if(n||r||i)return!0}return!1}catch(o){return!1}}function f(t){function e(){}e.prototype=t;for(var n=8;n--;)new e;return t}function _(t){return D.test(t)}function d(t,e,n){for(var r=new Array(t),i=0;t>i;++i)r[i]=e+i+n;return r}function v(t){try{return t+""}catch(e){return"[no string representation]"}}function y(t){return null!==t&&"object"==typeof t&&"string"==typeof t.message&&"string"==typeof t.name}function m(t){try{u(t,"isOperational",!0)}catch(e){}}function g(t){return null==t?!1:t instanceof Error.__BluebirdErrorTypes__.OperationalError||t.isOperational===!0}function b(t){return y(t)&&F.propertyIsWritable(t,"stack")}function w(t){return{}.toString.call(t)}function C(t,e,n){for(var r=F.names(t),i=0;i10||t[0]>0}(),B.isNode&&B.toFastProperties(process);try{throw new Error}catch(U){B.lastLineError=U}e.exports=B},{"./es5":13}]},{},[4])(4)}),"undefined"!=typeof window&&null!==window?window.P=window.Promise:"undefined"!=typeof self&&null!==self&&(self.P=self.Promise);
\ No newline at end of file
diff --git a/website_quotation_template/node_modules/bluebird/js/release/any.js b/website_quotation_template/node_modules/bluebird/js/release/any.js
new file mode 100644
index 000000000..05a6228ef
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/any.js
@@ -0,0 +1,21 @@
+"use strict";
+module.exports = function(Promise) {
+var SomePromiseArray = Promise._SomePromiseArray;
+function any(promises) {
+ var ret = new SomePromiseArray(promises);
+ var promise = ret.promise();
+ ret.setHowMany(1);
+ ret.setUnwrap();
+ ret.init();
+ return promise;
+}
+
+Promise.any = function (promises) {
+ return any(promises);
+};
+
+Promise.prototype.any = function () {
+ return any(this);
+};
+
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/assert.js b/website_quotation_template/node_modules/bluebird/js/release/assert.js
new file mode 100644
index 000000000..4518231a1
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/assert.js
@@ -0,0 +1,55 @@
+"use strict";
+module.exports = (function(){
+var AssertionError = (function() {
+ function AssertionError(a) {
+ this.constructor$(a);
+ this.message = a;
+ this.name = "AssertionError";
+ }
+ AssertionError.prototype = new Error();
+ AssertionError.prototype.constructor = AssertionError;
+ AssertionError.prototype.constructor$ = Error;
+ return AssertionError;
+})();
+
+function getParams(args) {
+ var params = [];
+ for (var i = 0; i < args.length; ++i) params.push("arg" + i);
+ return params;
+}
+
+function nativeAssert(callName, args, expect) {
+ try {
+ var params = getParams(args);
+ var constructorArgs = params;
+ constructorArgs.push("return " +
+ callName + "("+ params.join(",") + ");");
+ var fn = Function.apply(null, constructorArgs);
+ return fn.apply(null, args);
+ } catch (e) {
+ if (!(e instanceof SyntaxError)) {
+ throw e;
+ } else {
+ return expect;
+ }
+ }
+}
+
+return function assert(boolExpr, message) {
+ if (boolExpr === true) return;
+
+ if (typeof boolExpr === "string" &&
+ boolExpr.charAt(0) === "%") {
+ var nativeCallName = boolExpr;
+ var $_len = arguments.length;var args = new Array(Math.max($_len - 2, 0)); for(var $_i = 2; $_i < $_len; ++$_i) {args[$_i - 2] = arguments[$_i];};
+ if (nativeAssert(nativeCallName, args, message) === message) return;
+ message = (nativeCallName + " !== " + message);
+ }
+
+ var ret = new AssertionError(message);
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(ret, assert);
+ }
+ throw ret;
+};
+})();
diff --git a/website_quotation_template/node_modules/bluebird/js/release/async.js b/website_quotation_template/node_modules/bluebird/js/release/async.js
new file mode 100644
index 000000000..41f665564
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/async.js
@@ -0,0 +1,161 @@
+"use strict";
+var firstLineError;
+try {throw new Error(); } catch (e) {firstLineError = e;}
+var schedule = require("./schedule");
+var Queue = require("./queue");
+var util = require("./util");
+
+function Async() {
+ this._customScheduler = false;
+ this._isTickUsed = false;
+ this._lateQueue = new Queue(16);
+ this._normalQueue = new Queue(16);
+ this._haveDrainedQueues = false;
+ this._trampolineEnabled = true;
+ var self = this;
+ this.drainQueues = function () {
+ self._drainQueues();
+ };
+ this._schedule = schedule;
+}
+
+Async.prototype.setScheduler = function(fn) {
+ var prev = this._schedule;
+ this._schedule = fn;
+ this._customScheduler = true;
+ return prev;
+};
+
+Async.prototype.hasCustomScheduler = function() {
+ return this._customScheduler;
+};
+
+Async.prototype.enableTrampoline = function() {
+ this._trampolineEnabled = true;
+};
+
+Async.prototype.disableTrampolineIfNecessary = function() {
+ if (util.hasDevTools) {
+ this._trampolineEnabled = false;
+ }
+};
+
+Async.prototype.haveItemsQueued = function () {
+ return this._isTickUsed || this._haveDrainedQueues;
+};
+
+
+Async.prototype.fatalError = function(e, isNode) {
+ if (isNode) {
+ process.stderr.write("Fatal " + (e instanceof Error ? e.stack : e) +
+ "\n");
+ process.exit(2);
+ } else {
+ this.throwLater(e);
+ }
+};
+
+Async.prototype.throwLater = function(fn, arg) {
+ if (arguments.length === 1) {
+ arg = fn;
+ fn = function () { throw arg; };
+ }
+ if (typeof setTimeout !== "undefined") {
+ setTimeout(function() {
+ fn(arg);
+ }, 0);
+ } else try {
+ this._schedule(function() {
+ fn(arg);
+ });
+ } catch (e) {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+};
+
+function AsyncInvokeLater(fn, receiver, arg) {
+ this._lateQueue.push(fn, receiver, arg);
+ this._queueTick();
+}
+
+function AsyncInvoke(fn, receiver, arg) {
+ this._normalQueue.push(fn, receiver, arg);
+ this._queueTick();
+}
+
+function AsyncSettlePromises(promise) {
+ this._normalQueue._pushOne(promise);
+ this._queueTick();
+}
+
+if (!util.hasDevTools) {
+ Async.prototype.invokeLater = AsyncInvokeLater;
+ Async.prototype.invoke = AsyncInvoke;
+ Async.prototype.settlePromises = AsyncSettlePromises;
+} else {
+ Async.prototype.invokeLater = function (fn, receiver, arg) {
+ if (this._trampolineEnabled) {
+ AsyncInvokeLater.call(this, fn, receiver, arg);
+ } else {
+ this._schedule(function() {
+ setTimeout(function() {
+ fn.call(receiver, arg);
+ }, 100);
+ });
+ }
+ };
+
+ Async.prototype.invoke = function (fn, receiver, arg) {
+ if (this._trampolineEnabled) {
+ AsyncInvoke.call(this, fn, receiver, arg);
+ } else {
+ this._schedule(function() {
+ fn.call(receiver, arg);
+ });
+ }
+ };
+
+ Async.prototype.settlePromises = function(promise) {
+ if (this._trampolineEnabled) {
+ AsyncSettlePromises.call(this, promise);
+ } else {
+ this._schedule(function() {
+ promise._settlePromises();
+ });
+ }
+ };
+}
+
+Async.prototype._drainQueue = function(queue) {
+ while (queue.length() > 0) {
+ var fn = queue.shift();
+ if (typeof fn !== "function") {
+ fn._settlePromises();
+ continue;
+ }
+ var receiver = queue.shift();
+ var arg = queue.shift();
+ fn.call(receiver, arg);
+ }
+};
+
+Async.prototype._drainQueues = function () {
+ this._drainQueue(this._normalQueue);
+ this._reset();
+ this._haveDrainedQueues = true;
+ this._drainQueue(this._lateQueue);
+};
+
+Async.prototype._queueTick = function () {
+ if (!this._isTickUsed) {
+ this._isTickUsed = true;
+ this._schedule(this.drainQueues);
+ }
+};
+
+Async.prototype._reset = function () {
+ this._isTickUsed = false;
+};
+
+module.exports = Async;
+module.exports.firstLineError = firstLineError;
diff --git a/website_quotation_template/node_modules/bluebird/js/release/bind.js b/website_quotation_template/node_modules/bluebird/js/release/bind.js
new file mode 100644
index 000000000..fc3379db2
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/bind.js
@@ -0,0 +1,67 @@
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise, debug) {
+var calledBind = false;
+var rejectThis = function(_, e) {
+ this._reject(e);
+};
+
+var targetRejected = function(e, context) {
+ context.promiseRejectionQueued = true;
+ context.bindingPromise._then(rejectThis, rejectThis, null, this, e);
+};
+
+var bindingResolved = function(thisArg, context) {
+ if (((this._bitField & 50397184) === 0)) {
+ this._resolveCallback(context.target);
+ }
+};
+
+var bindingRejected = function(e, context) {
+ if (!context.promiseRejectionQueued) this._reject(e);
+};
+
+Promise.prototype.bind = function (thisArg) {
+ if (!calledBind) {
+ calledBind = true;
+ Promise.prototype._propagateFrom = debug.propagateFromFunction();
+ Promise.prototype._boundValue = debug.boundValueFunction();
+ }
+ var maybePromise = tryConvertToPromise(thisArg);
+ var ret = new Promise(INTERNAL);
+ ret._propagateFrom(this, 1);
+ var target = this._target();
+ ret._setBoundTo(maybePromise);
+ if (maybePromise instanceof Promise) {
+ var context = {
+ promiseRejectionQueued: false,
+ promise: ret,
+ target: target,
+ bindingPromise: maybePromise
+ };
+ target._then(INTERNAL, targetRejected, undefined, ret, context);
+ maybePromise._then(
+ bindingResolved, bindingRejected, undefined, ret, context);
+ ret._setOnCancel(maybePromise);
+ } else {
+ ret._resolveCallback(target);
+ }
+ return ret;
+};
+
+Promise.prototype._setBoundTo = function (obj) {
+ if (obj !== undefined) {
+ this._bitField = this._bitField | 2097152;
+ this._boundTo = obj;
+ } else {
+ this._bitField = this._bitField & (~2097152);
+ }
+};
+
+Promise.prototype._isBound = function () {
+ return (this._bitField & 2097152) === 2097152;
+};
+
+Promise.bind = function (thisArg, value) {
+ return Promise.resolve(value).bind(thisArg);
+};
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/bluebird.js b/website_quotation_template/node_modules/bluebird/js/release/bluebird.js
new file mode 100644
index 000000000..1c36cf364
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/bluebird.js
@@ -0,0 +1,11 @@
+"use strict";
+var old;
+if (typeof Promise !== "undefined") old = Promise;
+function noConflict() {
+ try { if (Promise === bluebird) Promise = old; }
+ catch (e) {}
+ return bluebird;
+}
+var bluebird = require("./promise")();
+bluebird.noConflict = noConflict;
+module.exports = bluebird;
diff --git a/website_quotation_template/node_modules/bluebird/js/release/call_get.js b/website_quotation_template/node_modules/bluebird/js/release/call_get.js
new file mode 100644
index 000000000..0ed7714ac
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/call_get.js
@@ -0,0 +1,123 @@
+"use strict";
+var cr = Object.create;
+if (cr) {
+ var callerCache = cr(null);
+ var getterCache = cr(null);
+ callerCache[" size"] = getterCache[" size"] = 0;
+}
+
+module.exports = function(Promise) {
+var util = require("./util");
+var canEvaluate = util.canEvaluate;
+var isIdentifier = util.isIdentifier;
+
+var getMethodCaller;
+var getGetter;
+if (!false) {
+var makeMethodCaller = function (methodName) {
+ return new Function("ensureMethod", " \n\
+ return function(obj) { \n\
+ 'use strict' \n\
+ var len = this.length; \n\
+ ensureMethod(obj, 'methodName'); \n\
+ switch(len) { \n\
+ case 1: return obj.methodName(this[0]); \n\
+ case 2: return obj.methodName(this[0], this[1]); \n\
+ case 3: return obj.methodName(this[0], this[1], this[2]); \n\
+ case 0: return obj.methodName(); \n\
+ default: \n\
+ return obj.methodName.apply(obj, this); \n\
+ } \n\
+ }; \n\
+ ".replace(/methodName/g, methodName))(ensureMethod);
+};
+
+var makeGetter = function (propertyName) {
+ return new Function("obj", " \n\
+ 'use strict'; \n\
+ return obj.propertyName; \n\
+ ".replace("propertyName", propertyName));
+};
+
+var getCompiled = function(name, compiler, cache) {
+ var ret = cache[name];
+ if (typeof ret !== "function") {
+ if (!isIdentifier(name)) {
+ return null;
+ }
+ ret = compiler(name);
+ cache[name] = ret;
+ cache[" size"]++;
+ if (cache[" size"] > 512) {
+ var keys = Object.keys(cache);
+ for (var i = 0; i < 256; ++i) delete cache[keys[i]];
+ cache[" size"] = keys.length - 256;
+ }
+ }
+ return ret;
+};
+
+getMethodCaller = function(name) {
+ return getCompiled(name, makeMethodCaller, callerCache);
+};
+
+getGetter = function(name) {
+ return getCompiled(name, makeGetter, getterCache);
+};
+}
+
+function ensureMethod(obj, methodName) {
+ var fn;
+ if (obj != null) fn = obj[methodName];
+ if (typeof fn !== "function") {
+ var message = "Object " + util.classString(obj) + " has no method '" +
+ util.toString(methodName) + "'";
+ throw new Promise.TypeError(message);
+ }
+ return fn;
+}
+
+function caller(obj) {
+ var methodName = this.pop();
+ var fn = ensureMethod(obj, methodName);
+ return fn.apply(obj, this);
+}
+Promise.prototype.call = function (methodName) {
+ var $_len = arguments.length;var args = new Array(Math.max($_len - 1, 0)); for(var $_i = 1; $_i < $_len; ++$_i) {args[$_i - 1] = arguments[$_i];};
+ if (!false) {
+ if (canEvaluate) {
+ var maybeCaller = getMethodCaller(methodName);
+ if (maybeCaller !== null) {
+ return this._then(
+ maybeCaller, undefined, undefined, args, undefined);
+ }
+ }
+ }
+ args.push(methodName);
+ return this._then(caller, undefined, undefined, args, undefined);
+};
+
+function namedGetter(obj) {
+ return obj[this];
+}
+function indexedGetter(obj) {
+ var index = +this;
+ if (index < 0) index = Math.max(0, index + obj.length);
+ return obj[index];
+}
+Promise.prototype.get = function (propertyName) {
+ var isIndex = (typeof propertyName === "number");
+ var getter;
+ if (!isIndex) {
+ if (canEvaluate) {
+ var maybeGetter = getGetter(propertyName);
+ getter = maybeGetter !== null ? maybeGetter : namedGetter;
+ } else {
+ getter = namedGetter;
+ }
+ } else {
+ getter = indexedGetter;
+ }
+ return this._then(getter, undefined, undefined, propertyName, undefined);
+};
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/cancel.js b/website_quotation_template/node_modules/bluebird/js/release/cancel.js
new file mode 100644
index 000000000..7a12415ee
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/cancel.js
@@ -0,0 +1,129 @@
+"use strict";
+module.exports = function(Promise, PromiseArray, apiRejection, debug) {
+var util = require("./util");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var async = Promise._async;
+
+Promise.prototype["break"] = Promise.prototype.cancel = function() {
+ if (!debug.cancellation()) return this._warn("cancellation is disabled");
+
+ var promise = this;
+ var child = promise;
+ while (promise._isCancellable()) {
+ if (!promise._cancelBy(child)) {
+ if (child._isFollowing()) {
+ child._followee().cancel();
+ } else {
+ child._cancelBranched();
+ }
+ break;
+ }
+
+ var parent = promise._cancellationParent;
+ if (parent == null || !parent._isCancellable()) {
+ if (promise._isFollowing()) {
+ promise._followee().cancel();
+ } else {
+ promise._cancelBranched();
+ }
+ break;
+ } else {
+ if (promise._isFollowing()) promise._followee().cancel();
+ promise._setWillBeCancelled();
+ child = promise;
+ promise = parent;
+ }
+ }
+};
+
+Promise.prototype._branchHasCancelled = function() {
+ this._branchesRemainingToCancel--;
+};
+
+Promise.prototype._enoughBranchesHaveCancelled = function() {
+ return this._branchesRemainingToCancel === undefined ||
+ this._branchesRemainingToCancel <= 0;
+};
+
+Promise.prototype._cancelBy = function(canceller) {
+ if (canceller === this) {
+ this._branchesRemainingToCancel = 0;
+ this._invokeOnCancel();
+ return true;
+ } else {
+ this._branchHasCancelled();
+ if (this._enoughBranchesHaveCancelled()) {
+ this._invokeOnCancel();
+ return true;
+ }
+ }
+ return false;
+};
+
+Promise.prototype._cancelBranched = function() {
+ if (this._enoughBranchesHaveCancelled()) {
+ this._cancel();
+ }
+};
+
+Promise.prototype._cancel = function() {
+ if (!this._isCancellable()) return;
+ this._setCancelled();
+ async.invoke(this._cancelPromises, this, undefined);
+};
+
+Promise.prototype._cancelPromises = function() {
+ if (this._length() > 0) this._settlePromises();
+};
+
+Promise.prototype._unsetOnCancel = function() {
+ this._onCancelField = undefined;
+};
+
+Promise.prototype._isCancellable = function() {
+ return this.isPending() && !this._isCancelled();
+};
+
+Promise.prototype.isCancellable = function() {
+ return this.isPending() && !this.isCancelled();
+};
+
+Promise.prototype._doInvokeOnCancel = function(onCancelCallback, internalOnly) {
+ if (util.isArray(onCancelCallback)) {
+ for (var i = 0; i < onCancelCallback.length; ++i) {
+ this._doInvokeOnCancel(onCancelCallback[i], internalOnly);
+ }
+ } else if (onCancelCallback !== undefined) {
+ if (typeof onCancelCallback === "function") {
+ if (!internalOnly) {
+ var e = tryCatch(onCancelCallback).call(this._boundValue());
+ if (e === errorObj) {
+ this._attachExtraTrace(e.e);
+ async.throwLater(e.e);
+ }
+ }
+ } else {
+ onCancelCallback._resultCancelled(this);
+ }
+ }
+};
+
+Promise.prototype._invokeOnCancel = function() {
+ var onCancelCallback = this._onCancel();
+ this._unsetOnCancel();
+ async.invoke(this._doInvokeOnCancel, this, onCancelCallback);
+};
+
+Promise.prototype._invokeInternalOnCancel = function() {
+ if (this._isCancellable()) {
+ this._doInvokeOnCancel(this._onCancel(), true);
+ this._unsetOnCancel();
+ }
+};
+
+Promise.prototype._resultCancelled = function() {
+ this.cancel();
+};
+
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/catch_filter.js b/website_quotation_template/node_modules/bluebird/js/release/catch_filter.js
new file mode 100644
index 000000000..0f24ce23e
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/catch_filter.js
@@ -0,0 +1,42 @@
+"use strict";
+module.exports = function(NEXT_FILTER) {
+var util = require("./util");
+var getKeys = require("./es5").keys;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function catchFilter(instances, cb, promise) {
+ return function(e) {
+ var boundTo = promise._boundValue();
+ predicateLoop: for (var i = 0; i < instances.length; ++i) {
+ var item = instances[i];
+
+ if (item === Error ||
+ (item != null && item.prototype instanceof Error)) {
+ if (e instanceof item) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (typeof item === "function") {
+ var matchesPredicate = tryCatch(item).call(boundTo, e);
+ if (matchesPredicate === errorObj) {
+ return matchesPredicate;
+ } else if (matchesPredicate) {
+ return tryCatch(cb).call(boundTo, e);
+ }
+ } else if (util.isObject(e)) {
+ var keys = getKeys(item);
+ for (var j = 0; j < keys.length; ++j) {
+ var key = keys[j];
+ if (item[key] != e[key]) {
+ continue predicateLoop;
+ }
+ }
+ return tryCatch(cb).call(boundTo, e);
+ }
+ }
+ return NEXT_FILTER;
+ };
+}
+
+return catchFilter;
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/context.js b/website_quotation_template/node_modules/bluebird/js/release/context.js
new file mode 100644
index 000000000..c307414fc
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/context.js
@@ -0,0 +1,69 @@
+"use strict";
+module.exports = function(Promise) {
+var longStackTraces = false;
+var contextStack = [];
+
+Promise.prototype._promiseCreated = function() {};
+Promise.prototype._pushContext = function() {};
+Promise.prototype._popContext = function() {return null;};
+Promise._peekContext = Promise.prototype._peekContext = function() {};
+
+function Context() {
+ this._trace = new Context.CapturedTrace(peekContext());
+}
+Context.prototype._pushContext = function () {
+ if (this._trace !== undefined) {
+ this._trace._promiseCreated = null;
+ contextStack.push(this._trace);
+ }
+};
+
+Context.prototype._popContext = function () {
+ if (this._trace !== undefined) {
+ var trace = contextStack.pop();
+ var ret = trace._promiseCreated;
+ trace._promiseCreated = null;
+ return ret;
+ }
+ return null;
+};
+
+function createContext() {
+ if (longStackTraces) return new Context();
+}
+
+function peekContext() {
+ var lastIndex = contextStack.length - 1;
+ if (lastIndex >= 0) {
+ return contextStack[lastIndex];
+ }
+ return undefined;
+}
+Context.CapturedTrace = null;
+Context.create = createContext;
+Context.deactivateLongStackTraces = function() {};
+Context.activateLongStackTraces = function() {
+ var Promise_pushContext = Promise.prototype._pushContext;
+ var Promise_popContext = Promise.prototype._popContext;
+ var Promise_PeekContext = Promise._peekContext;
+ var Promise_peekContext = Promise.prototype._peekContext;
+ var Promise_promiseCreated = Promise.prototype._promiseCreated;
+ Context.deactivateLongStackTraces = function() {
+ Promise.prototype._pushContext = Promise_pushContext;
+ Promise.prototype._popContext = Promise_popContext;
+ Promise._peekContext = Promise_PeekContext;
+ Promise.prototype._peekContext = Promise_peekContext;
+ Promise.prototype._promiseCreated = Promise_promiseCreated;
+ longStackTraces = false;
+ };
+ longStackTraces = true;
+ Promise.prototype._pushContext = Context.prototype._pushContext;
+ Promise.prototype._popContext = Context.prototype._popContext;
+ Promise._peekContext = Promise.prototype._peekContext = peekContext;
+ Promise.prototype._promiseCreated = function() {
+ var ctx = this._peekContext();
+ if (ctx && ctx._promiseCreated == null) ctx._promiseCreated = this;
+ };
+};
+return Context;
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/debuggability.js b/website_quotation_template/node_modules/bluebird/js/release/debuggability.js
new file mode 100644
index 000000000..bf0587ce7
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/debuggability.js
@@ -0,0 +1,916 @@
+"use strict";
+module.exports = function(Promise, Context) {
+var getDomain = Promise._getDomain;
+var async = Promise._async;
+var Warning = require("./errors").Warning;
+var util = require("./util");
+var canAttachTrace = util.canAttachTrace;
+var unhandledRejectionHandled;
+var possiblyUnhandledRejection;
+var bluebirdFramePattern =
+ /[\\\/]bluebird[\\\/]js[\\\/](release|debug|instrumented)/;
+var nodeFramePattern = /\((?:timers\.js):\d+:\d+\)/;
+var parseLinePattern = /[\/<\(](.+?):(\d+):(\d+)\)?\s*$/;
+var stackFramePattern = null;
+var formatStack = null;
+var indentStackFrames = false;
+var printWarning;
+var debugging = !!(util.env("BLUEBIRD_DEBUG") != 0 &&
+ (false ||
+ util.env("BLUEBIRD_DEBUG") ||
+ util.env("NODE_ENV") === "development"));
+
+var warnings = !!(util.env("BLUEBIRD_WARNINGS") != 0 &&
+ (debugging || util.env("BLUEBIRD_WARNINGS")));
+
+var longStackTraces = !!(util.env("BLUEBIRD_LONG_STACK_TRACES") != 0 &&
+ (debugging || util.env("BLUEBIRD_LONG_STACK_TRACES")));
+
+var wForgottenReturn = util.env("BLUEBIRD_W_FORGOTTEN_RETURN") != 0 &&
+ (warnings || !!util.env("BLUEBIRD_W_FORGOTTEN_RETURN"));
+
+Promise.prototype.suppressUnhandledRejections = function() {
+ var target = this._target();
+ target._bitField = ((target._bitField & (~1048576)) |
+ 524288);
+};
+
+Promise.prototype._ensurePossibleRejectionHandled = function () {
+ if ((this._bitField & 524288) !== 0) return;
+ this._setRejectionIsUnhandled();
+ async.invokeLater(this._notifyUnhandledRejection, this, undefined);
+};
+
+Promise.prototype._notifyUnhandledRejectionIsHandled = function () {
+ fireRejectionEvent("rejectionHandled",
+ unhandledRejectionHandled, undefined, this);
+};
+
+Promise.prototype._setReturnedNonUndefined = function() {
+ this._bitField = this._bitField | 268435456;
+};
+
+Promise.prototype._returnedNonUndefined = function() {
+ return (this._bitField & 268435456) !== 0;
+};
+
+Promise.prototype._notifyUnhandledRejection = function () {
+ if (this._isRejectionUnhandled()) {
+ var reason = this._settledValue();
+ this._setUnhandledRejectionIsNotified();
+ fireRejectionEvent("unhandledRejection",
+ possiblyUnhandledRejection, reason, this);
+ }
+};
+
+Promise.prototype._setUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField | 262144;
+};
+
+Promise.prototype._unsetUnhandledRejectionIsNotified = function () {
+ this._bitField = this._bitField & (~262144);
+};
+
+Promise.prototype._isUnhandledRejectionNotified = function () {
+ return (this._bitField & 262144) > 0;
+};
+
+Promise.prototype._setRejectionIsUnhandled = function () {
+ this._bitField = this._bitField | 1048576;
+};
+
+Promise.prototype._unsetRejectionIsUnhandled = function () {
+ this._bitField = this._bitField & (~1048576);
+ if (this._isUnhandledRejectionNotified()) {
+ this._unsetUnhandledRejectionIsNotified();
+ this._notifyUnhandledRejectionIsHandled();
+ }
+};
+
+Promise.prototype._isRejectionUnhandled = function () {
+ return (this._bitField & 1048576) > 0;
+};
+
+Promise.prototype._warn = function(message, shouldUseOwnTrace, promise) {
+ return warn(message, shouldUseOwnTrace, promise || this);
+};
+
+Promise.onPossiblyUnhandledRejection = function (fn) {
+ var domain = getDomain();
+ possiblyUnhandledRejection =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+Promise.onUnhandledRejectionHandled = function (fn) {
+ var domain = getDomain();
+ unhandledRejectionHandled =
+ typeof fn === "function" ? (domain === null ?
+ fn : util.domainBind(domain, fn))
+ : undefined;
+};
+
+var disableLongStackTraces = function() {};
+Promise.longStackTraces = function () {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ if (!config.longStackTraces && longStackTracesIsSupported()) {
+ var Promise_captureStackTrace = Promise.prototype._captureStackTrace;
+ var Promise_attachExtraTrace = Promise.prototype._attachExtraTrace;
+ config.longStackTraces = true;
+ disableLongStackTraces = function() {
+ if (async.haveItemsQueued() && !config.longStackTraces) {
+ throw new Error("cannot enable long stack traces after promises have been created\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ Promise.prototype._captureStackTrace = Promise_captureStackTrace;
+ Promise.prototype._attachExtraTrace = Promise_attachExtraTrace;
+ Context.deactivateLongStackTraces();
+ async.enableTrampoline();
+ config.longStackTraces = false;
+ };
+ Promise.prototype._captureStackTrace = longStackTracesCaptureStackTrace;
+ Promise.prototype._attachExtraTrace = longStackTracesAttachExtraTrace;
+ Context.activateLongStackTraces();
+ async.disableTrampolineIfNecessary();
+ }
+};
+
+Promise.hasLongStackTraces = function () {
+ return config.longStackTraces && longStackTracesIsSupported();
+};
+
+var fireDomEvent = (function() {
+ try {
+ if (typeof CustomEvent === "function") {
+ var event = new CustomEvent("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new CustomEvent(name.toLowerCase(), {
+ detail: event,
+ cancelable: true
+ });
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else if (typeof Event === "function") {
+ var event = new Event("CustomEvent");
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = new Event(name.toLowerCase(), {
+ cancelable: true
+ });
+ domEvent.detail = event;
+ return !util.global.dispatchEvent(domEvent);
+ };
+ } else {
+ var event = document.createEvent("CustomEvent");
+ event.initCustomEvent("testingtheevent", false, true, {});
+ util.global.dispatchEvent(event);
+ return function(name, event) {
+ var domEvent = document.createEvent("CustomEvent");
+ domEvent.initCustomEvent(name.toLowerCase(), false, true,
+ event);
+ return !util.global.dispatchEvent(domEvent);
+ };
+ }
+ } catch (e) {}
+ return function() {
+ return false;
+ };
+})();
+
+var fireGlobalEvent = (function() {
+ if (util.isNode) {
+ return function() {
+ return process.emit.apply(process, arguments);
+ };
+ } else {
+ if (!util.global) {
+ return function() {
+ return false;
+ };
+ }
+ return function(name) {
+ var methodName = "on" + name.toLowerCase();
+ var method = util.global[methodName];
+ if (!method) return false;
+ method.apply(util.global, [].slice.call(arguments, 1));
+ return true;
+ };
+ }
+})();
+
+function generatePromiseLifecycleEventObject(name, promise) {
+ return {promise: promise};
+}
+
+var eventToObjectGenerator = {
+ promiseCreated: generatePromiseLifecycleEventObject,
+ promiseFulfilled: generatePromiseLifecycleEventObject,
+ promiseRejected: generatePromiseLifecycleEventObject,
+ promiseResolved: generatePromiseLifecycleEventObject,
+ promiseCancelled: generatePromiseLifecycleEventObject,
+ promiseChained: function(name, promise, child) {
+ return {promise: promise, child: child};
+ },
+ warning: function(name, warning) {
+ return {warning: warning};
+ },
+ unhandledRejection: function (name, reason, promise) {
+ return {reason: reason, promise: promise};
+ },
+ rejectionHandled: generatePromiseLifecycleEventObject
+};
+
+var activeFireEvent = function (name) {
+ var globalEventFired = false;
+ try {
+ globalEventFired = fireGlobalEvent.apply(null, arguments);
+ } catch (e) {
+ async.throwLater(e);
+ globalEventFired = true;
+ }
+
+ var domEventFired = false;
+ try {
+ domEventFired = fireDomEvent(name,
+ eventToObjectGenerator[name].apply(null, arguments));
+ } catch (e) {
+ async.throwLater(e);
+ domEventFired = true;
+ }
+
+ return domEventFired || globalEventFired;
+};
+
+Promise.config = function(opts) {
+ opts = Object(opts);
+ if ("longStackTraces" in opts) {
+ if (opts.longStackTraces) {
+ Promise.longStackTraces();
+ } else if (!opts.longStackTraces && Promise.hasLongStackTraces()) {
+ disableLongStackTraces();
+ }
+ }
+ if ("warnings" in opts) {
+ var warningsOption = opts.warnings;
+ config.warnings = !!warningsOption;
+ wForgottenReturn = config.warnings;
+
+ if (util.isObject(warningsOption)) {
+ if ("wForgottenReturn" in warningsOption) {
+ wForgottenReturn = !!warningsOption.wForgottenReturn;
+ }
+ }
+ }
+ if ("cancellation" in opts && opts.cancellation && !config.cancellation) {
+ if (async.haveItemsQueued()) {
+ throw new Error(
+ "cannot enable cancellation after promises are in use");
+ }
+ Promise.prototype._clearCancellationData =
+ cancellationClearCancellationData;
+ Promise.prototype._propagateFrom = cancellationPropagateFrom;
+ Promise.prototype._onCancel = cancellationOnCancel;
+ Promise.prototype._setOnCancel = cancellationSetOnCancel;
+ Promise.prototype._attachCancellationCallback =
+ cancellationAttachCancellationCallback;
+ Promise.prototype._execute = cancellationExecute;
+ propagateFromFunction = cancellationPropagateFrom;
+ config.cancellation = true;
+ }
+ if ("monitoring" in opts) {
+ if (opts.monitoring && !config.monitoring) {
+ config.monitoring = true;
+ Promise.prototype._fireEvent = activeFireEvent;
+ } else if (!opts.monitoring && config.monitoring) {
+ config.monitoring = false;
+ Promise.prototype._fireEvent = defaultFireEvent;
+ }
+ }
+ return Promise;
+};
+
+function defaultFireEvent() { return false; }
+
+Promise.prototype._fireEvent = defaultFireEvent;
+Promise.prototype._execute = function(executor, resolve, reject) {
+ try {
+ executor(resolve, reject);
+ } catch (e) {
+ return e;
+ }
+};
+Promise.prototype._onCancel = function () {};
+Promise.prototype._setOnCancel = function (handler) { ; };
+Promise.prototype._attachCancellationCallback = function(onCancel) {
+ ;
+};
+Promise.prototype._captureStackTrace = function () {};
+Promise.prototype._attachExtraTrace = function () {};
+Promise.prototype._clearCancellationData = function() {};
+Promise.prototype._propagateFrom = function (parent, flags) {
+ ;
+ ;
+};
+
+function cancellationExecute(executor, resolve, reject) {
+ var promise = this;
+ try {
+ executor(resolve, reject, function(onCancel) {
+ if (typeof onCancel !== "function") {
+ throw new TypeError("onCancel must be a function, got: " +
+ util.toString(onCancel));
+ }
+ promise._attachCancellationCallback(onCancel);
+ });
+ } catch (e) {
+ return e;
+ }
+}
+
+function cancellationAttachCancellationCallback(onCancel) {
+ if (!this._isCancellable()) return this;
+
+ var previousOnCancel = this._onCancel();
+ if (previousOnCancel !== undefined) {
+ if (util.isArray(previousOnCancel)) {
+ previousOnCancel.push(onCancel);
+ } else {
+ this._setOnCancel([previousOnCancel, onCancel]);
+ }
+ } else {
+ this._setOnCancel(onCancel);
+ }
+}
+
+function cancellationOnCancel() {
+ return this._onCancelField;
+}
+
+function cancellationSetOnCancel(onCancel) {
+ this._onCancelField = onCancel;
+}
+
+function cancellationClearCancellationData() {
+ this._cancellationParent = undefined;
+ this._onCancelField = undefined;
+}
+
+function cancellationPropagateFrom(parent, flags) {
+ if ((flags & 1) !== 0) {
+ this._cancellationParent = parent;
+ var branchesRemainingToCancel = parent._branchesRemainingToCancel;
+ if (branchesRemainingToCancel === undefined) {
+ branchesRemainingToCancel = 0;
+ }
+ parent._branchesRemainingToCancel = branchesRemainingToCancel + 1;
+ }
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+
+function bindingPropagateFrom(parent, flags) {
+ if ((flags & 2) !== 0 && parent._isBound()) {
+ this._setBoundTo(parent._boundTo);
+ }
+}
+var propagateFromFunction = bindingPropagateFrom;
+
+function boundValueFunction() {
+ var ret = this._boundTo;
+ if (ret !== undefined) {
+ if (ret instanceof Promise) {
+ if (ret.isFulfilled()) {
+ return ret.value();
+ } else {
+ return undefined;
+ }
+ }
+ }
+ return ret;
+}
+
+function longStackTracesCaptureStackTrace() {
+ this._trace = new CapturedTrace(this._peekContext());
+}
+
+function longStackTracesAttachExtraTrace(error, ignoreSelf) {
+ if (canAttachTrace(error)) {
+ var trace = this._trace;
+ if (trace !== undefined) {
+ if (ignoreSelf) trace = trace._parent;
+ }
+ if (trace !== undefined) {
+ trace.attachExtraTrace(error);
+ } else if (!error.__stackCleaned__) {
+ var parsed = parseStackAndMessage(error);
+ util.notEnumerableProp(error, "stack",
+ parsed.message + "\n" + parsed.stack.join("\n"));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+ }
+ }
+}
+
+function checkForgottenReturns(returnValue, promiseCreated, name, promise,
+ parent) {
+ if (returnValue === undefined && promiseCreated !== null &&
+ wForgottenReturn) {
+ if (parent !== undefined && parent._returnedNonUndefined()) return;
+ if ((promise._bitField & 65535) === 0) return;
+
+ if (name) name = name + " ";
+ var handlerLine = "";
+ var creatorLine = "";
+ if (promiseCreated._trace) {
+ var traceLines = promiseCreated._trace.stack.split("\n");
+ var stack = cleanStack(traceLines);
+ for (var i = stack.length - 1; i >= 0; --i) {
+ var line = stack[i];
+ if (!nodeFramePattern.test(line)) {
+ var lineMatches = line.match(parseLinePattern);
+ if (lineMatches) {
+ handlerLine = "at " + lineMatches[1] +
+ ":" + lineMatches[2] + ":" + lineMatches[3] + " ";
+ }
+ break;
+ }
+ }
+
+ if (stack.length > 0) {
+ var firstUserLine = stack[0];
+ for (var i = 0; i < traceLines.length; ++i) {
+
+ if (traceLines[i] === firstUserLine) {
+ if (i > 0) {
+ creatorLine = "\n" + traceLines[i - 1];
+ }
+ break;
+ }
+ }
+
+ }
+ }
+ var msg = "a promise was created in a " + name +
+ "handler " + handlerLine + "but was not returned from it, " +
+ "see http://goo.gl/rRqMUw" +
+ creatorLine;
+ promise._warn(msg, true, promiseCreated);
+ }
+}
+
+function deprecated(name, replacement) {
+ var message = name +
+ " is deprecated and will be removed in a future version.";
+ if (replacement) message += " Use " + replacement + " instead.";
+ return warn(message);
+}
+
+function warn(message, shouldUseOwnTrace, promise) {
+ if (!config.warnings) return;
+ var warning = new Warning(message);
+ var ctx;
+ if (shouldUseOwnTrace) {
+ promise._attachExtraTrace(warning);
+ } else if (config.longStackTraces && (ctx = Promise._peekContext())) {
+ ctx.attachExtraTrace(warning);
+ } else {
+ var parsed = parseStackAndMessage(warning);
+ warning.stack = parsed.message + "\n" + parsed.stack.join("\n");
+ }
+
+ if (!activeFireEvent("warning", warning)) {
+ formatAndLogError(warning, "", true);
+ }
+}
+
+function reconstructStack(message, stacks) {
+ for (var i = 0; i < stacks.length - 1; ++i) {
+ stacks[i].push("From previous event:");
+ stacks[i] = stacks[i].join("\n");
+ }
+ if (i < stacks.length) {
+ stacks[i] = stacks[i].join("\n");
+ }
+ return message + "\n" + stacks.join("\n");
+}
+
+function removeDuplicateOrEmptyJumps(stacks) {
+ for (var i = 0; i < stacks.length; ++i) {
+ if (stacks[i].length === 0 ||
+ ((i + 1 < stacks.length) && stacks[i][0] === stacks[i+1][0])) {
+ stacks.splice(i, 1);
+ i--;
+ }
+ }
+}
+
+function removeCommonRoots(stacks) {
+ var current = stacks[0];
+ for (var i = 1; i < stacks.length; ++i) {
+ var prev = stacks[i];
+ var currentLastIndex = current.length - 1;
+ var currentLastLine = current[currentLastIndex];
+ var commonRootMeetPoint = -1;
+
+ for (var j = prev.length - 1; j >= 0; --j) {
+ if (prev[j] === currentLastLine) {
+ commonRootMeetPoint = j;
+ break;
+ }
+ }
+
+ for (var j = commonRootMeetPoint; j >= 0; --j) {
+ var line = prev[j];
+ if (current[currentLastIndex] === line) {
+ current.pop();
+ currentLastIndex--;
+ } else {
+ break;
+ }
+ }
+ current = prev;
+ }
+}
+
+function cleanStack(stack) {
+ var ret = [];
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ var isTraceLine = " (No stack trace)" === line ||
+ stackFramePattern.test(line);
+ var isInternalFrame = isTraceLine && shouldIgnore(line);
+ if (isTraceLine && !isInternalFrame) {
+ if (indentStackFrames && line.charAt(0) !== " ") {
+ line = " " + line;
+ }
+ ret.push(line);
+ }
+ }
+ return ret;
+}
+
+function stackFramesAsArray(error) {
+ var stack = error.stack.replace(/\s+$/g, "").split("\n");
+ for (var i = 0; i < stack.length; ++i) {
+ var line = stack[i];
+ if (" (No stack trace)" === line || stackFramePattern.test(line)) {
+ break;
+ }
+ }
+ if (i > 0 && error.name != "SyntaxError") {
+ stack = stack.slice(i);
+ }
+ return stack;
+}
+
+function parseStackAndMessage(error) {
+ var stack = error.stack;
+ var message = error.toString();
+ stack = typeof stack === "string" && stack.length > 0
+ ? stackFramesAsArray(error) : [" (No stack trace)"];
+ return {
+ message: message,
+ stack: error.name == "SyntaxError" ? stack : cleanStack(stack)
+ };
+}
+
+function formatAndLogError(error, title, isSoft) {
+ if (typeof console !== "undefined") {
+ var message;
+ if (util.isObject(error)) {
+ var stack = error.stack;
+ message = title + formatStack(stack, error);
+ } else {
+ message = title + String(error);
+ }
+ if (typeof printWarning === "function") {
+ printWarning(message, isSoft);
+ } else if (typeof console.log === "function" ||
+ typeof console.log === "object") {
+ console.log(message);
+ }
+ }
+}
+
+function fireRejectionEvent(name, localHandler, reason, promise) {
+ var localEventFired = false;
+ try {
+ if (typeof localHandler === "function") {
+ localEventFired = true;
+ if (name === "rejectionHandled") {
+ localHandler(promise);
+ } else {
+ localHandler(reason, promise);
+ }
+ }
+ } catch (e) {
+ async.throwLater(e);
+ }
+
+ if (name === "unhandledRejection") {
+ if (!activeFireEvent(name, reason, promise) && !localEventFired) {
+ formatAndLogError(reason, "Unhandled rejection ");
+ }
+ } else {
+ activeFireEvent(name, promise);
+ }
+}
+
+function formatNonError(obj) {
+ var str;
+ if (typeof obj === "function") {
+ str = "[function " +
+ (obj.name || "anonymous") +
+ "]";
+ } else {
+ str = obj && typeof obj.toString === "function"
+ ? obj.toString() : util.toString(obj);
+ var ruselessToString = /\[object [a-zA-Z0-9$_]+\]/;
+ if (ruselessToString.test(str)) {
+ try {
+ var newStr = JSON.stringify(obj);
+ str = newStr;
+ }
+ catch(e) {
+
+ }
+ }
+ if (str.length === 0) {
+ str = "(empty array)";
+ }
+ }
+ return ("(<" + snip(str) + ">, no stack trace)");
+}
+
+function snip(str) {
+ var maxChars = 41;
+ if (str.length < maxChars) {
+ return str;
+ }
+ return str.substr(0, maxChars - 3) + "...";
+}
+
+function longStackTracesIsSupported() {
+ return typeof captureStackTrace === "function";
+}
+
+var shouldIgnore = function() { return false; };
+var parseLineInfoRegex = /[\/<\(]([^:\/]+):(\d+):(?:\d+)\)?\s*$/;
+function parseLineInfo(line) {
+ var matches = line.match(parseLineInfoRegex);
+ if (matches) {
+ return {
+ fileName: matches[1],
+ line: parseInt(matches[2], 10)
+ };
+ }
+}
+
+function setBounds(firstLineError, lastLineError) {
+ if (!longStackTracesIsSupported()) return;
+ var firstStackLines = firstLineError.stack.split("\n");
+ var lastStackLines = lastLineError.stack.split("\n");
+ var firstIndex = -1;
+ var lastIndex = -1;
+ var firstFileName;
+ var lastFileName;
+ for (var i = 0; i < firstStackLines.length; ++i) {
+ var result = parseLineInfo(firstStackLines[i]);
+ if (result) {
+ firstFileName = result.fileName;
+ firstIndex = result.line;
+ break;
+ }
+ }
+ for (var i = 0; i < lastStackLines.length; ++i) {
+ var result = parseLineInfo(lastStackLines[i]);
+ if (result) {
+ lastFileName = result.fileName;
+ lastIndex = result.line;
+ break;
+ }
+ }
+ if (firstIndex < 0 || lastIndex < 0 || !firstFileName || !lastFileName ||
+ firstFileName !== lastFileName || firstIndex >= lastIndex) {
+ return;
+ }
+
+ shouldIgnore = function(line) {
+ if (bluebirdFramePattern.test(line)) return true;
+ var info = parseLineInfo(line);
+ if (info) {
+ if (info.fileName === firstFileName &&
+ (firstIndex <= info.line && info.line <= lastIndex)) {
+ return true;
+ }
+ }
+ return false;
+ };
+}
+
+function CapturedTrace(parent) {
+ this._parent = parent;
+ this._promisesCreated = 0;
+ var length = this._length = 1 + (parent === undefined ? 0 : parent._length);
+ captureStackTrace(this, CapturedTrace);
+ if (length > 32) this.uncycle();
+}
+util.inherits(CapturedTrace, Error);
+Context.CapturedTrace = CapturedTrace;
+
+CapturedTrace.prototype.uncycle = function() {
+ var length = this._length;
+ if (length < 2) return;
+ var nodes = [];
+ var stackToIndex = {};
+
+ for (var i = 0, node = this; node !== undefined; ++i) {
+ nodes.push(node);
+ node = node._parent;
+ }
+ length = this._length = i;
+ for (var i = length - 1; i >= 0; --i) {
+ var stack = nodes[i].stack;
+ if (stackToIndex[stack] === undefined) {
+ stackToIndex[stack] = i;
+ }
+ }
+ for (var i = 0; i < length; ++i) {
+ var currentStack = nodes[i].stack;
+ var index = stackToIndex[currentStack];
+ if (index !== undefined && index !== i) {
+ if (index > 0) {
+ nodes[index - 1]._parent = undefined;
+ nodes[index - 1]._length = 1;
+ }
+ nodes[i]._parent = undefined;
+ nodes[i]._length = 1;
+ var cycleEdgeNode = i > 0 ? nodes[i - 1] : this;
+
+ if (index < length - 1) {
+ cycleEdgeNode._parent = nodes[index + 1];
+ cycleEdgeNode._parent.uncycle();
+ cycleEdgeNode._length =
+ cycleEdgeNode._parent._length + 1;
+ } else {
+ cycleEdgeNode._parent = undefined;
+ cycleEdgeNode._length = 1;
+ }
+ var currentChildLength = cycleEdgeNode._length + 1;
+ for (var j = i - 2; j >= 0; --j) {
+ nodes[j]._length = currentChildLength;
+ currentChildLength++;
+ }
+ return;
+ }
+ }
+};
+
+CapturedTrace.prototype.attachExtraTrace = function(error) {
+ if (error.__stackCleaned__) return;
+ this.uncycle();
+ var parsed = parseStackAndMessage(error);
+ var message = parsed.message;
+ var stacks = [parsed.stack];
+
+ var trace = this;
+ while (trace !== undefined) {
+ stacks.push(cleanStack(trace.stack.split("\n")));
+ trace = trace._parent;
+ }
+ removeCommonRoots(stacks);
+ removeDuplicateOrEmptyJumps(stacks);
+ util.notEnumerableProp(error, "stack", reconstructStack(message, stacks));
+ util.notEnumerableProp(error, "__stackCleaned__", true);
+};
+
+var captureStackTrace = (function stackDetection() {
+ var v8stackFramePattern = /^\s*at\s*/;
+ var v8stackFormatter = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if (error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ if (typeof Error.stackTraceLimit === "number" &&
+ typeof Error.captureStackTrace === "function") {
+ Error.stackTraceLimit += 6;
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ var captureStackTrace = Error.captureStackTrace;
+
+ shouldIgnore = function(line) {
+ return bluebirdFramePattern.test(line);
+ };
+ return function(receiver, ignoreUntil) {
+ Error.stackTraceLimit += 6;
+ captureStackTrace(receiver, ignoreUntil);
+ Error.stackTraceLimit -= 6;
+ };
+ }
+ var err = new Error();
+
+ if (typeof err.stack === "string" &&
+ err.stack.split("\n")[0].indexOf("stackDetection@") >= 0) {
+ stackFramePattern = /@/;
+ formatStack = v8stackFormatter;
+ indentStackFrames = true;
+ return function captureStackTrace(o) {
+ o.stack = new Error().stack;
+ };
+ }
+
+ var hasStackAfterThrow;
+ try { throw new Error(); }
+ catch(e) {
+ hasStackAfterThrow = ("stack" in e);
+ }
+ if (!("stack" in err) && hasStackAfterThrow &&
+ typeof Error.stackTraceLimit === "number") {
+ stackFramePattern = v8stackFramePattern;
+ formatStack = v8stackFormatter;
+ return function captureStackTrace(o) {
+ Error.stackTraceLimit += 6;
+ try { throw new Error(); }
+ catch(e) { o.stack = e.stack; }
+ Error.stackTraceLimit -= 6;
+ };
+ }
+
+ formatStack = function(stack, error) {
+ if (typeof stack === "string") return stack;
+
+ if ((typeof error === "object" ||
+ typeof error === "function") &&
+ error.name !== undefined &&
+ error.message !== undefined) {
+ return error.toString();
+ }
+ return formatNonError(error);
+ };
+
+ return null;
+
+})([]);
+
+if (typeof console !== "undefined" && typeof console.warn !== "undefined") {
+ printWarning = function (message) {
+ console.warn(message);
+ };
+ if (util.isNode && process.stderr.isTTY) {
+ printWarning = function(message, isSoft) {
+ var color = isSoft ? "\u001b[33m" : "\u001b[31m";
+ console.warn(color + message + "\u001b[0m\n");
+ };
+ } else if (!util.isNode && typeof (new Error().stack) === "string") {
+ printWarning = function(message, isSoft) {
+ console.warn("%c" + message,
+ isSoft ? "color: darkorange" : "color: red");
+ };
+ }
+}
+
+var config = {
+ warnings: warnings,
+ longStackTraces: false,
+ cancellation: false,
+ monitoring: false
+};
+
+if (longStackTraces) Promise.longStackTraces();
+
+return {
+ longStackTraces: function() {
+ return config.longStackTraces;
+ },
+ warnings: function() {
+ return config.warnings;
+ },
+ cancellation: function() {
+ return config.cancellation;
+ },
+ monitoring: function() {
+ return config.monitoring;
+ },
+ propagateFromFunction: function() {
+ return propagateFromFunction;
+ },
+ boundValueFunction: function() {
+ return boundValueFunction;
+ },
+ checkForgottenReturns: checkForgottenReturns,
+ setBounds: setBounds,
+ warn: warn,
+ deprecated: deprecated,
+ CapturedTrace: CapturedTrace,
+ fireDomEvent: fireDomEvent,
+ fireGlobalEvent: fireGlobalEvent
+};
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/direct_resolve.js b/website_quotation_template/node_modules/bluebird/js/release/direct_resolve.js
new file mode 100644
index 000000000..a89029826
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/direct_resolve.js
@@ -0,0 +1,46 @@
+"use strict";
+module.exports = function(Promise) {
+function returner() {
+ return this.value;
+}
+function thrower() {
+ throw this.reason;
+}
+
+Promise.prototype["return"] =
+Promise.prototype.thenReturn = function (value) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ returner, undefined, undefined, {value: value}, undefined);
+};
+
+Promise.prototype["throw"] =
+Promise.prototype.thenThrow = function (reason) {
+ return this._then(
+ thrower, undefined, undefined, {reason: reason}, undefined);
+};
+
+Promise.prototype.catchThrow = function (reason) {
+ if (arguments.length <= 1) {
+ return this._then(
+ undefined, thrower, undefined, {reason: reason}, undefined);
+ } else {
+ var _reason = arguments[1];
+ var handler = function() {throw _reason;};
+ return this.caught(reason, handler);
+ }
+};
+
+Promise.prototype.catchReturn = function (value) {
+ if (arguments.length <= 1) {
+ if (value instanceof Promise) value.suppressUnhandledRejections();
+ return this._then(
+ undefined, returner, undefined, {value: value}, undefined);
+ } else {
+ var _value = arguments[1];
+ if (_value instanceof Promise) _value.suppressUnhandledRejections();
+ var handler = function() {return _value;};
+ return this.caught(value, handler);
+ }
+};
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/each.js b/website_quotation_template/node_modules/bluebird/js/release/each.js
new file mode 100644
index 000000000..e4f3d05ba
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/each.js
@@ -0,0 +1,30 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseReduce = Promise.reduce;
+var PromiseAll = Promise.all;
+
+function promiseAllThis() {
+ return PromiseAll(this);
+}
+
+function PromiseMapSeries(promises, fn) {
+ return PromiseReduce(promises, fn, INTERNAL, INTERNAL);
+}
+
+Promise.prototype.each = function (fn) {
+ return PromiseReduce(this, fn, INTERNAL, 0)
+ ._then(promiseAllThis, undefined, undefined, this, undefined);
+};
+
+Promise.prototype.mapSeries = function (fn) {
+ return PromiseReduce(this, fn, INTERNAL, INTERNAL);
+};
+
+Promise.each = function (promises, fn) {
+ return PromiseReduce(promises, fn, INTERNAL, 0)
+ ._then(promiseAllThis, undefined, undefined, promises, undefined);
+};
+
+Promise.mapSeries = PromiseMapSeries;
+};
+
diff --git a/website_quotation_template/node_modules/bluebird/js/release/errors.js b/website_quotation_template/node_modules/bluebird/js/release/errors.js
new file mode 100644
index 000000000..f62f323eb
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/errors.js
@@ -0,0 +1,116 @@
+"use strict";
+var es5 = require("./es5");
+var Objectfreeze = es5.freeze;
+var util = require("./util");
+var inherits = util.inherits;
+var notEnumerableProp = util.notEnumerableProp;
+
+function subError(nameProperty, defaultMessage) {
+ function SubError(message) {
+ if (!(this instanceof SubError)) return new SubError(message);
+ notEnumerableProp(this, "message",
+ typeof message === "string" ? message : defaultMessage);
+ notEnumerableProp(this, "name", nameProperty);
+ if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ } else {
+ Error.call(this);
+ }
+ }
+ inherits(SubError, Error);
+ return SubError;
+}
+
+var _TypeError, _RangeError;
+var Warning = subError("Warning", "warning");
+var CancellationError = subError("CancellationError", "cancellation error");
+var TimeoutError = subError("TimeoutError", "timeout error");
+var AggregateError = subError("AggregateError", "aggregate error");
+try {
+ _TypeError = TypeError;
+ _RangeError = RangeError;
+} catch(e) {
+ _TypeError = subError("TypeError", "type error");
+ _RangeError = subError("RangeError", "range error");
+}
+
+var methods = ("join pop push shift unshift slice filter forEach some " +
+ "every map indexOf lastIndexOf reduce reduceRight sort reverse").split(" ");
+
+for (var i = 0; i < methods.length; ++i) {
+ if (typeof Array.prototype[methods[i]] === "function") {
+ AggregateError.prototype[methods[i]] = Array.prototype[methods[i]];
+ }
+}
+
+es5.defineProperty(AggregateError.prototype, "length", {
+ value: 0,
+ configurable: false,
+ writable: true,
+ enumerable: true
+});
+AggregateError.prototype["isOperational"] = true;
+var level = 0;
+AggregateError.prototype.toString = function() {
+ var indent = Array(level * 4 + 1).join(" ");
+ var ret = "\n" + indent + "AggregateError of:" + "\n";
+ level++;
+ indent = Array(level * 4 + 1).join(" ");
+ for (var i = 0; i < this.length; ++i) {
+ var str = this[i] === this ? "[Circular AggregateError]" : this[i] + "";
+ var lines = str.split("\n");
+ for (var j = 0; j < lines.length; ++j) {
+ lines[j] = indent + lines[j];
+ }
+ str = lines.join("\n");
+ ret += str + "\n";
+ }
+ level--;
+ return ret;
+};
+
+function OperationalError(message) {
+ if (!(this instanceof OperationalError))
+ return new OperationalError(message);
+ notEnumerableProp(this, "name", "OperationalError");
+ notEnumerableProp(this, "message", message);
+ this.cause = message;
+ this["isOperational"] = true;
+
+ if (message instanceof Error) {
+ notEnumerableProp(this, "message", message.message);
+ notEnumerableProp(this, "stack", message.stack);
+ } else if (Error.captureStackTrace) {
+ Error.captureStackTrace(this, this.constructor);
+ }
+
+}
+inherits(OperationalError, Error);
+
+var errorTypes = Error["__BluebirdErrorTypes__"];
+if (!errorTypes) {
+ errorTypes = Objectfreeze({
+ CancellationError: CancellationError,
+ TimeoutError: TimeoutError,
+ OperationalError: OperationalError,
+ RejectionError: OperationalError,
+ AggregateError: AggregateError
+ });
+ es5.defineProperty(Error, "__BluebirdErrorTypes__", {
+ value: errorTypes,
+ writable: false,
+ enumerable: false,
+ configurable: false
+ });
+}
+
+module.exports = {
+ Error: Error,
+ TypeError: _TypeError,
+ RangeError: _RangeError,
+ CancellationError: errorTypes.CancellationError,
+ OperationalError: errorTypes.OperationalError,
+ TimeoutError: errorTypes.TimeoutError,
+ AggregateError: errorTypes.AggregateError,
+ Warning: Warning
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/es5.js b/website_quotation_template/node_modules/bluebird/js/release/es5.js
new file mode 100644
index 000000000..ea41d5a56
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/es5.js
@@ -0,0 +1,80 @@
+var isES5 = (function(){
+ "use strict";
+ return this === undefined;
+})();
+
+if (isES5) {
+ module.exports = {
+ freeze: Object.freeze,
+ defineProperty: Object.defineProperty,
+ getDescriptor: Object.getOwnPropertyDescriptor,
+ keys: Object.keys,
+ names: Object.getOwnPropertyNames,
+ getPrototypeOf: Object.getPrototypeOf,
+ isArray: Array.isArray,
+ isES5: isES5,
+ propertyIsWritable: function(obj, prop) {
+ var descriptor = Object.getOwnPropertyDescriptor(obj, prop);
+ return !!(!descriptor || descriptor.writable || descriptor.set);
+ }
+ };
+} else {
+ var has = {}.hasOwnProperty;
+ var str = {}.toString;
+ var proto = {}.constructor.prototype;
+
+ var ObjectKeys = function (o) {
+ var ret = [];
+ for (var key in o) {
+ if (has.call(o, key)) {
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+
+ var ObjectGetDescriptor = function(o, key) {
+ return {value: o[key]};
+ };
+
+ var ObjectDefineProperty = function (o, key, desc) {
+ o[key] = desc.value;
+ return o;
+ };
+
+ var ObjectFreeze = function (obj) {
+ return obj;
+ };
+
+ var ObjectGetPrototypeOf = function (obj) {
+ try {
+ return Object(obj).constructor.prototype;
+ }
+ catch (e) {
+ return proto;
+ }
+ };
+
+ var ArrayIsArray = function (obj) {
+ try {
+ return str.call(obj) === "[object Array]";
+ }
+ catch(e) {
+ return false;
+ }
+ };
+
+ module.exports = {
+ isArray: ArrayIsArray,
+ keys: ObjectKeys,
+ names: ObjectKeys,
+ defineProperty: ObjectDefineProperty,
+ getDescriptor: ObjectGetDescriptor,
+ freeze: ObjectFreeze,
+ getPrototypeOf: ObjectGetPrototypeOf,
+ isES5: isES5,
+ propertyIsWritable: function() {
+ return true;
+ }
+ };
+}
diff --git a/website_quotation_template/node_modules/bluebird/js/release/filter.js b/website_quotation_template/node_modules/bluebird/js/release/filter.js
new file mode 100644
index 000000000..ed57bf015
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/filter.js
@@ -0,0 +1,12 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var PromiseMap = Promise.map;
+
+Promise.prototype.filter = function (fn, options) {
+ return PromiseMap(this, fn, options, INTERNAL);
+};
+
+Promise.filter = function (promises, fn, options) {
+ return PromiseMap(promises, fn, options, INTERNAL);
+};
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/finally.js b/website_quotation_template/node_modules/bluebird/js/release/finally.js
new file mode 100644
index 000000000..371791121
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/finally.js
@@ -0,0 +1,111 @@
+"use strict";
+module.exports = function(Promise, tryConvertToPromise) {
+var util = require("./util");
+var CancellationError = Promise.CancellationError;
+var errorObj = util.errorObj;
+
+function PassThroughHandlerContext(promise, type, handler) {
+ this.promise = promise;
+ this.type = type;
+ this.handler = handler;
+ this.called = false;
+ this.cancelPromise = null;
+}
+
+PassThroughHandlerContext.prototype.isFinallyHandler = function() {
+ return this.type === 0;
+};
+
+function FinallyHandlerCancelReaction(finallyHandler) {
+ this.finallyHandler = finallyHandler;
+}
+
+FinallyHandlerCancelReaction.prototype._resultCancelled = function() {
+ checkCancel(this.finallyHandler);
+};
+
+function checkCancel(ctx, reason) {
+ if (ctx.cancelPromise != null) {
+ if (arguments.length > 1) {
+ ctx.cancelPromise._reject(reason);
+ } else {
+ ctx.cancelPromise._cancel();
+ }
+ ctx.cancelPromise = null;
+ return true;
+ }
+ return false;
+}
+
+function succeed() {
+ return finallyHandler.call(this, this.promise._target()._settledValue());
+}
+function fail(reason) {
+ if (checkCancel(this, reason)) return;
+ errorObj.e = reason;
+ return errorObj;
+}
+function finallyHandler(reasonOrValue) {
+ var promise = this.promise;
+ var handler = this.handler;
+
+ if (!this.called) {
+ this.called = true;
+ var ret = this.isFinallyHandler()
+ ? handler.call(promise._boundValue())
+ : handler.call(promise._boundValue(), reasonOrValue);
+ if (ret !== undefined) {
+ promise._setReturnedNonUndefined();
+ var maybePromise = tryConvertToPromise(ret, promise);
+ if (maybePromise instanceof Promise) {
+ if (this.cancelPromise != null) {
+ if (maybePromise._isCancelled()) {
+ var reason =
+ new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ errorObj.e = reason;
+ return errorObj;
+ } else if (maybePromise.isPending()) {
+ maybePromise._attachCancellationCallback(
+ new FinallyHandlerCancelReaction(this));
+ }
+ }
+ return maybePromise._then(
+ succeed, fail, undefined, this, undefined);
+ }
+ }
+ }
+
+ if (promise.isRejected()) {
+ checkCancel(this);
+ errorObj.e = reasonOrValue;
+ return errorObj;
+ } else {
+ checkCancel(this);
+ return reasonOrValue;
+ }
+}
+
+Promise.prototype._passThrough = function(handler, type, success, fail) {
+ if (typeof handler !== "function") return this.then();
+ return this._then(success,
+ fail,
+ undefined,
+ new PassThroughHandlerContext(this, type, handler),
+ undefined);
+};
+
+Promise.prototype.lastly =
+Promise.prototype["finally"] = function (handler) {
+ return this._passThrough(handler,
+ 0,
+ finallyHandler,
+ finallyHandler);
+};
+
+Promise.prototype.tap = function (handler) {
+ return this._passThrough(handler, 1, finallyHandler);
+};
+
+return PassThroughHandlerContext;
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/generators.js b/website_quotation_template/node_modules/bluebird/js/release/generators.js
new file mode 100644
index 000000000..40e9b1fa6
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/generators.js
@@ -0,0 +1,223 @@
+"use strict";
+module.exports = function(Promise,
+ apiRejection,
+ INTERNAL,
+ tryConvertToPromise,
+ Proxyable,
+ debug) {
+var errors = require("./errors");
+var TypeError = errors.TypeError;
+var util = require("./util");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+var yieldHandlers = [];
+
+function promiseFromYieldHandler(value, yieldHandlers, traceParent) {
+ for (var i = 0; i < yieldHandlers.length; ++i) {
+ traceParent._pushContext();
+ var result = tryCatch(yieldHandlers[i])(value);
+ traceParent._popContext();
+ if (result === errorObj) {
+ traceParent._pushContext();
+ var ret = Promise.reject(errorObj.e);
+ traceParent._popContext();
+ return ret;
+ }
+ var maybePromise = tryConvertToPromise(result, traceParent);
+ if (maybePromise instanceof Promise) return maybePromise;
+ }
+ return null;
+}
+
+function PromiseSpawn(generatorFunction, receiver, yieldHandler, stack) {
+ if (debug.cancellation()) {
+ var internal = new Promise(INTERNAL);
+ var _finallyPromise = this._finallyPromise = new Promise(INTERNAL);
+ this._promise = internal.lastly(function() {
+ return _finallyPromise;
+ });
+ internal._captureStackTrace();
+ internal._setOnCancel(this);
+ } else {
+ var promise = this._promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ }
+ this._stack = stack;
+ this._generatorFunction = generatorFunction;
+ this._receiver = receiver;
+ this._generator = undefined;
+ this._yieldHandlers = typeof yieldHandler === "function"
+ ? [yieldHandler].concat(yieldHandlers)
+ : yieldHandlers;
+ this._yieldedPromise = null;
+ this._cancellationPhase = false;
+}
+util.inherits(PromiseSpawn, Proxyable);
+
+PromiseSpawn.prototype._isResolved = function() {
+ return this._promise === null;
+};
+
+PromiseSpawn.prototype._cleanup = function() {
+ this._promise = this._generator = null;
+ if (debug.cancellation() && this._finallyPromise !== null) {
+ this._finallyPromise._fulfill();
+ this._finallyPromise = null;
+ }
+};
+
+PromiseSpawn.prototype._promiseCancelled = function() {
+ if (this._isResolved()) return;
+ var implementsReturn = typeof this._generator["return"] !== "undefined";
+
+ var result;
+ if (!implementsReturn) {
+ var reason = new Promise.CancellationError(
+ "generator .return() sentinel");
+ Promise.coroutine.returnSentinel = reason;
+ this._promise._attachExtraTrace(reason);
+ this._promise._pushContext();
+ result = tryCatch(this._generator["throw"]).call(this._generator,
+ reason);
+ this._promise._popContext();
+ } else {
+ this._promise._pushContext();
+ result = tryCatch(this._generator["return"]).call(this._generator,
+ undefined);
+ this._promise._popContext();
+ }
+ this._cancellationPhase = true;
+ this._yieldedPromise = null;
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._promiseFulfilled = function(value) {
+ this._yieldedPromise = null;
+ this._promise._pushContext();
+ var result = tryCatch(this._generator.next).call(this._generator, value);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._promiseRejected = function(reason) {
+ this._yieldedPromise = null;
+ this._promise._attachExtraTrace(reason);
+ this._promise._pushContext();
+ var result = tryCatch(this._generator["throw"])
+ .call(this._generator, reason);
+ this._promise._popContext();
+ this._continue(result);
+};
+
+PromiseSpawn.prototype._resultCancelled = function() {
+ if (this._yieldedPromise instanceof Promise) {
+ var promise = this._yieldedPromise;
+ this._yieldedPromise = null;
+ promise.cancel();
+ }
+};
+
+PromiseSpawn.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseSpawn.prototype._run = function () {
+ this._generator = this._generatorFunction.call(this._receiver);
+ this._receiver =
+ this._generatorFunction = undefined;
+ this._promiseFulfilled(undefined);
+};
+
+PromiseSpawn.prototype._continue = function (result) {
+ var promise = this._promise;
+ if (result === errorObj) {
+ this._cleanup();
+ if (this._cancellationPhase) {
+ return promise.cancel();
+ } else {
+ return promise._rejectCallback(result.e, false);
+ }
+ }
+
+ var value = result.value;
+ if (result.done === true) {
+ this._cleanup();
+ if (this._cancellationPhase) {
+ return promise.cancel();
+ } else {
+ return promise._resolveCallback(value);
+ }
+ } else {
+ var maybePromise = tryConvertToPromise(value, this._promise);
+ if (!(maybePromise instanceof Promise)) {
+ maybePromise =
+ promiseFromYieldHandler(maybePromise,
+ this._yieldHandlers,
+ this._promise);
+ if (maybePromise === null) {
+ this._promiseRejected(
+ new TypeError(
+ "A value %s was yielded that could not be treated as a promise\u000a\u000a See http://goo.gl/MqrFmX\u000a\u000a".replace("%s", value) +
+ "From coroutine:\u000a" +
+ this._stack.split("\n").slice(1, -7).join("\n")
+ )
+ );
+ return;
+ }
+ }
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ this._yieldedPromise = maybePromise;
+ maybePromise._proxy(this, null);
+ } else if (((bitField & 33554432) !== 0)) {
+ Promise._async.invoke(
+ this._promiseFulfilled, this, maybePromise._value()
+ );
+ } else if (((bitField & 16777216) !== 0)) {
+ Promise._async.invoke(
+ this._promiseRejected, this, maybePromise._reason()
+ );
+ } else {
+ this._promiseCancelled();
+ }
+ }
+};
+
+Promise.coroutine = function (generatorFunction, options) {
+ if (typeof generatorFunction !== "function") {
+ throw new TypeError("generatorFunction must be a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var yieldHandler = Object(options).yieldHandler;
+ var PromiseSpawn$ = PromiseSpawn;
+ var stack = new Error().stack;
+ return function () {
+ var generator = generatorFunction.apply(this, arguments);
+ var spawn = new PromiseSpawn$(undefined, undefined, yieldHandler,
+ stack);
+ var ret = spawn.promise();
+ spawn._generator = generator;
+ spawn._promiseFulfilled(undefined);
+ return ret;
+ };
+};
+
+Promise.coroutine.addYieldHandler = function(fn) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ yieldHandlers.push(fn);
+};
+
+Promise.spawn = function (generatorFunction) {
+ debug.deprecated("Promise.spawn()", "Promise.coroutine()");
+ if (typeof generatorFunction !== "function") {
+ return apiRejection("generatorFunction must be a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var spawn = new PromiseSpawn(generatorFunction, this);
+ var ret = spawn.promise();
+ spawn._run(Promise.spawn);
+ return ret;
+};
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/join.js b/website_quotation_template/node_modules/bluebird/js/release/join.js
new file mode 100644
index 000000000..4945e3f78
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/join.js
@@ -0,0 +1,168 @@
+"use strict";
+module.exports =
+function(Promise, PromiseArray, tryConvertToPromise, INTERNAL, async,
+ getDomain) {
+var util = require("./util");
+var canEvaluate = util.canEvaluate;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var reject;
+
+if (!false) {
+if (canEvaluate) {
+ var thenCallback = function(i) {
+ return new Function("value", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = value; \n\
+ holder.checkFulfillment(this); \n\
+ ".replace(/Index/g, i));
+ };
+
+ var promiseSetter = function(i) {
+ return new Function("promise", "holder", " \n\
+ 'use strict'; \n\
+ holder.pIndex = promise; \n\
+ ".replace(/Index/g, i));
+ };
+
+ var generateHolderClass = function(total) {
+ var props = new Array(total);
+ for (var i = 0; i < props.length; ++i) {
+ props[i] = "this.p" + (i+1);
+ }
+ var assignment = props.join(" = ") + " = null;";
+ var cancellationCode= "var promise;\n" + props.map(function(prop) {
+ return " \n\
+ promise = " + prop + "; \n\
+ if (promise instanceof Promise) { \n\
+ promise.cancel(); \n\
+ } \n\
+ ";
+ }).join("\n");
+ var passedArguments = props.join(", ");
+ var name = "Holder$" + total;
+
+
+ var code = "return function(tryCatch, errorObj, Promise, async) { \n\
+ 'use strict'; \n\
+ function [TheName](fn) { \n\
+ [TheProperties] \n\
+ this.fn = fn; \n\
+ this.asyncNeeded = true; \n\
+ this.now = 0; \n\
+ } \n\
+ \n\
+ [TheName].prototype._callFunction = function(promise) { \n\
+ promise._pushContext(); \n\
+ var ret = tryCatch(this.fn)([ThePassedArguments]); \n\
+ promise._popContext(); \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(ret.e, false); \n\
+ } else { \n\
+ promise._resolveCallback(ret); \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype.checkFulfillment = function(promise) { \n\
+ var now = ++this.now; \n\
+ if (now === [TheTotal]) { \n\
+ if (this.asyncNeeded) { \n\
+ async.invoke(this._callFunction, this, promise); \n\
+ } else { \n\
+ this._callFunction(promise); \n\
+ } \n\
+ \n\
+ } \n\
+ }; \n\
+ \n\
+ [TheName].prototype._resultCancelled = function() { \n\
+ [CancellationCode] \n\
+ }; \n\
+ \n\
+ return [TheName]; \n\
+ }(tryCatch, errorObj, Promise, async); \n\
+ ";
+
+ code = code.replace(/\[TheName\]/g, name)
+ .replace(/\[TheTotal\]/g, total)
+ .replace(/\[ThePassedArguments\]/g, passedArguments)
+ .replace(/\[TheProperties\]/g, assignment)
+ .replace(/\[CancellationCode\]/g, cancellationCode);
+
+ return new Function("tryCatch", "errorObj", "Promise", "async", code)
+ (tryCatch, errorObj, Promise, async);
+ };
+
+ var holderClasses = [];
+ var thenCallbacks = [];
+ var promiseSetters = [];
+
+ for (var i = 0; i < 8; ++i) {
+ holderClasses.push(generateHolderClass(i + 1));
+ thenCallbacks.push(thenCallback(i + 1));
+ promiseSetters.push(promiseSetter(i + 1));
+ }
+
+ reject = function (reason) {
+ this._reject(reason);
+ };
+}}
+
+Promise.join = function () {
+ var last = arguments.length - 1;
+ var fn;
+ if (last > 0 && typeof arguments[last] === "function") {
+ fn = arguments[last];
+ if (!false) {
+ if (last <= 8 && canEvaluate) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var HolderClass = holderClasses[last - 1];
+ var holder = new HolderClass(fn);
+ var callbacks = thenCallbacks;
+
+ for (var i = 0; i < last; ++i) {
+ var maybePromise = tryConvertToPromise(arguments[i], ret);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._then(callbacks[i], reject,
+ undefined, ret, holder);
+ promiseSetters[i](maybePromise, holder);
+ holder.asyncNeeded = false;
+ } else if (((bitField & 33554432) !== 0)) {
+ callbacks[i].call(ret,
+ maybePromise._value(), holder);
+ } else if (((bitField & 16777216) !== 0)) {
+ ret._reject(maybePromise._reason());
+ } else {
+ ret._cancel();
+ }
+ } else {
+ callbacks[i].call(ret, maybePromise, holder);
+ }
+ }
+
+ if (!ret._isFateSealed()) {
+ if (holder.asyncNeeded) {
+ var domain = getDomain();
+ if (domain !== null) {
+ holder.fn = util.domainBind(domain, holder.fn);
+ }
+ }
+ ret._setAsyncGuaranteed();
+ ret._setOnCancel(holder);
+ }
+ return ret;
+ }
+ }
+ }
+ var $_len = arguments.length;var args = new Array($_len); for(var $_i = 0; $_i < $_len; ++$_i) {args[$_i] = arguments[$_i];};
+ if (fn) args.pop();
+ var ret = new PromiseArray(args).promise();
+ return fn !== undefined ? ret.spread(fn) : ret;
+};
+
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/map.js b/website_quotation_template/node_modules/bluebird/js/release/map.js
new file mode 100644
index 000000000..976f15ef2
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/map.js
@@ -0,0 +1,168 @@
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL,
+ debug) {
+var getDomain = Promise._getDomain;
+var util = require("./util");
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+var async = Promise._async;
+
+function MappingPromiseArray(promises, fn, limit, _filter) {
+ this.constructor$(promises);
+ this._promise._captureStackTrace();
+ var domain = getDomain();
+ this._callback = domain === null ? fn : util.domainBind(domain, fn);
+ this._preservedValues = _filter === INTERNAL
+ ? new Array(this.length())
+ : null;
+ this._limit = limit;
+ this._inFlight = 0;
+ this._queue = [];
+ async.invoke(this._asyncInit, this, undefined);
+}
+util.inherits(MappingPromiseArray, PromiseArray);
+
+MappingPromiseArray.prototype._asyncInit = function() {
+ this._init$(undefined, -2);
+};
+
+MappingPromiseArray.prototype._init = function () {};
+
+MappingPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var values = this._values;
+ var length = this.length();
+ var preservedValues = this._preservedValues;
+ var limit = this._limit;
+
+ if (index < 0) {
+ index = (index * -1) - 1;
+ values[index] = value;
+ if (limit >= 1) {
+ this._inFlight--;
+ this._drainQueue();
+ if (this._isResolved()) return true;
+ }
+ } else {
+ if (limit >= 1 && this._inFlight >= limit) {
+ values[index] = value;
+ this._queue.push(index);
+ return false;
+ }
+ if (preservedValues !== null) preservedValues[index] = value;
+
+ var promise = this._promise;
+ var callback = this._callback;
+ var receiver = promise._boundValue();
+ promise._pushContext();
+ var ret = tryCatch(callback).call(receiver, value, index, length);
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret,
+ promiseCreated,
+ preservedValues !== null ? "Promise.filter" : "Promise.map",
+ promise
+ );
+ if (ret === errorObj) {
+ this._reject(ret.e);
+ return true;
+ }
+
+ var maybePromise = tryConvertToPromise(ret, this._promise);
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ var bitField = maybePromise._bitField;
+ ;
+ if (((bitField & 50397184) === 0)) {
+ if (limit >= 1) this._inFlight++;
+ values[index] = maybePromise;
+ maybePromise._proxy(this, (index + 1) * -1);
+ return false;
+ } else if (((bitField & 33554432) !== 0)) {
+ ret = maybePromise._value();
+ } else if (((bitField & 16777216) !== 0)) {
+ this._reject(maybePromise._reason());
+ return true;
+ } else {
+ this._cancel();
+ return true;
+ }
+ }
+ values[index] = ret;
+ }
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= length) {
+ if (preservedValues !== null) {
+ this._filter(values, preservedValues);
+ } else {
+ this._resolve(values);
+ }
+ return true;
+ }
+ return false;
+};
+
+MappingPromiseArray.prototype._drainQueue = function () {
+ var queue = this._queue;
+ var limit = this._limit;
+ var values = this._values;
+ while (queue.length > 0 && this._inFlight < limit) {
+ if (this._isResolved()) return;
+ var index = queue.pop();
+ this._promiseFulfilled(values[index], index);
+ }
+};
+
+MappingPromiseArray.prototype._filter = function (booleans, values) {
+ var len = values.length;
+ var ret = new Array(len);
+ var j = 0;
+ for (var i = 0; i < len; ++i) {
+ if (booleans[i]) ret[j++] = values[i];
+ }
+ ret.length = j;
+ this._resolve(ret);
+};
+
+MappingPromiseArray.prototype.preservedValues = function () {
+ return this._preservedValues;
+};
+
+function map(promises, fn, options, _filter) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+
+ var limit = 0;
+ if (options !== undefined) {
+ if (typeof options === "object" && options !== null) {
+ if (typeof options.concurrency !== "number") {
+ return Promise.reject(
+ new TypeError("'concurrency' must be a number but it is " +
+ util.classString(options.concurrency)));
+ }
+ limit = options.concurrency;
+ } else {
+ return Promise.reject(new TypeError(
+ "options argument must be an object but it is " +
+ util.classString(options)));
+ }
+ }
+ limit = typeof limit === "number" &&
+ isFinite(limit) && limit >= 1 ? limit : 0;
+ return new MappingPromiseArray(promises, fn, limit, _filter).promise();
+}
+
+Promise.prototype.map = function (fn, options) {
+ return map(this, fn, options, null);
+};
+
+Promise.map = function (promises, fn, options, _filter) {
+ return map(promises, fn, options, _filter);
+};
+
+
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/method.js b/website_quotation_template/node_modules/bluebird/js/release/method.js
new file mode 100644
index 000000000..ce9e4db7e
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/method.js
@@ -0,0 +1,55 @@
+"use strict";
+module.exports =
+function(Promise, INTERNAL, tryConvertToPromise, apiRejection, debug) {
+var util = require("./util");
+var tryCatch = util.tryCatch;
+
+Promise.method = function (fn) {
+ if (typeof fn !== "function") {
+ throw new Promise.TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return function () {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value = tryCatch(fn).apply(this, arguments);
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.method", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+ };
+};
+
+Promise.attempt = Promise["try"] = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._pushContext();
+ var value;
+ if (arguments.length > 1) {
+ debug.deprecated("calling Promise.try with more than 1 argument");
+ var arg = arguments[1];
+ var ctx = arguments[2];
+ value = util.isArray(arg) ? tryCatch(fn).apply(ctx, arg)
+ : tryCatch(fn).call(ctx, arg);
+ } else {
+ value = tryCatch(fn)();
+ }
+ var promiseCreated = ret._popContext();
+ debug.checkForgottenReturns(
+ value, promiseCreated, "Promise.try", ret);
+ ret._resolveFromSyncValue(value);
+ return ret;
+};
+
+Promise.prototype._resolveFromSyncValue = function (value) {
+ if (value === util.errorObj) {
+ this._rejectCallback(value.e, false);
+ } else {
+ this._resolveCallback(value, true);
+ }
+};
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/nodeback.js b/website_quotation_template/node_modules/bluebird/js/release/nodeback.js
new file mode 100644
index 000000000..71e69ebdb
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/nodeback.js
@@ -0,0 +1,51 @@
+"use strict";
+var util = require("./util");
+var maybeWrapAsError = util.maybeWrapAsError;
+var errors = require("./errors");
+var OperationalError = errors.OperationalError;
+var es5 = require("./es5");
+
+function isUntypedError(obj) {
+ return obj instanceof Error &&
+ es5.getPrototypeOf(obj) === Error.prototype;
+}
+
+var rErrorKey = /^(?:name|message|stack|cause)$/;
+function wrapAsOperationalError(obj) {
+ var ret;
+ if (isUntypedError(obj)) {
+ ret = new OperationalError(obj);
+ ret.name = obj.name;
+ ret.message = obj.message;
+ ret.stack = obj.stack;
+ var keys = es5.keys(obj);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (!rErrorKey.test(key)) {
+ ret[key] = obj[key];
+ }
+ }
+ return ret;
+ }
+ util.markAsOriginatingFromRejection(obj);
+ return obj;
+}
+
+function nodebackForPromise(promise, multiArgs) {
+ return function(err, value) {
+ if (promise === null) return;
+ if (err) {
+ var wrapped = wrapAsOperationalError(maybeWrapAsError(err));
+ promise._attachExtraTrace(wrapped);
+ promise._reject(wrapped);
+ } else if (!multiArgs) {
+ promise._fulfill(value);
+ } else {
+ var $_len = arguments.length;var args = new Array(Math.max($_len - 1, 0)); for(var $_i = 1; $_i < $_len; ++$_i) {args[$_i - 1] = arguments[$_i];};
+ promise._fulfill(args);
+ }
+ promise = null;
+ };
+}
+
+module.exports = nodebackForPromise;
diff --git a/website_quotation_template/node_modules/bluebird/js/release/nodeify.js b/website_quotation_template/node_modules/bluebird/js/release/nodeify.js
new file mode 100644
index 000000000..ce2b19004
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/nodeify.js
@@ -0,0 +1,58 @@
+"use strict";
+module.exports = function(Promise) {
+var util = require("./util");
+var async = Promise._async;
+var tryCatch = util.tryCatch;
+var errorObj = util.errorObj;
+
+function spreadAdapter(val, nodeback) {
+ var promise = this;
+ if (!util.isArray(val)) return successAdapter.call(promise, val, nodeback);
+ var ret =
+ tryCatch(nodeback).apply(promise._boundValue(), [null].concat(val));
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+function successAdapter(val, nodeback) {
+ var promise = this;
+ var receiver = promise._boundValue();
+ var ret = val === undefined
+ ? tryCatch(nodeback).call(receiver, null)
+ : tryCatch(nodeback).call(receiver, null, val);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+function errorAdapter(reason, nodeback) {
+ var promise = this;
+ if (!reason) {
+ var newReason = new Error(reason + "");
+ newReason.cause = reason;
+ reason = newReason;
+ }
+ var ret = tryCatch(nodeback).call(promise._boundValue(), reason);
+ if (ret === errorObj) {
+ async.throwLater(ret.e);
+ }
+}
+
+Promise.prototype.asCallback = Promise.prototype.nodeify = function (nodeback,
+ options) {
+ if (typeof nodeback == "function") {
+ var adapter = successAdapter;
+ if (options !== undefined && Object(options).spread) {
+ adapter = spreadAdapter;
+ }
+ this._then(
+ adapter,
+ errorAdapter,
+ undefined,
+ this,
+ nodeback
+ );
+ }
+ return this;
+};
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/promise.js b/website_quotation_template/node_modules/bluebird/js/release/promise.js
new file mode 100644
index 000000000..f699a539a
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/promise.js
@@ -0,0 +1,773 @@
+"use strict";
+module.exports = function() {
+var makeSelfResolutionError = function () {
+ return new TypeError("circular promise resolution chain\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var reflectHandler = function() {
+ return new Promise.PromiseInspection(this._target());
+};
+var apiRejection = function(msg) {
+ return Promise.reject(new TypeError(msg));
+};
+function Proxyable() {}
+var UNDEFINED_BINDING = {};
+var util = require("./util");
+
+var getDomain;
+if (util.isNode) {
+ getDomain = function() {
+ var ret = process.domain;
+ if (ret === undefined) ret = null;
+ return ret;
+ };
+} else {
+ getDomain = function() {
+ return null;
+ };
+}
+util.notEnumerableProp(Promise, "_getDomain", getDomain);
+
+var es5 = require("./es5");
+var Async = require("./async");
+var async = new Async();
+es5.defineProperty(Promise, "_async", {value: async});
+var errors = require("./errors");
+var TypeError = Promise.TypeError = errors.TypeError;
+Promise.RangeError = errors.RangeError;
+var CancellationError = Promise.CancellationError = errors.CancellationError;
+Promise.TimeoutError = errors.TimeoutError;
+Promise.OperationalError = errors.OperationalError;
+Promise.RejectionError = errors.OperationalError;
+Promise.AggregateError = errors.AggregateError;
+var INTERNAL = function(){};
+var APPLY = {};
+var NEXT_FILTER = {};
+var tryConvertToPromise = require("./thenables")(Promise, INTERNAL);
+var PromiseArray =
+ require("./promise_array")(Promise, INTERNAL,
+ tryConvertToPromise, apiRejection, Proxyable);
+var Context = require("./context")(Promise);
+ /*jshint unused:false*/
+var createContext = Context.create;
+var debug = require("./debuggability")(Promise, Context);
+var CapturedTrace = debug.CapturedTrace;
+var PassThroughHandlerContext =
+ require("./finally")(Promise, tryConvertToPromise);
+var catchFilter = require("./catch_filter")(NEXT_FILTER);
+var nodebackForPromise = require("./nodeback");
+var errorObj = util.errorObj;
+var tryCatch = util.tryCatch;
+function check(self, executor) {
+ if (typeof executor !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(executor));
+ }
+ if (self.constructor !== Promise) {
+ throw new TypeError("the promise constructor cannot be invoked directly\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+}
+
+function Promise(executor) {
+ this._bitField = 0;
+ this._fulfillmentHandler0 = undefined;
+ this._rejectionHandler0 = undefined;
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ if (executor !== INTERNAL) {
+ check(this, executor);
+ this._resolveFromExecutor(executor);
+ }
+ this._promiseCreated();
+ this._fireEvent("promiseCreated", this);
+}
+
+Promise.prototype.toString = function () {
+ return "[object Promise]";
+};
+
+Promise.prototype.caught = Promise.prototype["catch"] = function (fn) {
+ var len = arguments.length;
+ if (len > 1) {
+ var catchInstances = new Array(len - 1),
+ j = 0, i;
+ for (i = 0; i < len - 1; ++i) {
+ var item = arguments[i];
+ if (util.isObject(item)) {
+ catchInstances[j++] = item;
+ } else {
+ return apiRejection("expecting an object but got " +
+ "A catch statement predicate " + util.classString(item));
+ }
+ }
+ catchInstances.length = j;
+ fn = arguments[i];
+ return this.then(undefined, catchFilter(catchInstances, fn, this));
+ }
+ return this.then(undefined, fn);
+};
+
+Promise.prototype.reflect = function () {
+ return this._then(reflectHandler,
+ reflectHandler, undefined, this, undefined);
+};
+
+Promise.prototype.then = function (didFulfill, didReject) {
+ if (debug.warnings() && arguments.length > 0 &&
+ typeof didFulfill !== "function" &&
+ typeof didReject !== "function") {
+ var msg = ".then() only accepts functions but was passed: " +
+ util.classString(didFulfill);
+ if (arguments.length > 1) {
+ msg += ", " + util.classString(didReject);
+ }
+ this._warn(msg);
+ }
+ return this._then(didFulfill, didReject, undefined, undefined, undefined);
+};
+
+Promise.prototype.done = function (didFulfill, didReject) {
+ var promise =
+ this._then(didFulfill, didReject, undefined, undefined, undefined);
+ promise._setIsFinal();
+};
+
+Promise.prototype.spread = function (fn) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ return this.all()._then(fn, undefined, undefined, APPLY, undefined);
+};
+
+Promise.prototype.toJSON = function () {
+ var ret = {
+ isFulfilled: false,
+ isRejected: false,
+ fulfillmentValue: undefined,
+ rejectionReason: undefined
+ };
+ if (this.isFulfilled()) {
+ ret.fulfillmentValue = this.value();
+ ret.isFulfilled = true;
+ } else if (this.isRejected()) {
+ ret.rejectionReason = this.reason();
+ ret.isRejected = true;
+ }
+ return ret;
+};
+
+Promise.prototype.all = function () {
+ if (arguments.length > 0) {
+ this._warn(".all() was passed arguments but it does not take any");
+ }
+ return new PromiseArray(this).promise();
+};
+
+Promise.prototype.error = function (fn) {
+ return this.caught(util.originatesFromRejection, fn);
+};
+
+Promise.getNewLibraryCopy = module.exports;
+
+Promise.is = function (val) {
+ return val instanceof Promise;
+};
+
+Promise.fromNode = Promise.fromCallback = function(fn) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ var multiArgs = arguments.length > 1 ? !!Object(arguments[1]).multiArgs
+ : false;
+ var result = tryCatch(fn)(nodebackForPromise(ret, multiArgs));
+ if (result === errorObj) {
+ ret._rejectCallback(result.e, true);
+ }
+ if (!ret._isFateSealed()) ret._setAsyncGuaranteed();
+ return ret;
+};
+
+Promise.all = function (promises) {
+ return new PromiseArray(promises).promise();
+};
+
+Promise.cast = function (obj) {
+ var ret = tryConvertToPromise(obj);
+ if (!(ret instanceof Promise)) {
+ ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._setFulfilled();
+ ret._rejectionHandler0 = obj;
+ }
+ return ret;
+};
+
+Promise.resolve = Promise.fulfilled = Promise.cast;
+
+Promise.reject = Promise.rejected = function (reason) {
+ var ret = new Promise(INTERNAL);
+ ret._captureStackTrace();
+ ret._rejectCallback(reason, true);
+ return ret;
+};
+
+Promise.setScheduler = function(fn) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ return async.setScheduler(fn);
+};
+
+Promise.prototype._then = function (
+ didFulfill,
+ didReject,
+ _, receiver,
+ internalData
+) {
+ var haveInternalData = internalData !== undefined;
+ var promise = haveInternalData ? internalData : new Promise(INTERNAL);
+ var target = this._target();
+ var bitField = target._bitField;
+
+ if (!haveInternalData) {
+ promise._propagateFrom(this, 3);
+ promise._captureStackTrace();
+ if (receiver === undefined &&
+ ((this._bitField & 2097152) !== 0)) {
+ if (!((bitField & 50397184) === 0)) {
+ receiver = this._boundValue();
+ } else {
+ receiver = target === this ? undefined : this._boundTo;
+ }
+ }
+ this._fireEvent("promiseChained", this, promise);
+ }
+
+ var domain = getDomain();
+ if (!((bitField & 50397184) === 0)) {
+ var handler, value, settler = target._settlePromiseCtx;
+ if (((bitField & 33554432) !== 0)) {
+ value = target._rejectionHandler0;
+ handler = didFulfill;
+ } else if (((bitField & 16777216) !== 0)) {
+ value = target._fulfillmentHandler0;
+ handler = didReject;
+ target._unsetRejectionIsUnhandled();
+ } else {
+ settler = target._settlePromiseLateCancellationObserver;
+ value = new CancellationError("late cancellation observer");
+ target._attachExtraTrace(value);
+ handler = didReject;
+ }
+
+ async.invoke(settler, target, {
+ handler: domain === null ? handler
+ : (typeof handler === "function" &&
+ util.domainBind(domain, handler)),
+ promise: promise,
+ receiver: receiver,
+ value: value
+ });
+ } else {
+ target._addCallbacks(didFulfill, didReject, promise, receiver, domain);
+ }
+
+ return promise;
+};
+
+Promise.prototype._length = function () {
+ return this._bitField & 65535;
+};
+
+Promise.prototype._isFateSealed = function () {
+ return (this._bitField & 117506048) !== 0;
+};
+
+Promise.prototype._isFollowing = function () {
+ return (this._bitField & 67108864) === 67108864;
+};
+
+Promise.prototype._setLength = function (len) {
+ this._bitField = (this._bitField & -65536) |
+ (len & 65535);
+};
+
+Promise.prototype._setFulfilled = function () {
+ this._bitField = this._bitField | 33554432;
+ this._fireEvent("promiseFulfilled", this);
+};
+
+Promise.prototype._setRejected = function () {
+ this._bitField = this._bitField | 16777216;
+ this._fireEvent("promiseRejected", this);
+};
+
+Promise.prototype._setFollowing = function () {
+ this._bitField = this._bitField | 67108864;
+ this._fireEvent("promiseResolved", this);
+};
+
+Promise.prototype._setIsFinal = function () {
+ this._bitField = this._bitField | 4194304;
+};
+
+Promise.prototype._isFinal = function () {
+ return (this._bitField & 4194304) > 0;
+};
+
+Promise.prototype._unsetCancelled = function() {
+ this._bitField = this._bitField & (~65536);
+};
+
+Promise.prototype._setCancelled = function() {
+ this._bitField = this._bitField | 65536;
+ this._fireEvent("promiseCancelled", this);
+};
+
+Promise.prototype._setWillBeCancelled = function() {
+ this._bitField = this._bitField | 8388608;
+};
+
+Promise.prototype._setAsyncGuaranteed = function() {
+ if (async.hasCustomScheduler()) return;
+ this._bitField = this._bitField | 134217728;
+};
+
+Promise.prototype._receiverAt = function (index) {
+ var ret = index === 0 ? this._receiver0 : this[
+ index * 4 - 4 + 3];
+ if (ret === UNDEFINED_BINDING) {
+ return undefined;
+ } else if (ret === undefined && this._isBound()) {
+ return this._boundValue();
+ }
+ return ret;
+};
+
+Promise.prototype._promiseAt = function (index) {
+ return this[
+ index * 4 - 4 + 2];
+};
+
+Promise.prototype._fulfillmentHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 0];
+};
+
+Promise.prototype._rejectionHandlerAt = function (index) {
+ return this[
+ index * 4 - 4 + 1];
+};
+
+Promise.prototype._boundValue = function() {};
+
+Promise.prototype._migrateCallback0 = function (follower) {
+ var bitField = follower._bitField;
+ var fulfill = follower._fulfillmentHandler0;
+ var reject = follower._rejectionHandler0;
+ var promise = follower._promise0;
+ var receiver = follower._receiverAt(0);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._migrateCallbackAt = function (follower, index) {
+ var fulfill = follower._fulfillmentHandlerAt(index);
+ var reject = follower._rejectionHandlerAt(index);
+ var promise = follower._promiseAt(index);
+ var receiver = follower._receiverAt(index);
+ if (receiver === undefined) receiver = UNDEFINED_BINDING;
+ this._addCallbacks(fulfill, reject, promise, receiver, null);
+};
+
+Promise.prototype._addCallbacks = function (
+ fulfill,
+ reject,
+ promise,
+ receiver,
+ domain
+) {
+ var index = this._length();
+
+ if (index >= 65535 - 4) {
+ index = 0;
+ this._setLength(0);
+ }
+
+ if (index === 0) {
+ this._promise0 = promise;
+ this._receiver0 = receiver;
+ if (typeof fulfill === "function") {
+ this._fulfillmentHandler0 =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this._rejectionHandler0 =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ } else {
+ var base = index * 4 - 4;
+ this[base + 2] = promise;
+ this[base + 3] = receiver;
+ if (typeof fulfill === "function") {
+ this[base + 0] =
+ domain === null ? fulfill : util.domainBind(domain, fulfill);
+ }
+ if (typeof reject === "function") {
+ this[base + 1] =
+ domain === null ? reject : util.domainBind(domain, reject);
+ }
+ }
+ this._setLength(index + 1);
+ return index;
+};
+
+Promise.prototype._proxy = function (proxyable, arg) {
+ this._addCallbacks(undefined, undefined, arg, proxyable, null);
+};
+
+Promise.prototype._resolveCallback = function(value, shouldBind) {
+ if (((this._bitField & 117506048) !== 0)) return;
+ if (value === this)
+ return this._rejectCallback(makeSelfResolutionError(), false);
+ var maybePromise = tryConvertToPromise(value, this);
+ if (!(maybePromise instanceof Promise)) return this._fulfill(value);
+
+ if (shouldBind) this._propagateFrom(maybePromise, 2);
+
+ var promise = maybePromise._target();
+
+ if (promise === this) {
+ this._reject(makeSelfResolutionError());
+ return;
+ }
+
+ var bitField = promise._bitField;
+ if (((bitField & 50397184) === 0)) {
+ var len = this._length();
+ if (len > 0) promise._migrateCallback0(this);
+ for (var i = 1; i < len; ++i) {
+ promise._migrateCallbackAt(this, i);
+ }
+ this._setFollowing();
+ this._setLength(0);
+ this._setFollowee(promise);
+ } else if (((bitField & 33554432) !== 0)) {
+ this._fulfill(promise._value());
+ } else if (((bitField & 16777216) !== 0)) {
+ this._reject(promise._reason());
+ } else {
+ var reason = new CancellationError("late cancellation observer");
+ promise._attachExtraTrace(reason);
+ this._reject(reason);
+ }
+};
+
+Promise.prototype._rejectCallback =
+function(reason, synchronous, ignoreNonErrorWarnings) {
+ var trace = util.ensureErrorObject(reason);
+ var hasStack = trace === reason;
+ if (!hasStack && !ignoreNonErrorWarnings && debug.warnings()) {
+ var message = "a promise was rejected with a non-error: " +
+ util.classString(reason);
+ this._warn(message, true);
+ }
+ this._attachExtraTrace(trace, synchronous ? hasStack : false);
+ this._reject(reason);
+};
+
+Promise.prototype._resolveFromExecutor = function (executor) {
+ var promise = this;
+ this._captureStackTrace();
+ this._pushContext();
+ var synchronous = true;
+ var r = this._execute(executor, function(value) {
+ promise._resolveCallback(value);
+ }, function (reason) {
+ promise._rejectCallback(reason, synchronous);
+ });
+ synchronous = false;
+ this._popContext();
+
+ if (r !== undefined) {
+ promise._rejectCallback(r, true);
+ }
+};
+
+Promise.prototype._settlePromiseFromHandler = function (
+ handler, receiver, value, promise
+) {
+ var bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+ promise._pushContext();
+ var x;
+ if (receiver === APPLY) {
+ if (!value || typeof value.length !== "number") {
+ x = errorObj;
+ x.e = new TypeError("cannot .spread() a non-array: " +
+ util.classString(value));
+ } else {
+ x = tryCatch(handler).apply(this._boundValue(), value);
+ }
+ } else {
+ x = tryCatch(handler).call(receiver, value);
+ }
+ var promiseCreated = promise._popContext();
+ bitField = promise._bitField;
+ if (((bitField & 65536) !== 0)) return;
+
+ if (x === NEXT_FILTER) {
+ promise._reject(value);
+ } else if (x === errorObj) {
+ promise._rejectCallback(x.e, false);
+ } else {
+ debug.checkForgottenReturns(x, promiseCreated, "", promise, this);
+ promise._resolveCallback(x);
+ }
+};
+
+Promise.prototype._target = function() {
+ var ret = this;
+ while (ret._isFollowing()) ret = ret._followee();
+ return ret;
+};
+
+Promise.prototype._followee = function() {
+ return this._rejectionHandler0;
+};
+
+Promise.prototype._setFollowee = function(promise) {
+ this._rejectionHandler0 = promise;
+};
+
+Promise.prototype._settlePromise = function(promise, handler, receiver, value) {
+ var isPromise = promise instanceof Promise;
+ var bitField = this._bitField;
+ var asyncGuaranteed = ((bitField & 134217728) !== 0);
+ if (((bitField & 65536) !== 0)) {
+ if (isPromise) promise._invokeInternalOnCancel();
+
+ if (receiver instanceof PassThroughHandlerContext &&
+ receiver.isFinallyHandler()) {
+ receiver.cancelPromise = promise;
+ if (tryCatch(handler).call(receiver, value) === errorObj) {
+ promise._reject(errorObj.e);
+ }
+ } else if (handler === reflectHandler) {
+ promise._fulfill(reflectHandler.call(receiver));
+ } else if (receiver instanceof Proxyable) {
+ receiver._promiseCancelled(promise);
+ } else if (isPromise || promise instanceof PromiseArray) {
+ promise._cancel();
+ } else {
+ receiver.cancel();
+ }
+ } else if (typeof handler === "function") {
+ if (!isPromise) {
+ handler.call(receiver, value, promise);
+ } else {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (receiver instanceof Proxyable) {
+ if (!receiver._isResolved()) {
+ if (((bitField & 33554432) !== 0)) {
+ receiver._promiseFulfilled(value, promise);
+ } else {
+ receiver._promiseRejected(value, promise);
+ }
+ }
+ } else if (isPromise) {
+ if (asyncGuaranteed) promise._setAsyncGuaranteed();
+ if (((bitField & 33554432) !== 0)) {
+ promise._fulfill(value);
+ } else {
+ promise._reject(value);
+ }
+ }
+};
+
+Promise.prototype._settlePromiseLateCancellationObserver = function(ctx) {
+ var handler = ctx.handler;
+ var promise = ctx.promise;
+ var receiver = ctx.receiver;
+ var value = ctx.value;
+ if (typeof handler === "function") {
+ if (!(promise instanceof Promise)) {
+ handler.call(receiver, value, promise);
+ } else {
+ this._settlePromiseFromHandler(handler, receiver, value, promise);
+ }
+ } else if (promise instanceof Promise) {
+ promise._reject(value);
+ }
+};
+
+Promise.prototype._settlePromiseCtx = function(ctx) {
+ this._settlePromise(ctx.promise, ctx.handler, ctx.receiver, ctx.value);
+};
+
+Promise.prototype._settlePromise0 = function(handler, value, bitField) {
+ var promise = this._promise0;
+ var receiver = this._receiverAt(0);
+ this._promise0 = undefined;
+ this._receiver0 = undefined;
+ this._settlePromise(promise, handler, receiver, value);
+};
+
+Promise.prototype._clearCallbackDataAtIndex = function(index) {
+ var base = index * 4 - 4;
+ this[base + 2] =
+ this[base + 3] =
+ this[base + 0] =
+ this[base + 1] = undefined;
+};
+
+Promise.prototype._fulfill = function (value) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ if (value === this) {
+ var err = makeSelfResolutionError();
+ this._attachExtraTrace(err);
+ return this._reject(err);
+ }
+ this._setFulfilled();
+ this._rejectionHandler0 = value;
+
+ if ((bitField & 65535) > 0) {
+ if (((bitField & 134217728) !== 0)) {
+ this._settlePromises();
+ } else {
+ async.settlePromises(this);
+ }
+ }
+};
+
+Promise.prototype._reject = function (reason) {
+ var bitField = this._bitField;
+ if (((bitField & 117506048) >>> 16)) return;
+ this._setRejected();
+ this._fulfillmentHandler0 = reason;
+
+ if (this._isFinal()) {
+ return async.fatalError(reason, util.isNode);
+ }
+
+ if ((bitField & 65535) > 0) {
+ async.settlePromises(this);
+ } else {
+ this._ensurePossibleRejectionHandled();
+ }
+};
+
+Promise.prototype._fulfillPromises = function (len, value) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._fulfillmentHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, value);
+ }
+};
+
+Promise.prototype._rejectPromises = function (len, reason) {
+ for (var i = 1; i < len; i++) {
+ var handler = this._rejectionHandlerAt(i);
+ var promise = this._promiseAt(i);
+ var receiver = this._receiverAt(i);
+ this._clearCallbackDataAtIndex(i);
+ this._settlePromise(promise, handler, receiver, reason);
+ }
+};
+
+Promise.prototype._settlePromises = function () {
+ var bitField = this._bitField;
+ var len = (bitField & 65535);
+
+ if (len > 0) {
+ if (((bitField & 16842752) !== 0)) {
+ var reason = this._fulfillmentHandler0;
+ this._settlePromise0(this._rejectionHandler0, reason, bitField);
+ this._rejectPromises(len, reason);
+ } else {
+ var value = this._rejectionHandler0;
+ this._settlePromise0(this._fulfillmentHandler0, value, bitField);
+ this._fulfillPromises(len, value);
+ }
+ this._setLength(0);
+ }
+ this._clearCancellationData();
+};
+
+Promise.prototype._settledValue = function() {
+ var bitField = this._bitField;
+ if (((bitField & 33554432) !== 0)) {
+ return this._rejectionHandler0;
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._fulfillmentHandler0;
+ }
+};
+
+function deferResolve(v) {this.promise._resolveCallback(v);}
+function deferReject(v) {this.promise._rejectCallback(v, false);}
+
+Promise.defer = Promise.pending = function() {
+ debug.deprecated("Promise.defer", "new Promise");
+ var promise = new Promise(INTERNAL);
+ return {
+ promise: promise,
+ resolve: deferResolve,
+ reject: deferReject
+ };
+};
+
+util.notEnumerableProp(Promise,
+ "_makeSelfResolutionError",
+ makeSelfResolutionError);
+
+require("./method")(Promise, INTERNAL, tryConvertToPromise, apiRejection,
+ debug);
+require("./bind")(Promise, INTERNAL, tryConvertToPromise, debug);
+require("./cancel")(Promise, PromiseArray, apiRejection, debug);
+require("./direct_resolve")(Promise);
+require("./synchronous_inspection")(Promise);
+require("./join")(
+ Promise, PromiseArray, tryConvertToPromise, INTERNAL, async, getDomain);
+Promise.Promise = Promise;
+Promise.version = "3.4.7";
+require('./map.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL, debug);
+require('./call_get.js')(Promise);
+require('./using.js')(Promise, apiRejection, tryConvertToPromise, createContext, INTERNAL, debug);
+require('./timers.js')(Promise, INTERNAL, debug);
+require('./generators.js')(Promise, apiRejection, INTERNAL, tryConvertToPromise, Proxyable, debug);
+require('./nodeify.js')(Promise);
+require('./promisify.js')(Promise, INTERNAL);
+require('./props.js')(Promise, PromiseArray, tryConvertToPromise, apiRejection);
+require('./race.js')(Promise, INTERNAL, tryConvertToPromise, apiRejection);
+require('./reduce.js')(Promise, PromiseArray, apiRejection, tryConvertToPromise, INTERNAL, debug);
+require('./settle.js')(Promise, PromiseArray, debug);
+require('./some.js')(Promise, PromiseArray, apiRejection);
+require('./filter.js')(Promise, INTERNAL);
+require('./each.js')(Promise, INTERNAL);
+require('./any.js')(Promise);
+
+ util.toFastProperties(Promise);
+ util.toFastProperties(Promise.prototype);
+ function fillTypes(value) {
+ var p = new Promise(INTERNAL);
+ p._fulfillmentHandler0 = value;
+ p._rejectionHandler0 = value;
+ p._promise0 = value;
+ p._receiver0 = value;
+ }
+ // Complete slack tracking, opt out of field-type tracking and
+ // stabilize map
+ fillTypes({a: 1});
+ fillTypes({b: 2});
+ fillTypes({c: 3});
+ fillTypes(1);
+ fillTypes(function(){});
+ fillTypes(undefined);
+ fillTypes(false);
+ fillTypes(new Promise(INTERNAL));
+ debug.setBounds(Async.firstLineError, util.lastLineError);
+ return Promise;
+
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/promise_array.js b/website_quotation_template/node_modules/bluebird/js/release/promise_array.js
new file mode 100644
index 000000000..f874df3f3
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/promise_array.js
@@ -0,0 +1,184 @@
+"use strict";
+module.exports = function(Promise, INTERNAL, tryConvertToPromise,
+ apiRejection, Proxyable) {
+var util = require("./util");
+var isArray = util.isArray;
+
+function toResolutionValue(val) {
+ switch(val) {
+ case -2: return [];
+ case -3: return {};
+ }
+}
+
+function PromiseArray(values) {
+ var promise = this._promise = new Promise(INTERNAL);
+ if (values instanceof Promise) {
+ promise._propagateFrom(values, 3);
+ }
+ promise._setOnCancel(this);
+ this._values = values;
+ this._length = 0;
+ this._totalResolved = 0;
+ this._init(undefined, -2);
+}
+util.inherits(PromiseArray, Proxyable);
+
+PromiseArray.prototype.length = function () {
+ return this._length;
+};
+
+PromiseArray.prototype.promise = function () {
+ return this._promise;
+};
+
+PromiseArray.prototype._init = function init(_, resolveValueIfEmpty) {
+ var values = tryConvertToPromise(this._values, this._promise);
+ if (values instanceof Promise) {
+ values = values._target();
+ var bitField = values._bitField;
+ ;
+ this._values = values;
+
+ if (((bitField & 50397184) === 0)) {
+ this._promise._setAsyncGuaranteed();
+ return values._then(
+ init,
+ this._reject,
+ undefined,
+ this,
+ resolveValueIfEmpty
+ );
+ } else if (((bitField & 33554432) !== 0)) {
+ values = values._value();
+ } else if (((bitField & 16777216) !== 0)) {
+ return this._reject(values._reason());
+ } else {
+ return this._cancel();
+ }
+ }
+ values = util.asArray(values);
+ if (values === null) {
+ var err = apiRejection(
+ "expecting an array or an iterable object but got " + util.classString(values)).reason();
+ this._promise._rejectCallback(err, false);
+ return;
+ }
+
+ if (values.length === 0) {
+ if (resolveValueIfEmpty === -5) {
+ this._resolveEmptyArray();
+ }
+ else {
+ this._resolve(toResolutionValue(resolveValueIfEmpty));
+ }
+ return;
+ }
+ this._iterate(values);
+};
+
+PromiseArray.prototype._iterate = function(values) {
+ var len = this.getActualLength(values.length);
+ this._length = len;
+ this._values = this.shouldCopyValues() ? new Array(len) : this._values;
+ var result = this._promise;
+ var isResolved = false;
+ var bitField = null;
+ for (var i = 0; i < len; ++i) {
+ var maybePromise = tryConvertToPromise(values[i], result);
+
+ if (maybePromise instanceof Promise) {
+ maybePromise = maybePromise._target();
+ bitField = maybePromise._bitField;
+ } else {
+ bitField = null;
+ }
+
+ if (isResolved) {
+ if (bitField !== null) {
+ maybePromise.suppressUnhandledRejections();
+ }
+ } else if (bitField !== null) {
+ if (((bitField & 50397184) === 0)) {
+ maybePromise._proxy(this, i);
+ this._values[i] = maybePromise;
+ } else if (((bitField & 33554432) !== 0)) {
+ isResolved = this._promiseFulfilled(maybePromise._value(), i);
+ } else if (((bitField & 16777216) !== 0)) {
+ isResolved = this._promiseRejected(maybePromise._reason(), i);
+ } else {
+ isResolved = this._promiseCancelled(i);
+ }
+ } else {
+ isResolved = this._promiseFulfilled(maybePromise, i);
+ }
+ }
+ if (!isResolved) result._setAsyncGuaranteed();
+};
+
+PromiseArray.prototype._isResolved = function () {
+ return this._values === null;
+};
+
+PromiseArray.prototype._resolve = function (value) {
+ this._values = null;
+ this._promise._fulfill(value);
+};
+
+PromiseArray.prototype._cancel = function() {
+ if (this._isResolved() || !this._promise._isCancellable()) return;
+ this._values = null;
+ this._promise._cancel();
+};
+
+PromiseArray.prototype._reject = function (reason) {
+ this._values = null;
+ this._promise._rejectCallback(reason, false);
+};
+
+PromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ return true;
+ }
+ return false;
+};
+
+PromiseArray.prototype._promiseCancelled = function() {
+ this._cancel();
+ return true;
+};
+
+PromiseArray.prototype._promiseRejected = function (reason) {
+ this._totalResolved++;
+ this._reject(reason);
+ return true;
+};
+
+PromiseArray.prototype._resultCancelled = function() {
+ if (this._isResolved()) return;
+ var values = this._values;
+ this._cancel();
+ if (values instanceof Promise) {
+ values.cancel();
+ } else {
+ for (var i = 0; i < values.length; ++i) {
+ if (values[i] instanceof Promise) {
+ values[i].cancel();
+ }
+ }
+ }
+};
+
+PromiseArray.prototype.shouldCopyValues = function () {
+ return true;
+};
+
+PromiseArray.prototype.getActualLength = function (len) {
+ return len;
+};
+
+return PromiseArray;
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/promisify.js b/website_quotation_template/node_modules/bluebird/js/release/promisify.js
new file mode 100644
index 000000000..aa98e5bde
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/promisify.js
@@ -0,0 +1,314 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var THIS = {};
+var util = require("./util");
+var nodebackForPromise = require("./nodeback");
+var withAppended = util.withAppended;
+var maybeWrapAsError = util.maybeWrapAsError;
+var canEvaluate = util.canEvaluate;
+var TypeError = require("./errors").TypeError;
+var defaultSuffix = "Async";
+var defaultPromisified = {__isPromisified__: true};
+var noCopyProps = [
+ "arity", "length",
+ "name",
+ "arguments",
+ "caller",
+ "callee",
+ "prototype",
+ "__isPromisified__"
+];
+var noCopyPropsPattern = new RegExp("^(?:" + noCopyProps.join("|") + ")$");
+
+var defaultFilter = function(name) {
+ return util.isIdentifier(name) &&
+ name.charAt(0) !== "_" &&
+ name !== "constructor";
+};
+
+function propsFilter(key) {
+ return !noCopyPropsPattern.test(key);
+}
+
+function isPromisified(fn) {
+ try {
+ return fn.__isPromisified__ === true;
+ }
+ catch (e) {
+ return false;
+ }
+}
+
+function hasPromisified(obj, key, suffix) {
+ var val = util.getDataPropertyOrDefault(obj, key + suffix,
+ defaultPromisified);
+ return val ? isPromisified(val) : false;
+}
+function checkValid(ret, suffix, suffixRegexp) {
+ for (var i = 0; i < ret.length; i += 2) {
+ var key = ret[i];
+ if (suffixRegexp.test(key)) {
+ var keyWithoutAsyncSuffix = key.replace(suffixRegexp, "");
+ for (var j = 0; j < ret.length; j += 2) {
+ if (ret[j] === keyWithoutAsyncSuffix) {
+ throw new TypeError("Cannot promisify an API that has normal methods with '%s'-suffix\u000a\u000a See http://goo.gl/MqrFmX\u000a"
+ .replace("%s", suffix));
+ }
+ }
+ }
+ }
+}
+
+function promisifiableMethods(obj, suffix, suffixRegexp, filter) {
+ var keys = util.inheritedDataKeys(obj);
+ var ret = [];
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ var value = obj[key];
+ var passesDefaultFilter = filter === defaultFilter
+ ? true : defaultFilter(key, value, obj);
+ if (typeof value === "function" &&
+ !isPromisified(value) &&
+ !hasPromisified(obj, key, suffix) &&
+ filter(key, value, obj, passesDefaultFilter)) {
+ ret.push(key, value);
+ }
+ }
+ checkValid(ret, suffix, suffixRegexp);
+ return ret;
+}
+
+var escapeIdentRegex = function(str) {
+ return str.replace(/([$])/, "\\$");
+};
+
+var makeNodePromisifiedEval;
+if (!false) {
+var switchCaseArgumentOrder = function(likelyArgumentCount) {
+ var ret = [likelyArgumentCount];
+ var min = Math.max(0, likelyArgumentCount - 1 - 3);
+ for(var i = likelyArgumentCount - 1; i >= min; --i) {
+ ret.push(i);
+ }
+ for(var i = likelyArgumentCount + 1; i <= 3; ++i) {
+ ret.push(i);
+ }
+ return ret;
+};
+
+var argumentSequence = function(argumentCount) {
+ return util.filledRange(argumentCount, "_arg", "");
+};
+
+var parameterDeclaration = function(parameterCount) {
+ return util.filledRange(
+ Math.max(parameterCount, 3), "_arg", "");
+};
+
+var parameterCount = function(fn) {
+ if (typeof fn.length === "number") {
+ return Math.max(Math.min(fn.length, 1023 + 1), 0);
+ }
+ return 0;
+};
+
+makeNodePromisifiedEval =
+function(callback, receiver, originalName, fn, _, multiArgs) {
+ var newParameterCount = Math.max(0, parameterCount(fn) - 1);
+ var argumentOrder = switchCaseArgumentOrder(newParameterCount);
+ var shouldProxyThis = typeof callback === "string" || receiver === THIS;
+
+ function generateCallForArgumentCount(count) {
+ var args = argumentSequence(count).join(", ");
+ var comma = count > 0 ? ", " : "";
+ var ret;
+ if (shouldProxyThis) {
+ ret = "ret = callback.call(this, {{args}}, nodeback); break;\n";
+ } else {
+ ret = receiver === undefined
+ ? "ret = callback({{args}}, nodeback); break;\n"
+ : "ret = callback.call(receiver, {{args}}, nodeback); break;\n";
+ }
+ return ret.replace("{{args}}", args).replace(", ", comma);
+ }
+
+ function generateArgumentSwitchCase() {
+ var ret = "";
+ for (var i = 0; i < argumentOrder.length; ++i) {
+ ret += "case " + argumentOrder[i] +":" +
+ generateCallForArgumentCount(argumentOrder[i]);
+ }
+
+ ret += " \n\
+ default: \n\
+ var args = new Array(len + 1); \n\
+ var i = 0; \n\
+ for (var i = 0; i < len; ++i) { \n\
+ args[i] = arguments[i]; \n\
+ } \n\
+ args[i] = nodeback; \n\
+ [CodeForCall] \n\
+ break; \n\
+ ".replace("[CodeForCall]", (shouldProxyThis
+ ? "ret = callback.apply(this, args);\n"
+ : "ret = callback.apply(receiver, args);\n"));
+ return ret;
+ }
+
+ var getFunctionCode = typeof callback === "string"
+ ? ("this != null ? this['"+callback+"'] : fn")
+ : "fn";
+ var body = "'use strict'; \n\
+ var ret = function (Parameters) { \n\
+ 'use strict'; \n\
+ var len = arguments.length; \n\
+ var promise = new Promise(INTERNAL); \n\
+ promise._captureStackTrace(); \n\
+ var nodeback = nodebackForPromise(promise, " + multiArgs + "); \n\
+ var ret; \n\
+ var callback = tryCatch([GetFunctionCode]); \n\
+ switch(len) { \n\
+ [CodeForSwitchCase] \n\
+ } \n\
+ if (ret === errorObj) { \n\
+ promise._rejectCallback(maybeWrapAsError(ret.e), true, true);\n\
+ } \n\
+ if (!promise._isFateSealed()) promise._setAsyncGuaranteed(); \n\
+ return promise; \n\
+ }; \n\
+ notEnumerableProp(ret, '__isPromisified__', true); \n\
+ return ret; \n\
+ ".replace("[CodeForSwitchCase]", generateArgumentSwitchCase())
+ .replace("[GetFunctionCode]", getFunctionCode);
+ body = body.replace("Parameters", parameterDeclaration(newParameterCount));
+ return new Function("Promise",
+ "fn",
+ "receiver",
+ "withAppended",
+ "maybeWrapAsError",
+ "nodebackForPromise",
+ "tryCatch",
+ "errorObj",
+ "notEnumerableProp",
+ "INTERNAL",
+ body)(
+ Promise,
+ fn,
+ receiver,
+ withAppended,
+ maybeWrapAsError,
+ nodebackForPromise,
+ util.tryCatch,
+ util.errorObj,
+ util.notEnumerableProp,
+ INTERNAL);
+};
+}
+
+function makeNodePromisifiedClosure(callback, receiver, _, fn, __, multiArgs) {
+ var defaultThis = (function() {return this;})();
+ var method = callback;
+ if (typeof method === "string") {
+ callback = fn;
+ }
+ function promisified() {
+ var _receiver = receiver;
+ if (receiver === THIS) _receiver = this;
+ var promise = new Promise(INTERNAL);
+ promise._captureStackTrace();
+ var cb = typeof method === "string" && this !== defaultThis
+ ? this[method] : callback;
+ var fn = nodebackForPromise(promise, multiArgs);
+ try {
+ cb.apply(_receiver, withAppended(arguments, fn));
+ } catch(e) {
+ promise._rejectCallback(maybeWrapAsError(e), true, true);
+ }
+ if (!promise._isFateSealed()) promise._setAsyncGuaranteed();
+ return promise;
+ }
+ util.notEnumerableProp(promisified, "__isPromisified__", true);
+ return promisified;
+}
+
+var makeNodePromisified = canEvaluate
+ ? makeNodePromisifiedEval
+ : makeNodePromisifiedClosure;
+
+function promisifyAll(obj, suffix, filter, promisifier, multiArgs) {
+ var suffixRegexp = new RegExp(escapeIdentRegex(suffix) + "$");
+ var methods =
+ promisifiableMethods(obj, suffix, suffixRegexp, filter);
+
+ for (var i = 0, len = methods.length; i < len; i+= 2) {
+ var key = methods[i];
+ var fn = methods[i+1];
+ var promisifiedKey = key + suffix;
+ if (promisifier === makeNodePromisified) {
+ obj[promisifiedKey] =
+ makeNodePromisified(key, THIS, key, fn, suffix, multiArgs);
+ } else {
+ var promisified = promisifier(fn, function() {
+ return makeNodePromisified(key, THIS, key,
+ fn, suffix, multiArgs);
+ });
+ util.notEnumerableProp(promisified, "__isPromisified__", true);
+ obj[promisifiedKey] = promisified;
+ }
+ }
+ util.toFastProperties(obj);
+ return obj;
+}
+
+function promisify(callback, receiver, multiArgs) {
+ return makeNodePromisified(callback, receiver, undefined,
+ callback, null, multiArgs);
+}
+
+Promise.promisify = function (fn, options) {
+ if (typeof fn !== "function") {
+ throw new TypeError("expecting a function but got " + util.classString(fn));
+ }
+ if (isPromisified(fn)) {
+ return fn;
+ }
+ options = Object(options);
+ var receiver = options.context === undefined ? THIS : options.context;
+ var multiArgs = !!options.multiArgs;
+ var ret = promisify(fn, receiver, multiArgs);
+ util.copyDescriptors(fn, ret, propsFilter);
+ return ret;
+};
+
+Promise.promisifyAll = function (target, options) {
+ if (typeof target !== "function" && typeof target !== "object") {
+ throw new TypeError("the target of promisifyAll must be an object or a function\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ options = Object(options);
+ var multiArgs = !!options.multiArgs;
+ var suffix = options.suffix;
+ if (typeof suffix !== "string") suffix = defaultSuffix;
+ var filter = options.filter;
+ if (typeof filter !== "function") filter = defaultFilter;
+ var promisifier = options.promisifier;
+ if (typeof promisifier !== "function") promisifier = makeNodePromisified;
+
+ if (!util.isIdentifier(suffix)) {
+ throw new RangeError("suffix must be a valid identifier\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+
+ var keys = util.inheritedDataKeys(target);
+ for (var i = 0; i < keys.length; ++i) {
+ var value = target[keys[i]];
+ if (keys[i] !== "constructor" &&
+ util.isClass(value)) {
+ promisifyAll(value.prototype, suffix, filter, promisifier,
+ multiArgs);
+ promisifyAll(value, suffix, filter, promisifier, multiArgs);
+ }
+ }
+
+ return promisifyAll(target, suffix, filter, promisifier, multiArgs);
+};
+};
+
diff --git a/website_quotation_template/node_modules/bluebird/js/release/props.js b/website_quotation_template/node_modules/bluebird/js/release/props.js
new file mode 100644
index 000000000..fc981ce49
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/props.js
@@ -0,0 +1,118 @@
+"use strict";
+module.exports = function(
+ Promise, PromiseArray, tryConvertToPromise, apiRejection) {
+var util = require("./util");
+var isObject = util.isObject;
+var es5 = require("./es5");
+var Es6Map;
+if (typeof Map === "function") Es6Map = Map;
+
+var mapToEntries = (function() {
+ var index = 0;
+ var size = 0;
+
+ function extractEntry(value, key) {
+ this[index] = value;
+ this[index + size] = key;
+ index++;
+ }
+
+ return function mapToEntries(map) {
+ size = map.size;
+ index = 0;
+ var ret = new Array(map.size * 2);
+ map.forEach(extractEntry, ret);
+ return ret;
+ };
+})();
+
+var entriesToMap = function(entries) {
+ var ret = new Es6Map();
+ var length = entries.length / 2 | 0;
+ for (var i = 0; i < length; ++i) {
+ var key = entries[length + i];
+ var value = entries[i];
+ ret.set(key, value);
+ }
+ return ret;
+};
+
+function PropertiesPromiseArray(obj) {
+ var isMap = false;
+ var entries;
+ if (Es6Map !== undefined && obj instanceof Es6Map) {
+ entries = mapToEntries(obj);
+ isMap = true;
+ } else {
+ var keys = es5.keys(obj);
+ var len = keys.length;
+ entries = new Array(len * 2);
+ for (var i = 0; i < len; ++i) {
+ var key = keys[i];
+ entries[i] = obj[key];
+ entries[i + len] = key;
+ }
+ }
+ this.constructor$(entries);
+ this._isMap = isMap;
+ this._init$(undefined, -3);
+}
+util.inherits(PropertiesPromiseArray, PromiseArray);
+
+PropertiesPromiseArray.prototype._init = function () {};
+
+PropertiesPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ this._values[index] = value;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ var val;
+ if (this._isMap) {
+ val = entriesToMap(this._values);
+ } else {
+ val = {};
+ var keyOffset = this.length();
+ for (var i = 0, len = this.length(); i < len; ++i) {
+ val[this._values[i + keyOffset]] = this._values[i];
+ }
+ }
+ this._resolve(val);
+ return true;
+ }
+ return false;
+};
+
+PropertiesPromiseArray.prototype.shouldCopyValues = function () {
+ return false;
+};
+
+PropertiesPromiseArray.prototype.getActualLength = function (len) {
+ return len >> 1;
+};
+
+function props(promises) {
+ var ret;
+ var castValue = tryConvertToPromise(promises);
+
+ if (!isObject(castValue)) {
+ return apiRejection("cannot await properties of a non-object\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ } else if (castValue instanceof Promise) {
+ ret = castValue._then(
+ Promise.props, undefined, undefined, undefined, undefined);
+ } else {
+ ret = new PropertiesPromiseArray(castValue).promise();
+ }
+
+ if (castValue instanceof Promise) {
+ ret._propagateFrom(castValue, 2);
+ }
+ return ret;
+}
+
+Promise.prototype.props = function () {
+ return props(this);
+};
+
+Promise.props = function (promises) {
+ return props(promises);
+};
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/queue.js b/website_quotation_template/node_modules/bluebird/js/release/queue.js
new file mode 100644
index 000000000..ffd36fda1
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/queue.js
@@ -0,0 +1,73 @@
+"use strict";
+function arrayMove(src, srcIndex, dst, dstIndex, len) {
+ for (var j = 0; j < len; ++j) {
+ dst[j + dstIndex] = src[j + srcIndex];
+ src[j + srcIndex] = void 0;
+ }
+}
+
+function Queue(capacity) {
+ this._capacity = capacity;
+ this._length = 0;
+ this._front = 0;
+}
+
+Queue.prototype._willBeOverCapacity = function (size) {
+ return this._capacity < size;
+};
+
+Queue.prototype._pushOne = function (arg) {
+ var length = this.length();
+ this._checkCapacity(length + 1);
+ var i = (this._front + length) & (this._capacity - 1);
+ this[i] = arg;
+ this._length = length + 1;
+};
+
+Queue.prototype.push = function (fn, receiver, arg) {
+ var length = this.length() + 3;
+ if (this._willBeOverCapacity(length)) {
+ this._pushOne(fn);
+ this._pushOne(receiver);
+ this._pushOne(arg);
+ return;
+ }
+ var j = this._front + length - 3;
+ this._checkCapacity(length);
+ var wrapMask = this._capacity - 1;
+ this[(j + 0) & wrapMask] = fn;
+ this[(j + 1) & wrapMask] = receiver;
+ this[(j + 2) & wrapMask] = arg;
+ this._length = length;
+};
+
+Queue.prototype.shift = function () {
+ var front = this._front,
+ ret = this[front];
+
+ this[front] = undefined;
+ this._front = (front + 1) & (this._capacity - 1);
+ this._length--;
+ return ret;
+};
+
+Queue.prototype.length = function () {
+ return this._length;
+};
+
+Queue.prototype._checkCapacity = function (size) {
+ if (this._capacity < size) {
+ this._resizeTo(this._capacity << 1);
+ }
+};
+
+Queue.prototype._resizeTo = function (capacity) {
+ var oldCapacity = this._capacity;
+ this._capacity = capacity;
+ var front = this._front;
+ var length = this._length;
+ var moveItemsCount = (front + length) & (oldCapacity - 1);
+ arrayMove(this, 0, this, oldCapacity, moveItemsCount);
+};
+
+module.exports = Queue;
diff --git a/website_quotation_template/node_modules/bluebird/js/release/race.js b/website_quotation_template/node_modules/bluebird/js/release/race.js
new file mode 100644
index 000000000..b862f46d6
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/race.js
@@ -0,0 +1,49 @@
+"use strict";
+module.exports = function(
+ Promise, INTERNAL, tryConvertToPromise, apiRejection) {
+var util = require("./util");
+
+var raceLater = function (promise) {
+ return promise.then(function(array) {
+ return race(array, promise);
+ });
+};
+
+function race(promises, parent) {
+ var maybePromise = tryConvertToPromise(promises);
+
+ if (maybePromise instanceof Promise) {
+ return raceLater(maybePromise);
+ } else {
+ promises = util.asArray(promises);
+ if (promises === null)
+ return apiRejection("expecting an array or an iterable object but got " + util.classString(promises));
+ }
+
+ var ret = new Promise(INTERNAL);
+ if (parent !== undefined) {
+ ret._propagateFrom(parent, 3);
+ }
+ var fulfill = ret._fulfill;
+ var reject = ret._reject;
+ for (var i = 0, len = promises.length; i < len; ++i) {
+ var val = promises[i];
+
+ if (val === undefined && !(i in promises)) {
+ continue;
+ }
+
+ Promise.cast(val)._then(fulfill, reject, undefined, ret, null);
+ }
+ return ret;
+}
+
+Promise.race = function (promises) {
+ return race(promises, undefined);
+};
+
+Promise.prototype.race = function () {
+ return race(this, undefined);
+};
+
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/reduce.js b/website_quotation_template/node_modules/bluebird/js/release/reduce.js
new file mode 100644
index 000000000..26e2b1a97
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/reduce.js
@@ -0,0 +1,172 @@
+"use strict";
+module.exports = function(Promise,
+ PromiseArray,
+ apiRejection,
+ tryConvertToPromise,
+ INTERNAL,
+ debug) {
+var getDomain = Promise._getDomain;
+var util = require("./util");
+var tryCatch = util.tryCatch;
+
+function ReductionPromiseArray(promises, fn, initialValue, _each) {
+ this.constructor$(promises);
+ var domain = getDomain();
+ this._fn = domain === null ? fn : util.domainBind(domain, fn);
+ if (initialValue !== undefined) {
+ initialValue = Promise.resolve(initialValue);
+ initialValue._attachCancellationCallback(this);
+ }
+ this._initialValue = initialValue;
+ this._currentCancellable = null;
+ if(_each === INTERNAL) {
+ this._eachValues = Array(this._length);
+ } else if (_each === 0) {
+ this._eachValues = null;
+ } else {
+ this._eachValues = undefined;
+ }
+ this._promise._captureStackTrace();
+ this._init$(undefined, -5);
+}
+util.inherits(ReductionPromiseArray, PromiseArray);
+
+ReductionPromiseArray.prototype._gotAccum = function(accum) {
+ if (this._eachValues !== undefined &&
+ this._eachValues !== null &&
+ accum !== INTERNAL) {
+ this._eachValues.push(accum);
+ }
+};
+
+ReductionPromiseArray.prototype._eachComplete = function(value) {
+ if (this._eachValues !== null) {
+ this._eachValues.push(value);
+ }
+ return this._eachValues;
+};
+
+ReductionPromiseArray.prototype._init = function() {};
+
+ReductionPromiseArray.prototype._resolveEmptyArray = function() {
+ this._resolve(this._eachValues !== undefined ? this._eachValues
+ : this._initialValue);
+};
+
+ReductionPromiseArray.prototype.shouldCopyValues = function () {
+ return false;
+};
+
+ReductionPromiseArray.prototype._resolve = function(value) {
+ this._promise._resolveCallback(value);
+ this._values = null;
+};
+
+ReductionPromiseArray.prototype._resultCancelled = function(sender) {
+ if (sender === this._initialValue) return this._cancel();
+ if (this._isResolved()) return;
+ this._resultCancelled$();
+ if (this._currentCancellable instanceof Promise) {
+ this._currentCancellable.cancel();
+ }
+ if (this._initialValue instanceof Promise) {
+ this._initialValue.cancel();
+ }
+};
+
+ReductionPromiseArray.prototype._iterate = function (values) {
+ this._values = values;
+ var value;
+ var i;
+ var length = values.length;
+ if (this._initialValue !== undefined) {
+ value = this._initialValue;
+ i = 0;
+ } else {
+ value = Promise.resolve(values[0]);
+ i = 1;
+ }
+
+ this._currentCancellable = value;
+
+ if (!value.isRejected()) {
+ for (; i < length; ++i) {
+ var ctx = {
+ accum: null,
+ value: values[i],
+ index: i,
+ length: length,
+ array: this
+ };
+ value = value._then(gotAccum, undefined, undefined, ctx, undefined);
+ }
+ }
+
+ if (this._eachValues !== undefined) {
+ value = value
+ ._then(this._eachComplete, undefined, undefined, this, undefined);
+ }
+ value._then(completed, completed, undefined, value, this);
+};
+
+Promise.prototype.reduce = function (fn, initialValue) {
+ return reduce(this, fn, initialValue, null);
+};
+
+Promise.reduce = function (promises, fn, initialValue, _each) {
+ return reduce(promises, fn, initialValue, _each);
+};
+
+function completed(valueOrReason, array) {
+ if (this.isFulfilled()) {
+ array._resolve(valueOrReason);
+ } else {
+ array._reject(valueOrReason);
+ }
+}
+
+function reduce(promises, fn, initialValue, _each) {
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var array = new ReductionPromiseArray(promises, fn, initialValue, _each);
+ return array.promise();
+}
+
+function gotAccum(accum) {
+ this.accum = accum;
+ this.array._gotAccum(accum);
+ var value = tryConvertToPromise(this.value, this.array._promise);
+ if (value instanceof Promise) {
+ this.array._currentCancellable = value;
+ return value._then(gotValue, undefined, undefined, this, undefined);
+ } else {
+ return gotValue.call(this, value);
+ }
+}
+
+function gotValue(value) {
+ var array = this.array;
+ var promise = array._promise;
+ var fn = tryCatch(array._fn);
+ promise._pushContext();
+ var ret;
+ if (array._eachValues !== undefined) {
+ ret = fn.call(promise._boundValue(), value, this.index, this.length);
+ } else {
+ ret = fn.call(promise._boundValue(),
+ this.accum, value, this.index, this.length);
+ }
+ if (ret instanceof Promise) {
+ array._currentCancellable = ret;
+ }
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret,
+ promiseCreated,
+ array._eachValues !== undefined ? "Promise.each" : "Promise.reduce",
+ promise
+ );
+ return ret;
+}
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/schedule.js b/website_quotation_template/node_modules/bluebird/js/release/schedule.js
new file mode 100644
index 000000000..a19072882
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/schedule.js
@@ -0,0 +1,61 @@
+"use strict";
+var util = require("./util");
+var schedule;
+var noAsyncScheduler = function() {
+ throw new Error("No async scheduler available\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+};
+var NativePromise = util.getNativePromise();
+if (util.isNode && typeof MutationObserver === "undefined") {
+ var GlobalSetImmediate = global.setImmediate;
+ var ProcessNextTick = process.nextTick;
+ schedule = util.isRecentNode
+ ? function(fn) { GlobalSetImmediate.call(global, fn); }
+ : function(fn) { ProcessNextTick.call(process, fn); };
+} else if (typeof NativePromise === "function" &&
+ typeof NativePromise.resolve === "function") {
+ var nativePromise = NativePromise.resolve();
+ schedule = function(fn) {
+ nativePromise.then(fn);
+ };
+} else if ((typeof MutationObserver !== "undefined") &&
+ !(typeof window !== "undefined" &&
+ window.navigator &&
+ (window.navigator.standalone || window.cordova))) {
+ schedule = (function() {
+ var div = document.createElement("div");
+ var opts = {attributes: true};
+ var toggleScheduled = false;
+ var div2 = document.createElement("div");
+ var o2 = new MutationObserver(function() {
+ div.classList.toggle("foo");
+ toggleScheduled = false;
+ });
+ o2.observe(div2, opts);
+
+ var scheduleToggle = function() {
+ if (toggleScheduled) return;
+ toggleScheduled = true;
+ div2.classList.toggle("foo");
+ };
+
+ return function schedule(fn) {
+ var o = new MutationObserver(function() {
+ o.disconnect();
+ fn();
+ });
+ o.observe(div, opts);
+ scheduleToggle();
+ };
+ })();
+} else if (typeof setImmediate !== "undefined") {
+ schedule = function (fn) {
+ setImmediate(fn);
+ };
+} else if (typeof setTimeout !== "undefined") {
+ schedule = function (fn) {
+ setTimeout(fn, 0);
+ };
+} else {
+ schedule = noAsyncScheduler;
+}
+module.exports = schedule;
diff --git a/website_quotation_template/node_modules/bluebird/js/release/settle.js b/website_quotation_template/node_modules/bluebird/js/release/settle.js
new file mode 100644
index 000000000..fade3a174
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/settle.js
@@ -0,0 +1,43 @@
+"use strict";
+module.exports =
+ function(Promise, PromiseArray, debug) {
+var PromiseInspection = Promise.PromiseInspection;
+var util = require("./util");
+
+function SettledPromiseArray(values) {
+ this.constructor$(values);
+}
+util.inherits(SettledPromiseArray, PromiseArray);
+
+SettledPromiseArray.prototype._promiseResolved = function (index, inspection) {
+ this._values[index] = inspection;
+ var totalResolved = ++this._totalResolved;
+ if (totalResolved >= this._length) {
+ this._resolve(this._values);
+ return true;
+ }
+ return false;
+};
+
+SettledPromiseArray.prototype._promiseFulfilled = function (value, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 33554432;
+ ret._settledValueField = value;
+ return this._promiseResolved(index, ret);
+};
+SettledPromiseArray.prototype._promiseRejected = function (reason, index) {
+ var ret = new PromiseInspection();
+ ret._bitField = 16777216;
+ ret._settledValueField = reason;
+ return this._promiseResolved(index, ret);
+};
+
+Promise.settle = function (promises) {
+ debug.deprecated(".settle()", ".reflect()");
+ return new SettledPromiseArray(promises).promise();
+};
+
+Promise.prototype.settle = function () {
+ return Promise.settle(this);
+};
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/some.js b/website_quotation_template/node_modules/bluebird/js/release/some.js
new file mode 100644
index 000000000..400d85207
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/some.js
@@ -0,0 +1,148 @@
+"use strict";
+module.exports =
+function(Promise, PromiseArray, apiRejection) {
+var util = require("./util");
+var RangeError = require("./errors").RangeError;
+var AggregateError = require("./errors").AggregateError;
+var isArray = util.isArray;
+var CANCELLATION = {};
+
+
+function SomePromiseArray(values) {
+ this.constructor$(values);
+ this._howMany = 0;
+ this._unwrap = false;
+ this._initialized = false;
+}
+util.inherits(SomePromiseArray, PromiseArray);
+
+SomePromiseArray.prototype._init = function () {
+ if (!this._initialized) {
+ return;
+ }
+ if (this._howMany === 0) {
+ this._resolve([]);
+ return;
+ }
+ this._init$(undefined, -5);
+ var isArrayResolved = isArray(this._values);
+ if (!this._isResolved() &&
+ isArrayResolved &&
+ this._howMany > this._canPossiblyFulfill()) {
+ this._reject(this._getRangeError(this.length()));
+ }
+};
+
+SomePromiseArray.prototype.init = function () {
+ this._initialized = true;
+ this._init();
+};
+
+SomePromiseArray.prototype.setUnwrap = function () {
+ this._unwrap = true;
+};
+
+SomePromiseArray.prototype.howMany = function () {
+ return this._howMany;
+};
+
+SomePromiseArray.prototype.setHowMany = function (count) {
+ this._howMany = count;
+};
+
+SomePromiseArray.prototype._promiseFulfilled = function (value) {
+ this._addFulfilled(value);
+ if (this._fulfilled() === this.howMany()) {
+ this._values.length = this.howMany();
+ if (this.howMany() === 1 && this._unwrap) {
+ this._resolve(this._values[0]);
+ } else {
+ this._resolve(this._values);
+ }
+ return true;
+ }
+ return false;
+
+};
+SomePromiseArray.prototype._promiseRejected = function (reason) {
+ this._addRejected(reason);
+ return this._checkOutcome();
+};
+
+SomePromiseArray.prototype._promiseCancelled = function () {
+ if (this._values instanceof Promise || this._values == null) {
+ return this._cancel();
+ }
+ this._addRejected(CANCELLATION);
+ return this._checkOutcome();
+};
+
+SomePromiseArray.prototype._checkOutcome = function() {
+ if (this.howMany() > this._canPossiblyFulfill()) {
+ var e = new AggregateError();
+ for (var i = this.length(); i < this._values.length; ++i) {
+ if (this._values[i] !== CANCELLATION) {
+ e.push(this._values[i]);
+ }
+ }
+ if (e.length > 0) {
+ this._reject(e);
+ } else {
+ this._cancel();
+ }
+ return true;
+ }
+ return false;
+};
+
+SomePromiseArray.prototype._fulfilled = function () {
+ return this._totalResolved;
+};
+
+SomePromiseArray.prototype._rejected = function () {
+ return this._values.length - this.length();
+};
+
+SomePromiseArray.prototype._addRejected = function (reason) {
+ this._values.push(reason);
+};
+
+SomePromiseArray.prototype._addFulfilled = function (value) {
+ this._values[this._totalResolved++] = value;
+};
+
+SomePromiseArray.prototype._canPossiblyFulfill = function () {
+ return this.length() - this._rejected();
+};
+
+SomePromiseArray.prototype._getRangeError = function (count) {
+ var message = "Input array must contain at least " +
+ this._howMany + " items but contains only " + count + " items";
+ return new RangeError(message);
+};
+
+SomePromiseArray.prototype._resolveEmptyArray = function () {
+ this._reject(this._getRangeError(0));
+};
+
+function some(promises, howMany) {
+ if ((howMany | 0) !== howMany || howMany < 0) {
+ return apiRejection("expecting a positive integer\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ var ret = new SomePromiseArray(promises);
+ var promise = ret.promise();
+ ret.setHowMany(howMany);
+ ret.init();
+ return promise;
+}
+
+Promise.some = function (promises, howMany) {
+ return some(promises, howMany);
+};
+
+Promise.prototype.some = function (howMany) {
+ return some(this, howMany);
+};
+
+Promise._SomePromiseArray = SomePromiseArray;
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/synchronous_inspection.js b/website_quotation_template/node_modules/bluebird/js/release/synchronous_inspection.js
new file mode 100644
index 000000000..9c49d2e60
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/synchronous_inspection.js
@@ -0,0 +1,103 @@
+"use strict";
+module.exports = function(Promise) {
+function PromiseInspection(promise) {
+ if (promise !== undefined) {
+ promise = promise._target();
+ this._bitField = promise._bitField;
+ this._settledValueField = promise._isFateSealed()
+ ? promise._settledValue() : undefined;
+ }
+ else {
+ this._bitField = 0;
+ this._settledValueField = undefined;
+ }
+}
+
+PromiseInspection.prototype._settledValue = function() {
+ return this._settledValueField;
+};
+
+var value = PromiseInspection.prototype.value = function () {
+ if (!this.isFulfilled()) {
+ throw new TypeError("cannot get fulfillment value of a non-fulfilled promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var reason = PromiseInspection.prototype.error =
+PromiseInspection.prototype.reason = function () {
+ if (!this.isRejected()) {
+ throw new TypeError("cannot get rejection reason of a non-rejected promise\u000a\u000a See http://goo.gl/MqrFmX\u000a");
+ }
+ return this._settledValue();
+};
+
+var isFulfilled = PromiseInspection.prototype.isFulfilled = function() {
+ return (this._bitField & 33554432) !== 0;
+};
+
+var isRejected = PromiseInspection.prototype.isRejected = function () {
+ return (this._bitField & 16777216) !== 0;
+};
+
+var isPending = PromiseInspection.prototype.isPending = function () {
+ return (this._bitField & 50397184) === 0;
+};
+
+var isResolved = PromiseInspection.prototype.isResolved = function () {
+ return (this._bitField & 50331648) !== 0;
+};
+
+PromiseInspection.prototype.isCancelled = function() {
+ return (this._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.__isCancelled = function() {
+ return (this._bitField & 65536) === 65536;
+};
+
+Promise.prototype._isCancelled = function() {
+ return this._target().__isCancelled();
+};
+
+Promise.prototype.isCancelled = function() {
+ return (this._target()._bitField & 8454144) !== 0;
+};
+
+Promise.prototype.isPending = function() {
+ return isPending.call(this._target());
+};
+
+Promise.prototype.isRejected = function() {
+ return isRejected.call(this._target());
+};
+
+Promise.prototype.isFulfilled = function() {
+ return isFulfilled.call(this._target());
+};
+
+Promise.prototype.isResolved = function() {
+ return isResolved.call(this._target());
+};
+
+Promise.prototype.value = function() {
+ return value.call(this._target());
+};
+
+Promise.prototype.reason = function() {
+ var target = this._target();
+ target._unsetRejectionIsUnhandled();
+ return reason.call(target);
+};
+
+Promise.prototype._value = function() {
+ return this._settledValue();
+};
+
+Promise.prototype._reason = function() {
+ this._unsetRejectionIsUnhandled();
+ return this._settledValue();
+};
+
+Promise.PromiseInspection = PromiseInspection;
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/thenables.js b/website_quotation_template/node_modules/bluebird/js/release/thenables.js
new file mode 100644
index 000000000..d6ab9aa27
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/thenables.js
@@ -0,0 +1,86 @@
+"use strict";
+module.exports = function(Promise, INTERNAL) {
+var util = require("./util");
+var errorObj = util.errorObj;
+var isObject = util.isObject;
+
+function tryConvertToPromise(obj, context) {
+ if (isObject(obj)) {
+ if (obj instanceof Promise) return obj;
+ var then = getThen(obj);
+ if (then === errorObj) {
+ if (context) context._pushContext();
+ var ret = Promise.reject(then.e);
+ if (context) context._popContext();
+ return ret;
+ } else if (typeof then === "function") {
+ if (isAnyBluebirdPromise(obj)) {
+ var ret = new Promise(INTERNAL);
+ obj._then(
+ ret._fulfill,
+ ret._reject,
+ undefined,
+ ret,
+ null
+ );
+ return ret;
+ }
+ return doThenable(obj, then, context);
+ }
+ }
+ return obj;
+}
+
+function doGetThen(obj) {
+ return obj.then;
+}
+
+function getThen(obj) {
+ try {
+ return doGetThen(obj);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+
+var hasProp = {}.hasOwnProperty;
+function isAnyBluebirdPromise(obj) {
+ try {
+ return hasProp.call(obj, "_promise0");
+ } catch (e) {
+ return false;
+ }
+}
+
+function doThenable(x, then, context) {
+ var promise = new Promise(INTERNAL);
+ var ret = promise;
+ if (context) context._pushContext();
+ promise._captureStackTrace();
+ if (context) context._popContext();
+ var synchronous = true;
+ var result = util.tryCatch(then).call(x, resolve, reject);
+ synchronous = false;
+
+ if (promise && result === errorObj) {
+ promise._rejectCallback(result.e, true, true);
+ promise = null;
+ }
+
+ function resolve(value) {
+ if (!promise) return;
+ promise._resolveCallback(value);
+ promise = null;
+ }
+
+ function reject(reason) {
+ if (!promise) return;
+ promise._rejectCallback(reason, synchronous, true);
+ promise = null;
+ }
+ return ret;
+}
+
+return tryConvertToPromise;
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/timers.js b/website_quotation_template/node_modules/bluebird/js/release/timers.js
new file mode 100644
index 000000000..cb8f1f421
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/timers.js
@@ -0,0 +1,93 @@
+"use strict";
+module.exports = function(Promise, INTERNAL, debug) {
+var util = require("./util");
+var TimeoutError = Promise.TimeoutError;
+
+function HandleWrapper(handle) {
+ this.handle = handle;
+}
+
+HandleWrapper.prototype._resultCancelled = function() {
+ clearTimeout(this.handle);
+};
+
+var afterValue = function(value) { return delay(+this).thenReturn(value); };
+var delay = Promise.delay = function (ms, value) {
+ var ret;
+ var handle;
+ if (value !== undefined) {
+ ret = Promise.resolve(value)
+ ._then(afterValue, null, null, ms, undefined);
+ if (debug.cancellation() && value instanceof Promise) {
+ ret._setOnCancel(value);
+ }
+ } else {
+ ret = new Promise(INTERNAL);
+ handle = setTimeout(function() { ret._fulfill(); }, +ms);
+ if (debug.cancellation()) {
+ ret._setOnCancel(new HandleWrapper(handle));
+ }
+ ret._captureStackTrace();
+ }
+ ret._setAsyncGuaranteed();
+ return ret;
+};
+
+Promise.prototype.delay = function (ms) {
+ return delay(ms, this);
+};
+
+var afterTimeout = function (promise, message, parent) {
+ var err;
+ if (typeof message !== "string") {
+ if (message instanceof Error) {
+ err = message;
+ } else {
+ err = new TimeoutError("operation timed out");
+ }
+ } else {
+ err = new TimeoutError(message);
+ }
+ util.markAsOriginatingFromRejection(err);
+ promise._attachExtraTrace(err);
+ promise._reject(err);
+
+ if (parent != null) {
+ parent.cancel();
+ }
+};
+
+function successClear(value) {
+ clearTimeout(this.handle);
+ return value;
+}
+
+function failureClear(reason) {
+ clearTimeout(this.handle);
+ throw reason;
+}
+
+Promise.prototype.timeout = function (ms, message) {
+ ms = +ms;
+ var ret, parent;
+
+ var handleWrapper = new HandleWrapper(setTimeout(function timeoutTimeout() {
+ if (ret.isPending()) {
+ afterTimeout(ret, message, parent);
+ }
+ }, ms));
+
+ if (debug.cancellation()) {
+ parent = this.then();
+ ret = parent._then(successClear, failureClear,
+ undefined, handleWrapper, undefined);
+ ret._setOnCancel(handleWrapper);
+ } else {
+ ret = this._then(successClear, failureClear,
+ undefined, handleWrapper, undefined);
+ }
+
+ return ret;
+};
+
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/using.js b/website_quotation_template/node_modules/bluebird/js/release/using.js
new file mode 100644
index 000000000..65de531c1
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/using.js
@@ -0,0 +1,226 @@
+"use strict";
+module.exports = function (Promise, apiRejection, tryConvertToPromise,
+ createContext, INTERNAL, debug) {
+ var util = require("./util");
+ var TypeError = require("./errors").TypeError;
+ var inherits = require("./util").inherits;
+ var errorObj = util.errorObj;
+ var tryCatch = util.tryCatch;
+ var NULL = {};
+
+ function thrower(e) {
+ setTimeout(function(){throw e;}, 0);
+ }
+
+ function castPreservingDisposable(thenable) {
+ var maybePromise = tryConvertToPromise(thenable);
+ if (maybePromise !== thenable &&
+ typeof thenable._isDisposable === "function" &&
+ typeof thenable._getDisposer === "function" &&
+ thenable._isDisposable()) {
+ maybePromise._setDisposable(thenable._getDisposer());
+ }
+ return maybePromise;
+ }
+ function dispose(resources, inspection) {
+ var i = 0;
+ var len = resources.length;
+ var ret = new Promise(INTERNAL);
+ function iterator() {
+ if (i >= len) return ret._fulfill();
+ var maybePromise = castPreservingDisposable(resources[i++]);
+ if (maybePromise instanceof Promise &&
+ maybePromise._isDisposable()) {
+ try {
+ maybePromise = tryConvertToPromise(
+ maybePromise._getDisposer().tryDispose(inspection),
+ resources.promise);
+ } catch (e) {
+ return thrower(e);
+ }
+ if (maybePromise instanceof Promise) {
+ return maybePromise._then(iterator, thrower,
+ null, null, null);
+ }
+ }
+ iterator();
+ }
+ iterator();
+ return ret;
+ }
+
+ function Disposer(data, promise, context) {
+ this._data = data;
+ this._promise = promise;
+ this._context = context;
+ }
+
+ Disposer.prototype.data = function () {
+ return this._data;
+ };
+
+ Disposer.prototype.promise = function () {
+ return this._promise;
+ };
+
+ Disposer.prototype.resource = function () {
+ if (this.promise().isFulfilled()) {
+ return this.promise().value();
+ }
+ return NULL;
+ };
+
+ Disposer.prototype.tryDispose = function(inspection) {
+ var resource = this.resource();
+ var context = this._context;
+ if (context !== undefined) context._pushContext();
+ var ret = resource !== NULL
+ ? this.doDispose(resource, inspection) : null;
+ if (context !== undefined) context._popContext();
+ this._promise._unsetDisposable();
+ this._data = null;
+ return ret;
+ };
+
+ Disposer.isDisposer = function (d) {
+ return (d != null &&
+ typeof d.resource === "function" &&
+ typeof d.tryDispose === "function");
+ };
+
+ function FunctionDisposer(fn, promise, context) {
+ this.constructor$(fn, promise, context);
+ }
+ inherits(FunctionDisposer, Disposer);
+
+ FunctionDisposer.prototype.doDispose = function (resource, inspection) {
+ var fn = this.data();
+ return fn.call(resource, resource, inspection);
+ };
+
+ function maybeUnwrapDisposer(value) {
+ if (Disposer.isDisposer(value)) {
+ this.resources[this.index]._setDisposable(value);
+ return value.promise();
+ }
+ return value;
+ }
+
+ function ResourceList(length) {
+ this.length = length;
+ this.promise = null;
+ this[length-1] = null;
+ }
+
+ ResourceList.prototype._resultCancelled = function() {
+ var len = this.length;
+ for (var i = 0; i < len; ++i) {
+ var item = this[i];
+ if (item instanceof Promise) {
+ item.cancel();
+ }
+ }
+ };
+
+ Promise.using = function () {
+ var len = arguments.length;
+ if (len < 2) return apiRejection(
+ "you must pass at least 2 arguments to Promise.using");
+ var fn = arguments[len - 1];
+ if (typeof fn !== "function") {
+ return apiRejection("expecting a function but got " + util.classString(fn));
+ }
+ var input;
+ var spreadArgs = true;
+ if (len === 2 && Array.isArray(arguments[0])) {
+ input = arguments[0];
+ len = input.length;
+ spreadArgs = false;
+ } else {
+ input = arguments;
+ len--;
+ }
+ var resources = new ResourceList(len);
+ for (var i = 0; i < len; ++i) {
+ var resource = input[i];
+ if (Disposer.isDisposer(resource)) {
+ var disposer = resource;
+ resource = resource.promise();
+ resource._setDisposable(disposer);
+ } else {
+ var maybePromise = tryConvertToPromise(resource);
+ if (maybePromise instanceof Promise) {
+ resource =
+ maybePromise._then(maybeUnwrapDisposer, null, null, {
+ resources: resources,
+ index: i
+ }, undefined);
+ }
+ }
+ resources[i] = resource;
+ }
+
+ var reflectedResources = new Array(resources.length);
+ for (var i = 0; i < reflectedResources.length; ++i) {
+ reflectedResources[i] = Promise.resolve(resources[i]).reflect();
+ }
+
+ var resultPromise = Promise.all(reflectedResources)
+ .then(function(inspections) {
+ for (var i = 0; i < inspections.length; ++i) {
+ var inspection = inspections[i];
+ if (inspection.isRejected()) {
+ errorObj.e = inspection.error();
+ return errorObj;
+ } else if (!inspection.isFulfilled()) {
+ resultPromise.cancel();
+ return;
+ }
+ inspections[i] = inspection.value();
+ }
+ promise._pushContext();
+
+ fn = tryCatch(fn);
+ var ret = spreadArgs
+ ? fn.apply(undefined, inspections) : fn(inspections);
+ var promiseCreated = promise._popContext();
+ debug.checkForgottenReturns(
+ ret, promiseCreated, "Promise.using", promise);
+ return ret;
+ });
+
+ var promise = resultPromise.lastly(function() {
+ var inspection = new Promise.PromiseInspection(resultPromise);
+ return dispose(resources, inspection);
+ });
+ resources.promise = promise;
+ promise._setOnCancel(resources);
+ return promise;
+ };
+
+ Promise.prototype._setDisposable = function (disposer) {
+ this._bitField = this._bitField | 131072;
+ this._disposer = disposer;
+ };
+
+ Promise.prototype._isDisposable = function () {
+ return (this._bitField & 131072) > 0;
+ };
+
+ Promise.prototype._getDisposer = function () {
+ return this._disposer;
+ };
+
+ Promise.prototype._unsetDisposable = function () {
+ this._bitField = this._bitField & (~131072);
+ this._disposer = undefined;
+ };
+
+ Promise.prototype.disposer = function (fn) {
+ if (typeof fn === "function") {
+ return new FunctionDisposer(fn, this, createContext());
+ }
+ throw new TypeError();
+ };
+
+};
diff --git a/website_quotation_template/node_modules/bluebird/js/release/util.js b/website_quotation_template/node_modules/bluebird/js/release/util.js
new file mode 100644
index 000000000..84c28ec47
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/js/release/util.js
@@ -0,0 +1,379 @@
+"use strict";
+var es5 = require("./es5");
+var canEvaluate = typeof navigator == "undefined";
+
+var errorObj = {e: {}};
+var tryCatchTarget;
+var globalObject = typeof self !== "undefined" ? self :
+ typeof window !== "undefined" ? window :
+ typeof global !== "undefined" ? global :
+ this !== undefined ? this : null;
+
+function tryCatcher() {
+ try {
+ var target = tryCatchTarget;
+ tryCatchTarget = null;
+ return target.apply(this, arguments);
+ } catch (e) {
+ errorObj.e = e;
+ return errorObj;
+ }
+}
+function tryCatch(fn) {
+ tryCatchTarget = fn;
+ return tryCatcher;
+}
+
+var inherits = function(Child, Parent) {
+ var hasProp = {}.hasOwnProperty;
+
+ function T() {
+ this.constructor = Child;
+ this.constructor$ = Parent;
+ for (var propertyName in Parent.prototype) {
+ if (hasProp.call(Parent.prototype, propertyName) &&
+ propertyName.charAt(propertyName.length-1) !== "$"
+ ) {
+ this[propertyName + "$"] = Parent.prototype[propertyName];
+ }
+ }
+ }
+ T.prototype = Parent.prototype;
+ Child.prototype = new T();
+ return Child.prototype;
+};
+
+
+function isPrimitive(val) {
+ return val == null || val === true || val === false ||
+ typeof val === "string" || typeof val === "number";
+
+}
+
+function isObject(value) {
+ return typeof value === "function" ||
+ typeof value === "object" && value !== null;
+}
+
+function maybeWrapAsError(maybeError) {
+ if (!isPrimitive(maybeError)) return maybeError;
+
+ return new Error(safeToString(maybeError));
+}
+
+function withAppended(target, appendee) {
+ var len = target.length;
+ var ret = new Array(len + 1);
+ var i;
+ for (i = 0; i < len; ++i) {
+ ret[i] = target[i];
+ }
+ ret[i] = appendee;
+ return ret;
+}
+
+function getDataPropertyOrDefault(obj, key, defaultValue) {
+ if (es5.isES5) {
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+
+ if (desc != null) {
+ return desc.get == null && desc.set == null
+ ? desc.value
+ : defaultValue;
+ }
+ } else {
+ return {}.hasOwnProperty.call(obj, key) ? obj[key] : undefined;
+ }
+}
+
+function notEnumerableProp(obj, name, value) {
+ if (isPrimitive(obj)) return obj;
+ var descriptor = {
+ value: value,
+ configurable: true,
+ enumerable: false,
+ writable: true
+ };
+ es5.defineProperty(obj, name, descriptor);
+ return obj;
+}
+
+function thrower(r) {
+ throw r;
+}
+
+var inheritedDataKeys = (function() {
+ var excludedPrototypes = [
+ Array.prototype,
+ Object.prototype,
+ Function.prototype
+ ];
+
+ var isExcludedProto = function(val) {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (excludedPrototypes[i] === val) {
+ return true;
+ }
+ }
+ return false;
+ };
+
+ if (es5.isES5) {
+ var getKeys = Object.getOwnPropertyNames;
+ return function(obj) {
+ var ret = [];
+ var visitedKeys = Object.create(null);
+ while (obj != null && !isExcludedProto(obj)) {
+ var keys;
+ try {
+ keys = getKeys(obj);
+ } catch (e) {
+ return ret;
+ }
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (visitedKeys[key]) continue;
+ visitedKeys[key] = true;
+ var desc = Object.getOwnPropertyDescriptor(obj, key);
+ if (desc != null && desc.get == null && desc.set == null) {
+ ret.push(key);
+ }
+ }
+ obj = es5.getPrototypeOf(obj);
+ }
+ return ret;
+ };
+ } else {
+ var hasProp = {}.hasOwnProperty;
+ return function(obj) {
+ if (isExcludedProto(obj)) return [];
+ var ret = [];
+
+ /*jshint forin:false */
+ enumeration: for (var key in obj) {
+ if (hasProp.call(obj, key)) {
+ ret.push(key);
+ } else {
+ for (var i = 0; i < excludedPrototypes.length; ++i) {
+ if (hasProp.call(excludedPrototypes[i], key)) {
+ continue enumeration;
+ }
+ }
+ ret.push(key);
+ }
+ }
+ return ret;
+ };
+ }
+
+})();
+
+var thisAssignmentPattern = /this\s*\.\s*\S+\s*=/;
+function isClass(fn) {
+ try {
+ if (typeof fn === "function") {
+ var keys = es5.names(fn.prototype);
+
+ var hasMethods = es5.isES5 && keys.length > 1;
+ var hasMethodsOtherThanConstructor = keys.length > 0 &&
+ !(keys.length === 1 && keys[0] === "constructor");
+ var hasThisAssignmentAndStaticMethods =
+ thisAssignmentPattern.test(fn + "") && es5.names(fn).length > 0;
+
+ if (hasMethods || hasMethodsOtherThanConstructor ||
+ hasThisAssignmentAndStaticMethods) {
+ return true;
+ }
+ }
+ return false;
+ } catch (e) {
+ return false;
+ }
+}
+
+function toFastProperties(obj) {
+ /*jshint -W027,-W055,-W031*/
+ function FakeConstructor() {}
+ FakeConstructor.prototype = obj;
+ var l = 8;
+ while (l--) new FakeConstructor();
+ return obj;
+ eval(obj);
+}
+
+var rident = /^[a-z$_][a-z$_0-9]*$/i;
+function isIdentifier(str) {
+ return rident.test(str);
+}
+
+function filledRange(count, prefix, suffix) {
+ var ret = new Array(count);
+ for(var i = 0; i < count; ++i) {
+ ret[i] = prefix + i + suffix;
+ }
+ return ret;
+}
+
+function safeToString(obj) {
+ try {
+ return obj + "";
+ } catch (e) {
+ return "[no string representation]";
+ }
+}
+
+function isError(obj) {
+ return obj !== null &&
+ typeof obj === "object" &&
+ typeof obj.message === "string" &&
+ typeof obj.name === "string";
+}
+
+function markAsOriginatingFromRejection(e) {
+ try {
+ notEnumerableProp(e, "isOperational", true);
+ }
+ catch(ignore) {}
+}
+
+function originatesFromRejection(e) {
+ if (e == null) return false;
+ return ((e instanceof Error["__BluebirdErrorTypes__"].OperationalError) ||
+ e["isOperational"] === true);
+}
+
+function canAttachTrace(obj) {
+ return isError(obj) && es5.propertyIsWritable(obj, "stack");
+}
+
+var ensureErrorObject = (function() {
+ if (!("stack" in new Error())) {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ try {throw new Error(safeToString(value));}
+ catch(err) {return err;}
+ };
+ } else {
+ return function(value) {
+ if (canAttachTrace(value)) return value;
+ return new Error(safeToString(value));
+ };
+ }
+})();
+
+function classString(obj) {
+ return {}.toString.call(obj);
+}
+
+function copyDescriptors(from, to, filter) {
+ var keys = es5.names(from);
+ for (var i = 0; i < keys.length; ++i) {
+ var key = keys[i];
+ if (filter(key)) {
+ try {
+ es5.defineProperty(to, key, es5.getDescriptor(from, key));
+ } catch (ignore) {}
+ }
+ }
+}
+
+var asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ }
+ return null;
+};
+
+if (typeof Symbol !== "undefined" && Symbol.iterator) {
+ var ArrayFrom = typeof Array.from === "function" ? function(v) {
+ return Array.from(v);
+ } : function(v) {
+ var ret = [];
+ var it = v[Symbol.iterator]();
+ var itResult;
+ while (!((itResult = it.next()).done)) {
+ ret.push(itResult.value);
+ }
+ return ret;
+ };
+
+ asArray = function(v) {
+ if (es5.isArray(v)) {
+ return v;
+ } else if (v != null && typeof v[Symbol.iterator] === "function") {
+ return ArrayFrom(v);
+ }
+ return null;
+ };
+}
+
+var isNode = typeof process !== "undefined" &&
+ classString(process).toLowerCase() === "[object process]";
+
+var hasEnvVariables = typeof process !== "undefined" &&
+ typeof process.env !== "undefined";
+
+function env(key) {
+ return hasEnvVariables ? process.env[key] : undefined;
+}
+
+function getNativePromise() {
+ if (typeof Promise === "function") {
+ try {
+ var promise = new Promise(function(){});
+ if ({}.toString.call(promise) === "[object Promise]") {
+ return Promise;
+ }
+ } catch (e) {}
+ }
+}
+
+function domainBind(self, cb) {
+ return self.bind(cb);
+}
+
+var ret = {
+ isClass: isClass,
+ isIdentifier: isIdentifier,
+ inheritedDataKeys: inheritedDataKeys,
+ getDataPropertyOrDefault: getDataPropertyOrDefault,
+ thrower: thrower,
+ isArray: es5.isArray,
+ asArray: asArray,
+ notEnumerableProp: notEnumerableProp,
+ isPrimitive: isPrimitive,
+ isObject: isObject,
+ isError: isError,
+ canEvaluate: canEvaluate,
+ errorObj: errorObj,
+ tryCatch: tryCatch,
+ inherits: inherits,
+ withAppended: withAppended,
+ maybeWrapAsError: maybeWrapAsError,
+ toFastProperties: toFastProperties,
+ filledRange: filledRange,
+ toString: safeToString,
+ canAttachTrace: canAttachTrace,
+ ensureErrorObject: ensureErrorObject,
+ originatesFromRejection: originatesFromRejection,
+ markAsOriginatingFromRejection: markAsOriginatingFromRejection,
+ classString: classString,
+ copyDescriptors: copyDescriptors,
+ hasDevTools: typeof chrome !== "undefined" && chrome &&
+ typeof chrome.loadTimes === "function",
+ isNode: isNode,
+ hasEnvVariables: hasEnvVariables,
+ env: env,
+ global: globalObject,
+ getNativePromise: getNativePromise,
+ domainBind: domainBind
+};
+ret.isRecentNode = ret.isNode && (function() {
+ var version = process.versions.node.split(".").map(Number);
+ return (version[0] === 0 && version[1] > 10) || (version[0] > 0);
+})();
+
+if (ret.isNode) ret.toFastProperties(process);
+
+try {throw new Error(); } catch (e) {ret.lastLineError = e;}
+module.exports = ret;
diff --git a/website_quotation_template/node_modules/bluebird/package.json b/website_quotation_template/node_modules/bluebird/package.json
new file mode 100644
index 000000000..6ab2a5444
--- /dev/null
+++ b/website_quotation_template/node_modules/bluebird/package.json
@@ -0,0 +1,100 @@
+{
+ "_from": "bluebird@~3.4.0",
+ "_id": "bluebird@3.4.7",
+ "_inBundle": false,
+ "_integrity": "sha512-iD3898SR7sWVRHbiQv+sHUtHnMvC1o3nW5rAcqnq3uOn07DSAppZYUkIGslDz6gXC7HfunPe7YVBgoEJASPcHA==",
+ "_location": "/bluebird",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "bluebird@~3.4.0",
+ "name": "bluebird",
+ "escapedName": "bluebird",
+ "rawSpec": "~3.4.0",
+ "saveSpec": null,
+ "fetchSpec": "~3.4.0"
+ },
+ "_requiredBy": [
+ "/mammoth"
+ ],
+ "_resolved": "https://registry.npmjs.org/bluebird/-/bluebird-3.4.7.tgz",
+ "_shasum": "f72d760be09b7f76d08ed8fae98b289a8d05fab3",
+ "_spec": "bluebird@~3.4.0",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/mammoth",
+ "author": {
+ "name": "Petka Antonov",
+ "email": "petka_antonov@hotmail.com",
+ "url": "http://github.com/petkaantonov/"
+ },
+ "browser": "./js/browser/bluebird.js",
+ "bugs": {
+ "url": "http://github.com/petkaantonov/bluebird/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Full featured Promises/A+ implementation with exceptionally good performance",
+ "devDependencies": {
+ "acorn": "~0.6.0",
+ "baconjs": "^0.7.43",
+ "bluebird": "^2.9.2",
+ "body-parser": "^1.10.2",
+ "browserify": "^8.1.1",
+ "cli-table": "~0.3.1",
+ "co": "^4.2.0",
+ "cross-spawn": "^0.2.3",
+ "glob": "^4.3.2",
+ "grunt-saucelabs": "~8.4.1",
+ "highland": "^2.3.0",
+ "istanbul": "^0.3.5",
+ "jshint": "^2.6.0",
+ "jshint-stylish": "~0.2.0",
+ "kefir": "^2.4.1",
+ "mkdirp": "~0.5.0",
+ "mocha": "~2.1",
+ "open": "~0.0.5",
+ "optimist": "~0.6.1",
+ "rimraf": "~2.2.6",
+ "rx": "^2.3.25",
+ "serve-static": "^1.7.1",
+ "sinon": "~1.7.3",
+ "uglify-js": "~2.4.16"
+ },
+ "files": [
+ "js/browser",
+ "js/release",
+ "LICENSE"
+ ],
+ "homepage": "https://github.com/petkaantonov/bluebird",
+ "keywords": [
+ "promise",
+ "performance",
+ "promises",
+ "promises-a",
+ "promises-aplus",
+ "async",
+ "await",
+ "deferred",
+ "deferreds",
+ "future",
+ "flow control",
+ "dsl",
+ "fluent interface"
+ ],
+ "license": "MIT",
+ "main": "./js/release/bluebird.js",
+ "name": "bluebird",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/petkaantonov/bluebird.git"
+ },
+ "scripts": {
+ "generate-browser-core": "node tools/build.js --features=core --no-debug --release --zalgo --browser --minify && mv js/browser/bluebird.js js/browser/bluebird.core.js && mv js/browser/bluebird.min.js js/browser/bluebird.core.min.js",
+ "generate-browser-full": "node tools/build.js --no-clean --no-debug --release --browser --minify",
+ "istanbul": "istanbul",
+ "lint": "node scripts/jshint.js",
+ "prepublish": "npm run generate-browser-core && npm run generate-browser-full",
+ "test": "node tools/test.js"
+ },
+ "version": "3.4.7"
+}
diff --git a/website_quotation_template/node_modules/buffer-crc32/LICENSE b/website_quotation_template/node_modules/buffer-crc32/LICENSE
new file mode 100644
index 000000000..4cef10eb7
--- /dev/null
+++ b/website_quotation_template/node_modules/buffer-crc32/LICENSE
@@ -0,0 +1,19 @@
+The MIT License
+
+Copyright (c) 2013 Brian J. Brennan
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to use,
+copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the
+Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED,
+INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR
+PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE
+FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE,
+ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
diff --git a/website_quotation_template/node_modules/buffer-crc32/README.md b/website_quotation_template/node_modules/buffer-crc32/README.md
new file mode 100644
index 000000000..0d9d8b835
--- /dev/null
+++ b/website_quotation_template/node_modules/buffer-crc32/README.md
@@ -0,0 +1,47 @@
+# buffer-crc32
+
+[](http://travis-ci.org/brianloveswords/buffer-crc32)
+
+crc32 that works with binary data and fancy character sets, outputs
+buffer, signed or unsigned data and has tests.
+
+Derived from the sample CRC implementation in the PNG specification: http://www.w3.org/TR/PNG/#D-CRCAppendix
+
+# install
+```
+npm install buffer-crc32
+```
+
+# example
+```js
+var crc32 = require('buffer-crc32');
+// works with buffers
+var buf = Buffer([0x00, 0x73, 0x75, 0x70, 0x20, 0x62, 0x72, 0x6f, 0x00])
+crc32(buf) // ->
+
+// has convenience methods for getting signed or unsigned ints
+crc32.signed(buf) // -> -1805997238
+crc32.unsigned(buf) // -> 2488970058
+
+// will cast to buffer if given a string, so you can
+// directly use foreign characters safely
+crc32('自動販売機') // ->
+
+// and works in append mode too
+var partialCrc = crc32('hey');
+var partialCrc = crc32(' ', partialCrc);
+var partialCrc = crc32('sup', partialCrc);
+var partialCrc = crc32(' ', partialCrc);
+var finalCrc = crc32('bros', partialCrc); // ->
+```
+
+# tests
+This was tested against the output of zlib's crc32 method. You can run
+the tests with`npm test` (requires tap)
+
+# see also
+https://github.com/alexgorbatchev/node-crc, `crc.buffer.crc32` also
+supports buffer inputs and return unsigned ints (thanks @tjholowaychuk).
+
+# license
+MIT/X11
diff --git a/website_quotation_template/node_modules/buffer-crc32/index.js b/website_quotation_template/node_modules/buffer-crc32/index.js
new file mode 100644
index 000000000..6727dd39b
--- /dev/null
+++ b/website_quotation_template/node_modules/buffer-crc32/index.js
@@ -0,0 +1,111 @@
+var Buffer = require('buffer').Buffer;
+
+var CRC_TABLE = [
+ 0x00000000, 0x77073096, 0xee0e612c, 0x990951ba, 0x076dc419,
+ 0x706af48f, 0xe963a535, 0x9e6495a3, 0x0edb8832, 0x79dcb8a4,
+ 0xe0d5e91e, 0x97d2d988, 0x09b64c2b, 0x7eb17cbd, 0xe7b82d07,
+ 0x90bf1d91, 0x1db71064, 0x6ab020f2, 0xf3b97148, 0x84be41de,
+ 0x1adad47d, 0x6ddde4eb, 0xf4d4b551, 0x83d385c7, 0x136c9856,
+ 0x646ba8c0, 0xfd62f97a, 0x8a65c9ec, 0x14015c4f, 0x63066cd9,
+ 0xfa0f3d63, 0x8d080df5, 0x3b6e20c8, 0x4c69105e, 0xd56041e4,
+ 0xa2677172, 0x3c03e4d1, 0x4b04d447, 0xd20d85fd, 0xa50ab56b,
+ 0x35b5a8fa, 0x42b2986c, 0xdbbbc9d6, 0xacbcf940, 0x32d86ce3,
+ 0x45df5c75, 0xdcd60dcf, 0xabd13d59, 0x26d930ac, 0x51de003a,
+ 0xc8d75180, 0xbfd06116, 0x21b4f4b5, 0x56b3c423, 0xcfba9599,
+ 0xb8bda50f, 0x2802b89e, 0x5f058808, 0xc60cd9b2, 0xb10be924,
+ 0x2f6f7c87, 0x58684c11, 0xc1611dab, 0xb6662d3d, 0x76dc4190,
+ 0x01db7106, 0x98d220bc, 0xefd5102a, 0x71b18589, 0x06b6b51f,
+ 0x9fbfe4a5, 0xe8b8d433, 0x7807c9a2, 0x0f00f934, 0x9609a88e,
+ 0xe10e9818, 0x7f6a0dbb, 0x086d3d2d, 0x91646c97, 0xe6635c01,
+ 0x6b6b51f4, 0x1c6c6162, 0x856530d8, 0xf262004e, 0x6c0695ed,
+ 0x1b01a57b, 0x8208f4c1, 0xf50fc457, 0x65b0d9c6, 0x12b7e950,
+ 0x8bbeb8ea, 0xfcb9887c, 0x62dd1ddf, 0x15da2d49, 0x8cd37cf3,
+ 0xfbd44c65, 0x4db26158, 0x3ab551ce, 0xa3bc0074, 0xd4bb30e2,
+ 0x4adfa541, 0x3dd895d7, 0xa4d1c46d, 0xd3d6f4fb, 0x4369e96a,
+ 0x346ed9fc, 0xad678846, 0xda60b8d0, 0x44042d73, 0x33031de5,
+ 0xaa0a4c5f, 0xdd0d7cc9, 0x5005713c, 0x270241aa, 0xbe0b1010,
+ 0xc90c2086, 0x5768b525, 0x206f85b3, 0xb966d409, 0xce61e49f,
+ 0x5edef90e, 0x29d9c998, 0xb0d09822, 0xc7d7a8b4, 0x59b33d17,
+ 0x2eb40d81, 0xb7bd5c3b, 0xc0ba6cad, 0xedb88320, 0x9abfb3b6,
+ 0x03b6e20c, 0x74b1d29a, 0xead54739, 0x9dd277af, 0x04db2615,
+ 0x73dc1683, 0xe3630b12, 0x94643b84, 0x0d6d6a3e, 0x7a6a5aa8,
+ 0xe40ecf0b, 0x9309ff9d, 0x0a00ae27, 0x7d079eb1, 0xf00f9344,
+ 0x8708a3d2, 0x1e01f268, 0x6906c2fe, 0xf762575d, 0x806567cb,
+ 0x196c3671, 0x6e6b06e7, 0xfed41b76, 0x89d32be0, 0x10da7a5a,
+ 0x67dd4acc, 0xf9b9df6f, 0x8ebeeff9, 0x17b7be43, 0x60b08ed5,
+ 0xd6d6a3e8, 0xa1d1937e, 0x38d8c2c4, 0x4fdff252, 0xd1bb67f1,
+ 0xa6bc5767, 0x3fb506dd, 0x48b2364b, 0xd80d2bda, 0xaf0a1b4c,
+ 0x36034af6, 0x41047a60, 0xdf60efc3, 0xa867df55, 0x316e8eef,
+ 0x4669be79, 0xcb61b38c, 0xbc66831a, 0x256fd2a0, 0x5268e236,
+ 0xcc0c7795, 0xbb0b4703, 0x220216b9, 0x5505262f, 0xc5ba3bbe,
+ 0xb2bd0b28, 0x2bb45a92, 0x5cb36a04, 0xc2d7ffa7, 0xb5d0cf31,
+ 0x2cd99e8b, 0x5bdeae1d, 0x9b64c2b0, 0xec63f226, 0x756aa39c,
+ 0x026d930a, 0x9c0906a9, 0xeb0e363f, 0x72076785, 0x05005713,
+ 0x95bf4a82, 0xe2b87a14, 0x7bb12bae, 0x0cb61b38, 0x92d28e9b,
+ 0xe5d5be0d, 0x7cdcefb7, 0x0bdbdf21, 0x86d3d2d4, 0xf1d4e242,
+ 0x68ddb3f8, 0x1fda836e, 0x81be16cd, 0xf6b9265b, 0x6fb077e1,
+ 0x18b74777, 0x88085ae6, 0xff0f6a70, 0x66063bca, 0x11010b5c,
+ 0x8f659eff, 0xf862ae69, 0x616bffd3, 0x166ccf45, 0xa00ae278,
+ 0xd70dd2ee, 0x4e048354, 0x3903b3c2, 0xa7672661, 0xd06016f7,
+ 0x4969474d, 0x3e6e77db, 0xaed16a4a, 0xd9d65adc, 0x40df0b66,
+ 0x37d83bf0, 0xa9bcae53, 0xdebb9ec5, 0x47b2cf7f, 0x30b5ffe9,
+ 0xbdbdf21c, 0xcabac28a, 0x53b39330, 0x24b4a3a6, 0xbad03605,
+ 0xcdd70693, 0x54de5729, 0x23d967bf, 0xb3667a2e, 0xc4614ab8,
+ 0x5d681b02, 0x2a6f2b94, 0xb40bbe37, 0xc30c8ea1, 0x5a05df1b,
+ 0x2d02ef8d
+];
+
+if (typeof Int32Array !== 'undefined') {
+ CRC_TABLE = new Int32Array(CRC_TABLE);
+}
+
+function ensureBuffer(input) {
+ if (Buffer.isBuffer(input)) {
+ return input;
+ }
+
+ var hasNewBufferAPI =
+ typeof Buffer.alloc === "function" &&
+ typeof Buffer.from === "function";
+
+ if (typeof input === "number") {
+ return hasNewBufferAPI ? Buffer.alloc(input) : new Buffer(input);
+ }
+ else if (typeof input === "string") {
+ return hasNewBufferAPI ? Buffer.from(input) : new Buffer(input);
+ }
+ else {
+ throw new Error("input must be buffer, number, or string, received " +
+ typeof input);
+ }
+}
+
+function bufferizeInt(num) {
+ var tmp = ensureBuffer(4);
+ tmp.writeInt32BE(num, 0);
+ return tmp;
+}
+
+function _crc32(buf, previous) {
+ buf = ensureBuffer(buf);
+ if (Buffer.isBuffer(previous)) {
+ previous = previous.readUInt32BE(0);
+ }
+ var crc = ~~previous ^ -1;
+ for (var n = 0; n < buf.length; n++) {
+ crc = CRC_TABLE[(crc ^ buf[n]) & 0xff] ^ (crc >>> 8);
+ }
+ return (crc ^ -1);
+}
+
+function crc32() {
+ return bufferizeInt(_crc32.apply(null, arguments));
+}
+crc32.signed = function () {
+ return _crc32.apply(null, arguments);
+};
+crc32.unsigned = function () {
+ return _crc32.apply(null, arguments) >>> 0;
+};
+
+module.exports = crc32;
diff --git a/website_quotation_template/node_modules/buffer-crc32/package.json b/website_quotation_template/node_modules/buffer-crc32/package.json
new file mode 100644
index 000000000..ad318c57a
--- /dev/null
+++ b/website_quotation_template/node_modules/buffer-crc32/package.json
@@ -0,0 +1,69 @@
+{
+ "_from": "buffer-crc32@~0.2.3",
+ "_id": "buffer-crc32@0.2.13",
+ "_inBundle": false,
+ "_integrity": "sha512-VO9Ht/+p3SN7SKWqcrgEzjGbRSJYTx+Q1pTQC0wrWqHx0vpJraQ6GtHx8tvcg1rlK1byhU5gccxgOgj7B0TDkQ==",
+ "_location": "/buffer-crc32",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "buffer-crc32@~0.2.3",
+ "name": "buffer-crc32",
+ "escapedName": "buffer-crc32",
+ "rawSpec": "~0.2.3",
+ "saveSpec": null,
+ "fetchSpec": "~0.2.3"
+ },
+ "_requiredBy": [
+ "/yauzl"
+ ],
+ "_resolved": "https://registry.npmjs.org/buffer-crc32/-/buffer-crc32-0.2.13.tgz",
+ "_shasum": "0d333e3f00eac50aa1454abd30ef8c2a5d9a7242",
+ "_spec": "buffer-crc32@~0.2.3",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/yauzl",
+ "author": {
+ "name": "Brian J. Brennan",
+ "email": "brianloveswords@gmail.com"
+ },
+ "bugs": {
+ "url": "https://github.com/brianloveswords/buffer-crc32/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Vladimir Kuznetsov"
+ }
+ ],
+ "dependencies": {},
+ "deprecated": false,
+ "description": "A pure javascript CRC32 algorithm that plays nice with binary data",
+ "devDependencies": {
+ "tap": "~0.2.5"
+ },
+ "engines": {
+ "node": "*"
+ },
+ "files": [
+ "index.js"
+ ],
+ "homepage": "https://github.com/brianloveswords/buffer-crc32",
+ "license": "MIT",
+ "licenses": [
+ {
+ "type": "MIT",
+ "url": "https://github.com/brianloveswords/buffer-crc32/raw/master/LICENSE"
+ }
+ ],
+ "main": "index.js",
+ "name": "buffer-crc32",
+ "optionalDependencies": {},
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/brianloveswords/buffer-crc32.git"
+ },
+ "scripts": {
+ "test": "tap tests/*.test.js"
+ },
+ "version": "0.2.13"
+}
diff --git a/website_quotation_template/node_modules/buffer-from/LICENSE b/website_quotation_template/node_modules/buffer-from/LICENSE
new file mode 100644
index 000000000..e4bf1d69b
--- /dev/null
+++ b/website_quotation_template/node_modules/buffer-from/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2016, 2018 Linus Unnebäck
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/website_quotation_template/node_modules/buffer-from/index.js b/website_quotation_template/node_modules/buffer-from/index.js
new file mode 100644
index 000000000..e1a58b5e8
--- /dev/null
+++ b/website_quotation_template/node_modules/buffer-from/index.js
@@ -0,0 +1,72 @@
+/* eslint-disable node/no-deprecated-api */
+
+var toString = Object.prototype.toString
+
+var isModern = (
+ typeof Buffer !== 'undefined' &&
+ typeof Buffer.alloc === 'function' &&
+ typeof Buffer.allocUnsafe === 'function' &&
+ typeof Buffer.from === 'function'
+)
+
+function isArrayBuffer (input) {
+ return toString.call(input).slice(8, -1) === 'ArrayBuffer'
+}
+
+function fromArrayBuffer (obj, byteOffset, length) {
+ byteOffset >>>= 0
+
+ var maxLength = obj.byteLength - byteOffset
+
+ if (maxLength < 0) {
+ throw new RangeError("'offset' is out of bounds")
+ }
+
+ if (length === undefined) {
+ length = maxLength
+ } else {
+ length >>>= 0
+
+ if (length > maxLength) {
+ throw new RangeError("'length' is out of bounds")
+ }
+ }
+
+ return isModern
+ ? Buffer.from(obj.slice(byteOffset, byteOffset + length))
+ : new Buffer(new Uint8Array(obj.slice(byteOffset, byteOffset + length)))
+}
+
+function fromString (string, encoding) {
+ if (typeof encoding !== 'string' || encoding === '') {
+ encoding = 'utf8'
+ }
+
+ if (!Buffer.isEncoding(encoding)) {
+ throw new TypeError('"encoding" must be a valid string encoding')
+ }
+
+ return isModern
+ ? Buffer.from(string, encoding)
+ : new Buffer(string, encoding)
+}
+
+function bufferFrom (value, encodingOrOffset, length) {
+ if (typeof value === 'number') {
+ throw new TypeError('"value" argument must not be a number')
+ }
+
+ if (isArrayBuffer(value)) {
+ return fromArrayBuffer(value, encodingOrOffset, length)
+ }
+
+ if (typeof value === 'string') {
+ return fromString(value, encodingOrOffset)
+ }
+
+ return isModern
+ ? Buffer.from(value)
+ : new Buffer(value)
+}
+
+module.exports = bufferFrom
diff --git a/website_quotation_template/node_modules/buffer-from/package.json b/website_quotation_template/node_modules/buffer-from/package.json
new file mode 100644
index 000000000..b690d8f75
--- /dev/null
+++ b/website_quotation_template/node_modules/buffer-from/package.json
@@ -0,0 +1,52 @@
+{
+ "_from": "buffer-from@^1.0.0",
+ "_id": "buffer-from@1.1.2",
+ "_inBundle": false,
+ "_integrity": "sha512-E+XQCRwSbaaiChtv6k6Dwgc+bx+Bs6vuKJHHl5kox/BaKbhiXzqQOwK4cO22yElGp2OCmjwVhT3HmxgyPGnJfQ==",
+ "_location": "/buffer-from",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "buffer-from@^1.0.0",
+ "name": "buffer-from",
+ "escapedName": "buffer-from",
+ "rawSpec": "^1.0.0",
+ "saveSpec": null,
+ "fetchSpec": "^1.0.0"
+ },
+ "_requiredBy": [
+ "/concat-stream"
+ ],
+ "_resolved": "https://registry.npmjs.org/buffer-from/-/buffer-from-1.1.2.tgz",
+ "_shasum": "2b146a6fd72e80b4f55d255f35ed59a3a9a41bd5",
+ "_spec": "buffer-from@^1.0.0",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/concat-stream",
+ "bugs": {
+ "url": "https://github.com/LinusU/buffer-from/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "A [ponyfill](https://ponyfill.com) for `Buffer.from`, uses native implementation if available.",
+ "devDependencies": {
+ "standard": "^12.0.1"
+ },
+ "files": [
+ "index.js"
+ ],
+ "homepage": "https://github.com/LinusU/buffer-from#readme",
+ "keywords": [
+ "buffer",
+ "buffer from"
+ ],
+ "license": "MIT",
+ "name": "buffer-from",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/LinusU/buffer-from.git"
+ },
+ "scripts": {
+ "test": "standard && node test"
+ },
+ "version": "1.1.2"
+}
diff --git a/website_quotation_template/node_modules/buffer-from/readme.md b/website_quotation_template/node_modules/buffer-from/readme.md
new file mode 100644
index 000000000..9880a558a
--- /dev/null
+++ b/website_quotation_template/node_modules/buffer-from/readme.md
@@ -0,0 +1,69 @@
+# Buffer From
+
+A [ponyfill](https://ponyfill.com) for `Buffer.from`, uses native implementation if available.
+
+## Installation
+
+```sh
+npm install --save buffer-from
+```
+
+## Usage
+
+```js
+const bufferFrom = require('buffer-from')
+
+console.log(bufferFrom([1, 2, 3, 4]))
+//=>
+
+const arr = new Uint8Array([1, 2, 3, 4])
+console.log(bufferFrom(arr.buffer, 1, 2))
+//=>
+
+console.log(bufferFrom('test', 'utf8'))
+//=>
+
+const buf = bufferFrom('test')
+console.log(bufferFrom(buf))
+//=>
+```
+
+## API
+
+### bufferFrom(array)
+
+- `array` <Array>
+
+Allocates a new `Buffer` using an `array` of octets.
+
+### bufferFrom(arrayBuffer[, byteOffset[, length]])
+
+- `arrayBuffer` <ArrayBuffer> The `.buffer` property of a TypedArray or ArrayBuffer
+- `byteOffset` <Integer> Where to start copying from `arrayBuffer`. **Default:** `0`
+- `length` <Integer> How many bytes to copy from `arrayBuffer`. **Default:** `arrayBuffer.length - byteOffset`
+
+When passed a reference to the `.buffer` property of a TypedArray instance, the
+newly created `Buffer` will share the same allocated memory as the TypedArray.
+
+The optional `byteOffset` and `length` arguments specify a memory range within
+the `arrayBuffer` that will be shared by the `Buffer`.
+
+### bufferFrom(buffer)
+
+- `buffer` <Buffer> An existing `Buffer` to copy data from
+
+Copies the passed `buffer` data onto a new `Buffer` instance.
+
+### bufferFrom(string[, encoding])
+
+- `string` <String> A string to encode.
+- `encoding` <String> The encoding of `string`. **Default:** `'utf8'`
+
+Creates a new `Buffer` containing the given JavaScript string `string`. If
+provided, the `encoding` parameter identifies the character encoding of
+`string`.
+
+## See also
+
+- [buffer-alloc](https://github.com/LinusU/buffer-alloc) A ponyfill for `Buffer.alloc`
+- [buffer-alloc-unsafe](https://github.com/LinusU/buffer-alloc-unsafe) A ponyfill for `Buffer.allocUnsafe`
diff --git a/website_quotation_template/node_modules/caseless/LICENSE b/website_quotation_template/node_modules/caseless/LICENSE
new file mode 100644
index 000000000..61789f4a4
--- /dev/null
+++ b/website_quotation_template/node_modules/caseless/LICENSE
@@ -0,0 +1,28 @@
+Apache License
+Version 2.0, January 2004
+http://www.apache.org/licenses/
+TERMS AND CONDITIONS FOR USE, REPRODUCTION, AND DISTRIBUTION
+1. Definitions.
+"License" shall mean the terms and conditions for use, reproduction, and distribution as defined by Sections 1 through 9 of this document.
+"Licensor" shall mean the copyright owner or entity authorized by the copyright owner that is granting the License.
+"Legal Entity" shall mean the union of the acting entity and all other entities that control, are controlled by, or are under common control with that entity. For the purposes of this definition, "control" means (i) the power, direct or indirect, to cause the direction or management of such entity, whether by contract or otherwise, or (ii) ownership of fifty percent (50%) or more of the outstanding shares, or (iii) beneficial ownership of such entity.
+"You" (or "Your") shall mean an individual or Legal Entity exercising permissions granted by this License.
+"Source" form shall mean the preferred form for making modifications, including but not limited to software source code, documentation source, and configuration files.
+"Object" form shall mean any form resulting from mechanical transformation or translation of a Source form, including but not limited to compiled object code, generated documentation, and conversions to other media types.
+"Work" shall mean the work of authorship, whether in Source or Object form, made available under the License, as indicated by a copyright notice that is included in or attached to the work (an example is provided in the Appendix below).
+"Derivative Works" shall mean any work, whether in Source or Object form, that is based on (or derived from) the Work and for which the editorial revisions, annotations, elaborations, or other modifications represent, as a whole, an original work of authorship. For the purposes of this License, Derivative Works shall not include works that remain separable from, or merely link (or bind by name) to the interfaces of, the Work and Derivative Works thereof.
+"Contribution" shall mean any work of authorship, including the original version of the Work and any modifications or additions to that Work or Derivative Works thereof, that is intentionally submitted to Licensor for inclusion in the Work by the copyright owner or by an individual or Legal Entity authorized to submit on behalf of the copyright owner. For the purposes of this definition, "submitted" means any form of electronic, verbal, or written communication sent to the Licensor or its representatives, including but not limited to communication on electronic mailing lists, source code control systems, and issue tracking systems that are managed by, or on behalf of, the Licensor for the purpose of discussing and improving the Work, but excluding communication that is conspicuously marked or otherwise designated in writing by the copyright owner as "Not a Contribution."
+"Contributor" shall mean Licensor and any individual or Legal Entity on behalf of whom a Contribution has been received by Licensor and subsequently incorporated within the Work.
+2. Grant of Copyright License. Subject to the terms and conditions of this License, each Contributor hereby grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, irrevocable copyright license to reproduce, prepare Derivative Works of, publicly display, publicly perform, sublicense, and distribute the Work and such Derivative Works in Source or Object form.
+3. Grant of Patent License. Subject to the terms and conditions of this License, each Contributor hereby grants to You a perpetual, worldwide, non-exclusive, no-charge, royalty-free, irrevocable (except as stated in this section) patent license to make, have made, use, offer to sell, sell, import, and otherwise transfer the Work, where such license applies only to those patent claims licensable by such Contributor that are necessarily infringed by their Contribution(s) alone or by combination of their Contribution(s) with the Work to which such Contribution(s) was submitted. If You institute patent litigation against any entity (including a cross-claim or counterclaim in a lawsuit) alleging that the Work or a Contribution incorporated within the Work constitutes direct or contributory patent infringement, then any patent licenses granted to You under this License for that Work shall terminate as of the date such litigation is filed.
+4. Redistribution. You may reproduce and distribute copies of the Work or Derivative Works thereof in any medium, with or without modifications, and in Source or Object form, provided that You meet the following conditions:
+You must give any other recipients of the Work or Derivative Works a copy of this License; and
+You must cause any modified files to carry prominent notices stating that You changed the files; and
+You must retain, in the Source form of any Derivative Works that You distribute, all copyright, patent, trademark, and attribution notices from the Source form of the Work, excluding those notices that do not pertain to any part of the Derivative Works; and
+If the Work includes a "NOTICE" text file as part of its distribution, then any Derivative Works that You distribute must include a readable copy of the attribution notices contained within such NOTICE file, excluding those notices that do not pertain to any part of the Derivative Works, in at least one of the following places: within a NOTICE text file distributed as part of the Derivative Works; within the Source form or documentation, if provided along with the Derivative Works; or, within a display generated by the Derivative Works, if and wherever such third-party notices normally appear. The contents of the NOTICE file are for informational purposes only and do not modify the License. You may add Your own attribution notices within Derivative Works that You distribute, alongside or as an addendum to the NOTICE text from the Work, provided that such additional attribution notices cannot be construed as modifying the License. You may add Your own copyright statement to Your modifications and may provide additional or different license terms and conditions for use, reproduction, or distribution of Your modifications, or for any such Derivative Works as a whole, provided Your use, reproduction, and distribution of the Work otherwise complies with the conditions stated in this License.
+5. Submission of Contributions. Unless You explicitly state otherwise, any Contribution intentionally submitted for inclusion in the Work by You to the Licensor shall be under the terms and conditions of this License, without any additional terms or conditions. Notwithstanding the above, nothing herein shall supersede or modify the terms of any separate license agreement you may have executed with Licensor regarding such Contributions.
+6. Trademarks. This License does not grant permission to use the trade names, trademarks, service marks, or product names of the Licensor, except as required for reasonable and customary use in describing the origin of the Work and reproducing the content of the NOTICE file.
+7. Disclaimer of Warranty. Unless required by applicable law or agreed to in writing, Licensor provides the Work (and each Contributor provides its Contributions) on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied, including, without limitation, any warranties or conditions of TITLE, NON-INFRINGEMENT, MERCHANTABILITY, or FITNESS FOR A PARTICULAR PURPOSE. You are solely responsible for determining the appropriateness of using or redistributing the Work and assume any risks associated with Your exercise of permissions under this License.
+8. Limitation of Liability. In no event and under no legal theory, whether in tort (including negligence), contract, or otherwise, unless required by applicable law (such as deliberate and grossly negligent acts) or agreed to in writing, shall any Contributor be liable to You for damages, including any direct, indirect, special, incidental, or consequential damages of any character arising as a result of this License or out of the use or inability to use the Work (including but not limited to damages for loss of goodwill, work stoppage, computer failure or malfunction, or any and all other commercial damages or losses), even if such Contributor has been advised of the possibility of such damages.
+9. Accepting Warranty or Additional Liability. While redistributing the Work or Derivative Works thereof, You may choose to offer, and charge a fee for, acceptance of support, warranty, indemnity, or other liability obligations and/or rights consistent with this License. However, in accepting such obligations, You may act only on Your own behalf and on Your sole responsibility, not on behalf of any other Contributor, and only if You agree to indemnify, defend, and hold each Contributor harmless for any liability incurred by, or claims asserted against, such Contributor by reason of your accepting any such warranty or additional liability.
+END OF TERMS AND CONDITIONS
\ No newline at end of file
diff --git a/website_quotation_template/node_modules/caseless/README.md b/website_quotation_template/node_modules/caseless/README.md
new file mode 100644
index 000000000..e5077a216
--- /dev/null
+++ b/website_quotation_template/node_modules/caseless/README.md
@@ -0,0 +1,45 @@
+## Caseless -- wrap an object to set and get property with caseless semantics but also preserve caseing.
+
+This library is incredibly useful when working with HTTP headers. It allows you to get/set/check for headers in a caseless manner while also preserving the caseing of headers the first time they are set.
+
+## Usage
+
+```javascript
+var headers = {}
+ , c = caseless(headers)
+ ;
+c.set('a-Header', 'asdf')
+c.get('a-header') === 'asdf'
+```
+
+## has(key)
+
+Has takes a name and if it finds a matching header will return that header name with the preserved caseing it was set with.
+
+```javascript
+c.has('a-header') === 'a-Header'
+```
+
+## set(key, value[, clobber=true])
+
+Set is fairly straight forward except that if the header exists and clobber is disabled it will add `','+value` to the existing header.
+
+```javascript
+c.set('a-Header', 'fdas')
+c.set('a-HEADER', 'more', false)
+c.get('a-header') === 'fdsa,more'
+```
+
+## swap(key)
+
+Swaps the casing of a header with the new one that is passed in.
+
+```javascript
+var headers = {}
+ , c = caseless(headers)
+ ;
+c.set('a-Header', 'fdas')
+c.swap('a-HEADER')
+c.has('a-header') === 'a-HEADER'
+headers === {'a-HEADER': 'fdas'}
+```
diff --git a/website_quotation_template/node_modules/caseless/index.js b/website_quotation_template/node_modules/caseless/index.js
new file mode 100644
index 000000000..b194734ee
--- /dev/null
+++ b/website_quotation_template/node_modules/caseless/index.js
@@ -0,0 +1,67 @@
+function Caseless (dict) {
+ this.dict = dict || {}
+}
+Caseless.prototype.set = function (name, value, clobber) {
+ if (typeof name === 'object') {
+ for (var i in name) {
+ this.set(i, name[i], value)
+ }
+ } else {
+ if (typeof clobber === 'undefined') clobber = true
+ var has = this.has(name)
+
+ if (!clobber && has) this.dict[has] = this.dict[has] + ',' + value
+ else this.dict[has || name] = value
+ return has
+ }
+}
+Caseless.prototype.has = function (name) {
+ var keys = Object.keys(this.dict)
+ , name = name.toLowerCase()
+ ;
+ for (var i=0;i
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/website_quotation_template/node_modules/combined-stream/Readme.md b/website_quotation_template/node_modules/combined-stream/Readme.md
new file mode 100644
index 000000000..9e367b5bc
--- /dev/null
+++ b/website_quotation_template/node_modules/combined-stream/Readme.md
@@ -0,0 +1,138 @@
+# combined-stream
+
+A stream that emits multiple other streams one after another.
+
+**NB** Currently `combined-stream` works with streams version 1 only. There is ongoing effort to switch this library to streams version 2. Any help is welcome. :) Meanwhile you can explore other libraries that provide streams2 support with more or less compatibility with `combined-stream`.
+
+- [combined-stream2](https://www.npmjs.com/package/combined-stream2): A drop-in streams2-compatible replacement for the combined-stream module.
+
+- [multistream](https://www.npmjs.com/package/multistream): A stream that emits multiple other streams one after another.
+
+## Installation
+
+``` bash
+npm install combined-stream
+```
+
+## Usage
+
+Here is a simple example that shows how you can use combined-stream to combine
+two files into one:
+
+``` javascript
+var CombinedStream = require('combined-stream');
+var fs = require('fs');
+
+var combinedStream = CombinedStream.create();
+combinedStream.append(fs.createReadStream('file1.txt'));
+combinedStream.append(fs.createReadStream('file2.txt'));
+
+combinedStream.pipe(fs.createWriteStream('combined.txt'));
+```
+
+While the example above works great, it will pause all source streams until
+they are needed. If you don't want that to happen, you can set `pauseStreams`
+to `false`:
+
+``` javascript
+var CombinedStream = require('combined-stream');
+var fs = require('fs');
+
+var combinedStream = CombinedStream.create({pauseStreams: false});
+combinedStream.append(fs.createReadStream('file1.txt'));
+combinedStream.append(fs.createReadStream('file2.txt'));
+
+combinedStream.pipe(fs.createWriteStream('combined.txt'));
+```
+
+However, what if you don't have all the source streams yet, or you don't want
+to allocate the resources (file descriptors, memory, etc.) for them right away?
+Well, in that case you can simply provide a callback that supplies the stream
+by calling a `next()` function:
+
+``` javascript
+var CombinedStream = require('combined-stream');
+var fs = require('fs');
+
+var combinedStream = CombinedStream.create();
+combinedStream.append(function(next) {
+ next(fs.createReadStream('file1.txt'));
+});
+combinedStream.append(function(next) {
+ next(fs.createReadStream('file2.txt'));
+});
+
+combinedStream.pipe(fs.createWriteStream('combined.txt'));
+```
+
+## API
+
+### CombinedStream.create([options])
+
+Returns a new combined stream object. Available options are:
+
+* `maxDataSize`
+* `pauseStreams`
+
+The effect of those options is described below.
+
+### combinedStream.pauseStreams = `true`
+
+Whether to apply back pressure to the underlaying streams. If set to `false`,
+the underlaying streams will never be paused. If set to `true`, the
+underlaying streams will be paused right after being appended, as well as when
+`delayedStream.pipe()` wants to throttle.
+
+### combinedStream.maxDataSize = `2 * 1024 * 1024`
+
+The maximum amount of bytes (or characters) to buffer for all source streams.
+If this value is exceeded, `combinedStream` emits an `'error'` event.
+
+### combinedStream.dataSize = `0`
+
+The amount of bytes (or characters) currently buffered by `combinedStream`.
+
+### combinedStream.append(stream)
+
+Appends the given `stream` to the combinedStream object. If `pauseStreams` is
+set to `true, this stream will also be paused right away.
+
+`streams` can also be a function that takes one parameter called `next`. `next`
+is a function that must be invoked in order to provide the `next` stream, see
+example above.
+
+Regardless of how the `stream` is appended, combined-stream always attaches an
+`'error'` listener to it, so you don't have to do that manually.
+
+Special case: `stream` can also be a String or Buffer.
+
+### combinedStream.write(data)
+
+You should not call this, `combinedStream` takes care of piping the appended
+streams into itself for you.
+
+### combinedStream.resume()
+
+Causes `combinedStream` to start drain the streams it manages. The function is
+idempotent, and also emits a `'resume'` event each time which usually goes to
+the stream that is currently being drained.
+
+### combinedStream.pause();
+
+If `combinedStream.pauseStreams` is set to `false`, this does nothing.
+Otherwise a `'pause'` event is emitted, this goes to the stream that is
+currently being drained, so you can use it to apply back pressure.
+
+### combinedStream.end();
+
+Sets `combinedStream.writable` to false, emits an `'end'` event, and removes
+all streams from the queue.
+
+### combinedStream.destroy();
+
+Same as `combinedStream.end()`, except it emits a `'close'` event instead of
+`'end'`.
+
+## License
+
+combined-stream is licensed under the MIT license.
diff --git a/website_quotation_template/node_modules/combined-stream/lib/combined_stream.js b/website_quotation_template/node_modules/combined-stream/lib/combined_stream.js
new file mode 100644
index 000000000..125f097f3
--- /dev/null
+++ b/website_quotation_template/node_modules/combined-stream/lib/combined_stream.js
@@ -0,0 +1,208 @@
+var util = require('util');
+var Stream = require('stream').Stream;
+var DelayedStream = require('delayed-stream');
+
+module.exports = CombinedStream;
+function CombinedStream() {
+ this.writable = false;
+ this.readable = true;
+ this.dataSize = 0;
+ this.maxDataSize = 2 * 1024 * 1024;
+ this.pauseStreams = true;
+
+ this._released = false;
+ this._streams = [];
+ this._currentStream = null;
+ this._insideLoop = false;
+ this._pendingNext = false;
+}
+util.inherits(CombinedStream, Stream);
+
+CombinedStream.create = function(options) {
+ var combinedStream = new this();
+
+ options = options || {};
+ for (var option in options) {
+ combinedStream[option] = options[option];
+ }
+
+ return combinedStream;
+};
+
+CombinedStream.isStreamLike = function(stream) {
+ return (typeof stream !== 'function')
+ && (typeof stream !== 'string')
+ && (typeof stream !== 'boolean')
+ && (typeof stream !== 'number')
+ && (!Buffer.isBuffer(stream));
+};
+
+CombinedStream.prototype.append = function(stream) {
+ var isStreamLike = CombinedStream.isStreamLike(stream);
+
+ if (isStreamLike) {
+ if (!(stream instanceof DelayedStream)) {
+ var newStream = DelayedStream.create(stream, {
+ maxDataSize: Infinity,
+ pauseStream: this.pauseStreams,
+ });
+ stream.on('data', this._checkDataSize.bind(this));
+ stream = newStream;
+ }
+
+ this._handleErrors(stream);
+
+ if (this.pauseStreams) {
+ stream.pause();
+ }
+ }
+
+ this._streams.push(stream);
+ return this;
+};
+
+CombinedStream.prototype.pipe = function(dest, options) {
+ Stream.prototype.pipe.call(this, dest, options);
+ this.resume();
+ return dest;
+};
+
+CombinedStream.prototype._getNext = function() {
+ this._currentStream = null;
+
+ if (this._insideLoop) {
+ this._pendingNext = true;
+ return; // defer call
+ }
+
+ this._insideLoop = true;
+ try {
+ do {
+ this._pendingNext = false;
+ this._realGetNext();
+ } while (this._pendingNext);
+ } finally {
+ this._insideLoop = false;
+ }
+};
+
+CombinedStream.prototype._realGetNext = function() {
+ var stream = this._streams.shift();
+
+
+ if (typeof stream == 'undefined') {
+ this.end();
+ return;
+ }
+
+ if (typeof stream !== 'function') {
+ this._pipeNext(stream);
+ return;
+ }
+
+ var getStream = stream;
+ getStream(function(stream) {
+ var isStreamLike = CombinedStream.isStreamLike(stream);
+ if (isStreamLike) {
+ stream.on('data', this._checkDataSize.bind(this));
+ this._handleErrors(stream);
+ }
+
+ this._pipeNext(stream);
+ }.bind(this));
+};
+
+CombinedStream.prototype._pipeNext = function(stream) {
+ this._currentStream = stream;
+
+ var isStreamLike = CombinedStream.isStreamLike(stream);
+ if (isStreamLike) {
+ stream.on('end', this._getNext.bind(this));
+ stream.pipe(this, {end: false});
+ return;
+ }
+
+ var value = stream;
+ this.write(value);
+ this._getNext();
+};
+
+CombinedStream.prototype._handleErrors = function(stream) {
+ var self = this;
+ stream.on('error', function(err) {
+ self._emitError(err);
+ });
+};
+
+CombinedStream.prototype.write = function(data) {
+ this.emit('data', data);
+};
+
+CombinedStream.prototype.pause = function() {
+ if (!this.pauseStreams) {
+ return;
+ }
+
+ if(this.pauseStreams && this._currentStream && typeof(this._currentStream.pause) == 'function') this._currentStream.pause();
+ this.emit('pause');
+};
+
+CombinedStream.prototype.resume = function() {
+ if (!this._released) {
+ this._released = true;
+ this.writable = true;
+ this._getNext();
+ }
+
+ if(this.pauseStreams && this._currentStream && typeof(this._currentStream.resume) == 'function') this._currentStream.resume();
+ this.emit('resume');
+};
+
+CombinedStream.prototype.end = function() {
+ this._reset();
+ this.emit('end');
+};
+
+CombinedStream.prototype.destroy = function() {
+ this._reset();
+ this.emit('close');
+};
+
+CombinedStream.prototype._reset = function() {
+ this.writable = false;
+ this._streams = [];
+ this._currentStream = null;
+};
+
+CombinedStream.prototype._checkDataSize = function() {
+ this._updateDataSize();
+ if (this.dataSize <= this.maxDataSize) {
+ return;
+ }
+
+ var message =
+ 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.';
+ this._emitError(new Error(message));
+};
+
+CombinedStream.prototype._updateDataSize = function() {
+ this.dataSize = 0;
+
+ var self = this;
+ this._streams.forEach(function(stream) {
+ if (!stream.dataSize) {
+ return;
+ }
+
+ self.dataSize += stream.dataSize;
+ });
+
+ if (this._currentStream && this._currentStream.dataSize) {
+ this.dataSize += this._currentStream.dataSize;
+ }
+};
+
+CombinedStream.prototype._emitError = function(err) {
+ this._reset();
+ this.emit('error', err);
+};
diff --git a/website_quotation_template/node_modules/combined-stream/package.json b/website_quotation_template/node_modules/combined-stream/package.json
new file mode 100644
index 000000000..58b1a4a6c
--- /dev/null
+++ b/website_quotation_template/node_modules/combined-stream/package.json
@@ -0,0 +1,58 @@
+{
+ "_from": "combined-stream@~1.0.6",
+ "_id": "combined-stream@1.0.8",
+ "_inBundle": false,
+ "_integrity": "sha512-FQN4MRfuJeHf7cBbBMJFXhKSDq+2kAArBlmRBvcvFE5BB1HZKXtSFASDhdlz9zOYwxh8lDdnvmMOe/+5cdoEdg==",
+ "_location": "/combined-stream",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "combined-stream@~1.0.6",
+ "name": "combined-stream",
+ "escapedName": "combined-stream",
+ "rawSpec": "~1.0.6",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.6"
+ },
+ "_requiredBy": [
+ "/form-data",
+ "/request"
+ ],
+ "_resolved": "https://registry.npmjs.org/combined-stream/-/combined-stream-1.0.8.tgz",
+ "_shasum": "c3d45a8b34fd730631a110a8a2520682b31d5a7f",
+ "_spec": "combined-stream@~1.0.6",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/request",
+ "author": {
+ "name": "Felix Geisendörfer",
+ "email": "felix@debuggable.com",
+ "url": "http://debuggable.com/"
+ },
+ "bugs": {
+ "url": "https://github.com/felixge/node-combined-stream/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {
+ "delayed-stream": "~1.0.0"
+ },
+ "deprecated": false,
+ "description": "A stream that emits multiple other streams one after another.",
+ "devDependencies": {
+ "far": "~0.0.7"
+ },
+ "engines": {
+ "node": ">= 0.8"
+ },
+ "homepage": "https://github.com/felixge/node-combined-stream",
+ "license": "MIT",
+ "main": "./lib/combined_stream",
+ "name": "combined-stream",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/felixge/node-combined-stream.git"
+ },
+ "scripts": {
+ "test": "node test/run.js"
+ },
+ "version": "1.0.8"
+}
diff --git a/website_quotation_template/node_modules/combined-stream/yarn.lock b/website_quotation_template/node_modules/combined-stream/yarn.lock
new file mode 100644
index 000000000..7edf41840
--- /dev/null
+++ b/website_quotation_template/node_modules/combined-stream/yarn.lock
@@ -0,0 +1,17 @@
+# THIS IS AN AUTOGENERATED FILE. DO NOT EDIT THIS FILE DIRECTLY.
+# yarn lockfile v1
+
+
+delayed-stream@~1.0.0:
+ version "1.0.0"
+ resolved "https://registry.yarnpkg.com/delayed-stream/-/delayed-stream-1.0.0.tgz#df3ae199acadfb7d440aaae0b29e2272b24ec619"
+
+far@~0.0.7:
+ version "0.0.7"
+ resolved "https://registry.yarnpkg.com/far/-/far-0.0.7.tgz#01c1fd362bcd26ce9cf161af3938aa34619f79a7"
+ dependencies:
+ oop "0.0.3"
+
+oop@0.0.3:
+ version "0.0.3"
+ resolved "https://registry.yarnpkg.com/oop/-/oop-0.0.3.tgz#70fa405a5650891a194fdc82ca68dad6dabf4401"
diff --git a/website_quotation_template/node_modules/concat-stream/LICENSE b/website_quotation_template/node_modules/concat-stream/LICENSE
new file mode 100644
index 000000000..99c130e1d
--- /dev/null
+++ b/website_quotation_template/node_modules/concat-stream/LICENSE
@@ -0,0 +1,24 @@
+The MIT License
+
+Copyright (c) 2013 Max Ogden
+
+Permission is hereby granted, free of charge,
+to any person obtaining a copy of this software and
+associated documentation files (the "Software"), to
+deal in the Software without restriction, including
+without limitation the rights to use, copy, modify,
+merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom
+the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice
+shall be included in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND,
+EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES
+OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR
+ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
\ No newline at end of file
diff --git a/website_quotation_template/node_modules/concat-stream/index.js b/website_quotation_template/node_modules/concat-stream/index.js
new file mode 100644
index 000000000..dd672a761
--- /dev/null
+++ b/website_quotation_template/node_modules/concat-stream/index.js
@@ -0,0 +1,144 @@
+var Writable = require('readable-stream').Writable
+var inherits = require('inherits')
+var bufferFrom = require('buffer-from')
+
+if (typeof Uint8Array === 'undefined') {
+ var U8 = require('typedarray').Uint8Array
+} else {
+ var U8 = Uint8Array
+}
+
+function ConcatStream(opts, cb) {
+ if (!(this instanceof ConcatStream)) return new ConcatStream(opts, cb)
+
+ if (typeof opts === 'function') {
+ cb = opts
+ opts = {}
+ }
+ if (!opts) opts = {}
+
+ var encoding = opts.encoding
+ var shouldInferEncoding = false
+
+ if (!encoding) {
+ shouldInferEncoding = true
+ } else {
+ encoding = String(encoding).toLowerCase()
+ if (encoding === 'u8' || encoding === 'uint8') {
+ encoding = 'uint8array'
+ }
+ }
+
+ Writable.call(this, { objectMode: true })
+
+ this.encoding = encoding
+ this.shouldInferEncoding = shouldInferEncoding
+
+ if (cb) this.on('finish', function () { cb(this.getBody()) })
+ this.body = []
+}
+
+module.exports = ConcatStream
+inherits(ConcatStream, Writable)
+
+ConcatStream.prototype._write = function(chunk, enc, next) {
+ this.body.push(chunk)
+ next()
+}
+
+ConcatStream.prototype.inferEncoding = function (buff) {
+ var firstBuffer = buff === undefined ? this.body[0] : buff;
+ if (Buffer.isBuffer(firstBuffer)) return 'buffer'
+ if (typeof Uint8Array !== 'undefined' && firstBuffer instanceof Uint8Array) return 'uint8array'
+ if (Array.isArray(firstBuffer)) return 'array'
+ if (typeof firstBuffer === 'string') return 'string'
+ if (Object.prototype.toString.call(firstBuffer) === "[object Object]") return 'object'
+ return 'buffer'
+}
+
+ConcatStream.prototype.getBody = function () {
+ if (!this.encoding && this.body.length === 0) return []
+ if (this.shouldInferEncoding) this.encoding = this.inferEncoding()
+ if (this.encoding === 'array') return arrayConcat(this.body)
+ if (this.encoding === 'string') return stringConcat(this.body)
+ if (this.encoding === 'buffer') return bufferConcat(this.body)
+ if (this.encoding === 'uint8array') return u8Concat(this.body)
+ return this.body
+}
+
+var isArray = Array.isArray || function (arr) {
+ return Object.prototype.toString.call(arr) == '[object Array]'
+}
+
+function isArrayish (arr) {
+ return /Array\]$/.test(Object.prototype.toString.call(arr))
+}
+
+function isBufferish (p) {
+ return typeof p === 'string' || isArrayish(p) || (p && typeof p.subarray === 'function')
+}
+
+function stringConcat (parts) {
+ var strings = []
+ var needsToString = false
+ for (var i = 0; i < parts.length; i++) {
+ var p = parts[i]
+ if (typeof p === 'string') {
+ strings.push(p)
+ } else if (Buffer.isBuffer(p)) {
+ strings.push(p)
+ } else if (isBufferish(p)) {
+ strings.push(bufferFrom(p))
+ } else {
+ strings.push(bufferFrom(String(p)))
+ }
+ }
+ if (Buffer.isBuffer(parts[0])) {
+ strings = Buffer.concat(strings)
+ strings = strings.toString('utf8')
+ } else {
+ strings = strings.join('')
+ }
+ return strings
+}
+
+function bufferConcat (parts) {
+ var bufs = []
+ for (var i = 0; i < parts.length; i++) {
+ var p = parts[i]
+ if (Buffer.isBuffer(p)) {
+ bufs.push(p)
+ } else if (isBufferish(p)) {
+ bufs.push(bufferFrom(p))
+ } else {
+ bufs.push(bufferFrom(String(p)))
+ }
+ }
+ return Buffer.concat(bufs)
+}
+
+function arrayConcat (parts) {
+ var res = []
+ for (var i = 0; i < parts.length; i++) {
+ res.push.apply(res, parts[i])
+ }
+ return res
+}
+
+function u8Concat (parts) {
+ var len = 0
+ for (var i = 0; i < parts.length; i++) {
+ if (typeof parts[i] === 'string') {
+ parts[i] = bufferFrom(parts[i])
+ }
+ len += parts[i].length
+ }
+ var u8 = new U8(len)
+ for (var i = 0, offset = 0; i < parts.length; i++) {
+ var part = parts[i]
+ for (var j = 0; j < part.length; j++) {
+ u8[offset++] = part[j]
+ }
+ }
+ return u8
+}
diff --git a/website_quotation_template/node_modules/concat-stream/package.json b/website_quotation_template/node_modules/concat-stream/package.json
new file mode 100644
index 000000000..686875dee
--- /dev/null
+++ b/website_quotation_template/node_modules/concat-stream/package.json
@@ -0,0 +1,84 @@
+{
+ "_from": "concat-stream@^1.6.2",
+ "_id": "concat-stream@1.6.2",
+ "_inBundle": false,
+ "_integrity": "sha512-27HBghJxjiZtIk3Ycvn/4kbJk/1uZuJFfuPEns6LaEvpvG1f0hTea8lilrouyo9mVc2GWdcEZ8OLoGmSADlrCw==",
+ "_location": "/concat-stream",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "concat-stream@^1.6.2",
+ "name": "concat-stream",
+ "escapedName": "concat-stream",
+ "rawSpec": "^1.6.2",
+ "saveSpec": null,
+ "fetchSpec": "^1.6.2"
+ },
+ "_requiredBy": [
+ "/extract-zip"
+ ],
+ "_resolved": "https://registry.npmjs.org/concat-stream/-/concat-stream-1.6.2.tgz",
+ "_shasum": "904bdf194cd3122fc675c77fc4ac3d4ff0fd1a34",
+ "_spec": "concat-stream@^1.6.2",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/extract-zip",
+ "author": {
+ "name": "Max Ogden",
+ "email": "max@maxogden.com"
+ },
+ "bugs": {
+ "url": "http://github.com/maxogden/concat-stream/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {
+ "buffer-from": "^1.0.0",
+ "inherits": "^2.0.3",
+ "readable-stream": "^2.2.2",
+ "typedarray": "^0.0.6"
+ },
+ "deprecated": false,
+ "description": "writable stream that concatenates strings or binary data and calls a callback with the result",
+ "devDependencies": {
+ "tape": "^4.6.3"
+ },
+ "engines": [
+ "node >= 0.8"
+ ],
+ "files": [
+ "index.js"
+ ],
+ "homepage": "https://github.com/maxogden/concat-stream#readme",
+ "license": "MIT",
+ "main": "index.js",
+ "name": "concat-stream",
+ "repository": {
+ "type": "git",
+ "url": "git+ssh://git@github.com/maxogden/concat-stream.git"
+ },
+ "scripts": {
+ "test": "tape test/*.js test/server/*.js"
+ },
+ "tags": [
+ "stream",
+ "simple",
+ "util",
+ "utility"
+ ],
+ "testling": {
+ "files": "test/*.js",
+ "browsers": [
+ "ie/8..latest",
+ "firefox/17..latest",
+ "firefox/nightly",
+ "chrome/22..latest",
+ "chrome/canary",
+ "opera/12..latest",
+ "opera/next",
+ "safari/5.1..latest",
+ "ipad/6.0..latest",
+ "iphone/6.0..latest",
+ "android-browser/4.2..latest"
+ ]
+ },
+ "version": "1.6.2"
+}
diff --git a/website_quotation_template/node_modules/concat-stream/readme.md b/website_quotation_template/node_modules/concat-stream/readme.md
new file mode 100644
index 000000000..7aa19c4fb
--- /dev/null
+++ b/website_quotation_template/node_modules/concat-stream/readme.md
@@ -0,0 +1,102 @@
+# concat-stream
+
+Writable stream that concatenates all the data from a stream and calls a callback with the result. Use this when you want to collect all the data from a stream into a single buffer.
+
+[](https://travis-ci.org/maxogden/concat-stream)
+
+[](https://nodei.co/npm/concat-stream/)
+
+### description
+
+Streams emit many buffers. If you want to collect all of the buffers, and when the stream ends concatenate all of the buffers together and receive a single buffer then this is the module for you.
+
+Only use this if you know you can fit all of the output of your stream into a single Buffer (e.g. in RAM).
+
+There are also `objectMode` streams that emit things other than Buffers, and you can concatenate these too. See below for details.
+
+## Related
+
+`concat-stream` is part of the [mississippi stream utility collection](https://github.com/maxogden/mississippi) which includes more useful stream modules similar to this one.
+
+### examples
+
+#### Buffers
+
+```js
+var fs = require('fs')
+var concat = require('concat-stream')
+
+var readStream = fs.createReadStream('cat.png')
+var concatStream = concat(gotPicture)
+
+readStream.on('error', handleError)
+readStream.pipe(concatStream)
+
+function gotPicture(imageBuffer) {
+ // imageBuffer is all of `cat.png` as a node.js Buffer
+}
+
+function handleError(err) {
+ // handle your error appropriately here, e.g.:
+ console.error(err) // print the error to STDERR
+ process.exit(1) // exit program with non-zero exit code
+}
+
+```
+
+#### Arrays
+
+```js
+var write = concat(function(data) {})
+write.write([1,2,3])
+write.write([4,5,6])
+write.end()
+// data will be [1,2,3,4,5,6] in the above callback
+```
+
+#### Uint8Arrays
+
+```js
+var write = concat(function(data) {})
+var a = new Uint8Array(3)
+a[0] = 97; a[1] = 98; a[2] = 99
+write.write(a)
+write.write('!')
+write.end(Buffer.from('!!1'))
+```
+
+See `test/` for more examples
+
+# methods
+
+```js
+var concat = require('concat-stream')
+```
+
+## var writable = concat(opts={}, cb)
+
+Return a `writable` stream that will fire `cb(data)` with all of the data that
+was written to the stream. Data can be written to `writable` as strings,
+Buffers, arrays of byte integers, and Uint8Arrays.
+
+By default `concat-stream` will give you back the same data type as the type of the first buffer written to the stream. Use `opts.encoding` to set what format `data` should be returned as, e.g. if you if you don't want to rely on the built-in type checking or for some other reason.
+
+* `string` - get a string
+* `buffer` - get back a Buffer
+* `array` - get an array of byte integers
+* `uint8array`, `u8`, `uint8` - get back a Uint8Array
+* `object`, get back an array of Objects
+
+If you don't specify an encoding, and the types can't be inferred (e.g. you write things that aren't in the list above), it will try to convert concat them into a `Buffer`.
+
+If nothing is written to `writable` then `data` will be an empty array `[]`.
+
+# error handling
+
+`concat-stream` does not handle errors for you, so you must handle errors on whatever streams you pipe into `concat-stream`. This is a general rule when programming with node.js streams: always handle errors on each and every stream. Since `concat-stream` is not itself a stream it does not emit errors.
+
+We recommend using [`end-of-stream`](https://npmjs.org/end-of-stream) or [`pump`](https://npmjs.org/pump) for writing error tolerant stream code.
+
+# license
+
+MIT LICENSE
diff --git a/website_quotation_template/node_modules/core-util-is/LICENSE b/website_quotation_template/node_modules/core-util-is/LICENSE
new file mode 100644
index 000000000..d8d7f9437
--- /dev/null
+++ b/website_quotation_template/node_modules/core-util-is/LICENSE
@@ -0,0 +1,19 @@
+Copyright Node.js contributors. All rights reserved.
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to
+deal in the Software without restriction, including without limitation the
+rights to use, copy, modify, merge, publish, distribute, sublicense, and/or
+sell copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING
+FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS
+IN THE SOFTWARE.
diff --git a/website_quotation_template/node_modules/core-util-is/README.md b/website_quotation_template/node_modules/core-util-is/README.md
new file mode 100644
index 000000000..5a76b4149
--- /dev/null
+++ b/website_quotation_template/node_modules/core-util-is/README.md
@@ -0,0 +1,3 @@
+# core-util-is
+
+The `util.is*` functions introduced in Node v0.12.
diff --git a/website_quotation_template/node_modules/core-util-is/lib/util.js b/website_quotation_template/node_modules/core-util-is/lib/util.js
new file mode 100644
index 000000000..6e5a20d7d
--- /dev/null
+++ b/website_quotation_template/node_modules/core-util-is/lib/util.js
@@ -0,0 +1,107 @@
+// Copyright Joyent, Inc. and other Node contributors.
+//
+// Permission is hereby granted, free of charge, to any person obtaining a
+// copy of this software and associated documentation files (the
+// "Software"), to deal in the Software without restriction, including
+// without limitation the rights to use, copy, modify, merge, publish,
+// distribute, sublicense, and/or sell copies of the Software, and to permit
+// persons to whom the Software is furnished to do so, subject to the
+// following conditions:
+//
+// The above copyright notice and this permission notice shall be included
+// in all copies or substantial portions of the Software.
+//
+// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+// OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+// MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN
+// NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM,
+// DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR
+// OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE
+// USE OR OTHER DEALINGS IN THE SOFTWARE.
+
+// NOTE: These type checking functions intentionally don't use `instanceof`
+// because it is fragile and can be easily faked with `Object.create()`.
+
+function isArray(arg) {
+ if (Array.isArray) {
+ return Array.isArray(arg);
+ }
+ return objectToString(arg) === '[object Array]';
+}
+exports.isArray = isArray;
+
+function isBoolean(arg) {
+ return typeof arg === 'boolean';
+}
+exports.isBoolean = isBoolean;
+
+function isNull(arg) {
+ return arg === null;
+}
+exports.isNull = isNull;
+
+function isNullOrUndefined(arg) {
+ return arg == null;
+}
+exports.isNullOrUndefined = isNullOrUndefined;
+
+function isNumber(arg) {
+ return typeof arg === 'number';
+}
+exports.isNumber = isNumber;
+
+function isString(arg) {
+ return typeof arg === 'string';
+}
+exports.isString = isString;
+
+function isSymbol(arg) {
+ return typeof arg === 'symbol';
+}
+exports.isSymbol = isSymbol;
+
+function isUndefined(arg) {
+ return arg === void 0;
+}
+exports.isUndefined = isUndefined;
+
+function isRegExp(re) {
+ return objectToString(re) === '[object RegExp]';
+}
+exports.isRegExp = isRegExp;
+
+function isObject(arg) {
+ return typeof arg === 'object' && arg !== null;
+}
+exports.isObject = isObject;
+
+function isDate(d) {
+ return objectToString(d) === '[object Date]';
+}
+exports.isDate = isDate;
+
+function isError(e) {
+ return (objectToString(e) === '[object Error]' || e instanceof Error);
+}
+exports.isError = isError;
+
+function isFunction(arg) {
+ return typeof arg === 'function';
+}
+exports.isFunction = isFunction;
+
+function isPrimitive(arg) {
+ return arg === null ||
+ typeof arg === 'boolean' ||
+ typeof arg === 'number' ||
+ typeof arg === 'string' ||
+ typeof arg === 'symbol' || // ES6 symbol
+ typeof arg === 'undefined';
+}
+exports.isPrimitive = isPrimitive;
+
+exports.isBuffer = require('buffer').Buffer.isBuffer;
+
+function objectToString(o) {
+ return Object.prototype.toString.call(o);
+}
diff --git a/website_quotation_template/node_modules/core-util-is/package.json b/website_quotation_template/node_modules/core-util-is/package.json
new file mode 100644
index 000000000..e88607d0f
--- /dev/null
+++ b/website_quotation_template/node_modules/core-util-is/package.json
@@ -0,0 +1,68 @@
+{
+ "_from": "core-util-is@~1.0.0",
+ "_id": "core-util-is@1.0.3",
+ "_inBundle": false,
+ "_integrity": "sha512-ZQBvi1DcpJ4GDqanjucZ2Hj3wEO5pZDS89BWbkcrvdxksJorwUDDZamX9ldFkp9aw2lmBDLgkObEA4DWNJ9FYQ==",
+ "_location": "/core-util-is",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "core-util-is@~1.0.0",
+ "name": "core-util-is",
+ "escapedName": "core-util-is",
+ "rawSpec": "~1.0.0",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.0"
+ },
+ "_requiredBy": [
+ "/readable-stream"
+ ],
+ "_resolved": "https://registry.npmjs.org/core-util-is/-/core-util-is-1.0.3.tgz",
+ "_shasum": "a6042d3634c2b27e9328f837b965fac83808db85",
+ "_spec": "core-util-is@~1.0.0",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/readable-stream",
+ "author": {
+ "name": "Isaac Z. Schlueter",
+ "email": "i@izs.me",
+ "url": "http://blog.izs.me/"
+ },
+ "bugs": {
+ "url": "https://github.com/isaacs/core-util-is/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "The `util.is*` functions introduced in Node v0.12.",
+ "devDependencies": {
+ "tap": "^15.0.9"
+ },
+ "files": [
+ "lib"
+ ],
+ "homepage": "https://github.com/isaacs/core-util-is#readme",
+ "keywords": [
+ "util",
+ "isBuffer",
+ "isArray",
+ "isNumber",
+ "isString",
+ "isRegExp",
+ "isThis",
+ "isThat",
+ "polyfill"
+ ],
+ "license": "MIT",
+ "main": "lib/util.js",
+ "name": "core-util-is",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/isaacs/core-util-is.git"
+ },
+ "scripts": {
+ "postversion": "npm publish",
+ "prepublishOnly": "git push origin --follow-tags",
+ "preversion": "npm test",
+ "test": "tap test.js"
+ },
+ "version": "1.0.3"
+}
diff --git a/website_quotation_template/node_modules/dashdash/CHANGES.md b/website_quotation_template/node_modules/dashdash/CHANGES.md
new file mode 100644
index 000000000..d7c8f4ebe
--- /dev/null
+++ b/website_quotation_template/node_modules/dashdash/CHANGES.md
@@ -0,0 +1,364 @@
+# node-dashdash changelog
+
+## not yet released
+
+(nothing yet)
+
+## 1.14.1
+
+- [issue #30] Change the output used by dashdash's Bash completion support to
+ indicate "there are no completions for this argument" to cope with different
+ sorting rules on different Bash/platforms. For example:
+
+ $ triton -v -p test2 package get # before
+ ##-no -tritonpackage- completions-##
+
+ $ triton -v -p test2 package get # after
+ ##-no-completion- -results-##
+
+## 1.14.0
+
+- New `synopsisFromOpt()` function. This will be used by
+ [node-cmdln](https://github.com/trentm/node-cmdln) to put together a synopsis
+ of options for a command. Some examples:
+
+ > synopsisFromOpt({names: ['help', 'h'], type: 'bool'});
+ '[ --help | -h ]'
+ > synopsisFromOpt({name: 'file', type: 'string', helpArg: 'FILE'});
+ '[ --file=FILE ]'
+
+
+## 1.13.1
+
+- [issue #20] `bashCompletionSpecFromOptions` breaks on an options array with
+ an empty-string group.
+
+
+## 1.13.0
+
+- Update assert-plus dep to 1.x to get recent fixes (particularly for
+ `assert.optional*`).
+
+- Drop testing (and official support in packages.json#engines) for node 0.8.x.
+ Add testing against node 5.x and 4.x with `make testall`.
+
+- [pull #16] Change the `positiveInteger` type to NOT accept zero (0).
+ For those who might need the old behaviour, see
+ "examples/custom-option-intGteZero.js". (By Dave Pacheco.)
+
+
+## 1.12.2
+
+- Bash completion: Add `argtypes` to specify the types of positional args.
+ E.g. this would allow you to have an `ssh` command with `argtypes = ['host',
+ 'cmd']` for bash completion. You then have to provide Bash functions to
+ handle completing those types via the `specExtra` arg. See
+ "[examples/ddcompletion.js](examples/ddcompletion.js)" for an example.
+
+- Bash completion: Tweak so that options or only offered as completions when
+ there is a leading '-'. E.g. `mytool ` does NOT offer options, `mytool
+ -` *does*. Without this, a tool with options would never be able to
+ fallback to Bash's "default" completion. For example `ls ` wouldn't
+ result in filename completion. Now it will.
+
+- Bash completion: A workaround for not being able to explicitly have *no*
+ completion results. Because dashdash's completion uses `complete -o default`,
+ we fallback to Bash's "default" completion (typically for filename
+ completion). Before this change, an attempt to explicitly say "there are
+ no completions that match" would unintentionally trigger filename completion.
+ Instead as a workaround we return:
+
+ $ ddcompletion --none # the 'none' argtype
+ ##-no completions-##
+
+ $ ddcompletion # a custom 'fruit' argtype
+ apple banana orange
+ $ ddcompletion z
+ ##-no -fruit- completions-##
+
+ This is a bit of a hack, but IMO a better experience than the surprise
+ of matching a local filename beginning with 'z', which isn't, in this
+ case, a "fruit".
+
+## 1.12.1
+
+- Bash completion: Document `.completionType`. Add `includeHidden`
+ option to `bashCompletionSpecFromOptions()`. Add support for dealing with
+ hidden subcmds.
+
+
+## 1.12.0
+
+- Support for generating Bash completion files. See the "Bash completion"
+ section of the README.md and "examples/ddcompletion.js" for an example.
+
+
+## 1.11.0
+
+- Add the `arrayFlatten` boolean option to `dashdash.addOptionType` used for
+ custom option types. This allows one to create an `arrayOf...` option type
+ where each usage of the option can return multiple results. For example:
+
+ node mytool.js --foo a,b --foo c
+
+ We could define an option type for `--foo` such that
+ `opts.foo = ['a', 'b', 'c']`. See
+ "[examples/custom-option-arrayOfCommaSepString.js](examples/custom-option-arrayOfCommaSepString.js)"
+ for an example.
+
+
+## 1.10.1
+
+- Trim the published package to the minimal bits. Before: 24K tarball, 144K unpacked.
+ After: 12K tarball, 48K unpacked. `npm` won't let me drop the README.md. :)
+
+
+## 1.10.0
+
+- [issue #9] Support `includeDefault` in help config (similar to `includeEnv`) to have a
+ note of an option's default value, if any, in help output.
+- [issue #11] Fix option group breakage introduced in v1.9.0.
+
+
+## 1.9.0
+
+- [issue #10] Custom option types added with `addOptionType` can specify a
+ "default" value. See "examples/custom-option-fruit.js".
+
+
+## 1.8.0
+
+- Support `hidden: true` in an option spec to have help output exclude this
+ option.
+
+
+## 1.7.3
+
+- [issue #8] Fix parsing of a short option group when one of the
+ option takes an argument. For example, consider `tail` with
+ a `-f` boolean option and a `-n` option that takes a number
+ argument. This should parse:
+
+ tail -fn5
+
+ Before this change, that would not parse correctly.
+ It is suspected that this was introduced in version 1.4.0
+ (with commit 656fa8bc71c372ebddad0a7026bd71611e2ec99a).
+
+
+## 1.7.2
+
+- Known issues: #8
+
+- Exclude 'tools/' dir in packages published to npm.
+
+
+## 1.7.1
+
+- Known issues: #8
+
+- Support an option group *empty string* value:
+
+ ...
+ { group: '' },
+ ...
+
+ to render as a blank line in option help. This can help separate loosely
+ related sets of options without resorting to a title for option groups.
+
+
+## 1.7.0
+
+- Known issues: #8
+
+- [pull #7] Support for `.help({helpWrap: false, ...})` option to be able
+ to fully control the formatting for option help (by Patrick Mooney) `helpWrap:
+ false` can also be set on individual options in the option objects, e.g.:
+
+ var options = [
+ {
+ names: ['foo'],
+ type: 'string',
+ helpWrap: false,
+ help: 'long help with\n newlines' +
+ '\n spaces\n and such\nwill render correctly'
+ },
+ ...
+ ];
+
+
+## 1.6.0
+
+- Known issues: #8
+
+- [pull #6] Support headings between groups of options (by Joshua M. Clulow)
+ so that this code:
+
+ var options = [
+ { group: 'Armament Options' },
+ { names: [ 'weapon', 'w' ], type: 'string' },
+ { group: 'General Options' },
+ { names: [ 'help', 'h' ], type: 'bool' }
+ ];
+ ...
+
+ will give you this help output:
+
+ ...
+ Armament Options:
+ -w, --weapon
+
+ General Options:
+ -h, --help
+ ...
+
+
+## 1.5.0
+
+- Known issues: #8
+
+- Add support for adding custom option types. "examples/custom-option-duration.js"
+ shows an example adding a "duration" option type.
+
+ $ node custom-option-duration.js -t 1h
+ duration: 3600000 ms
+ $ node custom-option-duration.js -t 1s
+ duration: 1000 ms
+ $ node custom-option-duration.js -t 5d
+ duration: 432000000 ms
+ $ node custom-option-duration.js -t bogus
+ custom-option-duration.js: error: arg for "-t" is not a valid duration: "bogus"
+
+ A custom option type is added via:
+
+ var dashdash = require('dashdash');
+ dashdash.addOptionType({
+ name: '...',
+ takesArg: true,
+ helpArg: '...',
+ parseArg: function (option, optstr, arg) {
+ ...
+ }
+ });
+
+- [issue #4] Add `date` and `arrayOfDate` option types. They accept these date
+ formats: epoch second times (e.g. 1396031701) and ISO 8601 format:
+ `YYYY-MM-DD[THH:MM:SS[.sss][Z]]` (e.g. "2014-03-28",
+ "2014-03-28T18:35:01.489Z"). See "examples/date.js" for an example usage.
+
+ $ node examples/date.js -s 2014-01-01 -e $(date +%s)
+ start at 2014-01-01T00:00:00.000Z
+ end at 2014-03-29T04:26:18.000Z
+
+
+## 1.4.0
+
+- Known issues: #8
+
+- [pull #2, pull #3] Add a `allowUnknown: true` option on `createParser` to
+ allow unknown options to be passed through as `opts._args` instead of parsing
+ throwing an exception (by https://github.com/isaacs).
+
+ See 'allowUnknown' in the README for a subtle caveat.
+
+
+## 1.3.2
+
+- Fix a subtlety where a *bool* option using both `env` and `default` didn't
+ work exactly correctly. If `default: false` then all was fine (by luck).
+ However, if you had an option like this:
+
+ options: [ {
+ names: ['verbose', 'v'],
+ env: 'FOO_VERBOSE',
+ 'default': true, // <--- this
+ type: 'bool'
+ } ],
+
+ wanted `FOO_VERBOSE=0` to make the option false, then you need the fix
+ in this version of dashdash.
+
+
+## 1.3.1
+
+- [issue #1] Fix an envvar not winning over an option 'default'. Previously
+ an option with both `default` and `env` would never take a value from the
+ environment variable. E.g. `FOO_FILE` would never work here:
+
+ options: [ {
+ names: ['file', 'f'],
+ env: 'FOO_FILE',
+ 'default': 'default.file',
+ type: 'string'
+ } ],
+
+
+## 1.3.0
+
+- [Backward incompatible change for boolean envvars] Change the
+ interpretation of environment variables for boolean options to consider '0'
+ to be false. Previous to this *any* value to the envvar was considered
+ true -- which was quite misleading. Example:
+
+ $ FOO_VERBOSE=0 node examples/foo.js
+ # opts: { verbose: [ false ],
+ _order: [ { key: 'verbose', value: false, from: 'env' } ],
+ _args: [] }
+ # args: []
+
+
+## 1.2.1
+
+- Fix for `parse.help({includeEnv: true, ...})` handling to ensure that an
+ option with an `env` **but no `help`** still has the "Environment: ..."
+ output. E.g.:
+
+ { names: ['foo'], type: 'string', env: 'FOO' }
+
+ ...
+
+ --foo=ARG Environment: FOO=ARG
+
+
+## 1.2.0
+
+- Transform the option key on the `opts` object returned from
+ `.parse()` for convenience. Currently this is just
+ `s/-/_/g`, e.g. '--dry-run' -> `opts.dry_run`. This allow one to use hyphen
+ in option names (common) but not have to do silly things like
+ `opt["dry-run"]` to access the parsed results.
+
+
+## 1.1.0
+
+- Environment variable integration. Envvars can be associated with an option,
+ then option processing will fallback to using that envvar if defined and
+ if the option isn't specified in argv. See the "Environment variable
+ integration" section in the README.
+
+- Change the `.parse()` signature to take a single object with keys
+ for arguments. The old signature is still supported.
+
+- `dashdash.createParser(CONFIG)` alternative to `new dashdash.Parser(CONFIG)`
+ a la many node-land APIs.
+
+
+## 1.0.2
+
+- Add "positiveInteger" and "arrayOfPositiveInteger" option types that only
+ accept positive integers.
+
+- Add "integer" and "arrayOfInteger" option types that accepts only integers.
+ Note that, for better or worse, these do NOT accept: "0x42" (hex), "1e2"
+ (with exponent) or "1.", "3.0" (floats).
+
+
+## 1.0.1
+
+- Fix not modifying the given option spec objects (which breaks creating
+ a Parser with them more than once).
+
+
+## 1.0.0
+
+First release.
diff --git a/website_quotation_template/node_modules/dashdash/LICENSE.txt b/website_quotation_template/node_modules/dashdash/LICENSE.txt
new file mode 100644
index 000000000..54706c66e
--- /dev/null
+++ b/website_quotation_template/node_modules/dashdash/LICENSE.txt
@@ -0,0 +1,24 @@
+# This is the MIT license
+
+Copyright (c) 2013 Trent Mick. All rights reserved.
+Copyright (c) 2013 Joyent Inc. All rights reserved.
+
+Permission is hereby granted, free of charge, to any person obtaining a
+copy of this software and associated documentation files (the
+"Software"), to deal in the Software without restriction, including
+without limitation the rights to use, copy, modify, merge, publish,
+distribute, sublicense, and/or sell copies of the Software, and to
+permit persons to whom the Software is furnished to do so, subject to
+the following conditions:
+
+The above copyright notice and this permission notice shall be included
+in all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS
+OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF
+MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY
+CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT,
+TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/website_quotation_template/node_modules/dashdash/README.md b/website_quotation_template/node_modules/dashdash/README.md
new file mode 100644
index 000000000..e47b106e6
--- /dev/null
+++ b/website_quotation_template/node_modules/dashdash/README.md
@@ -0,0 +1,574 @@
+A light, featureful and explicit option parsing library for node.js.
+
+[Why another one? See below](#why). tl;dr: The others I've tried are one of
+too loosey goosey (not explicit), too big/too many deps, or ill specified.
+YMMV.
+
+Follow @trentmick
+for updates to node-dashdash.
+
+# Install
+
+ npm install dashdash
+
+
+# Usage
+
+```javascript
+var dashdash = require('dashdash');
+
+// Specify the options. Minimally `name` (or `names`) and `type`
+// must be given for each.
+var options = [
+ {
+ // `names` or a single `name`. First element is the `opts.KEY`.
+ names: ['help', 'h'],
+ // See "Option specs" below for types.
+ type: 'bool',
+ help: 'Print this help and exit.'
+ }
+];
+
+// Shortcut form. As called it infers `process.argv`. See below for
+// the longer form to use methods like `.help()` on the Parser object.
+var opts = dashdash.parse({options: options});
+
+console.log("opts:", opts);
+console.log("args:", opts._args);
+```
+
+
+# Longer Example
+
+A more realistic [starter script "foo.js"](./examples/foo.js) is as follows.
+This also shows using `parser.help()` for formatted option help.
+
+```javascript
+var dashdash = require('./lib/dashdash');
+
+var options = [
+ {
+ name: 'version',
+ type: 'bool',
+ help: 'Print tool version and exit.'
+ },
+ {
+ names: ['help', 'h'],
+ type: 'bool',
+ help: 'Print this help and exit.'
+ },
+ {
+ names: ['verbose', 'v'],
+ type: 'arrayOfBool',
+ help: 'Verbose output. Use multiple times for more verbose.'
+ },
+ {
+ names: ['file', 'f'],
+ type: 'string',
+ help: 'File to process',
+ helpArg: 'FILE'
+ }
+];
+
+var parser = dashdash.createParser({options: options});
+try {
+ var opts = parser.parse(process.argv);
+} catch (e) {
+ console.error('foo: error: %s', e.message);
+ process.exit(1);
+}
+
+console.log("# opts:", opts);
+console.log("# args:", opts._args);
+
+// Use `parser.help()` for formatted options help.
+if (opts.help) {
+ var help = parser.help({includeEnv: true}).trimRight();
+ console.log('usage: node foo.js [OPTIONS]\n'
+ + 'options:\n'
+ + help);
+ process.exit(0);
+}
+
+// ...
+```
+
+
+Some example output from this script (foo.js):
+
+```
+$ node foo.js -h
+# opts: { help: true,
+ _order: [ { name: 'help', value: true, from: 'argv' } ],
+ _args: [] }
+# args: []
+usage: node foo.js [OPTIONS]
+options:
+ --version Print tool version and exit.
+ -h, --help Print this help and exit.
+ -v, --verbose Verbose output. Use multiple times for more verbose.
+ -f FILE, --file=FILE File to process
+
+$ node foo.js -v
+# opts: { verbose: [ true ],
+ _order: [ { name: 'verbose', value: true, from: 'argv' } ],
+ _args: [] }
+# args: []
+
+$ node foo.js --version arg1
+# opts: { version: true,
+ _order: [ { name: 'version', value: true, from: 'argv' } ],
+ _args: [ 'arg1' ] }
+# args: [ 'arg1' ]
+
+$ node foo.js -f bar.txt
+# opts: { file: 'bar.txt',
+ _order: [ { name: 'file', value: 'bar.txt', from: 'argv' } ],
+ _args: [] }
+# args: []
+
+$ node foo.js -vvv --file=blah
+# opts: { verbose: [ true, true, true ],
+ file: 'blah',
+ _order:
+ [ { name: 'verbose', value: true, from: 'argv' },
+ { name: 'verbose', value: true, from: 'argv' },
+ { name: 'verbose', value: true, from: 'argv' },
+ { name: 'file', value: 'blah', from: 'argv' } ],
+ _args: [] }
+# args: []
+```
+
+
+See the ["examples"](examples/) dir for a number of starter examples using
+some of dashdash's features.
+
+
+# Environment variable integration
+
+If you want to allow environment variables to specify options to your tool,
+dashdash makes this easy. We can change the 'verbose' option in the example
+above to include an 'env' field:
+
+```javascript
+ {
+ names: ['verbose', 'v'],
+ type: 'arrayOfBool',
+ env: 'FOO_VERBOSE', // <--- add this line
+ help: 'Verbose output. Use multiple times for more verbose.'
+ },
+```
+
+then the **"FOO_VERBOSE" environment variable** can be used to set this
+option:
+
+```shell
+$ FOO_VERBOSE=1 node foo.js
+# opts: { verbose: [ true ],
+ _order: [ { name: 'verbose', value: true, from: 'env' } ],
+ _args: [] }
+# args: []
+```
+
+Boolean options will interpret the empty string as unset, '0' as false
+and anything else as true.
+
+```shell
+$ FOO_VERBOSE= node examples/foo.js # not set
+# opts: { _order: [], _args: [] }
+# args: []
+
+$ FOO_VERBOSE=0 node examples/foo.js # '0' is false
+# opts: { verbose: [ false ],
+ _order: [ { key: 'verbose', value: false, from: 'env' } ],
+ _args: [] }
+# args: []
+
+$ FOO_VERBOSE=1 node examples/foo.js # true
+# opts: { verbose: [ true ],
+ _order: [ { key: 'verbose', value: true, from: 'env' } ],
+ _args: [] }
+# args: []
+
+$ FOO_VERBOSE=boogabooga node examples/foo.js # true
+# opts: { verbose: [ true ],
+ _order: [ { key: 'verbose', value: true, from: 'env' } ],
+ _args: [] }
+# args: []
+```
+
+Non-booleans can be used as well. Strings:
+
+```shell
+$ FOO_FILE=data.txt node examples/foo.js
+# opts: { file: 'data.txt',
+ _order: [ { key: 'file', value: 'data.txt', from: 'env' } ],
+ _args: [] }
+# args: []
+```
+
+Numbers:
+
+```shell
+$ FOO_TIMEOUT=5000 node examples/foo.js
+# opts: { timeout: 5000,
+ _order: [ { key: 'timeout', value: 5000, from: 'env' } ],
+ _args: [] }
+# args: []
+
+$ FOO_TIMEOUT=blarg node examples/foo.js
+foo: error: arg for "FOO_TIMEOUT" is not a positive integer: "blarg"
+```
+
+With the `includeEnv: true` config to `parser.help()` the environment
+variable can also be included in **help output**:
+
+ usage: node foo.js [OPTIONS]
+ options:
+ --version Print tool version and exit.
+ -h, --help Print this help and exit.
+ -v, --verbose Verbose output. Use multiple times for more verbose.
+ Environment: FOO_VERBOSE=1
+ -f FILE, --file=FILE File to process
+
+
+# Bash completion
+
+Dashdash provides a simple way to create a Bash completion file that you
+can place in your "bash_completion.d" directory -- sometimes that is
+"/usr/local/etc/bash_completion.d/"). Features:
+
+- Support for short and long opts
+- Support for knowing which options take arguments
+- Support for subcommands (e.g. 'git log ' to show just options for the
+ log subcommand). See
+ [node-cmdln](https://github.com/trentm/node-cmdln#bash-completion) for
+ how to integrate that.
+- Does the right thing with "--" to stop options.
+- Custom optarg and arg types for custom completions.
+
+Dashdash will return bash completion file content given a parser instance:
+
+ var parser = dashdash.createParser({options: options});
+ console.log( parser.bashCompletion({name: 'mycli'}) );
+
+or directly from a `options` array of options specs:
+
+ var code = dashdash.bashCompletionFromOptions({
+ name: 'mycli',
+ options: OPTIONS
+ });
+
+Write that content to "/usr/local/etc/bash_completion.d/mycli" and you will
+have Bash completions for `mycli`. Alternatively you can write it to
+any file (e.g. "~/.bashrc") and source it.
+
+You could add a `--completion` hidden option to your tool that emits the
+completion content and document for your users to call that to install
+Bash completions.
+
+See [examples/ddcompletion.js](examples/ddcompletion.js) for a complete
+example, including how one can define bash functions for completion of custom
+option types. Also see [node-cmdln](https://github.com/trentm/node-cmdln) for
+how it uses this for Bash completion for full multi-subcommand tools.
+
+- TODO: document specExtra
+- TODO: document includeHidden
+- TODO: document custom types, `function complete\_FOO` guide, completionType
+- TODO: document argtypes
+
+
+# Parser config
+
+Parser construction (i.e. `dashdash.createParser(CONFIG)`) takes the
+following fields:
+
+- `options` (Array of option specs). Required. See the
+ [Option specs](#option-specs) section below.
+
+- `interspersed` (Boolean). Optional. Default is true. If true this allows
+ interspersed arguments and options. I.e.:
+
+ node ./tool.js -v arg1 arg2 -h # '-h' is after interspersed args
+
+ Set it to false to have '-h' **not** get parsed as an option in the above
+ example.
+
+- `allowUnknown` (Boolean). Optional. Default is false. If false, this causes
+ unknown arguments to throw an error. I.e.:
+
+ node ./tool.js -v arg1 --afe8asefksjefhas
+
+ Set it to true to treat the unknown option as a positional
+ argument.
+
+ **Caveat**: When a shortopt group, such as `-xaz` contains a mix of
+ known and unknown options, the *entire* group is passed through
+ unmolested as a positional argument.
+
+ Consider if you have a known short option `-a`, and parse the
+ following command line:
+
+ node ./tool.js -xaz
+
+ where `-x` and `-z` are unknown. There are multiple ways to
+ interpret this:
+
+ 1. `-x` takes a value: `{x: 'az'}`
+ 2. `-x` and `-z` are both booleans: `{x:true,a:true,z:true}`
+
+ Since dashdash does not know what `-x` and `-z` are, it can't know
+ if you'd prefer to receive `{a:true,_args:['-x','-z']}` or
+ `{x:'az'}`, or `{_args:['-xaz']}`. Leaving the positional arg unprocessed
+ is the easiest mistake for the user to recover from.
+
+
+# Option specs
+
+Example using all fields (required fields are noted):
+
+```javascript
+{
+ names: ['file', 'f'], // Required (one of `names` or `name`).
+ type: 'string', // Required.
+ completionType: 'filename',
+ env: 'MYTOOL_FILE',
+ help: 'Config file to load before running "mytool"',
+ helpArg: 'PATH',
+ helpWrap: false,
+ default: path.resolve(process.env.HOME, '.mytoolrc')
+}
+```
+
+Each option spec in the `options` array must/can have the following fields:
+
+- `name` (String) or `names` (Array). Required. These give the option name
+ and aliases. The first name (if more than one given) is the key for the
+ parsed `opts` object.
+
+- `type` (String). Required. One of:
+
+ - bool
+ - string
+ - number
+ - integer
+ - positiveInteger
+ - date (epoch seconds, e.g. 1396031701, or ISO 8601 format
+ `YYYY-MM-DD[THH:MM:SS[.sss][Z]]`, e.g. "2014-03-28T18:35:01.489Z")
+ - arrayOfBool
+ - arrayOfString
+ - arrayOfNumber
+ - arrayOfInteger
+ - arrayOfPositiveInteger
+ - arrayOfDate
+
+ FWIW, these names attempt to match with asserts on
+ [assert-plus](https://github.com/mcavage/node-assert-plus).
+ You can add your own custom option types with `dashdash.addOptionType`.
+ See below.
+
+- `completionType` (String). Optional. This is used for [Bash
+ completion](#bash-completion) for an option argument. If not specified,
+ then the value of `type` is used. Any string may be specified, but only the
+ following values have meaning:
+
+ - `none`: Provide no completions.
+ - `file`: Bash's default completion (i.e. `complete -o default`), which
+ includes filenames.
+ - *Any string FOO for which a `function complete_FOO` Bash function is
+ defined.* This is for custom completions for a given tool. Typically
+ these custom functions are provided in the `specExtra` argument to
+ `dashdash.bashCompletionFromOptions()`. See
+ ["examples/ddcompletion.js"](examples/ddcompletion.js) for an example.
+
+- `env` (String or Array of String). Optional. An environment variable name
+ (or names) that can be used as a fallback for this option. For example,
+ given a "foo.js" like this:
+
+ var options = [{names: ['dry-run', 'n'], env: 'FOO_DRY_RUN'}];
+ var opts = dashdash.parse({options: options});
+
+ Both `node foo.js --dry-run` and `FOO_DRY_RUN=1 node foo.js` would result
+ in `opts.dry_run = true`.
+
+ An environment variable is only used as a fallback, i.e. it is ignored if
+ the associated option is given in `argv`.
+
+- `help` (String). Optional. Used for `parser.help()` output.
+
+- `helpArg` (String). Optional. Used in help output as the placeholder for
+ the option argument, e.g. the "PATH" in:
+
+ ...
+ -f PATH, --file=PATH File to process
+ ...
+
+- `helpWrap` (Boolean). Optional, default true. Set this to `false` to have
+ that option's `help` *not* be text wrapped in `.help()` output.
+
+- `default`. Optional. A default value used for this option, if the
+ option isn't specified in argv.
+
+- `hidden` (Boolean). Optional, default false. If true, help output will not
+ include this option. See also the `includeHidden` option to
+ `bashCompletionFromOptions()` for [Bash completion](#bash-completion).
+
+
+# Option group headings
+
+You can add headings between option specs in the `options` array. To do so,
+simply add an object with only a `group` property -- the string to print as
+the heading for the subsequent options in the array. For example:
+
+```javascript
+var options = [
+ {
+ group: 'Armament Options'
+ },
+ {
+ names: [ 'weapon', 'w' ],
+ type: 'string'
+ },
+ {
+ group: 'General Options'
+ },
+ {
+ names: [ 'help', 'h' ],
+ type: 'bool'
+ }
+];
+...
+```
+
+Note: You can use an empty string, `{group: ''}`, to get a blank line in help
+output between groups of options.
+
+
+# Help config
+
+The `parser.help(...)` function is configurable as follows:
+
+ Options:
+ Armament Options:
+ ^^ -w WEAPON, --weapon=WEAPON Weapon with which to crush. One of: |
+ / sword, spear, maul |
+ / General Options: |
+ / -h, --help Print this help and exit. |
+ / ^^^^ ^ |
+ \ `-- indent `-- helpCol maxCol ---'
+ `-- headingIndent
+
+- `indent` (Number or String). Default 4. Set to a number (for that many
+ spaces) or a string for the literal indent.
+- `headingIndent` (Number or String). Default half length of `indent`. Set to
+ a number (for that many spaces) or a string for the literal indent. This
+ indent applies to group heading lines, between normal option lines.
+- `nameSort` (String). Default is 'length'. By default the names are
+ sorted to put the short opts first (i.e. '-h, --help' preferred
+ to '--help, -h'). Set to 'none' to not do this sorting.
+- `maxCol` (Number). Default 80. Note that reflow is just done on whitespace
+ so a long token in the option help can overflow maxCol.
+- `helpCol` (Number). If not set a reasonable value will be determined
+ between `minHelpCol` and `maxHelpCol`.
+- `minHelpCol` (Number). Default 20.
+- `maxHelpCol` (Number). Default 40.
+- `helpWrap` (Boolean). Default true. Set to `false` to have option `help`
+ strings *not* be textwrapped to the helpCol..maxCol range.
+- `includeEnv` (Boolean). Default false. If the option has associated
+ environment variables (via the `env` option spec attribute), then
+ append mentioned of those envvars to the help string.
+- `includeDefault` (Boolean). Default false. If the option has a default value
+ (via the `default` option spec attribute, or a default on the option's type),
+ then a "Default: VALUE" string will be appended to the help string.
+
+
+# Custom option types
+
+Dashdash includes a good starter set of option types that it will parse for
+you. However, you can add your own via:
+
+ var dashdash = require('dashdash');
+ dashdash.addOptionType({
+ name: '...',
+ takesArg: true,
+ helpArg: '...',
+ parseArg: function (option, optstr, arg) {
+ ...
+ },
+ array: false, // optional
+ arrayFlatten: false, // optional
+ default: ..., // optional
+ completionType: ... // optional
+ });
+
+For example, a simple option type that accepts 'yes', 'y', 'no' or 'n' as
+a boolean argument would look like:
+
+ var dashdash = require('dashdash');
+
+ function parseYesNo(option, optstr, arg) {
+ var argLower = arg.toLowerCase()
+ if (~['yes', 'y'].indexOf(argLower)) {
+ return true;
+ } else if (~['no', 'n'].indexOf(argLower)) {
+ return false;
+ } else {
+ throw new Error(format(
+ 'arg for "%s" is not "yes" or "no": "%s"',
+ optstr, arg));
+ }
+ }
+
+ dashdash.addOptionType({
+ name: 'yesno'
+ takesArg: true,
+ helpArg: '',
+ parseArg: parseYesNo
+ });
+
+ var options = {
+ {names: ['answer', 'a'], type: 'yesno'}
+ };
+ var opts = dashdash.parse({options: options});
+
+See "examples/custom-option-\*.js" for other examples.
+See the `addOptionType` block comment in "lib/dashdash.js" for more details.
+Please let me know [with an
+issue](https://github.com/trentm/node-dashdash/issues/new) if you write a
+generally useful one.
+
+
+
+# Why
+
+Why another node.js option parsing lib?
+
+- `nopt` really is just for "tools like npm". Implicit opts (e.g. '--no-foo'
+ works for every '--foo'). Can't disable abbreviated opts. Can't do multiple
+ usages of same opt, e.g. '-vvv' (I think). Can't do grouped short opts.
+
+- `optimist` has surprise interpretation of options (at least to me).
+ Implicit opts mean ambiguities and poor error handling for fat-fingering.
+ `process.exit` calls makes it hard to use as a libary.
+
+- `optparse` Incomplete docs. Is this an attempted clone of Python's `optparse`.
+ Not clear. Some divergence. `parser.on("name", ...)` API is weird.
+
+- `argparse` Dep on underscore. No thanks just for option processing.
+ `find lib | wc -l` -> `26`. Overkill.
+ Argparse is a bit different anyway. Not sure I want that.
+
+- `posix-getopt` No type validation. Though that isn't a killer. AFAIK can't
+ have a long opt without a short alias. I.e. no `getopt_long` semantics.
+ Also, no whizbang features like generated help output.
+
+- ["commander.js"](https://github.com/visionmedia/commander.js): I wrote
+ [a critique](http://trentm.com/2014/01/a-critique-of-commander-for-nodejs.html)
+ a while back. It seems fine, but last I checked had
+ [an outstanding bug](https://github.com/visionmedia/commander.js/pull/121)
+ that would prevent me from using it.
+
+
+# License
+
+MIT. See LICENSE.txt.
diff --git a/website_quotation_template/node_modules/dashdash/etc/dashdash.bash_completion.in b/website_quotation_template/node_modules/dashdash/etc/dashdash.bash_completion.in
new file mode 100644
index 000000000..dc333096c
--- /dev/null
+++ b/website_quotation_template/node_modules/dashdash/etc/dashdash.bash_completion.in
@@ -0,0 +1,389 @@
+#!/bin/bash
+#
+# Bash completion generated for '{{name}}' at {{date}}.
+#
+# The original template lives here:
+# https://github.com/trentm/node-dashdash/blob/master/etc/dashdash.bash_completion.in
+#
+
+#
+# Copyright 2016 Trent Mick
+# Copyright 2016 Joyent, Inc.
+#
+#
+# A generic Bash completion driver script.
+#
+# This is meant to provide a re-usable chunk of Bash to use for
+# "etc/bash_completion.d/" files for individual tools. Only the "Configuration"
+# section with tool-specific info need differ. Features:
+#
+# - support for short and long opts
+# - support for knowing which options take arguments
+# - support for subcommands (e.g. 'git log ' to show just options for the
+# log subcommand)
+# - does the right thing with "--" to stop options
+# - custom optarg and arg types for custom completions
+# - (TODO) support for shells other than Bash (tcsh, zsh, fish?, etc.)
+#
+#
+# Examples/design:
+#
+# 1. Bash "default" completion. By default Bash's 'complete -o default' is
+# enabled. That means when there are no completions (e.g. if no opts match
+# the current word), then you'll get Bash's default completion. Most notably
+# that means you get filename completion. E.g.:
+# $ tool ./
+# $ tool READ
+#
+# 2. all opts and subcmds:
+# $ tool
+# $ tool -v # assuming '-v' doesn't take an arg
+# $ tool - # matching opts
+# $ git lo # matching subcmds
+#
+# Long opt completions are given *without* the '=', i.e. we prefer space
+# separated because that's easier for good completions.
+#
+# 3. long opt arg with '='
+# $ tool --file=
+# $ tool --file=./d
+# We maintain the "--file=" prefix. Limitation: With the attached prefix
+# the 'complete -o filenames' doesn't know to do dirname '/' suffixing. Meh.
+#
+# 4. envvars:
+# $ tool $
+# $ tool $P
+# Limitation: Currently only getting exported vars, so we miss "PS1" and
+# others.
+#
+# 5. Defer to other completion in a subshell:
+# $ tool --file $(cat ./
+# We get this from 'complete -o default ...'.
+#
+# 6. Custom completion types from a provided bash function.
+# $ tool --profile # complete available "profiles"
+#
+#
+# Dev Notes:
+# - compgen notes, from http://unix.stackexchange.com/questions/151118/understand-compgen-builtin-command
+# - https://www.gnu.org/software/bash/manual/html_node/Programmable-Completion-Builtins.html
+#
+
+
+# Debugging this completion:
+# 1. Uncomment the "_{{name}}_log_file=..." line.
+# 2. 'tail -f /var/tmp/dashdash-completion.log' in one terminal.
+# 3. Re-source this bash completion file.
+#_{{name}}_log=/var/tmp/dashdash-completion.log
+
+function _{{name}}_completer {
+
+ # ---- cmd definition
+
+ {{spec}}
+
+
+ # ---- locals
+
+ declare -a argv
+
+
+ # ---- support functions
+
+ function trace {
+ [[ -n "$_{{name}}_log" ]] && echo "$*" >&2
+ }
+
+ function _dashdash_complete {
+ local idx context
+ idx=$1
+ context=$2
+
+ local shortopts longopts optargs subcmds allsubcmds argtypes
+ shortopts="$(eval "echo \${cmd${context}_shortopts}")"
+ longopts="$(eval "echo \${cmd${context}_longopts}")"
+ optargs="$(eval "echo \${cmd${context}_optargs}")"
+ subcmds="$(eval "echo \${cmd${context}_subcmds}")"
+ allsubcmds="$(eval "echo \${cmd${context}_allsubcmds}")"
+ IFS=', ' read -r -a argtypes <<< "$(eval "echo \${cmd${context}_argtypes}")"
+
+ trace ""
+ trace "_dashdash_complete(idx=$idx, context=$context)"
+ trace " shortopts: $shortopts"
+ trace " longopts: $longopts"
+ trace " optargs: $optargs"
+ trace " subcmds: $subcmds"
+ trace " allsubcmds: $allsubcmds"
+
+ # Get 'state' of option parsing at this COMP_POINT.
+ # Copying "dashdash.js#parse()" behaviour here.
+ local state=
+ local nargs=0
+ local i=$idx
+ local argtype
+ local optname
+ local prefix
+ local word
+ local dashdashseen=
+ while [[ $i -lt $len && $i -le $COMP_CWORD ]]; do
+ argtype=
+ optname=
+ prefix=
+ word=
+
+ arg=${argv[$i]}
+ trace " consider argv[$i]: '$arg'"
+
+ if [[ "$arg" == "--" && $i -lt $COMP_CWORD ]]; then
+ trace " dashdash seen"
+ dashdashseen=yes
+ state=arg
+ word=$arg
+ elif [[ -z "$dashdashseen" && "${arg:0:2}" == "--" ]]; then
+ arg=${arg:2}
+ if [[ "$arg" == *"="* ]]; then
+ optname=${arg%%=*}
+ val=${arg##*=}
+ trace " long opt: optname='$optname' val='$val'"
+ state=arg
+ argtype=$(echo "$optargs" | awk -F "-$optname=" '{print $2}' | cut -d' ' -f1)
+ word=$val
+ prefix="--$optname="
+ else
+ optname=$arg
+ val=
+ trace " long opt: optname='$optname'"
+ state=longopt
+ word=--$optname
+
+ if [[ "$optargs" == *"-$optname="* && $i -lt $COMP_CWORD ]]; then
+ i=$(( $i + 1 ))
+ state=arg
+ argtype=$(echo "$optargs" | awk -F "-$optname=" '{print $2}' | cut -d' ' -f1)
+ word=${argv[$i]}
+ trace " takes arg (consume argv[$i], word='$word')"
+ fi
+ fi
+ elif [[ -z "$dashdashseen" && "${arg:0:1}" == "-" ]]; then
+ trace " short opt group"
+ state=shortopt
+ word=$arg
+
+ local j=1
+ while [[ $j -lt ${#arg} ]]; do
+ optname=${arg:$j:1}
+ trace " consider index $j: optname '$optname'"
+
+ if [[ "$optargs" == *"-$optname="* ]]; then
+ argtype=$(echo "$optargs" | awk -F "-$optname=" '{print $2}' | cut -d' ' -f1)
+ if [[ $(( $j + 1 )) -lt ${#arg} ]]; then
+ state=arg
+ word=${arg:$(( $j + 1 ))}
+ trace " takes arg (rest of this arg, word='$word', argtype='$argtype')"
+ elif [[ $i -lt $COMP_CWORD ]]; then
+ state=arg
+ i=$(( $i + 1 ))
+ word=${argv[$i]}
+ trace " takes arg (word='$word', argtype='$argtype')"
+ fi
+ break
+ fi
+
+ j=$(( $j + 1 ))
+ done
+ elif [[ $i -lt $COMP_CWORD && -n "$arg" ]] && $(echo "$allsubcmds" | grep -w "$arg" >/dev/null); then
+ trace " complete subcmd: recurse _dashdash_complete"
+ _dashdash_complete $(( $i + 1 )) "${context}__${arg/-/_}"
+ return
+ else
+ trace " not an opt or a complete subcmd"
+ state=arg
+ word=$arg
+ nargs=$(( $nargs + 1 ))
+ if [[ ${#argtypes[@]} -gt 0 ]]; then
+ argtype="${argtypes[$(( $nargs - 1 ))]}"
+ if [[ -z "$argtype" ]]; then
+ # If we have more args than argtypes, we use the
+ # last type.
+ argtype="${argtypes[@]: -1:1}"
+ fi
+ fi
+ fi
+
+ trace " state=$state prefix='$prefix' word='$word'"
+ i=$(( $i + 1 ))
+ done
+
+ trace " parsed: state=$state optname='$optname' argtype='$argtype' prefix='$prefix' word='$word' dashdashseen=$dashdashseen"
+ local compgen_opts=
+ if [[ -n "$prefix" ]]; then
+ compgen_opts="$compgen_opts -P $prefix"
+ fi
+
+ case $state in
+ shortopt)
+ compgen $compgen_opts -W "$shortopts $longopts" -- "$word"
+ ;;
+ longopt)
+ compgen $compgen_opts -W "$longopts" -- "$word"
+ ;;
+ arg)
+ # If we don't know what completion to do, then emit nothing. We
+ # expect that we are running with:
+ # complete -o default ...
+ # where "default" means: "Use Readline's default completion if
+ # the compspec generates no matches." This gives us the good filename
+ # completion, completion in subshells/backticks.
+ #
+ # We cannot support an argtype="directory" because
+ # compgen -S '/' -A directory -- "$word"
+ # doesn't give a satisfying result. It doesn't stop at the trailing '/'
+ # so you cannot descend into dirs.
+ if [[ "${word:0:1}" == '$' ]]; then
+ # By default, Bash will complete '$' to all envvars. Apparently
+ # 'complete -o default' does *not* give us that. The following
+ # gets *close* to the same completions: '-A export' misses envvars
+ # like "PS1".
+ trace " completing envvars"
+ compgen $compgen_opts -P '$' -A export -- "${word:1}"
+ elif [[ -z "$argtype" ]]; then
+ # Only include opts in completions if $word is not empty.
+ # This is to avoid completing the leading '-', which foils
+ # using 'default' completion.
+ if [[ -n "$dashdashseen" ]]; then
+ trace " completing subcmds, if any (no argtype, dashdash seen)"
+ compgen $compgen_opts -W "$subcmds" -- "$word"
+ elif [[ -z "$word" ]]; then
+ trace " completing subcmds, if any (no argtype, empty word)"
+ compgen $compgen_opts -W "$subcmds" -- "$word"
+ else
+ trace " completing opts & subcmds (no argtype)"
+ compgen $compgen_opts -W "$shortopts $longopts $subcmds" -- "$word"
+ fi
+ elif [[ $argtype == "none" ]]; then
+ # We want *no* completions, i.e. some way to get the active
+ # 'complete -o default' to not do filename completion.
+ trace " completing 'none' (hack to imply no completions)"
+ echo "##-no-completion- -results-##"
+ elif [[ $argtype == "file" ]]; then
+ # 'complete -o default' gives the best filename completion, at least
+ # on Mac.
+ trace " completing 'file' (let 'complete -o default' handle it)"
+ echo ""
+ elif ! type complete_$argtype 2>/dev/null >/dev/null; then
+ trace " completing '$argtype' (fallback to default b/c complete_$argtype is unknown)"
+ echo ""
+ else
+ trace " completing custom '$argtype'"
+ completions=$(complete_$argtype "$word")
+ if [[ -z "$completions" ]]; then
+ trace " no custom '$argtype' completions"
+ # These are in ascii and "dictionary" order so they sort
+ # correctly.
+ echo "##-no-completion- -results-##"
+ else
+ echo $completions
+ fi
+ fi
+ ;;
+ *)
+ trace " unknown state: $state"
+ ;;
+ esac
+ }
+
+
+ trace ""
+ trace "-- $(date)"
+ #trace "\$IFS: '$IFS'"
+ #trace "\$@: '$@'"
+ #trace "COMP_WORDBREAKS: '$COMP_WORDBREAKS'"
+ trace "COMP_CWORD: '$COMP_CWORD'"
+ trace "COMP_LINE: '$COMP_LINE'"
+ trace "COMP_POINT: $COMP_POINT"
+
+ # Guard against negative COMP_CWORD. This is a Bash bug at least on
+ # Mac 10.10.4's bash. See
+ # .
+ if [[ $COMP_CWORD -lt 0 ]]; then
+ trace "abort on negative COMP_CWORD"
+ exit 1;
+ fi
+
+ # I don't know how to do array manip on argv vars,
+ # so copy over to argv array to work on them.
+ shift # the leading '--'
+ i=0
+ len=$#
+ while [[ $# -gt 0 ]]; do
+ argv[$i]=$1
+ shift;
+ i=$(( $i + 1 ))
+ done
+ trace "argv: '${argv[@]}'"
+ trace "argv[COMP_CWORD-1]: '${argv[$(( $COMP_CWORD - 1 ))]}'"
+ trace "argv[COMP_CWORD]: '${argv[$COMP_CWORD]}'"
+ trace "argv len: '$len'"
+
+ _dashdash_complete 1 ""
+}
+
+
+# ---- mainline
+
+# Note: This if-block to help work with 'compdef' and 'compctl' is
+# adapted from 'npm completion'.
+if type complete &>/dev/null; then
+ function _{{name}}_completion {
+ local _log_file=/dev/null
+ [[ -z "$_{{name}}_log" ]] || _log_file="$_{{name}}_log"
+ COMPREPLY=($(COMP_CWORD="$COMP_CWORD" \
+ COMP_LINE="$COMP_LINE" \
+ COMP_POINT="$COMP_POINT" \
+ _{{name}}_completer -- "${COMP_WORDS[@]}" \
+ 2>$_log_file)) || return $?
+ }
+ complete -o default -F _{{name}}_completion {{name}}
+elif type compdef &>/dev/null; then
+ function _{{name}}_completion {
+ local _log_file=/dev/null
+ [[ -z "$_{{name}}_log" ]] || _log_file="$_{{name}}_log"
+ compadd -- $(COMP_CWORD=$((CURRENT-1)) \
+ COMP_LINE=$BUFFER \
+ COMP_POINT=0 \
+ _{{name}}_completer -- "${words[@]}" \
+ 2>$_log_file)
+ }
+ compdef _{{name}}_completion {{name}}
+elif type compctl &>/dev/null; then
+ function _{{name}}_completion {
+ local cword line point words si
+ read -Ac words
+ read -cn cword
+ let cword-=1
+ read -l line
+ read -ln point
+ local _log_file=/dev/null
+ [[ -z "$_{{name}}_log" ]] || _log_file="$_{{name}}_log"
+ reply=($(COMP_CWORD="$cword" \
+ COMP_LINE="$line" \
+ COMP_POINT="$point" \
+ _{{name}}_completer -- "${words[@]}" \
+ 2>$_log_file)) || return $?
+ }
+ compctl -K _{{name}}_completion {{name}}
+fi
+
+
+##
+## This is a Bash completion file for the '{{name}}' command. You can install
+## with either:
+##
+## cp FILE /usr/local/etc/bash_completion.d/{{name}} # Mac
+## cp FILE /etc/bash_completion.d/{{name}} # Linux
+##
+## or:
+##
+## cp FILE > ~/.{{name}}.completion
+## echo "source ~/.{{name}}.completion" >> ~/.bashrc
+##
\ No newline at end of file
diff --git a/website_quotation_template/node_modules/dashdash/lib/dashdash.js b/website_quotation_template/node_modules/dashdash/lib/dashdash.js
new file mode 100644
index 000000000..adb6f13b1
--- /dev/null
+++ b/website_quotation_template/node_modules/dashdash/lib/dashdash.js
@@ -0,0 +1,1055 @@
+/**
+ * dashdash - A light, featureful and explicit option parsing library for
+ * node.js.
+ */
+// vim: set ts=4 sts=4 sw=4 et:
+
+var assert = require('assert-plus');
+var format = require('util').format;
+var fs = require('fs');
+var path = require('path');
+
+
+var DEBUG = true;
+if (DEBUG) {
+ var debug = console.warn;
+} else {
+ var debug = function () {};
+}
+
+
+
+// ---- internal support stuff
+
+// Replace {{variable}} in `s` with the template data in `d`.
+function renderTemplate(s, d) {
+ return s.replace(/{{([a-zA-Z]+)}}/g, function (match, key) {
+ return d.hasOwnProperty(key) ? d[key] : match;
+ });
+}
+
+/**
+ * Return a shallow copy of the given object;
+ */
+function shallowCopy(obj) {
+ if (!obj) {
+ return (obj);
+ }
+ var copy = {};
+ Object.keys(obj).forEach(function (k) {
+ copy[k] = obj[k];
+ });
+ return (copy);
+}
+
+
+function space(n) {
+ var s = '';
+ for (var i = 0; i < n; i++) {
+ s += ' ';
+ }
+ return s;
+}
+
+
+function makeIndent(arg, deflen, name) {
+ if (arg === null || arg === undefined)
+ return space(deflen);
+ else if (typeof (arg) === 'number')
+ return space(arg);
+ else if (typeof (arg) === 'string')
+ return arg;
+ else
+ assert.fail('invalid "' + name + '": not a string or number: ' + arg);
+}
+
+
+/**
+ * Return an array of lines wrapping the given text to the given width.
+ * This splits on whitespace. Single tokens longer than `width` are not
+ * broken up.
+ */
+function textwrap(s, width) {
+ var words = s.trim().split(/\s+/);
+ var lines = [];
+ var line = '';
+ words.forEach(function (w) {
+ var newLength = line.length + w.length;
+ if (line.length > 0)
+ newLength += 1;
+ if (newLength > width) {
+ lines.push(line);
+ line = '';
+ }
+ if (line.length > 0)
+ line += ' ';
+ line += w;
+ });
+ lines.push(line);
+ return lines;
+}
+
+
+/**
+ * Transform an option name to a "key" that is used as the field
+ * on the `opts` object returned from `.parse()`.
+ *
+ * Transformations:
+ * - '-' -> '_': This allow one to use hyphen in option names (common)
+ * but not have to do silly things like `opt["dry-run"]` to access the
+ * parsed results.
+ */
+function optionKeyFromName(name) {
+ return name.replace(/-/g, '_');
+}
+
+
+
+// ---- Option types
+
+function parseBool(option, optstr, arg) {
+ return Boolean(arg);
+}
+
+function parseString(option, optstr, arg) {
+ assert.string(arg, 'arg');
+ return arg;
+}
+
+function parseNumber(option, optstr, arg) {
+ assert.string(arg, 'arg');
+ var num = Number(arg);
+ if (isNaN(num)) {
+ throw new Error(format('arg for "%s" is not a number: "%s"',
+ optstr, arg));
+ }
+ return num;
+}
+
+function parseInteger(option, optstr, arg) {
+ assert.string(arg, 'arg');
+ var num = Number(arg);
+ if (!/^[0-9-]+$/.test(arg) || isNaN(num)) {
+ throw new Error(format('arg for "%s" is not an integer: "%s"',
+ optstr, arg));
+ }
+ return num;
+}
+
+function parsePositiveInteger(option, optstr, arg) {
+ assert.string(arg, 'arg');
+ var num = Number(arg);
+ if (!/^[0-9]+$/.test(arg) || isNaN(num) || num === 0) {
+ throw new Error(format('arg for "%s" is not a positive integer: "%s"',
+ optstr, arg));
+ }
+ return num;
+}
+
+/**
+ * Supported date args:
+ * - epoch second times (e.g. 1396031701)
+ * - ISO 8601 format: YYYY-MM-DD[THH:MM:SS[.sss][Z]]
+ * 2014-03-28T18:35:01.489Z
+ * 2014-03-28T18:35:01.489
+ * 2014-03-28T18:35:01Z
+ * 2014-03-28T18:35:01
+ * 2014-03-28
+ */
+function parseDate(option, optstr, arg) {
+ assert.string(arg, 'arg');
+ var date;
+ if (/^\d+$/.test(arg)) {
+ // epoch seconds
+ date = new Date(Number(arg) * 1000);
+ /* JSSTYLED */
+ } else if (/^\d{4}-\d{2}-\d{2}(T\d{2}:\d{2}:\d{2}(\.\d+)?Z?)?$/i.test(arg)) {
+ // ISO 8601 format
+ date = new Date(arg);
+ } else {
+ throw new Error(format('arg for "%s" is not a valid date format: "%s"',
+ optstr, arg));
+ }
+ if (date.toString() === 'Invalid Date') {
+ throw new Error(format('arg for "%s" is an invalid date: "%s"',
+ optstr, arg));
+ }
+ return date;
+}
+
+var optionTypes = {
+ bool: {
+ takesArg: false,
+ parseArg: parseBool
+ },
+ string: {
+ takesArg: true,
+ helpArg: 'ARG',
+ parseArg: parseString
+ },
+ number: {
+ takesArg: true,
+ helpArg: 'NUM',
+ parseArg: parseNumber
+ },
+ integer: {
+ takesArg: true,
+ helpArg: 'INT',
+ parseArg: parseInteger
+ },
+ positiveInteger: {
+ takesArg: true,
+ helpArg: 'INT',
+ parseArg: parsePositiveInteger
+ },
+ date: {
+ takesArg: true,
+ helpArg: 'DATE',
+ parseArg: parseDate
+ },
+ arrayOfBool: {
+ takesArg: false,
+ array: true,
+ parseArg: parseBool
+ },
+ arrayOfString: {
+ takesArg: true,
+ helpArg: 'ARG',
+ array: true,
+ parseArg: parseString
+ },
+ arrayOfNumber: {
+ takesArg: true,
+ helpArg: 'NUM',
+ array: true,
+ parseArg: parseNumber
+ },
+ arrayOfInteger: {
+ takesArg: true,
+ helpArg: 'INT',
+ array: true,
+ parseArg: parseInteger
+ },
+ arrayOfPositiveInteger: {
+ takesArg: true,
+ helpArg: 'INT',
+ array: true,
+ parseArg: parsePositiveInteger
+ },
+ arrayOfDate: {
+ takesArg: true,
+ helpArg: 'INT',
+ array: true,
+ parseArg: parseDate
+ },
+};
+
+
+
+// ---- Parser
+
+/**
+ * Parser constructor.
+ *
+ * @param config {Object} The parser configuration
+ * - options {Array} Array of option specs. See the README for how to
+ * specify each option spec.
+ * - allowUnknown {Boolean} Default false. Whether to throw on unknown
+ * options. If false, then unknown args are included in the _args array.
+ * - interspersed {Boolean} Default true. Whether to allow interspersed
+ * arguments (non-options) and options. E.g.:
+ * node tool.js arg1 arg2 -v
+ * '-v' is after some args here. If `interspersed: false` then '-v'
+ * would not be parsed out. Note that regardless of `interspersed`
+ * the presence of '--' will stop option parsing, as all good
+ * option parsers should.
+ */
+function Parser(config) {
+ assert.object(config, 'config');
+ assert.arrayOfObject(config.options, 'config.options');
+ assert.optionalBool(config.interspersed, 'config.interspersed');
+ var self = this;
+
+ // Allow interspersed arguments (true by default).
+ this.interspersed = (config.interspersed !== undefined
+ ? config.interspersed : true);
+
+ // Don't allow unknown flags (true by default).
+ this.allowUnknown = (config.allowUnknown !== undefined
+ ? config.allowUnknown : false);
+
+ this.options = config.options.map(function (o) { return shallowCopy(o); });
+ this.optionFromName = {};
+ this.optionFromEnv = {};
+ for (var i = 0; i < this.options.length; i++) {
+ var o = this.options[i];
+ if (o.group !== undefined && o.group !== null) {
+ assert.optionalString(o.group,
+ format('config.options.%d.group', i));
+ continue;
+ }
+ assert.ok(optionTypes[o.type],
+ format('invalid config.options.%d.type: "%s" in %j',
+ i, o.type, o));
+ assert.optionalString(o.name, format('config.options.%d.name', i));
+ assert.optionalArrayOfString(o.names,
+ format('config.options.%d.names', i));
+ assert.ok((o.name || o.names) && !(o.name && o.names),
+ format('exactly one of "name" or "names" required: %j', o));
+ assert.optionalString(o.help, format('config.options.%d.help', i));
+ var env = o.env || [];
+ if (typeof (env) === 'string') {
+ env = [env];
+ }
+ assert.optionalArrayOfString(env, format('config.options.%d.env', i));
+ assert.optionalString(o.helpGroup,
+ format('config.options.%d.helpGroup', i));
+ assert.optionalBool(o.helpWrap,
+ format('config.options.%d.helpWrap', i));
+ assert.optionalBool(o.hidden, format('config.options.%d.hidden', i));
+
+ if (o.name) {
+ o.names = [o.name];
+ } else {
+ assert.string(o.names[0],
+ format('config.options.%d.names is empty', i));
+ }
+ o.key = optionKeyFromName(o.names[0]);
+ o.names.forEach(function (n) {
+ if (self.optionFromName[n]) {
+ throw new Error(format(
+ 'option name collision: "%s" used in %j and %j',
+ n, self.optionFromName[n], o));
+ }
+ self.optionFromName[n] = o;
+ });
+ env.forEach(function (n) {
+ if (self.optionFromEnv[n]) {
+ throw new Error(format(
+ 'option env collision: "%s" used in %j and %j',
+ n, self.optionFromEnv[n], o));
+ }
+ self.optionFromEnv[n] = o;
+ });
+ }
+}
+
+Parser.prototype.optionTakesArg = function optionTakesArg(option) {
+ return optionTypes[option.type].takesArg;
+};
+
+/**
+ * Parse options from the given argv.
+ *
+ * @param inputs {Object} Optional.
+ * - argv {Array} Optional. The argv to parse. Defaults to
+ * `process.argv`.
+ * - slice {Number} The index into argv at which options/args begin.
+ * Default is 2, as appropriate for `process.argv`.
+ * - env {Object} Optional. The env to use for 'env' entries in the
+ * option specs. Defaults to `process.env`.
+ * @returns {Object} Parsed `opts`. It has special keys `_args` (the
+ * remaining args from `argv`) and `_order` (gives the order that
+ * options were specified).
+ */
+Parser.prototype.parse = function parse(inputs) {
+ var self = this;
+
+ // Old API was `parse([argv, [slice]])`
+ if (Array.isArray(arguments[0])) {
+ inputs = {argv: arguments[0], slice: arguments[1]};
+ }
+
+ assert.optionalObject(inputs, 'inputs');
+ if (!inputs) {
+ inputs = {};
+ }
+ assert.optionalArrayOfString(inputs.argv, 'inputs.argv');
+ //assert.optionalNumber(slice, 'slice');
+ var argv = inputs.argv || process.argv;
+ var slice = inputs.slice !== undefined ? inputs.slice : 2;
+ var args = argv.slice(slice);
+ var env = inputs.env || process.env;
+ var opts = {};
+ var _order = [];
+
+ function addOpt(option, optstr, key, val, from) {
+ var type = optionTypes[option.type];
+ var parsedVal = type.parseArg(option, optstr, val);
+ if (type.array) {
+ if (!opts[key]) {
+ opts[key] = [];
+ }
+ if (type.arrayFlatten && Array.isArray(parsedVal)) {
+ for (var i = 0; i < parsedVal.length; i++) {
+ opts[key].push(parsedVal[i]);
+ }
+ } else {
+ opts[key].push(parsedVal);
+ }
+ } else {
+ opts[key] = parsedVal;
+ }
+ var item = { key: key, value: parsedVal, from: from };
+ _order.push(item);
+ }
+
+ // Parse args.
+ var _args = [];
+ var i = 0;
+ outer: while (i < args.length) {
+ var arg = args[i];
+
+ // End of options marker.
+ if (arg === '--') {
+ i++;
+ break;
+
+ // Long option
+ } else if (arg.slice(0, 2) === '--') {
+ var name = arg.slice(2);
+ var val = null;
+ var idx = name.indexOf('=');
+ if (idx !== -1) {
+ val = name.slice(idx + 1);
+ name = name.slice(0, idx);
+ }
+ var option = this.optionFromName[name];
+ if (!option) {
+ if (!this.allowUnknown)
+ throw new Error(format('unknown option: "--%s"', name));
+ else if (this.interspersed)
+ _args.push(arg);
+ else
+ break outer;
+ } else {
+ var takesArg = this.optionTakesArg(option);
+ if (val !== null && !takesArg) {
+ throw new Error(format('argument given to "--%s" option '
+ + 'that does not take one: "%s"', name, arg));
+ }
+ if (!takesArg) {
+ addOpt(option, '--'+name, option.key, true, 'argv');
+ } else if (val !== null) {
+ addOpt(option, '--'+name, option.key, val, 'argv');
+ } else if (i + 1 >= args.length) {
+ throw new Error(format('do not have enough args for "--%s" '
+ + 'option', name));
+ } else {
+ addOpt(option, '--'+name, option.key, args[i + 1], 'argv');
+ i++;
+ }
+ }
+
+ // Short option
+ } else if (arg[0] === '-' && arg.length > 1) {
+ var j = 1;
+ var allFound = true;
+ while (j < arg.length) {
+ var name = arg[j];
+ var option = this.optionFromName[name];
+ if (!option) {
+ allFound = false;
+ if (this.allowUnknown) {
+ if (this.interspersed) {
+ _args.push(arg);
+ break;
+ } else
+ break outer;
+ } else if (arg.length > 2) {
+ throw new Error(format(
+ 'unknown option: "-%s" in "%s" group',
+ name, arg));
+ } else {
+ throw new Error(format('unknown option: "-%s"', name));
+ }
+ } else if (this.optionTakesArg(option)) {
+ break;
+ }
+ j++;
+ }
+
+ j = 1;
+ while (allFound && j < arg.length) {
+ var name = arg[j];
+ var val = arg.slice(j + 1); // option val if it takes an arg
+ var option = this.optionFromName[name];
+ var takesArg = this.optionTakesArg(option);
+ if (!takesArg) {
+ addOpt(option, '-'+name, option.key, true, 'argv');
+ } else if (val) {
+ addOpt(option, '-'+name, option.key, val, 'argv');
+ break;
+ } else {
+ if (i + 1 >= args.length) {
+ throw new Error(format('do not have enough args '
+ + 'for "-%s" option', name));
+ }
+ addOpt(option, '-'+name, option.key, args[i + 1], 'argv');
+ i++;
+ break;
+ }
+ j++;
+ }
+
+ // An interspersed arg
+ } else if (this.interspersed) {
+ _args.push(arg);
+
+ // An arg and interspersed args are not allowed, so done options.
+ } else {
+ break outer;
+ }
+ i++;
+ }
+ _args = _args.concat(args.slice(i));
+
+ // Parse environment.
+ Object.keys(this.optionFromEnv).forEach(function (envname) {
+ var val = env[envname];
+ if (val === undefined)
+ return;
+ var option = self.optionFromEnv[envname];
+ if (opts[option.key] !== undefined)
+ return;
+ var takesArg = self.optionTakesArg(option);
+ if (takesArg) {
+ addOpt(option, envname, option.key, val, 'env');
+ } else if (val !== '') {
+ // Boolean envvar handling:
+ // - VAR= not set (as if the VAR was not set)
+ // - VAR=0 false
+ // - anything else true
+ addOpt(option, envname, option.key, (val !== '0'), 'env');
+ }
+ });
+
+ // Apply default values.
+ this.options.forEach(function (o) {
+ if (opts[o.key] === undefined) {
+ if (o.default !== undefined) {
+ opts[o.key] = o.default;
+ } else if (o.type && optionTypes[o.type].default !== undefined) {
+ opts[o.key] = optionTypes[o.type].default;
+ }
+ }
+ });
+
+ opts._order = _order;
+ opts._args = _args;
+ return opts;
+};
+
+
+/**
+ * Return help output for the current options.
+ *
+ * E.g.: if the current options are:
+ * [{names: ['help', 'h'], type: 'bool', help: 'Show help and exit.'}]
+ * then this would return:
+ * ' -h, --help Show help and exit.\n'
+ *
+ * @param config {Object} Config for controlling the option help output.
+ * - indent {Number|String} Default 4. An indent/prefix to use for
+ * each option line.
+ * - nameSort {String} Default is 'length'. By default the names are
+ * sorted to put the short opts first (i.e. '-h, --help' preferred
+ * to '--help, -h'). Set to 'none' to not do this sorting.
+ * - maxCol {Number} Default 80. Note that long tokens in a help string
+ * can go past this.
+ * - helpCol {Number} Set to specify a specific column at which
+ * option help will be aligned. By default this is determined
+ * automatically.
+ * - minHelpCol {Number} Default 20.
+ * - maxHelpCol {Number} Default 40.
+ * - includeEnv {Boolean} Default false. If true, a note stating the `env`
+ * envvar (if specified for this option) will be appended to the help
+ * output.
+ * - includeDefault {Boolean} Default false. If true, a note stating
+ * the `default` for this option, if any, will be appended to the help
+ * output.
+ * - helpWrap {Boolean} Default true. Wrap help text in helpCol..maxCol
+ * bounds.
+ * @returns {String}
+ */
+Parser.prototype.help = function help(config) {
+ config = config || {};
+ assert.object(config, 'config');
+
+ var indent = makeIndent(config.indent, 4, 'config.indent');
+ var headingIndent = makeIndent(config.headingIndent,
+ Math.round(indent.length / 2), 'config.headingIndent');
+
+ assert.optionalString(config.nameSort, 'config.nameSort');
+ var nameSort = config.nameSort || 'length';
+ assert.ok(~['length', 'none'].indexOf(nameSort),
+ 'invalid "config.nameSort"');
+ assert.optionalNumber(config.maxCol, 'config.maxCol');
+ assert.optionalNumber(config.maxHelpCol, 'config.maxHelpCol');
+ assert.optionalNumber(config.minHelpCol, 'config.minHelpCol');
+ assert.optionalNumber(config.helpCol, 'config.helpCol');
+ assert.optionalBool(config.includeEnv, 'config.includeEnv');
+ assert.optionalBool(config.includeDefault, 'config.includeDefault');
+ assert.optionalBool(config.helpWrap, 'config.helpWrap');
+ var maxCol = config.maxCol || 80;
+ var minHelpCol = config.minHelpCol || 20;
+ var maxHelpCol = config.maxHelpCol || 40;
+
+ var lines = [];
+ var maxWidth = 0;
+ this.options.forEach(function (o) {
+ if (o.hidden) {
+ return;
+ }
+ if (o.group !== undefined && o.group !== null) {
+ // We deal with groups in the next pass
+ lines.push(null);
+ return;
+ }
+ var type = optionTypes[o.type];
+ var arg = o.helpArg || type.helpArg || 'ARG';
+ var line = '';
+ var names = o.names.slice();
+ if (nameSort === 'length') {
+ names.sort(function (a, b) {
+ if (a.length < b.length)
+ return -1;
+ else if (b.length < a.length)
+ return 1;
+ else
+ return 0;
+ })
+ }
+ names.forEach(function (name, i) {
+ if (i > 0)
+ line += ', ';
+ if (name.length === 1) {
+ line += '-' + name
+ if (type.takesArg)
+ line += ' ' + arg;
+ } else {
+ line += '--' + name
+ if (type.takesArg)
+ line += '=' + arg;
+ }
+ });
+ maxWidth = Math.max(maxWidth, line.length);
+ lines.push(line);
+ });
+
+ // Add help strings.
+ var helpCol = config.helpCol;
+ if (!helpCol) {
+ helpCol = maxWidth + indent.length + 2;
+ helpCol = Math.min(Math.max(helpCol, minHelpCol), maxHelpCol);
+ }
+ var i = -1;
+ this.options.forEach(function (o) {
+ if (o.hidden) {
+ return;
+ }
+ i++;
+
+ if (o.group !== undefined && o.group !== null) {
+ if (o.group === '') {
+ // Support a empty string "group" to have a blank line between
+ // sets of options.
+ lines[i] = '';
+ } else {
+ // Render the group heading with the heading-specific indent.
+ lines[i] = (i === 0 ? '' : '\n') + headingIndent +
+ o.group + ':';
+ }
+ return;
+ }
+
+ var helpDefault;
+ if (config.includeDefault) {
+ if (o.default !== undefined) {
+ helpDefault = format('Default: %j', o.default);
+ } else if (o.type && optionTypes[o.type].default !== undefined) {
+ helpDefault = format('Default: %j',
+ optionTypes[o.type].default);
+ }
+ }
+
+ var line = lines[i] = indent + lines[i];
+ if (!o.help && !(config.includeEnv && o.env) && !helpDefault) {
+ return;
+ }
+ var n = helpCol - line.length;
+ if (n >= 0) {
+ line += space(n);
+ } else {
+ line += '\n' + space(helpCol);
+ }
+
+ var helpEnv = '';
+ if (o.env && o.env.length && config.includeEnv) {
+ helpEnv += 'Environment: ';
+ var type = optionTypes[o.type];
+ var arg = o.helpArg || type.helpArg || 'ARG';
+ var envs = (Array.isArray(o.env) ? o.env : [o.env]).map(
+ function (e) {
+ if (type.takesArg) {
+ return e + '=' + arg;
+ } else {
+ return e + '=1';
+ }
+ }
+ );
+ helpEnv += envs.join(', ');
+ }
+ var help = (o.help || '').trim();
+ if (o.helpWrap !== false && config.helpWrap !== false) {
+ // Wrap help description normally.
+ if (help.length && !~'.!?"\''.indexOf(help.slice(-1))) {
+ help += '.';
+ }
+ if (help.length) {
+ help += ' ';
+ }
+ help += helpEnv;
+ if (helpDefault) {
+ if (helpEnv) {
+ help += '. ';
+ }
+ help += helpDefault;
+ }
+ line += textwrap(help, maxCol - helpCol).join(
+ '\n' + space(helpCol));
+ } else {
+ // Do not wrap help description, but indent newlines appropriately.
+ var helpLines = help.split('\n').filter(
+ function (ln) { return ln.length });
+ if (helpEnv !== '') {
+ helpLines.push(helpEnv);
+ }
+ if (helpDefault) {
+ helpLines.push(helpDefault);
+ }
+ line += helpLines.join('\n' + space(helpCol));
+ }
+
+ lines[i] = line;
+ });
+
+ var rv = '';
+ if (lines.length > 0) {
+ rv = lines.join('\n') + '\n';
+ }
+ return rv;
+};
+
+
+/**
+ * Return a string suitable for a Bash completion file for this tool.
+ *
+ * @param args.name {String} The tool name.
+ * @param args.specExtra {String} Optional. Extra Bash code content to add
+ * to the end of the "spec". Typically this is used to append Bash
+ * "complete_TYPE" functions for custom option types. See
+ * "examples/ddcompletion.js" for an example.
+ * @param args.argtypes {Array} Optional. Array of completion types for
+ * positional args (i.e. non-options). E.g.
+ * argtypes = ['fruit', 'veggie', 'file']
+ * will result in completion of fruits for the first arg, veggies for the
+ * second, and filenames for the third and subsequent positional args.
+ * If not given, positional args will use Bash's 'default' completion.
+ * See `specExtra` for providing Bash `complete_TYPE` functions, e.g.
+ * `complete_fruit` and `complete_veggie` in this example.
+ */
+Parser.prototype.bashCompletion = function bashCompletion(args) {
+ assert.object(args, 'args');
+ assert.string(args.name, 'args.name');
+ assert.optionalString(args.specExtra, 'args.specExtra');
+ assert.optionalArrayOfString(args.argtypes, 'args.argtypes');
+
+ return bashCompletionFromOptions({
+ name: args.name,
+ specExtra: args.specExtra,
+ argtypes: args.argtypes,
+ options: this.options
+ });
+};
+
+
+// ---- Bash completion
+
+const BASH_COMPLETION_TEMPLATE_PATH = path.join(
+ __dirname, '../etc/dashdash.bash_completion.in');
+
+/**
+ * Return the Bash completion "spec" (the string value for the "{{spec}}"
+ * var in the "dashdash.bash_completion.in" template) for this tool.
+ *
+ * The "spec" is Bash code that defines the CLI options and subcmds for
+ * the template's completion code. It looks something like this:
+ *
+ * local cmd_shortopts="-J ..."
+ * local cmd_longopts="--help ..."
+ * local cmd_optargs="-p=tritonprofile ..."
+ *
+ * @param args.options {Array} The array of dashdash option specs.
+ * @param args.context {String} Optional. A context string for the "local cmd*"
+ * vars in the spec. By default it is the empty string. When used to
+ * scope for completion on a *sub-command* (e.g. for "git log" on a "git"
+ * tool), then it would have a value (e.g. "__log"). See
+ * Bash completion for details.
+ * @param opts.includeHidden {Boolean} Optional. Default false. By default
+ * hidden options and subcmds are "excluded". Here excluded means they
+ * won't be offered as a completion, but if used, their argument type
+ * will be completed. "Hidden" options and subcmds are ones with the
+ * `hidden: true` attribute to exclude them from default help output.
+ * @param args.argtypes {Array} Optional. Array of completion types for
+ * positional args (i.e. non-options). E.g.
+ * argtypes = ['fruit', 'veggie', 'file']
+ * will result in completion of fruits for the first arg, veggies for the
+ * second, and filenames for the third and subsequent positional args.
+ * If not given, positional args will use Bash's 'default' completion.
+ * See `specExtra` for providing Bash `complete_TYPE` functions, e.g.
+ * `complete_fruit` and `complete_veggie` in this example.
+ */
+function bashCompletionSpecFromOptions(args) {
+ assert.object(args, 'args');
+ assert.object(args.options, 'args.options');
+ assert.optionalString(args.context, 'args.context');
+ assert.optionalBool(args.includeHidden, 'args.includeHidden');
+ assert.optionalArrayOfString(args.argtypes, 'args.argtypes');
+
+ var context = args.context || '';
+ var includeHidden = (args.includeHidden === undefined
+ ? false : args.includeHidden);
+
+ var spec = [];
+ var shortopts = [];
+ var longopts = [];
+ var optargs = [];
+ (args.options || []).forEach(function (o) {
+ if (o.group !== undefined && o.group !== null) {
+ // Skip group headers.
+ return;
+ }
+
+ var optNames = o.names || [o.name];
+ var optType = getOptionType(o.type);
+ if (optType.takesArg) {
+ var completionType = o.completionType ||
+ optType.completionType || o.type;
+ optNames.forEach(function (optName) {
+ if (optName.length === 1) {
+ if (includeHidden || !o.hidden) {
+ shortopts.push('-' + optName);
+ }
+ // Include even hidden options in `optargs` so that bash
+ // completion of its arg still works.
+ optargs.push('-' + optName + '=' + completionType);
+ } else {
+ if (includeHidden || !o.hidden) {
+ longopts.push('--' + optName);
+ }
+ optargs.push('--' + optName + '=' + completionType);
+ }
+ });
+ } else {
+ optNames.forEach(function (optName) {
+ if (includeHidden || !o.hidden) {
+ if (optName.length === 1) {
+ shortopts.push('-' + optName);
+ } else {
+ longopts.push('--' + optName);
+ }
+ }
+ });
+ }
+ });
+
+ spec.push(format('local cmd%s_shortopts="%s"',
+ context, shortopts.sort().join(' ')));
+ spec.push(format('local cmd%s_longopts="%s"',
+ context, longopts.sort().join(' ')));
+ spec.push(format('local cmd%s_optargs="%s"',
+ context, optargs.sort().join(' ')));
+ if (args.argtypes) {
+ spec.push(format('local cmd%s_argtypes="%s"',
+ context, args.argtypes.join(' ')));
+ }
+ return spec.join('\n');
+}
+
+
+/**
+ * Return a string suitable for a Bash completion file for this tool.
+ *
+ * @param args.name {String} The tool name.
+ * @param args.options {Array} The array of dashdash option specs.
+ * @param args.specExtra {String} Optional. Extra Bash code content to add
+ * to the end of the "spec". Typically this is used to append Bash
+ * "complete_TYPE" functions for custom option types. See
+ * "examples/ddcompletion.js" for an example.
+ * @param args.argtypes {Array} Optional. Array of completion types for
+ * positional args (i.e. non-options). E.g.
+ * argtypes = ['fruit', 'veggie', 'file']
+ * will result in completion of fruits for the first arg, veggies for the
+ * second, and filenames for the third and subsequent positional args.
+ * If not given, positional args will use Bash's 'default' completion.
+ * See `specExtra` for providing Bash `complete_TYPE` functions, e.g.
+ * `complete_fruit` and `complete_veggie` in this example.
+ */
+function bashCompletionFromOptions(args) {
+ assert.object(args, 'args');
+ assert.object(args.options, 'args.options');
+ assert.string(args.name, 'args.name');
+ assert.optionalString(args.specExtra, 'args.specExtra');
+ assert.optionalArrayOfString(args.argtypes, 'args.argtypes');
+
+ // Gather template data.
+ var data = {
+ name: args.name,
+ date: new Date(),
+ spec: bashCompletionSpecFromOptions({
+ options: args.options,
+ argtypes: args.argtypes
+ }),
+ };
+ if (args.specExtra) {
+ data.spec += '\n\n' + args.specExtra;
+ }
+
+ // Render template.
+ var template = fs.readFileSync(BASH_COMPLETION_TEMPLATE_PATH, 'utf8');
+ return renderTemplate(template, data);
+}
+
+
+
+// ---- exports
+
+function createParser(config) {
+ return new Parser(config);
+}
+
+/**
+ * Parse argv with the given options.
+ *
+ * @param config {Object} A merge of all the available fields from
+ * `dashdash.Parser` and `dashdash.Parser.parse`: options, interspersed,
+ * argv, env, slice.
+ */
+function parse(config) {
+ assert.object(config, 'config');
+ assert.optionalArrayOfString(config.argv, 'config.argv');
+ assert.optionalObject(config.env, 'config.env');
+ var config = shallowCopy(config);
+ var argv = config.argv;
+ delete config.argv;
+ var env = config.env;
+ delete config.env;
+
+ var parser = new Parser(config);
+ return parser.parse({argv: argv, env: env});
+}
+
+
+/**
+ * Add a new option type.
+ *
+ * @params optionType {Object}:
+ * - name {String} Required.
+ * - takesArg {Boolean} Required. Whether this type of option takes an
+ * argument on process.argv. Typically this is true for all but the
+ * "bool" type.
+ * - helpArg {String} Required iff `takesArg === true`. The string to
+ * show in generated help for options of this type.
+ * - parseArg {Function} Require. `function (option, optstr, arg)` parser
+ * that takes a string argument and returns an instance of the
+ * appropriate type, or throws an error if the arg is invalid.
+ * - array {Boolean} Optional. Set to true if this is an 'arrayOf' type
+ * that collects multiple usages of the option in process.argv and
+ * puts results in an array.
+ * - arrayFlatten {Boolean} Optional. XXX
+ * - default Optional. Default value for options of this type, if no
+ * default is specified in the option type usage.
+ */
+function addOptionType(optionType) {
+ assert.object(optionType, 'optionType');
+ assert.string(optionType.name, 'optionType.name');
+ assert.bool(optionType.takesArg, 'optionType.takesArg');
+ if (optionType.takesArg) {
+ assert.string(optionType.helpArg, 'optionType.helpArg');
+ }
+ assert.func(optionType.parseArg, 'optionType.parseArg');
+ assert.optionalBool(optionType.array, 'optionType.array');
+ assert.optionalBool(optionType.arrayFlatten, 'optionType.arrayFlatten');
+
+ optionTypes[optionType.name] = {
+ takesArg: optionType.takesArg,
+ helpArg: optionType.helpArg,
+ parseArg: optionType.parseArg,
+ array: optionType.array,
+ arrayFlatten: optionType.arrayFlatten,
+ default: optionType.default
+ }
+}
+
+
+function getOptionType(name) {
+ assert.string(name, 'name');
+ return optionTypes[name];
+}
+
+
+/**
+ * Return a synopsis string for the given option spec.
+ *
+ * Examples:
+ * > synopsisFromOpt({names: ['help', 'h'], type: 'bool'});
+ * '[ --help | -h ]'
+ * > synopsisFromOpt({name: 'file', type: 'string', helpArg: 'FILE'});
+ * '[ --file=FILE ]'
+ */
+function synopsisFromOpt(o) {
+ assert.object(o, 'o');
+
+ if (o.hasOwnProperty('group')) {
+ return null;
+ }
+ var names = o.names || [o.name];
+ // `type` here could be undefined if, for example, the command has a
+ // dashdash option spec with a bogus 'type'.
+ var type = getOptionType(o.type);
+ var helpArg = o.helpArg || (type && type.helpArg) || 'ARG';
+ var parts = [];
+ names.forEach(function (name) {
+ var part = (name.length === 1 ? '-' : '--') + name;
+ if (type && type.takesArg) {
+ part += (name.length === 1 ? ' ' + helpArg : '=' + helpArg);
+ }
+ parts.push(part);
+ });
+ return ('[ ' + parts.join(' | ') + ' ]');
+};
+
+
+module.exports = {
+ createParser: createParser,
+ Parser: Parser,
+ parse: parse,
+ addOptionType: addOptionType,
+ getOptionType: getOptionType,
+ synopsisFromOpt: synopsisFromOpt,
+
+ // Bash completion-related exports
+ BASH_COMPLETION_TEMPLATE_PATH: BASH_COMPLETION_TEMPLATE_PATH,
+ bashCompletionFromOptions: bashCompletionFromOptions,
+ bashCompletionSpecFromOptions: bashCompletionSpecFromOptions,
+
+ // Export the parseFoo parsers because they might be useful as primitives
+ // for custom option types.
+ parseBool: parseBool,
+ parseString: parseString,
+ parseNumber: parseNumber,
+ parseInteger: parseInteger,
+ parsePositiveInteger: parsePositiveInteger,
+ parseDate: parseDate
+};
diff --git a/website_quotation_template/node_modules/dashdash/package.json b/website_quotation_template/node_modules/dashdash/package.json
new file mode 100644
index 000000000..b78c1644f
--- /dev/null
+++ b/website_quotation_template/node_modules/dashdash/package.json
@@ -0,0 +1,67 @@
+{
+ "_from": "dashdash@^1.12.0",
+ "_id": "dashdash@1.14.1",
+ "_inBundle": false,
+ "_integrity": "sha512-jRFi8UDGo6j+odZiEpjazZaWqEal3w/basFjQHQEwVtZJGDpxbH1MeYluwCS8Xq5wmLJooDlMgvVarmWfGM44g==",
+ "_location": "/dashdash",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "dashdash@^1.12.0",
+ "name": "dashdash",
+ "escapedName": "dashdash",
+ "rawSpec": "^1.12.0",
+ "saveSpec": null,
+ "fetchSpec": "^1.12.0"
+ },
+ "_requiredBy": [
+ "/sshpk"
+ ],
+ "_resolved": "https://registry.npmjs.org/dashdash/-/dashdash-1.14.1.tgz",
+ "_shasum": "853cfa0f7cbe2fed5de20326b8dd581035f6e2f0",
+ "_spec": "dashdash@^1.12.0",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/sshpk",
+ "author": {
+ "name": "Trent Mick",
+ "email": "trentm@gmail.com",
+ "url": "http://trentm.com"
+ },
+ "bugs": {
+ "url": "https://github.com/trentm/node-dashdash/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {
+ "assert-plus": "^1.0.0"
+ },
+ "deprecated": false,
+ "description": "A light, featureful and explicit option parsing library.",
+ "devDependencies": {
+ "nodeunit": "0.9.x"
+ },
+ "engines": {
+ "node": ">=0.10"
+ },
+ "homepage": "https://github.com/trentm/node-dashdash#readme",
+ "keywords": [
+ "option",
+ "parser",
+ "parsing",
+ "cli",
+ "command",
+ "args",
+ "bash",
+ "completion"
+ ],
+ "license": "MIT",
+ "main": "./lib/dashdash.js",
+ "name": "dashdash",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/trentm/node-dashdash.git"
+ },
+ "scripts": {
+ "test": "nodeunit test/*.test.js"
+ },
+ "version": "1.14.1"
+}
diff --git a/website_quotation_template/node_modules/debug/.coveralls.yml b/website_quotation_template/node_modules/debug/.coveralls.yml
new file mode 100644
index 000000000..20a706858
--- /dev/null
+++ b/website_quotation_template/node_modules/debug/.coveralls.yml
@@ -0,0 +1 @@
+repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve
diff --git a/website_quotation_template/node_modules/debug/.eslintrc b/website_quotation_template/node_modules/debug/.eslintrc
new file mode 100644
index 000000000..8a37ae2c2
--- /dev/null
+++ b/website_quotation_template/node_modules/debug/.eslintrc
@@ -0,0 +1,11 @@
+{
+ "env": {
+ "browser": true,
+ "node": true
+ },
+ "rules": {
+ "no-console": 0,
+ "no-empty": [1, { "allowEmptyCatch": true }]
+ },
+ "extends": "eslint:recommended"
+}
diff --git a/website_quotation_template/node_modules/debug/.npmignore b/website_quotation_template/node_modules/debug/.npmignore
new file mode 100644
index 000000000..5f60eecc8
--- /dev/null
+++ b/website_quotation_template/node_modules/debug/.npmignore
@@ -0,0 +1,9 @@
+support
+test
+examples
+example
+*.sock
+dist
+yarn.lock
+coverage
+bower.json
diff --git a/website_quotation_template/node_modules/debug/.travis.yml b/website_quotation_template/node_modules/debug/.travis.yml
new file mode 100644
index 000000000..6c6090c3b
--- /dev/null
+++ b/website_quotation_template/node_modules/debug/.travis.yml
@@ -0,0 +1,14 @@
+
+language: node_js
+node_js:
+ - "6"
+ - "5"
+ - "4"
+
+install:
+ - make node_modules
+
+script:
+ - make lint
+ - make test
+ - make coveralls
diff --git a/website_quotation_template/node_modules/debug/CHANGELOG.md b/website_quotation_template/node_modules/debug/CHANGELOG.md
new file mode 100644
index 000000000..eadaa1895
--- /dev/null
+++ b/website_quotation_template/node_modules/debug/CHANGELOG.md
@@ -0,0 +1,362 @@
+
+2.6.9 / 2017-09-22
+==================
+
+ * remove ReDoS regexp in %o formatter (#504)
+
+2.6.8 / 2017-05-18
+==================
+
+ * Fix: Check for undefined on browser globals (#462, @marbemac)
+
+2.6.7 / 2017-05-16
+==================
+
+ * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom)
+ * Fix: Inline extend function in node implementation (#452, @dougwilson)
+ * Docs: Fix typo (#455, @msasad)
+
+2.6.5 / 2017-04-27
+==================
+
+ * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek)
+ * Misc: clean up browser reference checks (#447, @thebigredgeek)
+ * Misc: add npm-debug.log to .gitignore (@thebigredgeek)
+
+
+2.6.4 / 2017-04-20
+==================
+
+ * Fix: bug that would occure if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo)
+ * Chore: ignore bower.json in npm installations. (#437, @joaovieira)
+ * Misc: update "ms" to v0.7.3 (@tootallnate)
+
+2.6.3 / 2017-03-13
+==================
+
+ * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts)
+ * Docs: Changelog fix (@thebigredgeek)
+
+2.6.2 / 2017-03-10
+==================
+
+ * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin)
+ * Docs: Add backers and sponsors from Open Collective (#422, @piamancini)
+ * Docs: Add Slackin invite badge (@tootallnate)
+
+2.6.1 / 2017-02-10
+==================
+
+ * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error
+ * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0)
+ * Fix: IE8 "Expected identifier" error (#414, @vgoma)
+ * Fix: Namespaces would not disable once enabled (#409, @musikov)
+
+2.6.0 / 2016-12-28
+==================
+
+ * Fix: added better null pointer checks for browser useColors (@thebigredgeek)
+ * Improvement: removed explicit `window.debug` export (#404, @tootallnate)
+ * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate)
+
+2.5.2 / 2016-12-25
+==================
+
+ * Fix: reference error on window within webworkers (#393, @KlausTrainer)
+ * Docs: fixed README typo (#391, @lurch)
+ * Docs: added notice about v3 api discussion (@thebigredgeek)
+
+2.5.1 / 2016-12-20
+==================
+
+ * Fix: babel-core compatibility
+
+2.5.0 / 2016-12-20
+==================
+
+ * Fix: wrong reference in bower file (@thebigredgeek)
+ * Fix: webworker compatibility (@thebigredgeek)
+ * Fix: output formatting issue (#388, @kribblo)
+ * Fix: babel-loader compatibility (#383, @escwald)
+ * Misc: removed built asset from repo and publications (@thebigredgeek)
+ * Misc: moved source files to /src (#378, @yamikuronue)
+ * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue)
+ * Test: coveralls integration (#378, @yamikuronue)
+ * Docs: simplified language in the opening paragraph (#373, @yamikuronue)
+
+2.4.5 / 2016-12-17
+==================
+
+ * Fix: `navigator` undefined in Rhino (#376, @jochenberger)
+ * Fix: custom log function (#379, @hsiliev)
+ * Improvement: bit of cleanup + linting fixes (@thebigredgeek)
+ * Improvement: rm non-maintainted `dist/` dir (#375, @freewil)
+ * Docs: simplified language in the opening paragraph. (#373, @yamikuronue)
+
+2.4.4 / 2016-12-14
+==================
+
+ * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts)
+
+2.4.3 / 2016-12-14
+==================
+
+ * Fix: navigation.userAgent error for react native (#364, @escwald)
+
+2.4.2 / 2016-12-14
+==================
+
+ * Fix: browser colors (#367, @tootallnate)
+ * Misc: travis ci integration (@thebigredgeek)
+ * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek)
+
+2.4.1 / 2016-12-13
+==================
+
+ * Fix: typo that broke the package (#356)
+
+2.4.0 / 2016-12-13
+==================
+
+ * Fix: bower.json references unbuilt src entry point (#342, @justmatt)
+ * Fix: revert "handle regex special characters" (@tootallnate)
+ * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate)
+ * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate)
+ * Improvement: allow colors in workers (#335, @botverse)
+ * Improvement: use same color for same namespace. (#338, @lchenay)
+
+2.3.3 / 2016-11-09
+==================
+
+ * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne)
+ * Fix: Returning `localStorage` saved values (#331, Levi Thomason)
+ * Improvement: Don't create an empty object when no `process` (Nathan Rajlich)
+
+2.3.2 / 2016-11-09
+==================
+
+ * Fix: be super-safe in index.js as well (@TooTallNate)
+ * Fix: should check whether process exists (Tom Newby)
+
+2.3.1 / 2016-11-09
+==================
+
+ * Fix: Added electron compatibility (#324, @paulcbetts)
+ * Improvement: Added performance optimizations (@tootallnate)
+ * Readme: Corrected PowerShell environment variable example (#252, @gimre)
+ * Misc: Removed yarn lock file from source control (#321, @fengmk2)
+
+2.3.0 / 2016-11-07
+==================
+
+ * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic)
+ * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos)
+ * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15)
+ * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran)
+ * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom)
+ * Package: Update "ms" to 0.7.2 (#315, @DevSide)
+ * Package: removed superfluous version property from bower.json (#207 @kkirsche)
+ * Readme: fix USE_COLORS to DEBUG_COLORS
+ * Readme: Doc fixes for format string sugar (#269, @mlucool)
+ * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0)
+ * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable)
+ * Readme: better docs for browser support (#224, @matthewmueller)
+ * Tooling: Added yarn integration for development (#317, @thebigredgeek)
+ * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek)
+ * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman)
+ * Misc: Updated contributors (@thebigredgeek)
+
+2.2.0 / 2015-05-09
+==================
+
+ * package: update "ms" to v0.7.1 (#202, @dougwilson)
+ * README: add logging to file example (#193, @DanielOchoa)
+ * README: fixed a typo (#191, @amir-s)
+ * browser: expose `storage` (#190, @stephenmathieson)
+ * Makefile: add a `distclean` target (#189, @stephenmathieson)
+
+2.1.3 / 2015-03-13
+==================
+
+ * Updated stdout/stderr example (#186)
+ * Updated example/stdout.js to match debug current behaviour
+ * Renamed example/stderr.js to stdout.js
+ * Update Readme.md (#184)
+ * replace high intensity foreground color for bold (#182, #183)
+
+2.1.2 / 2015-03-01
+==================
+
+ * dist: recompile
+ * update "ms" to v0.7.0
+ * package: update "browserify" to v9.0.3
+ * component: fix "ms.js" repo location
+ * changed bower package name
+ * updated documentation about using debug in a browser
+ * fix: security error on safari (#167, #168, @yields)
+
+2.1.1 / 2014-12-29
+==================
+
+ * browser: use `typeof` to check for `console` existence
+ * browser: check for `console.log` truthiness (fix IE 8/9)
+ * browser: add support for Chrome apps
+ * Readme: added Windows usage remarks
+ * Add `bower.json` to properly support bower install
+
+2.1.0 / 2014-10-15
+==================
+
+ * node: implement `DEBUG_FD` env variable support
+ * package: update "browserify" to v6.1.0
+ * package: add "license" field to package.json (#135, @panuhorsmalahti)
+
+2.0.0 / 2014-09-01
+==================
+
+ * package: update "browserify" to v5.11.0
+ * node: use stderr rather than stdout for logging (#29, @stephenmathieson)
+
+1.0.4 / 2014-07-15
+==================
+
+ * dist: recompile
+ * example: remove `console.info()` log usage
+ * example: add "Content-Type" UTF-8 header to browser example
+ * browser: place %c marker after the space character
+ * browser: reset the "content" color via `color: inherit`
+ * browser: add colors support for Firefox >= v31
+ * debug: prefer an instance `log()` function over the global one (#119)
+ * Readme: update documentation about styled console logs for FF v31 (#116, @wryk)
+
+1.0.3 / 2014-07-09
+==================
+
+ * Add support for multiple wildcards in namespaces (#122, @seegno)
+ * browser: fix lint
+
+1.0.2 / 2014-06-10
+==================
+
+ * browser: update color palette (#113, @gscottolson)
+ * common: make console logging function configurable (#108, @timoxley)
+ * node: fix %o colors on old node <= 0.8.x
+ * Makefile: find node path using shell/which (#109, @timoxley)
+
+1.0.1 / 2014-06-06
+==================
+
+ * browser: use `removeItem()` to clear localStorage
+ * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777)
+ * package: add "contributors" section
+ * node: fix comment typo
+ * README: list authors
+
+1.0.0 / 2014-06-04
+==================
+
+ * make ms diff be global, not be scope
+ * debug: ignore empty strings in enable()
+ * node: make DEBUG_COLORS able to disable coloring
+ * *: export the `colors` array
+ * npmignore: don't publish the `dist` dir
+ * Makefile: refactor to use browserify
+ * package: add "browserify" as a dev dependency
+ * Readme: add Web Inspector Colors section
+ * node: reset terminal color for the debug content
+ * node: map "%o" to `util.inspect()`
+ * browser: map "%j" to `JSON.stringify()`
+ * debug: add custom "formatters"
+ * debug: use "ms" module for humanizing the diff
+ * Readme: add "bash" syntax highlighting
+ * browser: add Firebug color support
+ * browser: add colors for WebKit browsers
+ * node: apply log to `console`
+ * rewrite: abstract common logic for Node & browsers
+ * add .jshintrc file
+
+0.8.1 / 2014-04-14
+==================
+
+ * package: re-add the "component" section
+
+0.8.0 / 2014-03-30
+==================
+
+ * add `enable()` method for nodejs. Closes #27
+ * change from stderr to stdout
+ * remove unnecessary index.js file
+
+0.7.4 / 2013-11-13
+==================
+
+ * remove "browserify" key from package.json (fixes something in browserify)
+
+0.7.3 / 2013-10-30
+==================
+
+ * fix: catch localStorage security error when cookies are blocked (Chrome)
+ * add debug(err) support. Closes #46
+ * add .browser prop to package.json. Closes #42
+
+0.7.2 / 2013-02-06
+==================
+
+ * fix package.json
+ * fix: Mobile Safari (private mode) is broken with debug
+ * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript
+
+0.7.1 / 2013-02-05
+==================
+
+ * add repository URL to package.json
+ * add DEBUG_COLORED to force colored output
+ * add browserify support
+ * fix component. Closes #24
+
+0.7.0 / 2012-05-04
+==================
+
+ * Added .component to package.json
+ * Added debug.component.js build
+
+0.6.0 / 2012-03-16
+==================
+
+ * Added support for "-" prefix in DEBUG [Vinay Pulim]
+ * Added `.enabled` flag to the node version [TooTallNate]
+
+0.5.0 / 2012-02-02
+==================
+
+ * Added: humanize diffs. Closes #8
+ * Added `debug.disable()` to the CS variant
+ * Removed padding. Closes #10
+ * Fixed: persist client-side variant again. Closes #9
+
+0.4.0 / 2012-02-01
+==================
+
+ * Added browser variant support for older browsers [TooTallNate]
+ * Added `debug.enable('project:*')` to browser variant [TooTallNate]
+ * Added padding to diff (moved it to the right)
+
+0.3.0 / 2012-01-26
+==================
+
+ * Added millisecond diff when isatty, otherwise UTC string
+
+0.2.0 / 2012-01-22
+==================
+
+ * Added wildcard support
+
+0.1.0 / 2011-12-02
+==================
+
+ * Added: remove colors unless stderr isatty [TooTallNate]
+
+0.0.1 / 2010-01-03
+==================
+
+ * Initial release
diff --git a/website_quotation_template/node_modules/debug/LICENSE b/website_quotation_template/node_modules/debug/LICENSE
new file mode 100644
index 000000000..658c933d2
--- /dev/null
+++ b/website_quotation_template/node_modules/debug/LICENSE
@@ -0,0 +1,19 @@
+(The MIT License)
+
+Copyright (c) 2014 TJ Holowaychuk
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of this software
+and associated documentation files (the 'Software'), to deal in the Software without restriction,
+including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense,
+and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so,
+subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all copies or substantial
+portions of the Software.
+
+THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT
+LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT.
+IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY,
+WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE
+SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE.
+
diff --git a/website_quotation_template/node_modules/debug/Makefile b/website_quotation_template/node_modules/debug/Makefile
new file mode 100644
index 000000000..584da8bf9
--- /dev/null
+++ b/website_quotation_template/node_modules/debug/Makefile
@@ -0,0 +1,50 @@
+# get Makefile directory name: http://stackoverflow.com/a/5982798/376773
+THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST))
+THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd)
+
+# BIN directory
+BIN := $(THIS_DIR)/node_modules/.bin
+
+# Path
+PATH := node_modules/.bin:$(PATH)
+SHELL := /bin/bash
+
+# applications
+NODE ?= $(shell which node)
+YARN ?= $(shell which yarn)
+PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm))
+BROWSERIFY ?= $(NODE) $(BIN)/browserify
+
+.FORCE:
+
+install: node_modules
+
+node_modules: package.json
+ @NODE_ENV= $(PKG) install
+ @touch node_modules
+
+lint: .FORCE
+ eslint browser.js debug.js index.js node.js
+
+test-node: .FORCE
+ istanbul cover node_modules/mocha/bin/_mocha -- test/**.js
+
+test-browser: .FORCE
+ mkdir -p dist
+
+ @$(BROWSERIFY) \
+ --standalone debug \
+ . > dist/debug.js
+
+ karma start --single-run
+ rimraf dist
+
+test: .FORCE
+ concurrently \
+ "make test-node" \
+ "make test-browser"
+
+coveralls:
+ cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js
+
+.PHONY: all install clean distclean
diff --git a/website_quotation_template/node_modules/debug/README.md b/website_quotation_template/node_modules/debug/README.md
new file mode 100644
index 000000000..f67be6b31
--- /dev/null
+++ b/website_quotation_template/node_modules/debug/README.md
@@ -0,0 +1,312 @@
+# debug
+[](https://travis-ci.org/visionmedia/debug) [](https://coveralls.io/github/visionmedia/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers)
+[](#sponsors)
+
+
+
+A tiny node.js debugging utility modelled after node core's debugging technique.
+
+**Discussion around the V3 API is under way [here](https://github.com/visionmedia/debug/issues/370)**
+
+## Installation
+
+```bash
+$ npm install debug
+```
+
+## Usage
+
+`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole.
+
+Example _app.js_:
+
+```js
+var debug = require('debug')('http')
+ , http = require('http')
+ , name = 'My App';
+
+// fake app
+
+debug('booting %s', name);
+
+http.createServer(function(req, res){
+ debug(req.method + ' ' + req.url);
+ res.end('hello\n');
+}).listen(3000, function(){
+ debug('listening');
+});
+
+// fake worker of some kind
+
+require('./worker');
+```
+
+Example _worker.js_:
+
+```js
+var debug = require('debug')('worker');
+
+setInterval(function(){
+ debug('doing some work');
+}, 1000);
+```
+
+ The __DEBUG__ environment variable is then used to enable these based on space or comma-delimited names. Here are some examples:
+
+ 
+
+ 
+
+#### Windows note
+
+ On Windows the environment variable is set using the `set` command.
+
+ ```cmd
+ set DEBUG=*,-not_this
+ ```
+
+ Note that PowerShell uses different syntax to set environment variables.
+
+ ```cmd
+ $env:DEBUG = "*,-not_this"
+ ```
+
+Then, run the program to be debugged as usual.
+
+## Millisecond diff
+
+ When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls.
+
+ 
+
+ When stdout is not a TTY, `Date#toUTCString()` is used, making it more useful for logging the debug information as shown below:
+
+ 
+
+## Conventions
+
+ If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser".
+
+## Wildcards
+
+ The `*` character may be used as a wildcard. Suppose for example your library has debuggers named "connect:bodyParser", "connect:compress", "connect:session", instead of listing all three with `DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do `DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`.
+
+ You can also exclude specific debuggers by prefixing them with a "-" character. For example, `DEBUG=*,-connect:*` would include all debuggers except those starting with "connect:".
+
+## Environment Variables
+
+ When running through Node.js, you can set a few environment variables that will
+ change the behavior of the debug logging:
+
+| Name | Purpose |
+|-----------|-------------------------------------------------|
+| `DEBUG` | Enables/disables specific debugging namespaces. |
+| `DEBUG_COLORS`| Whether or not to use colors in the debug output. |
+| `DEBUG_DEPTH` | Object inspection depth. |
+| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. |
+
+
+ __Note:__ The environment variables beginning with `DEBUG_` end up being
+ converted into an Options object that gets used with `%o`/`%O` formatters.
+ See the Node.js documentation for
+ [`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options)
+ for the complete list.
+
+## Formatters
+
+
+ Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. Below are the officially supported formatters:
+
+| Formatter | Representation |
+|-----------|----------------|
+| `%O` | Pretty-print an Object on multiple lines. |
+| `%o` | Pretty-print an Object all on a single line. |
+| `%s` | String. |
+| `%d` | Number (both integer and float). |
+| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. |
+| `%%` | Single percent sign ('%'). This does not consume an argument. |
+
+### Custom formatters
+
+ You can add custom formatters by extending the `debug.formatters` object. For example, if you wanted to add support for rendering a Buffer as hex with `%h`, you could do something like:
+
+```js
+const createDebug = require('debug')
+createDebug.formatters.h = (v) => {
+ return v.toString('hex')
+}
+
+// …elsewhere
+const debug = createDebug('foo')
+debug('this is hex: %h', new Buffer('hello world'))
+// foo this is hex: 68656c6c6f20776f726c6421 +0ms
+```
+
+## Browser support
+ You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify),
+ or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest),
+ if you don't want to build it yourself.
+
+ Debug's enable state is currently persisted by `localStorage`.
+ Consider the situation shown below where you have `worker:a` and `worker:b`,
+ and wish to debug both. You can enable this using `localStorage.debug`:
+
+```js
+localStorage.debug = 'worker:*'
+```
+
+And then refresh the page.
+
+```js
+a = debug('worker:a');
+b = debug('worker:b');
+
+setInterval(function(){
+ a('doing some work');
+}, 1000);
+
+setInterval(function(){
+ b('doing some work');
+}, 1200);
+```
+
+#### Web Inspector Colors
+
+ Colors are also enabled on "Web Inspectors" that understand the `%c` formatting
+ option. These are WebKit web inspectors, Firefox ([since version
+ 31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/))
+ and the Firebug plugin for Firefox (any version).
+
+ Colored output looks something like:
+
+ 
+
+
+## Output streams
+
+ By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method:
+
+Example _stdout.js_:
+
+```js
+var debug = require('debug');
+var error = debug('app:error');
+
+// by default stderr is used
+error('goes to stderr!');
+
+var log = debug('app:log');
+// set this namespace to log via console.log
+log.log = console.log.bind(console); // don't forget to bind to console!
+log('goes to stdout');
+error('still goes to stderr!');
+
+// set all output to go via console.info
+// overrides all per-namespace log settings
+debug.log = console.info.bind(console);
+error('now goes to stdout via console.info');
+log('still goes to stdout, but via console.info now');
+```
+
+
+## Authors
+
+ - TJ Holowaychuk
+ - Nathan Rajlich
+ - Andrew Rhyne
+
+## Backers
+
+Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)]
+
+
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in
+all copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+THE SOFTWARE.
diff --git a/website_quotation_template/node_modules/delayed-stream/Makefile b/website_quotation_template/node_modules/delayed-stream/Makefile
new file mode 100644
index 000000000..b4ff85a33
--- /dev/null
+++ b/website_quotation_template/node_modules/delayed-stream/Makefile
@@ -0,0 +1,7 @@
+SHELL := /bin/bash
+
+test:
+ @./test/run.js
+
+.PHONY: test
+
diff --git a/website_quotation_template/node_modules/delayed-stream/Readme.md b/website_quotation_template/node_modules/delayed-stream/Readme.md
new file mode 100644
index 000000000..aca36f9f0
--- /dev/null
+++ b/website_quotation_template/node_modules/delayed-stream/Readme.md
@@ -0,0 +1,141 @@
+# delayed-stream
+
+Buffers events from a stream until you are ready to handle them.
+
+## Installation
+
+``` bash
+npm install delayed-stream
+```
+
+## Usage
+
+The following example shows how to write a http echo server that delays its
+response by 1000 ms.
+
+``` javascript
+var DelayedStream = require('delayed-stream');
+var http = require('http');
+
+http.createServer(function(req, res) {
+ var delayed = DelayedStream.create(req);
+
+ setTimeout(function() {
+ res.writeHead(200);
+ delayed.pipe(res);
+ }, 1000);
+});
+```
+
+If you are not using `Stream#pipe`, you can also manually release the buffered
+events by calling `delayedStream.resume()`:
+
+``` javascript
+var delayed = DelayedStream.create(req);
+
+setTimeout(function() {
+ // Emit all buffered events and resume underlaying source
+ delayed.resume();
+}, 1000);
+```
+
+## Implementation
+
+In order to use this meta stream properly, here are a few things you should
+know about the implementation.
+
+### Event Buffering / Proxying
+
+All events of the `source` stream are hijacked by overwriting the `source.emit`
+method. Until node implements a catch-all event listener, this is the only way.
+
+However, delayed-stream still continues to emit all events it captures on the
+`source`, regardless of whether you have released the delayed stream yet or
+not.
+
+Upon creation, delayed-stream captures all `source` events and stores them in
+an internal event buffer. Once `delayedStream.release()` is called, all
+buffered events are emitted on the `delayedStream`, and the event buffer is
+cleared. After that, delayed-stream merely acts as a proxy for the underlaying
+source.
+
+### Error handling
+
+Error events on `source` are buffered / proxied just like any other events.
+However, `delayedStream.create` attaches a no-op `'error'` listener to the
+`source`. This way you only have to handle errors on the `delayedStream`
+object, rather than in two places.
+
+### Buffer limits
+
+delayed-stream provides a `maxDataSize` property that can be used to limit
+the amount of data being buffered. In order to protect you from bad `source`
+streams that don't react to `source.pause()`, this feature is enabled by
+default.
+
+## API
+
+### DelayedStream.create(source, [options])
+
+Returns a new `delayedStream`. Available options are:
+
+* `pauseStream`
+* `maxDataSize`
+
+The description for those properties can be found below.
+
+### delayedStream.source
+
+The `source` stream managed by this object. This is useful if you are
+passing your `delayedStream` around, and you still want to access properties
+on the `source` object.
+
+### delayedStream.pauseStream = true
+
+Whether to pause the underlaying `source` when calling
+`DelayedStream.create()`. Modifying this property afterwards has no effect.
+
+### delayedStream.maxDataSize = 1024 * 1024
+
+The amount of data to buffer before emitting an `error`.
+
+If the underlaying source is emitting `Buffer` objects, the `maxDataSize`
+refers to bytes.
+
+If the underlaying source is emitting JavaScript strings, the size refers to
+characters.
+
+If you know what you are doing, you can set this property to `Infinity` to
+disable this feature. You can also modify this property during runtime.
+
+### delayedStream.dataSize = 0
+
+The amount of data buffered so far.
+
+### delayedStream.readable
+
+An ECMA5 getter that returns the value of `source.readable`.
+
+### delayedStream.resume()
+
+If the `delayedStream` has not been released so far, `delayedStream.release()`
+is called.
+
+In either case, `source.resume()` is called.
+
+### delayedStream.pause()
+
+Calls `source.pause()`.
+
+### delayedStream.pipe(dest)
+
+Calls `delayedStream.resume()` and then proxies the arguments to `source.pipe`.
+
+### delayedStream.release()
+
+Emits and clears all events that have been buffered up so far. This does not
+resume the underlaying source, use `delayedStream.resume()` instead.
+
+## License
+
+delayed-stream is licensed under the MIT license.
diff --git a/website_quotation_template/node_modules/delayed-stream/lib/delayed_stream.js b/website_quotation_template/node_modules/delayed-stream/lib/delayed_stream.js
new file mode 100644
index 000000000..b38fc85ff
--- /dev/null
+++ b/website_quotation_template/node_modules/delayed-stream/lib/delayed_stream.js
@@ -0,0 +1,107 @@
+var Stream = require('stream').Stream;
+var util = require('util');
+
+module.exports = DelayedStream;
+function DelayedStream() {
+ this.source = null;
+ this.dataSize = 0;
+ this.maxDataSize = 1024 * 1024;
+ this.pauseStream = true;
+
+ this._maxDataSizeExceeded = false;
+ this._released = false;
+ this._bufferedEvents = [];
+}
+util.inherits(DelayedStream, Stream);
+
+DelayedStream.create = function(source, options) {
+ var delayedStream = new this();
+
+ options = options || {};
+ for (var option in options) {
+ delayedStream[option] = options[option];
+ }
+
+ delayedStream.source = source;
+
+ var realEmit = source.emit;
+ source.emit = function() {
+ delayedStream._handleEmit(arguments);
+ return realEmit.apply(source, arguments);
+ };
+
+ source.on('error', function() {});
+ if (delayedStream.pauseStream) {
+ source.pause();
+ }
+
+ return delayedStream;
+};
+
+Object.defineProperty(DelayedStream.prototype, 'readable', {
+ configurable: true,
+ enumerable: true,
+ get: function() {
+ return this.source.readable;
+ }
+});
+
+DelayedStream.prototype.setEncoding = function() {
+ return this.source.setEncoding.apply(this.source, arguments);
+};
+
+DelayedStream.prototype.resume = function() {
+ if (!this._released) {
+ this.release();
+ }
+
+ this.source.resume();
+};
+
+DelayedStream.prototype.pause = function() {
+ this.source.pause();
+};
+
+DelayedStream.prototype.release = function() {
+ this._released = true;
+
+ this._bufferedEvents.forEach(function(args) {
+ this.emit.apply(this, args);
+ }.bind(this));
+ this._bufferedEvents = [];
+};
+
+DelayedStream.prototype.pipe = function() {
+ var r = Stream.prototype.pipe.apply(this, arguments);
+ this.resume();
+ return r;
+};
+
+DelayedStream.prototype._handleEmit = function(args) {
+ if (this._released) {
+ this.emit.apply(this, args);
+ return;
+ }
+
+ if (args[0] === 'data') {
+ this.dataSize += args[1].length;
+ this._checkIfMaxDataSizeExceeded();
+ }
+
+ this._bufferedEvents.push(args);
+};
+
+DelayedStream.prototype._checkIfMaxDataSizeExceeded = function() {
+ if (this._maxDataSizeExceeded) {
+ return;
+ }
+
+ if (this.dataSize <= this.maxDataSize) {
+ return;
+ }
+
+ this._maxDataSizeExceeded = true;
+ var message =
+ 'DelayedStream#maxDataSize of ' + this.maxDataSize + ' bytes exceeded.'
+ this.emit('error', new Error(message));
+};
diff --git a/website_quotation_template/node_modules/delayed-stream/package.json b/website_quotation_template/node_modules/delayed-stream/package.json
new file mode 100644
index 000000000..0515f211a
--- /dev/null
+++ b/website_quotation_template/node_modules/delayed-stream/package.json
@@ -0,0 +1,62 @@
+{
+ "_from": "delayed-stream@~1.0.0",
+ "_id": "delayed-stream@1.0.0",
+ "_inBundle": false,
+ "_integrity": "sha512-ZySD7Nf91aLB0RxL4KGrKHBXl7Eds1DAmEdcoVawXnLD7SDhpNgtuII2aAkg7a7QS41jxPSZ17p4VdGnMHk3MQ==",
+ "_location": "/delayed-stream",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "delayed-stream@~1.0.0",
+ "name": "delayed-stream",
+ "escapedName": "delayed-stream",
+ "rawSpec": "~1.0.0",
+ "saveSpec": null,
+ "fetchSpec": "~1.0.0"
+ },
+ "_requiredBy": [
+ "/combined-stream"
+ ],
+ "_resolved": "https://registry.npmjs.org/delayed-stream/-/delayed-stream-1.0.0.tgz",
+ "_shasum": "df3ae199acadfb7d440aaae0b29e2272b24ec619",
+ "_spec": "delayed-stream@~1.0.0",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/combined-stream",
+ "author": {
+ "name": "Felix Geisendörfer",
+ "email": "felix@debuggable.com",
+ "url": "http://debuggable.com/"
+ },
+ "bugs": {
+ "url": "https://github.com/felixge/node-delayed-stream/issues"
+ },
+ "bundleDependencies": false,
+ "contributors": [
+ {
+ "name": "Mike Atkins",
+ "email": "apeherder@gmail.com"
+ }
+ ],
+ "dependencies": {},
+ "deprecated": false,
+ "description": "Buffers events from a stream until you are ready to handle them.",
+ "devDependencies": {
+ "fake": "0.2.0",
+ "far": "0.0.1"
+ },
+ "engines": {
+ "node": ">=0.4.0"
+ },
+ "homepage": "https://github.com/felixge/node-delayed-stream",
+ "license": "MIT",
+ "main": "./lib/delayed_stream",
+ "name": "delayed-stream",
+ "repository": {
+ "type": "git",
+ "url": "git://github.com/felixge/node-delayed-stream.git"
+ },
+ "scripts": {
+ "test": "make test"
+ },
+ "version": "1.0.0"
+}
diff --git a/website_quotation_template/node_modules/dingbat-to-unicode/README.md b/website_quotation_template/node_modules/dingbat-to-unicode/README.md
new file mode 100644
index 000000000..ece803969
--- /dev/null
+++ b/website_quotation_template/node_modules/dingbat-to-unicode/README.md
@@ -0,0 +1,79 @@
+# dingbat-to-unicode
+
+Mapping from Dingbat fonts, such as Symbol, Webdings and Wingdings, to Unicode code points.
+
+The following fonts are supported:
+
+* Symbol
+* Webdings
+* Wingdings 1
+* Wingdings 2
+* Wingdings 3
+
+Note that in some cases, such as docx files,
+the dingbat code point may have 0xF000 added to it to shift the code point into the Unicode private use area.
+You should subtract 0xF000 from the code point before passing it into this library.
+
+## Installation
+
+ npm install dingbat-to-unicode
+
+## Usage
+
+Import using `require` or `import`:
+
+```javascript
+const dingbatToUnicode = require("dingbat-to-unicode");
+// or
+import * as dingbatToUnicode from "dingbat-to-unicode";
+```
+
+You can then call one of the following functions, depending on the representation you have the dingbat code point in:
+
+* `dingbatToUnicode.codePoint(typeface: string, codePoint: number): UnicodeScalarValue | undefined`
+
+* `dingbatToUnicode.dec(typeface: string, dec: string): UnicodeScalarValue | undefined`
+
+* `dingbatToUnicode.hex(typeface: string, hex: string): UnicodeScalarValue | undefined`
+
+`UnicodeScalarValue` is an object with two properties:
+
+* `codePoint`: a `number` representing the Unicode code point
+* `string`: a `string` representing the code point as a string
+
+## Examples
+
+```javascript
+const result = dingbatToUnicode.codePoint("Wingdings", 41)!!;
+assert.strictEqual(result.codePoint, 0x2706);
+```
+
+```javascript
+const result = dingbatToUnicode.dec("Wingdings", "41")!!;
+assert.strictEqual(result.codePoint, 0x2706);
+```
+
+```javascript
+const result = dingbatToUnicode.hex("Wingdings", "29")!!;
+assert.strictEqual(result.codePoint, 0x2706);
+```
+
+```javascript
+const result = dingbatToUnicode.hex("Wingdings", "3E")!!;
+assert.strictEqual(result.codePoint, 0x2707);
+```
+
+```javascript
+const result = dingbatToUnicode.hex("Wingdings", "3e")!!;
+assert.strictEqual(result.codePoint, 0x2707);
+```
+
+```javascript
+const result = dingbatToUnicode.hex("Wingdings", "29")!!;
+assert.strictEqual(result.string, "\u2706");
+```
+
+```javascript
+const result = dingbatToUnicode.hex("Wingdings", "28")!!;
+assert.strictEqual(result.string, "🕿");
+```
diff --git a/website_quotation_template/node_modules/dingbat-to-unicode/package.json b/website_quotation_template/node_modules/dingbat-to-unicode/package.json
new file mode 100644
index 000000000..ca123b592
--- /dev/null
+++ b/website_quotation_template/node_modules/dingbat-to-unicode/package.json
@@ -0,0 +1,67 @@
+{
+ "_from": "dingbat-to-unicode@^1.0.1",
+ "_id": "dingbat-to-unicode@1.0.1",
+ "_inBundle": false,
+ "_integrity": "sha512-98l0sW87ZT58pU4i61wa2OHwxbiYSbuxsCBozaVnYX2iCnr3bLM3fIes1/ej7h1YdOKuKt/MLs706TVnALA65w==",
+ "_location": "/dingbat-to-unicode",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "dingbat-to-unicode@^1.0.1",
+ "name": "dingbat-to-unicode",
+ "escapedName": "dingbat-to-unicode",
+ "rawSpec": "^1.0.1",
+ "saveSpec": null,
+ "fetchSpec": "^1.0.1"
+ },
+ "_requiredBy": [
+ "/mammoth"
+ ],
+ "_resolved": "https://registry.npmjs.org/dingbat-to-unicode/-/dingbat-to-unicode-1.0.1.tgz",
+ "_shasum": "5091dd673241453e6b5865e26e5a4452cdef5c83",
+ "_spec": "dingbat-to-unicode@^1.0.1",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/mammoth",
+ "author": {
+ "name": "Michael Williamson",
+ "email": "mike@zwobble.org"
+ },
+ "bugs": {
+ "url": "https://github.com/mwilliamson/dingbat-to-unicode/issues"
+ },
+ "bundleDependencies": false,
+ "deprecated": false,
+ "description": "Mapping from Dingbat fonts, such as Symbol, Webdings and Wingdings, to Unicode code points",
+ "devDependencies": {
+ "@types/mocha": "^8.2.0",
+ "@types/node": "^14.14.21",
+ "mocha": "^8.2.1",
+ "ts-node": "^9.1.1",
+ "typescript": "^4.1.3"
+ },
+ "files": [
+ "dist"
+ ],
+ "homepage": "https://github.com/mwilliamson/dingbat-to-unicode#readme",
+ "keywords": [
+ "dingbat",
+ "dingbats",
+ "symbol",
+ "webdings",
+ "wingdings",
+ "unicode"
+ ],
+ "license": "BSD-2-Clause",
+ "main": "./dist/index.js",
+ "name": "dingbat-to-unicode",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/mwilliamson/dingbat-to-unicode.git"
+ },
+ "scripts": {
+ "prepare": "tsc",
+ "test": "mocha --ui exports --require ts-node/register 'test/**/*.ts'"
+ },
+ "types": "./dist/index.d.ts",
+ "version": "1.0.1"
+}
diff --git a/website_quotation_template/node_modules/docx-pdf/.npmignore b/website_quotation_template/node_modules/docx-pdf/.npmignore
new file mode 100644
index 000000000..3b14e9b43
--- /dev/null
+++ b/website_quotation_template/node_modules/docx-pdf/.npmignore
@@ -0,0 +1,35 @@
+# See http://help.github.com/ignore-files/ for more about ignoring files.
+
+# compiled output
+/dist
+/tmp
+
+# dependencies
+/node_modules/*
+/bower_components
+
+# IDEs and editors
+/.idea
+/.vscode
+.project
+.classpath
+.c9/
+*.launch
+.settings/
+
+# misc
+/.sass-cache
+/connect.lock
+/coverage/*
+/libpeerconnection.log
+npm-debug.log
+testem.log
+/typings
+
+# e2e
+/e2e/*.js
+/e2e/*.map
+
+#System Files
+.DS_Store
+Thumbs.db
diff --git a/website_quotation_template/node_modules/docx-pdf/LICENSE b/website_quotation_template/node_modules/docx-pdf/LICENSE
new file mode 100644
index 000000000..533fe72aa
--- /dev/null
+++ b/website_quotation_template/node_modules/docx-pdf/LICENSE
@@ -0,0 +1,21 @@
+MIT License
+
+Copyright (c) 2017 Sunil Lama
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/website_quotation_template/node_modules/docx-pdf/README.md b/website_quotation_template/node_modules/docx-pdf/README.md
new file mode 100644
index 000000000..e97b5a6ca
--- /dev/null
+++ b/website_quotation_template/node_modules/docx-pdf/README.md
@@ -0,0 +1,33 @@
+Docx to pdf
+=========
+
+A library that converts docx file to pdf.
+
+## Installation
+
+ npm install docx-pdf --save
+
+## Usage
+
+ var docxConverter = require('docx-pdf');
+
+ docxConverter('./input.docx','./output.pdf',function(err,result){
+ if(err){
+ console.log(err);
+ }
+ console.log('result'+result);
+ });
+
+ its basically docxConverter(inputPath,outPath,function(err,result){
+ if(err){
+ console.log(err);
+ }
+ console.log('result'+result);
+ });
+
+ Output should be output.pdf which will be produced on the output path your provided
+
+
+## Contributing
+
+This was created just for solo usage purpose. Anybody is welcome to contribute to it.
diff --git a/website_quotation_template/node_modules/docx-pdf/index.js b/website_quotation_template/node_modules/docx-pdf/index.js
new file mode 100644
index 000000000..b3e55673b
--- /dev/null
+++ b/website_quotation_template/node_modules/docx-pdf/index.js
@@ -0,0 +1,24 @@
+var mammoth = require("mammoth");
+var pdf = require('html-pdf');
+
+function convertToPdf(inputDocFilePathWithFileName, outputDocFilePathWithFileName, callback) {
+ mammoth.convertToHtml({
+ path: inputDocFilePathWithFileName
+ })
+ .then(function (result) {
+ var html = result.value; // The generated HTML
+ pdf.create(html).toFile(outputDocFilePathWithFileName, function (err, res) {
+ if (err) {
+ callback(err);
+ console.log(err);
+ return;
+ }
+ callback(null, res);
+ });
+ var messages = result.messages; // Any messages, such as warnings during conversion
+ console.log(messages);
+ })
+ .done();
+}
+
+module.exports = convertToPdf;
\ No newline at end of file
diff --git a/website_quotation_template/node_modules/docx-pdf/package.json b/website_quotation_template/node_modules/docx-pdf/package.json
new file mode 100644
index 000000000..d54551ea5
--- /dev/null
+++ b/website_quotation_template/node_modules/docx-pdf/package.json
@@ -0,0 +1,55 @@
+{
+ "_from": "docx-pdf",
+ "_id": "docx-pdf@0.0.1",
+ "_inBundle": false,
+ "_integrity": "sha512-JbQ7w2ZPRzJGY2uLjL5nCAtCtjRoiZS2YYh7eVjax5K6XIFSEalt5FyK3OLwac37qLywtBlx3TG+z1MqYTA0Vw==",
+ "_location": "/docx-pdf",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "tag",
+ "registry": true,
+ "raw": "docx-pdf",
+ "name": "docx-pdf",
+ "escapedName": "docx-pdf",
+ "rawSpec": "",
+ "saveSpec": null,
+ "fetchSpec": "latest"
+ },
+ "_requiredBy": [
+ "#USER",
+ "/"
+ ],
+ "_resolved": "https://registry.npmjs.org/docx-pdf/-/docx-pdf-0.0.1.tgz",
+ "_shasum": "96aa81574766e3708376802c0aff48420db0e4ba",
+ "_spec": "docx-pdf",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys",
+ "author": {
+ "name": "Sunil Lama",
+ "email": "rumba.alex47@gmail.com",
+ "url": "http://stackoverflow.com/users/5523066/sunil-lama?tab=profile"
+ },
+ "bundleDependencies": false,
+ "dependencies": {
+ "html-pdf": "^2.1.0",
+ "mammoth": "^1.3.4"
+ },
+ "deprecated": false,
+ "description": "Package to convert docx file to pdf",
+ "keywords": [
+ "docx",
+ "pdf",
+ "docxtopdf",
+ "convertdocxtopdf"
+ ],
+ "license": "MIT",
+ "main": "index.js",
+ "name": "docx-pdf",
+ "repository": {
+ "type": "git",
+ "url": "\"https://github.com/SunilRumbaLama/docxToPdf\""
+ },
+ "scripts": {
+ "test": "echo \"Error: no test specified\" && exit 1"
+ },
+ "version": "0.0.1"
+}
diff --git a/website_quotation_template/node_modules/duck/LICENSE b/website_quotation_template/node_modules/duck/LICENSE
new file mode 100644
index 000000000..7e7066117
--- /dev/null
+++ b/website_quotation_template/node_modules/duck/LICENSE
@@ -0,0 +1,22 @@
+Copyright (c) 2013, Michael Williamson
+All rights reserved.
+
+Redistribution and use in source and binary forms, with or without
+modification, are permitted provided that the following conditions are met:
+
+1. Redistributions of source code must retain the above copyright notice, this
+ list of conditions and the following disclaimer.
+2. Redistributions in binary form must reproduce the above copyright notice,
+ this list of conditions and the following disclaimer in the documentation
+ and/or other materials provided with the distribution.
+
+THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND
+ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED
+WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE
+DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR CONTRIBUTORS BE LIABLE FOR
+ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES
+(INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES;
+LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND
+ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT
+(INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE OF THIS
+SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.
diff --git a/website_quotation_template/node_modules/duck/README.md b/website_quotation_template/node_modules/duck/README.md
new file mode 100644
index 000000000..885c97d94
--- /dev/null
+++ b/website_quotation_template/node_modules/duck/README.md
@@ -0,0 +1,184 @@
+# duck.js -- rich matchers with helpful messages on match failure
+
+duck.js allows you to perform assertions on complex objects.
+When those assertions fail, duck.js will try to produce helpful error messages.
+For instance, suppose you want to assert the same property on an array of objects:
+
+```javascript
+var duck = require("duck");
+var isArray = duck.isArray;
+var hasProperties = duck.hasProperties;
+
+var users = fetchUsers();
+duck.assertThat(users, isArray([
+ hasProperties({name: "Bob"}),
+ hasProperties({name: "Jim"}),
+]));
+```
+
+which might produce an error message like:
+
+```
+Expected [object with properties {
+ name: 'Bob'
+}, object with properties {
+ name: 'Jim'
+}]
+but element at index 0 didn't match:
+ value of property "name" didn't match:
+ was 'Jim'
+ expected 'Bob'
+ expected object with properties {
+ name: 'Bob'
+ }
+element at index 1 didn't match:
+ value of property "name" didn't match:
+ was 'Bob'
+ expected 'Jim'
+ expected object with properties {
+ name: 'Jim'
+ }
+```
+
+## API
+
+The below is a quick reference to the API.
+For more examples, take a look at the tests.
+
+### duck.assertThat(value, matcher)
+
+Assert that `value` satifies `matcher`.
+
+If `value` satifies `matcher`, return normally, otherwise throw an
+AssertionError describing the mismatch.
+
+### duck.is(value)
+
+If `value` is a matcher, return that matcher,
+otherwise return `duck.equalTo(value)`.
+
+### duck.equalTo(value)
+
+Matcher for deep equality on `value`.
+
+### duck.isObject(matcherObj)
+
+An object `obj` matches `duck.isObject(matcherObj)` if:
+
+* `obj` matches `duck.hasProperties(matcherObj)`, and
+* there is no key that is present in `obj` but not in `matcherObj`
+
+Sample usage:
+
+```javascript
+duck.isObject({
+ name: "Bob",
+ address: duck.isObject({
+ city: "Cambridge",
+ county: "UK"
+ })
+})
+```
+
+`duck.is` is called on each value of the matcher object, meaning that the
+above is equivalent to:
+
+```javascript
+duck.isObject({
+ name: duck.is("Bob"),
+ address: duck.isObject({
+ city: duck.is("Cambridge"),
+ county: duck.is("UK")
+ })
+})
+```
+
+### duck.hasProperties(matcherProperties)
+
+An object `obj` matches `duck.hasProperties(matcherProperties)` if,
+for each `key` in `matcherProperties`, `matcherProperties[key].matches(obj[key])`
+
+Sample usage:
+
+```javascript
+duck.hasProperties({
+ name: "Bob",
+ address: duck.hasProperties({
+ city: "Cambridge",
+ county: "UK"
+ })
+})
+```
+
+`duck.is` is called on each value of the matcher object, meaning that the
+above is equivalent to:
+
+```javascript
+duck.hasProperties({
+ name: duck.is("Bob"),
+ address: duck.hasProperties({
+ city: duck.is("Cambridge"),
+ county: duck.is("UK")
+ })
+})
+```
+
+### duck.isArray(matcherArray)
+
+An array `blah` matches `duck.isArray(matcherArray)` if:
+
+* `blah.length == matcherArray.length`, and
+* For `0 <= i < array.length`, `matcherArray[i].matches(blah[i])`
+
+Sample usage:
+
+```javascript
+duck.isArray([
+ duck.hasProperties({name: "Bob"}),
+ duck.hasProperties({name: "Jim"}),
+]))
+```
+
+`duck.is` is called on each element of the matcher array, meaning that the
+following are equivalent:
+
+```javascript
+duck.isArray(["apple", "banana"])
+
+duck.isArray([duck.is("apple"), duck.is("banana")])
+```
+
+### Matcher
+
+Each matcher has the following methods:
+
+#### matcher.matches(value)
+
+Return `true` if `value` satifies this matcher, false otherwise.
+
+#### matcher.describeMismatch(value)
+
+Generate a string describing why `value` doesn't satisfy this matcher.
+Behaviour is undefined if `value` actually satisifies the matcher.
+
+#### matcher.matchesWithDescription(value)
+
+Equivalent to:
+
+```javascript
+var isMatch = this.matches(value);
+return {
+ matches: isMatch,
+ description: isMatch ? "" : this.describeMismatch(value)
+};
+```
+
+Useful if you're likely to want both the boolean and the mismatch description.
+
+#### matcher.describeSelf()
+
+Generate a string describing the matcher.
+
+## Thanks
+
+Thanks to [Hamcrest](http://hamcrest.org/) for inspiration.
diff --git a/website_quotation_template/node_modules/duck/index.js b/website_quotation_template/node_modules/duck/index.js
new file mode 100755
index 000000000..e9640731f
--- /dev/null
+++ b/website_quotation_template/node_modules/duck/index.js
@@ -0,0 +1,267 @@
+var util = require("util");
+var assert = require("assert");
+
+var _ = require("underscore");
+
+
+var inspect = function(value) {
+ return util.inspect(value, false, null);
+};
+
+exports.assertThat = function(value, matcher) {
+ var result = matcher.matchesWithDescription(value);
+ var message = "Expected " + matcher.describeSelf() +
+ "\nbut " + result.description;
+ assert.ok(result.matches, message);
+};
+
+exports.is = function(value) {
+ if (value && value._isDuckMatcher) {
+ return value;
+ } else {
+ return equalTo(value);
+ }
+};
+
+var equalTo = exports.equalTo = function(matchValue) {
+ return new Matcher({
+ matches: function(value) {
+ return _.isEqual(value, matchValue);
+ },
+ describeMismatch: function(value) {
+ return "was " + inspect(value);
+ },
+ describeSelf: function() {
+ return inspect(matchValue);
+ }
+ });
+};
+
+exports.isObject = function(object) {
+ var matchers = valuesToMatchers(object);
+
+ return new Matcher({
+ matchesWithDescription: function(value) {
+ var expectedKeys = ownKeys(object);
+ var hasPropertiesResult = exports.hasProperties(matchers).matchesWithDescription(value);
+
+ var unexpectedPropertyMismatches = ownKeys(value).filter(function(key) {
+ return expectedKeys.indexOf(key) === -1
+ }).map(function(key) {
+ return "unexpected property: \"" + key + "\"";
+ });
+
+ var mismatchDescriptions =
+ (hasPropertiesResult.matches ? [] : [hasPropertiesResult.description])
+ .concat(unexpectedPropertyMismatches);
+
+ if (mismatchDescriptions.length === 0) {
+ return {matches: true};
+ } else {
+ return {matches: false, description: mismatchDescriptions.join("\n")};
+ }
+ },
+ describeSelf: function() {
+ return formatObjectOfMatchers(matchers);
+ }
+ });
+};
+
+exports.hasProperties = function(object) {
+ var matchers = valuesToMatchers(object);
+
+ return new Matcher({
+ matchesWithDescription: function(value) {
+ var expectedKeys = ownKeys(object);
+ expectedKeys.sort(function(first, second) {
+ if (first < second) {
+ return -1;
+ } else if (first > second) {
+ return 1;
+ } else {
+ return 0;
+ }
+ });
+ var propertyResults = expectedKeys.map(function(key) {
+ var propertyMatcher = matchers[key];
+ if (!objectHasOwnProperty(value, key)) {
+ return {matches: false, description: util.format("missing property: \"%s\"", key)};
+ } else if (!propertyMatcher.matches(value[key])) {
+ var description = "value of property \"" + key + "\" didn't match:\n" +
+ " " + indent(propertyMatcher.describeMismatch(value[key]), 1) + "\n" +
+ " expected " + indent(propertyMatcher.describeSelf(), 1);
+ return {matches: false, description: description};
+ } else {
+ return {matches: true};
+ }
+ });
+
+ return combineMatchResults(propertyResults);
+ },
+ describeSelf: function() {
+ return "object with properties " + formatObjectOfMatchers(matchers);
+ }
+ });
+};
+
+exports.isArray = function(expectedArray) {
+ var elementMatchers = expectedArray.map(exports.is);
+ return new Matcher({
+ matchesWithDescription: function(value) {
+ if (value.length !== elementMatchers.length) {
+ return {matches: false, description: "was of length " + value.length};
+ } else {
+ var elementResults = _.zip(elementMatchers, value).map(function(values, index) {
+ var expectedMatcher = values[0];
+ var actual = values[1];
+ if (expectedMatcher.matches(actual)) {
+ return {matches: true};
+ } else {
+ var description = "element at index " + index + " didn't match:\n " + indent(expectedMatcher.describeMismatch(actual), 1)
+ + "\n expected " + indent(expectedMatcher.describeSelf(), 1);
+ return {matches: false, description: description};
+ }
+ });
+
+ return combineMatchResults(elementResults);
+ }
+ },
+ describeSelf: function() {
+ return util.format("[%s]", _.invoke(elementMatchers, "describeSelf").join(", "));
+ }
+ });
+};
+
+var Matcher = function(matcher) {
+ this._matcher = matcher;
+ this._isDuckMatcher = true;
+};
+
+Matcher.prototype.matches = function(value) {
+ if (this._matcher.matches) {
+ return this._matcher.matches(value);
+ } else {
+ return this._matcher.matchesWithDescription(value).matches;
+ }
+};
+
+Matcher.prototype.describeMismatch = function(value) {
+ if (this._matcher.describeMismatch) {
+ return this._matcher.describeMismatch(value);
+ } else {
+ return this._matcher.matchesWithDescription(value).description;
+ }
+};
+
+Matcher.prototype.matchesWithDescription = function(value) {
+ if (this._matcher.matchesWithDescription) {
+ var result = this._matcher.matchesWithDescription(value);
+ if (result.matches) {
+ return {
+ matches: true,
+ description: ""
+ };
+ } else {
+ return result;
+ }
+ } else {
+ var isMatch = this.matches(value);
+ return {
+ matches: isMatch,
+ description: isMatch ? "" : this.describeMismatch(value)
+ };
+ }
+};
+
+Matcher.prototype.describeSelf = function() {
+ return this._matcher.describeSelf();
+};
+
+var combineMatchResults = function(results) {
+ var mismatches = results.filter(function(result) {
+ return !result.matches;
+ });
+ return combineMismatchs(mismatches);
+};
+
+var combineMismatchs = function(mismatches) {
+ if (mismatches.length === 0) {
+ return {matches: true};
+ } else {
+ var mismatchDescriptions = mismatches.map(function(mismatch) {
+ return mismatch.description;
+ });
+ return {matches: false, description: mismatchDescriptions.join("\n")};
+ }
+};
+
+var ownKeys = function(obj) {
+ var keys = [];
+ for (var key in obj) {
+ if (objectHasOwnProperty(obj, key)) {
+ keys.push(key);
+ }
+ }
+ return keys;
+};
+
+var objectHasOwnProperty = function(obj, key) {
+ return Object.prototype.hasOwnProperty.call(obj, key);
+};
+
+var objectMap = function(obj, func) {
+ var matchers = {};
+ _.forEach(obj, function(value, key) {
+ if (_.has(obj, key)) {
+ matchers[key] = func(value, key);
+ }
+ });
+ return matchers;
+
+};
+
+var valuesToMatchers = function(obj) {
+ return objectMap(obj, exports.is);
+};
+
+var formatObject = function(obj) {
+ if (_.size(obj) === 0) {
+ return "{}";
+ } else {
+ return util.format("{%s\n}", formatProperties(obj));
+ }
+};
+
+var formatProperties = function(obj) {
+ var properties = _.map(obj, function(value, key) {
+ return {key: key, value: value};
+ });
+ var sortedProperties = _.sortBy(properties, function(property) {
+ return property.key;
+ });
+ return "\n " + sortedProperties.map(function(property) {
+ return indent(property.key + ": " + property.value, 1);
+ }).join(",\n ");
+};
+
+var formatObjectOfMatchers = function(matchers) {
+ return formatObject(objectMap(matchers, function(matcher) {
+ return matcher.describeSelf();
+ }));
+};
+
+var indent = function(str, indentationLevel) {
+ var indentation = _.range(indentationLevel).map(function() {
+ return " ";
+ }).join("");
+ return str.replace(/\n/g, "\n" + indentation);
+};
+
+exports.any = new Matcher({
+ matchesWithDescription: function() {
+ return {matches: true};
+ },
+ describeSelf: function() {
+ return "";
+ }
+});
diff --git a/website_quotation_template/node_modules/duck/makefile b/website_quotation_template/node_modules/duck/makefile
new file mode 100755
index 000000000..b185b9727
--- /dev/null
+++ b/website_quotation_template/node_modules/duck/makefile
@@ -0,0 +1,4 @@
+.PHONY: test
+
+test:
+ node_modules/.bin/nodeunit `find test -name \*.test.js -type f`
diff --git a/website_quotation_template/node_modules/duck/package.json b/website_quotation_template/node_modules/duck/package.json
new file mode 100644
index 000000000..2c0da59b3
--- /dev/null
+++ b/website_quotation_template/node_modules/duck/package.json
@@ -0,0 +1,55 @@
+{
+ "_from": "duck@^0.1.12",
+ "_id": "duck@0.1.12",
+ "_inBundle": false,
+ "_integrity": "sha512-wkctla1O6VfP89gQ+J/yDesM0S7B7XLXjKGzXxMDVFg7uEn706niAtyYovKbyq1oT9YwDcly721/iUWoc8MVRg==",
+ "_location": "/duck",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "duck@^0.1.12",
+ "name": "duck",
+ "escapedName": "duck",
+ "rawSpec": "^0.1.12",
+ "saveSpec": null,
+ "fetchSpec": "^0.1.12"
+ },
+ "_requiredBy": [
+ "/lop"
+ ],
+ "_resolved": "https://registry.npmjs.org/duck/-/duck-0.1.12.tgz",
+ "_shasum": "de7adf758421230b6d7aee799ce42670586b9efa",
+ "_spec": "duck@^0.1.12",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/lop",
+ "author": {
+ "name": "Michael Williamson",
+ "email": "mike@zwobble.org"
+ },
+ "bugs": {
+ "url": "https://github.com/mwilliamson/duck.js/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {
+ "underscore": "^1.13.1"
+ },
+ "deprecated": false,
+ "description": "Rich matchers inspired by Hamcrest. Useful for generating helpful assertion failure messages in tests.",
+ "devDependencies": {
+ "nodeunit": "~0.8.0"
+ },
+ "homepage": "https://github.com/mwilliamson/duck.js#readme",
+ "keywords": [
+ "test",
+ "assert",
+ "matcher",
+ "assertThat"
+ ],
+ "license": "BSD",
+ "name": "duck",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/mwilliamson/duck.js.git"
+ },
+ "version": "0.1.12"
+}
diff --git a/website_quotation_template/node_modules/duck/test/duck.test.js b/website_quotation_template/node_modules/duck/test/duck.test.js
new file mode 100755
index 000000000..bddf58bad
--- /dev/null
+++ b/website_quotation_template/node_modules/duck/test/duck.test.js
@@ -0,0 +1,160 @@
+var duck = require("../");
+
+var testMatcher = function(options) {
+ return function(test) {
+ var matcher = options.matcher;
+ var description = options.description;
+ var positives = options.positives;
+ var negatives = options.negatives;
+
+ test.equal(matcher.describeSelf(), description);
+
+ positives.forEach(function(positive) {
+ test.same(true, matcher.matches(positive));
+ var result = matcher.matchesWithDescription(positive);
+ test.same(true, result.matches);
+ test.same("", result.description);
+ });
+ negatives.forEach(function(negative) {
+ test.same(false, matcher.matches(negative.value));
+ test.same(negative.description, matcher.describeMismatch(negative.value));
+ var result = matcher.matchesWithDescription(negative.value);
+ test.same(false, result.matches);
+ test.same(negative.description, result.description);
+ });
+
+ test.done();
+ };
+};
+
+exports.isMatchesPrimitiveValues = testMatcher({
+ matcher: duck.is(1),
+ description: "1",
+ positives: [1],
+ negatives: [
+ {value: 2, description: "was 2"},
+ {value: "1", description: "was '1'"},
+ {value: null, description: "was null"}
+ ]
+});
+
+exports.isMatchesObjectUsingIsEqual = testMatcher({
+ matcher: duck.is({}),
+ description: "{}",
+ positives: [{}],
+ negatives: [
+ {value: {hair: "none"}, description: "was { hair: 'none' }"}
+ ]
+});
+
+exports.isDoesNothingToMatchers = testMatcher({
+ matcher: duck.is(duck.is(1)),
+ description: "1",
+ positives: [1],
+ negatives: [
+ {value: 2, description: "was 2"},
+ {value: "1", description: "was '1'"},
+ {value: null, description: "was null"}
+ ]
+});
+
+exports.isObjectMatchesValuesExactly = testMatcher({
+ matcher: duck.isObject({
+ name: "Bob",
+ age: 24
+ }),
+ description: "{\n age: 24,\n name: 'Bob'\n}",
+ positives: [{name: "Bob", age: 24}],
+ negatives: [
+ {value: {name: "Bob"}, description: "missing property: \"age\""},
+ {value: {}, description: "missing property: \"age\"\nmissing property: \"name\""},
+ {value: {name: "bob", age: 24}, description: "value of property \"name\" didn't match:\n was 'bob'\n expected 'Bob'"},
+ {value: {name: "Bob", age: 24, hair: "none"}, description: "unexpected property: \"hair\""}
+ ]
+});
+
+exports.isObjectSubDescriptionsAreIndented = testMatcher({
+ matcher: duck.isObject({artist: duck.isObject({name: "Bob"})}),
+ description: "{\n artist: {\n name: 'Bob'\n }\n}",
+ positives: [],
+ negatives: [
+ {
+ value: {artist: {name: "Jim"}},
+ description:
+ "value of property \"artist\" didn't match:\n" +
+ " value of property \"name\" didn't match:\n" +
+ " was 'Jim'\n" +
+ " expected 'Bob'\n" +
+ " expected {\n" +
+ " name: 'Bob'\n" +
+ " }"
+ }
+ ]
+});
+
+exports.hasPropertiesBehavesAsIsObjectExceptIgnoresUnexpectedValues = testMatcher({
+ matcher: duck.hasProperties({
+ name: "Bob",
+ age: 24
+ }),
+ description: "object with properties {\n age: 24,\n name: 'Bob'\n}",
+ positives: [{name: "Bob", age: 24}, {name: "Bob", age: 24, hair: "none"}],
+ negatives: [
+ {value: {name: "Bob"}, description: "missing property: \"age\""},
+ {value: {}, description: "missing property: \"age\"\nmissing property: \"name\""},
+ {value: {name: "bob", age: 24}, description: "value of property \"name\" didn't match:\n was 'bob'\n expected 'Bob'"}
+ ]
+});
+
+exports.isArrayMatchesLengthAndIndividualElements = testMatcher({
+ matcher: duck.isArray(["apple", "banana"]),
+ description: "['apple', 'banana']",
+ positives: [["apple", "banana"]],
+ negatives: [
+ {value: [], description: "was of length 0"},
+ {value: ["apple", "banana", "coconut"], description: "was of length 3"},
+ {value: ["apple", "coconut",], description: "element at index 1 didn't match:\n was 'coconut'\n expected 'banana'"}
+ ]
+});
+
+exports.isArraySubDescriptionsAreIndented = testMatcher({
+ matcher: duck.isArray([duck.isObject({name: "Bob"})]),
+ description: "[{\n name: 'Bob'\n}]",
+ positives: [[{name: "Bob"}]],
+ negatives: [
+ {
+ value: [{name: "Jim"}],
+ description:
+ "element at index 0 didn't match:\n" +
+ " value of property \"name\" didn't match:\n" +
+ " was 'Jim'\n" +
+ " expected 'Bob'\n" +
+ " expected {\n" +
+ " name: 'Bob'\n" +
+ " }"
+ }
+ ]
+});
+
+exports.isArraySubDescriptionsAreIndented = testMatcher({
+ matcher: duck.any,
+ description: "",
+ positives: [{name: "Bob"}, null, undefined, 0, 1, "Bob", []],
+ negatives: []
+});
+
+exports.assertReturnsNormallyOnSuccess = function(test) {
+ duck.assertThat(42, duck.is(42));
+ test.done();
+};
+
+exports.assertRaisesErrorIfAssertionFails = function(test) {
+ try {
+ duck.assertThat(42, duck.is(43));
+ test.fail("Should throw error");
+ } catch (error) {
+ test.equal(error.name, "AssertionError");
+ test.equal(error.message, "Expected 43\nbut was 42");
+ }
+ test.done();
+};
diff --git a/website_quotation_template/node_modules/ecc-jsbn/LICENSE b/website_quotation_template/node_modules/ecc-jsbn/LICENSE
new file mode 100755
index 000000000..f668fefc6
--- /dev/null
+++ b/website_quotation_template/node_modules/ecc-jsbn/LICENSE
@@ -0,0 +1,21 @@
+The MIT License (MIT)
+
+Copyright (c) 2014 Jeremie Miller
+
+Permission is hereby granted, free of charge, to any person obtaining a copy
+of this software and associated documentation files (the "Software"), to deal
+in the Software without restriction, including without limitation the rights
+to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+copies of the Software, and to permit persons to whom the Software is
+furnished to do so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
\ No newline at end of file
diff --git a/website_quotation_template/node_modules/ecc-jsbn/README.md b/website_quotation_template/node_modules/ecc-jsbn/README.md
new file mode 100755
index 000000000..b5d0b9de9
--- /dev/null
+++ b/website_quotation_template/node_modules/ecc-jsbn/README.md
@@ -0,0 +1,8 @@
+ecc-jsbn
+========
+
+ECC package based on [jsbn](https://github.com/andyperlitch/jsbn) from [Tom Wu](http://www-cs-students.stanford.edu/~tjw/).
+
+This is a subset of the same interface as the [node compiled module](https://github.com/quartzjer/ecc), but works in the browser too.
+
+Also uses point compression now from [https://github.com/kaielvin](https://github.com/kaielvin/jsbn-ec-point-compression).
diff --git a/website_quotation_template/node_modules/ecc-jsbn/index.js b/website_quotation_template/node_modules/ecc-jsbn/index.js
new file mode 100755
index 000000000..fb19a1d6f
--- /dev/null
+++ b/website_quotation_template/node_modules/ecc-jsbn/index.js
@@ -0,0 +1,58 @@
+var crypto = require("crypto");
+var BigInteger = require("jsbn").BigInteger;
+var ECPointFp = require("./lib/ec.js").ECPointFp;
+var Buffer = require("safer-buffer").Buffer;
+exports.ECCurves = require("./lib/sec.js");
+
+// zero prepad
+function unstupid(hex,len)
+{
+ return (hex.length >= len) ? hex : unstupid("0"+hex,len);
+}
+
+exports.ECKey = function(curve, key, isPublic)
+{
+ var priv;
+ var c = curve();
+ var n = c.getN();
+ var bytes = Math.floor(n.bitLength()/8);
+
+ if(key)
+ {
+ if(isPublic)
+ {
+ var curve = c.getCurve();
+// var x = key.slice(1,bytes+1); // skip the 04 for uncompressed format
+// var y = key.slice(bytes+1);
+// this.P = new ECPointFp(curve,
+// curve.fromBigInteger(new BigInteger(x.toString("hex"), 16)),
+// curve.fromBigInteger(new BigInteger(y.toString("hex"), 16)));
+ this.P = curve.decodePointHex(key.toString("hex"));
+ }else{
+ if(key.length != bytes) return false;
+ priv = new BigInteger(key.toString("hex"), 16);
+ }
+ }else{
+ var n1 = n.subtract(BigInteger.ONE);
+ var r = new BigInteger(crypto.randomBytes(n.bitLength()));
+ priv = r.mod(n1).add(BigInteger.ONE);
+ this.P = c.getG().multiply(priv);
+ }
+ if(this.P)
+ {
+// var pubhex = unstupid(this.P.getX().toBigInteger().toString(16),bytes*2)+unstupid(this.P.getY().toBigInteger().toString(16),bytes*2);
+// this.PublicKey = Buffer.from("04"+pubhex,"hex");
+ this.PublicKey = Buffer.from(c.getCurve().encodeCompressedPointHex(this.P),"hex");
+ }
+ if(priv)
+ {
+ this.PrivateKey = Buffer.from(unstupid(priv.toString(16),bytes*2),"hex");
+ this.deriveSharedSecret = function(key)
+ {
+ if(!key || !key.P) return false;
+ var S = key.P.multiply(priv);
+ return Buffer.from(unstupid(S.getX().toBigInteger().toString(16),bytes*2),"hex");
+ }
+ }
+}
+
diff --git a/website_quotation_template/node_modules/ecc-jsbn/lib/LICENSE-jsbn b/website_quotation_template/node_modules/ecc-jsbn/lib/LICENSE-jsbn
new file mode 100755
index 000000000..24502a9cf
--- /dev/null
+++ b/website_quotation_template/node_modules/ecc-jsbn/lib/LICENSE-jsbn
@@ -0,0 +1,40 @@
+Licensing
+---------
+
+This software is covered under the following copyright:
+
+/*
+ * Copyright (c) 2003-2005 Tom Wu
+ * All Rights Reserved.
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining
+ * a copy of this software and associated documentation files (the
+ * "Software"), to deal in the Software without restriction, including
+ * without limitation the rights to use, copy, modify, merge, publish,
+ * distribute, sublicense, and/or sell copies of the Software, and to
+ * permit persons to whom the Software is furnished to do so, subject to
+ * the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be
+ * included in all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS-IS" AND WITHOUT WARRANTY OF ANY KIND,
+ * EXPRESS, IMPLIED OR OTHERWISE, INCLUDING WITHOUT LIMITATION, ANY
+ * WARRANTY OF MERCHANTABILITY OR FITNESS FOR A PARTICULAR PURPOSE.
+ *
+ * IN NO EVENT SHALL TOM WU BE LIABLE FOR ANY SPECIAL, INCIDENTAL,
+ * INDIRECT OR CONSEQUENTIAL DAMAGES OF ANY KIND, OR ANY DAMAGES WHATSOEVER
+ * RESULTING FROM LOSS OF USE, DATA OR PROFITS, WHETHER OR NOT ADVISED OF
+ * THE POSSIBILITY OF DAMAGE, AND ON ANY THEORY OF LIABILITY, ARISING OUT
+ * OF OR IN CONNECTION WITH THE USE OR PERFORMANCE OF THIS SOFTWARE.
+ *
+ * In addition, the following condition applies:
+ *
+ * All redistributions must retain an intact copy of this copyright notice
+ * and disclaimer.
+ */
+
+Address all questions regarding this license to:
+
+ Tom Wu
+ tjw@cs.Stanford.EDU
diff --git a/website_quotation_template/node_modules/ecc-jsbn/lib/ec.js b/website_quotation_template/node_modules/ecc-jsbn/lib/ec.js
new file mode 100755
index 000000000..3852671ec
--- /dev/null
+++ b/website_quotation_template/node_modules/ecc-jsbn/lib/ec.js
@@ -0,0 +1,561 @@
+// Basic Javascript Elliptic Curve implementation
+// Ported loosely from BouncyCastle's Java EC code
+// Only Fp curves implemented for now
+
+// Requires jsbn.js and jsbn2.js
+var BigInteger = require('jsbn').BigInteger
+var Barrett = BigInteger.prototype.Barrett
+
+// ----------------
+// ECFieldElementFp
+
+// constructor
+function ECFieldElementFp(q,x) {
+ this.x = x;
+ // TODO if(x.compareTo(q) >= 0) error
+ this.q = q;
+}
+
+function feFpEquals(other) {
+ if(other == this) return true;
+ return (this.q.equals(other.q) && this.x.equals(other.x));
+}
+
+function feFpToBigInteger() {
+ return this.x;
+}
+
+function feFpNegate() {
+ return new ECFieldElementFp(this.q, this.x.negate().mod(this.q));
+}
+
+function feFpAdd(b) {
+ return new ECFieldElementFp(this.q, this.x.add(b.toBigInteger()).mod(this.q));
+}
+
+function feFpSubtract(b) {
+ return new ECFieldElementFp(this.q, this.x.subtract(b.toBigInteger()).mod(this.q));
+}
+
+function feFpMultiply(b) {
+ return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger()).mod(this.q));
+}
+
+function feFpSquare() {
+ return new ECFieldElementFp(this.q, this.x.square().mod(this.q));
+}
+
+function feFpDivide(b) {
+ return new ECFieldElementFp(this.q, this.x.multiply(b.toBigInteger().modInverse(this.q)).mod(this.q));
+}
+
+ECFieldElementFp.prototype.equals = feFpEquals;
+ECFieldElementFp.prototype.toBigInteger = feFpToBigInteger;
+ECFieldElementFp.prototype.negate = feFpNegate;
+ECFieldElementFp.prototype.add = feFpAdd;
+ECFieldElementFp.prototype.subtract = feFpSubtract;
+ECFieldElementFp.prototype.multiply = feFpMultiply;
+ECFieldElementFp.prototype.square = feFpSquare;
+ECFieldElementFp.prototype.divide = feFpDivide;
+
+// ----------------
+// ECPointFp
+
+// constructor
+function ECPointFp(curve,x,y,z) {
+ this.curve = curve;
+ this.x = x;
+ this.y = y;
+ // Projective coordinates: either zinv == null or z * zinv == 1
+ // z and zinv are just BigIntegers, not fieldElements
+ if(z == null) {
+ this.z = BigInteger.ONE;
+ }
+ else {
+ this.z = z;
+ }
+ this.zinv = null;
+ //TODO: compression flag
+}
+
+function pointFpGetX() {
+ if(this.zinv == null) {
+ this.zinv = this.z.modInverse(this.curve.q);
+ }
+ var r = this.x.toBigInteger().multiply(this.zinv);
+ this.curve.reduce(r);
+ return this.curve.fromBigInteger(r);
+}
+
+function pointFpGetY() {
+ if(this.zinv == null) {
+ this.zinv = this.z.modInverse(this.curve.q);
+ }
+ var r = this.y.toBigInteger().multiply(this.zinv);
+ this.curve.reduce(r);
+ return this.curve.fromBigInteger(r);
+}
+
+function pointFpEquals(other) {
+ if(other == this) return true;
+ if(this.isInfinity()) return other.isInfinity();
+ if(other.isInfinity()) return this.isInfinity();
+ var u, v;
+ // u = Y2 * Z1 - Y1 * Z2
+ u = other.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(other.z)).mod(this.curve.q);
+ if(!u.equals(BigInteger.ZERO)) return false;
+ // v = X2 * Z1 - X1 * Z2
+ v = other.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(other.z)).mod(this.curve.q);
+ return v.equals(BigInteger.ZERO);
+}
+
+function pointFpIsInfinity() {
+ if((this.x == null) && (this.y == null)) return true;
+ return this.z.equals(BigInteger.ZERO) && !this.y.toBigInteger().equals(BigInteger.ZERO);
+}
+
+function pointFpNegate() {
+ return new ECPointFp(this.curve, this.x, this.y.negate(), this.z);
+}
+
+function pointFpAdd(b) {
+ if(this.isInfinity()) return b;
+ if(b.isInfinity()) return this;
+
+ // u = Y2 * Z1 - Y1 * Z2
+ var u = b.y.toBigInteger().multiply(this.z).subtract(this.y.toBigInteger().multiply(b.z)).mod(this.curve.q);
+ // v = X2 * Z1 - X1 * Z2
+ var v = b.x.toBigInteger().multiply(this.z).subtract(this.x.toBigInteger().multiply(b.z)).mod(this.curve.q);
+
+ if(BigInteger.ZERO.equals(v)) {
+ if(BigInteger.ZERO.equals(u)) {
+ return this.twice(); // this == b, so double
+ }
+ return this.curve.getInfinity(); // this = -b, so infinity
+ }
+
+ var THREE = new BigInteger("3");
+ var x1 = this.x.toBigInteger();
+ var y1 = this.y.toBigInteger();
+ var x2 = b.x.toBigInteger();
+ var y2 = b.y.toBigInteger();
+
+ var v2 = v.square();
+ var v3 = v2.multiply(v);
+ var x1v2 = x1.multiply(v2);
+ var zu2 = u.square().multiply(this.z);
+
+ // x3 = v * (z2 * (z1 * u^2 - 2 * x1 * v^2) - v^3)
+ var x3 = zu2.subtract(x1v2.shiftLeft(1)).multiply(b.z).subtract(v3).multiply(v).mod(this.curve.q);
+ // y3 = z2 * (3 * x1 * u * v^2 - y1 * v^3 - z1 * u^3) + u * v^3
+ var y3 = x1v2.multiply(THREE).multiply(u).subtract(y1.multiply(v3)).subtract(zu2.multiply(u)).multiply(b.z).add(u.multiply(v3)).mod(this.curve.q);
+ // z3 = v^3 * z1 * z2
+ var z3 = v3.multiply(this.z).multiply(b.z).mod(this.curve.q);
+
+ return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3);
+}
+
+function pointFpTwice() {
+ if(this.isInfinity()) return this;
+ if(this.y.toBigInteger().signum() == 0) return this.curve.getInfinity();
+
+ // TODO: optimized handling of constants
+ var THREE = new BigInteger("3");
+ var x1 = this.x.toBigInteger();
+ var y1 = this.y.toBigInteger();
+
+ var y1z1 = y1.multiply(this.z);
+ var y1sqz1 = y1z1.multiply(y1).mod(this.curve.q);
+ var a = this.curve.a.toBigInteger();
+
+ // w = 3 * x1^2 + a * z1^2
+ var w = x1.square().multiply(THREE);
+ if(!BigInteger.ZERO.equals(a)) {
+ w = w.add(this.z.square().multiply(a));
+ }
+ w = w.mod(this.curve.q);
+ //this.curve.reduce(w);
+ // x3 = 2 * y1 * z1 * (w^2 - 8 * x1 * y1^2 * z1)
+ var x3 = w.square().subtract(x1.shiftLeft(3).multiply(y1sqz1)).shiftLeft(1).multiply(y1z1).mod(this.curve.q);
+ // y3 = 4 * y1^2 * z1 * (3 * w * x1 - 2 * y1^2 * z1) - w^3
+ var y3 = w.multiply(THREE).multiply(x1).subtract(y1sqz1.shiftLeft(1)).shiftLeft(2).multiply(y1sqz1).subtract(w.square().multiply(w)).mod(this.curve.q);
+ // z3 = 8 * (y1 * z1)^3
+ var z3 = y1z1.square().multiply(y1z1).shiftLeft(3).mod(this.curve.q);
+
+ return new ECPointFp(this.curve, this.curve.fromBigInteger(x3), this.curve.fromBigInteger(y3), z3);
+}
+
+// Simple NAF (Non-Adjacent Form) multiplication algorithm
+// TODO: modularize the multiplication algorithm
+function pointFpMultiply(k) {
+ if(this.isInfinity()) return this;
+ if(k.signum() == 0) return this.curve.getInfinity();
+
+ var e = k;
+ var h = e.multiply(new BigInteger("3"));
+
+ var neg = this.negate();
+ var R = this;
+
+ var i;
+ for(i = h.bitLength() - 2; i > 0; --i) {
+ R = R.twice();
+
+ var hBit = h.testBit(i);
+ var eBit = e.testBit(i);
+
+ if (hBit != eBit) {
+ R = R.add(hBit ? this : neg);
+ }
+ }
+
+ return R;
+}
+
+// Compute this*j + x*k (simultaneous multiplication)
+function pointFpMultiplyTwo(j,x,k) {
+ var i;
+ if(j.bitLength() > k.bitLength())
+ i = j.bitLength() - 1;
+ else
+ i = k.bitLength() - 1;
+
+ var R = this.curve.getInfinity();
+ var both = this.add(x);
+ while(i >= 0) {
+ R = R.twice();
+ if(j.testBit(i)) {
+ if(k.testBit(i)) {
+ R = R.add(both);
+ }
+ else {
+ R = R.add(this);
+ }
+ }
+ else {
+ if(k.testBit(i)) {
+ R = R.add(x);
+ }
+ }
+ --i;
+ }
+
+ return R;
+}
+
+ECPointFp.prototype.getX = pointFpGetX;
+ECPointFp.prototype.getY = pointFpGetY;
+ECPointFp.prototype.equals = pointFpEquals;
+ECPointFp.prototype.isInfinity = pointFpIsInfinity;
+ECPointFp.prototype.negate = pointFpNegate;
+ECPointFp.prototype.add = pointFpAdd;
+ECPointFp.prototype.twice = pointFpTwice;
+ECPointFp.prototype.multiply = pointFpMultiply;
+ECPointFp.prototype.multiplyTwo = pointFpMultiplyTwo;
+
+// ----------------
+// ECCurveFp
+
+// constructor
+function ECCurveFp(q,a,b) {
+ this.q = q;
+ this.a = this.fromBigInteger(a);
+ this.b = this.fromBigInteger(b);
+ this.infinity = new ECPointFp(this, null, null);
+ this.reducer = new Barrett(this.q);
+}
+
+function curveFpGetQ() {
+ return this.q;
+}
+
+function curveFpGetA() {
+ return this.a;
+}
+
+function curveFpGetB() {
+ return this.b;
+}
+
+function curveFpEquals(other) {
+ if(other == this) return true;
+ return(this.q.equals(other.q) && this.a.equals(other.a) && this.b.equals(other.b));
+}
+
+function curveFpGetInfinity() {
+ return this.infinity;
+}
+
+function curveFpFromBigInteger(x) {
+ return new ECFieldElementFp(this.q, x);
+}
+
+function curveReduce(x) {
+ this.reducer.reduce(x);
+}
+
+// for now, work with hex strings because they're easier in JS
+function curveFpDecodePointHex(s) {
+ switch(parseInt(s.substr(0,2), 16)) { // first byte
+ case 0:
+ return this.infinity;
+ case 2:
+ case 3:
+ // point compression not supported yet
+ return null;
+ case 4:
+ case 6:
+ case 7:
+ var len = (s.length - 2) / 2;
+ var xHex = s.substr(2, len);
+ var yHex = s.substr(len+2, len);
+
+ return new ECPointFp(this,
+ this.fromBigInteger(new BigInteger(xHex, 16)),
+ this.fromBigInteger(new BigInteger(yHex, 16)));
+
+ default: // unsupported
+ return null;
+ }
+}
+
+function curveFpEncodePointHex(p) {
+ if (p.isInfinity()) return "00";
+ var xHex = p.getX().toBigInteger().toString(16);
+ var yHex = p.getY().toBigInteger().toString(16);
+ var oLen = this.getQ().toString(16).length;
+ if ((oLen % 2) != 0) oLen++;
+ while (xHex.length < oLen) {
+ xHex = "0" + xHex;
+ }
+ while (yHex.length < oLen) {
+ yHex = "0" + yHex;
+ }
+ return "04" + xHex + yHex;
+}
+
+ECCurveFp.prototype.getQ = curveFpGetQ;
+ECCurveFp.prototype.getA = curveFpGetA;
+ECCurveFp.prototype.getB = curveFpGetB;
+ECCurveFp.prototype.equals = curveFpEquals;
+ECCurveFp.prototype.getInfinity = curveFpGetInfinity;
+ECCurveFp.prototype.fromBigInteger = curveFpFromBigInteger;
+ECCurveFp.prototype.reduce = curveReduce;
+//ECCurveFp.prototype.decodePointHex = curveFpDecodePointHex;
+ECCurveFp.prototype.encodePointHex = curveFpEncodePointHex;
+
+// from: https://github.com/kaielvin/jsbn-ec-point-compression
+ECCurveFp.prototype.decodePointHex = function(s)
+{
+ var yIsEven;
+ switch(parseInt(s.substr(0,2), 16)) { // first byte
+ case 0:
+ return this.infinity;
+ case 2:
+ yIsEven = false;
+ case 3:
+ if(yIsEven == undefined) yIsEven = true;
+ var len = s.length - 2;
+ var xHex = s.substr(2, len);
+ var x = this.fromBigInteger(new BigInteger(xHex,16));
+ var alpha = x.multiply(x.square().add(this.getA())).add(this.getB());
+ var beta = alpha.sqrt();
+
+ if (beta == null) throw "Invalid point compression";
+
+ var betaValue = beta.toBigInteger();
+ if (betaValue.testBit(0) != yIsEven)
+ {
+ // Use the other root
+ beta = this.fromBigInteger(this.getQ().subtract(betaValue));
+ }
+ return new ECPointFp(this,x,beta);
+ case 4:
+ case 6:
+ case 7:
+ var len = (s.length - 2) / 2;
+ var xHex = s.substr(2, len);
+ var yHex = s.substr(len+2, len);
+
+ return new ECPointFp(this,
+ this.fromBigInteger(new BigInteger(xHex, 16)),
+ this.fromBigInteger(new BigInteger(yHex, 16)));
+
+ default: // unsupported
+ return null;
+ }
+}
+ECCurveFp.prototype.encodeCompressedPointHex = function(p)
+{
+ if (p.isInfinity()) return "00";
+ var xHex = p.getX().toBigInteger().toString(16);
+ var oLen = this.getQ().toString(16).length;
+ if ((oLen % 2) != 0) oLen++;
+ while (xHex.length < oLen)
+ xHex = "0" + xHex;
+ var yPrefix;
+ if(p.getY().toBigInteger().isEven()) yPrefix = "02";
+ else yPrefix = "03";
+
+ return yPrefix + xHex;
+}
+
+
+ECFieldElementFp.prototype.getR = function()
+{
+ if(this.r != undefined) return this.r;
+
+ this.r = null;
+ var bitLength = this.q.bitLength();
+ if (bitLength > 128)
+ {
+ var firstWord = this.q.shiftRight(bitLength - 64);
+ if (firstWord.intValue() == -1)
+ {
+ this.r = BigInteger.ONE.shiftLeft(bitLength).subtract(this.q);
+ }
+ }
+ return this.r;
+}
+ECFieldElementFp.prototype.modMult = function(x1,x2)
+{
+ return this.modReduce(x1.multiply(x2));
+}
+ECFieldElementFp.prototype.modReduce = function(x)
+{
+ if (this.getR() != null)
+ {
+ var qLen = q.bitLength();
+ while (x.bitLength() > (qLen + 1))
+ {
+ var u = x.shiftRight(qLen);
+ var v = x.subtract(u.shiftLeft(qLen));
+ if (!this.getR().equals(BigInteger.ONE))
+ {
+ u = u.multiply(this.getR());
+ }
+ x = u.add(v);
+ }
+ while (x.compareTo(q) >= 0)
+ {
+ x = x.subtract(q);
+ }
+ }
+ else
+ {
+ x = x.mod(q);
+ }
+ return x;
+}
+ECFieldElementFp.prototype.sqrt = function()
+{
+ if (!this.q.testBit(0)) throw "unsupported";
+
+ // p mod 4 == 3
+ if (this.q.testBit(1))
+ {
+ var z = new ECFieldElementFp(this.q,this.x.modPow(this.q.shiftRight(2).add(BigInteger.ONE),this.q));
+ return z.square().equals(this) ? z : null;
+ }
+
+ // p mod 4 == 1
+ var qMinusOne = this.q.subtract(BigInteger.ONE);
+
+ var legendreExponent = qMinusOne.shiftRight(1);
+ if (!(this.x.modPow(legendreExponent, this.q).equals(BigInteger.ONE)))
+ {
+ return null;
+ }
+
+ var u = qMinusOne.shiftRight(2);
+ var k = u.shiftLeft(1).add(BigInteger.ONE);
+
+ var Q = this.x;
+ var fourQ = modDouble(modDouble(Q));
+
+ var U, V;
+ do
+ {
+ var P;
+ do
+ {
+ P = new BigInteger(this.q.bitLength(), new SecureRandom());
+ }
+ while (P.compareTo(this.q) >= 0
+ || !(P.multiply(P).subtract(fourQ).modPow(legendreExponent, this.q).equals(qMinusOne)));
+
+ var result = this.lucasSequence(P, Q, k);
+ U = result[0];
+ V = result[1];
+
+ if (this.modMult(V, V).equals(fourQ))
+ {
+ // Integer division by 2, mod q
+ if (V.testBit(0))
+ {
+ V = V.add(q);
+ }
+
+ V = V.shiftRight(1);
+
+ return new ECFieldElementFp(q,V);
+ }
+ }
+ while (U.equals(BigInteger.ONE) || U.equals(qMinusOne));
+
+ return null;
+}
+ECFieldElementFp.prototype.lucasSequence = function(P,Q,k)
+{
+ var n = k.bitLength();
+ var s = k.getLowestSetBit();
+
+ var Uh = BigInteger.ONE;
+ var Vl = BigInteger.TWO;
+ var Vh = P;
+ var Ql = BigInteger.ONE;
+ var Qh = BigInteger.ONE;
+
+ for (var j = n - 1; j >= s + 1; --j)
+ {
+ Ql = this.modMult(Ql, Qh);
+
+ if (k.testBit(j))
+ {
+ Qh = this.modMult(Ql, Q);
+ Uh = this.modMult(Uh, Vh);
+ Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql)));
+ Vh = this.modReduce(Vh.multiply(Vh).subtract(Qh.shiftLeft(1)));
+ }
+ else
+ {
+ Qh = Ql;
+ Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql));
+ Vh = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql)));
+ Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1)));
+ }
+ }
+
+ Ql = this.modMult(Ql, Qh);
+ Qh = this.modMult(Ql, Q);
+ Uh = this.modReduce(Uh.multiply(Vl).subtract(Ql));
+ Vl = this.modReduce(Vh.multiply(Vl).subtract(P.multiply(Ql)));
+ Ql = this.modMult(Ql, Qh);
+
+ for (var j = 1; j <= s; ++j)
+ {
+ Uh = this.modMult(Uh, Vl);
+ Vl = this.modReduce(Vl.multiply(Vl).subtract(Ql.shiftLeft(1)));
+ Ql = this.modMult(Ql, Ql);
+ }
+
+ return [ Uh, Vl ];
+}
+
+var exports = {
+ ECCurveFp: ECCurveFp,
+ ECPointFp: ECPointFp,
+ ECFieldElementFp: ECFieldElementFp
+}
+
+module.exports = exports
diff --git a/website_quotation_template/node_modules/ecc-jsbn/lib/sec.js b/website_quotation_template/node_modules/ecc-jsbn/lib/sec.js
new file mode 100755
index 000000000..5eec8179f
--- /dev/null
+++ b/website_quotation_template/node_modules/ecc-jsbn/lib/sec.js
@@ -0,0 +1,170 @@
+// Named EC curves
+
+// Requires ec.js, jsbn.js, and jsbn2.js
+var BigInteger = require('jsbn').BigInteger
+var ECCurveFp = require('./ec.js').ECCurveFp
+
+
+// ----------------
+// X9ECParameters
+
+// constructor
+function X9ECParameters(curve,g,n,h) {
+ this.curve = curve;
+ this.g = g;
+ this.n = n;
+ this.h = h;
+}
+
+function x9getCurve() {
+ return this.curve;
+}
+
+function x9getG() {
+ return this.g;
+}
+
+function x9getN() {
+ return this.n;
+}
+
+function x9getH() {
+ return this.h;
+}
+
+X9ECParameters.prototype.getCurve = x9getCurve;
+X9ECParameters.prototype.getG = x9getG;
+X9ECParameters.prototype.getN = x9getN;
+X9ECParameters.prototype.getH = x9getH;
+
+// ----------------
+// SECNamedCurves
+
+function fromHex(s) { return new BigInteger(s, 16); }
+
+function secp128r1() {
+ // p = 2^128 - 2^97 - 1
+ var p = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFF");
+ var a = fromHex("FFFFFFFDFFFFFFFFFFFFFFFFFFFFFFFC");
+ var b = fromHex("E87579C11079F43DD824993C2CEE5ED3");
+ //byte[] S = Hex.decode("000E0D4D696E6768756151750CC03A4473D03679");
+ var n = fromHex("FFFFFFFE0000000075A30D1B9038A115");
+ var h = BigInteger.ONE;
+ var curve = new ECCurveFp(p, a, b);
+ var G = curve.decodePointHex("04"
+ + "161FF7528B899B2D0C28607CA52C5B86"
+ + "CF5AC8395BAFEB13C02DA292DDED7A83");
+ return new X9ECParameters(curve, G, n, h);
+}
+
+function secp160k1() {
+ // p = 2^160 - 2^32 - 2^14 - 2^12 - 2^9 - 2^8 - 2^7 - 2^3 - 2^2 - 1
+ var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFAC73");
+ var a = BigInteger.ZERO;
+ var b = fromHex("7");
+ //byte[] S = null;
+ var n = fromHex("0100000000000000000001B8FA16DFAB9ACA16B6B3");
+ var h = BigInteger.ONE;
+ var curve = new ECCurveFp(p, a, b);
+ var G = curve.decodePointHex("04"
+ + "3B4C382CE37AA192A4019E763036F4F5DD4D7EBB"
+ + "938CF935318FDCED6BC28286531733C3F03C4FEE");
+ return new X9ECParameters(curve, G, n, h);
+}
+
+function secp160r1() {
+ // p = 2^160 - 2^31 - 1
+ var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFF");
+ var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF7FFFFFFC");
+ var b = fromHex("1C97BEFC54BD7A8B65ACF89F81D4D4ADC565FA45");
+ //byte[] S = Hex.decode("1053CDE42C14D696E67687561517533BF3F83345");
+ var n = fromHex("0100000000000000000001F4C8F927AED3CA752257");
+ var h = BigInteger.ONE;
+ var curve = new ECCurveFp(p, a, b);
+ var G = curve.decodePointHex("04"
+ + "4A96B5688EF573284664698968C38BB913CBFC82"
+ + "23A628553168947D59DCC912042351377AC5FB32");
+ return new X9ECParameters(curve, G, n, h);
+}
+
+function secp192k1() {
+ // p = 2^192 - 2^32 - 2^12 - 2^8 - 2^7 - 2^6 - 2^3 - 1
+ var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFEE37");
+ var a = BigInteger.ZERO;
+ var b = fromHex("3");
+ //byte[] S = null;
+ var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFE26F2FC170F69466A74DEFD8D");
+ var h = BigInteger.ONE;
+ var curve = new ECCurveFp(p, a, b);
+ var G = curve.decodePointHex("04"
+ + "DB4FF10EC057E9AE26B07D0280B7F4341DA5D1B1EAE06C7D"
+ + "9B2F2F6D9C5628A7844163D015BE86344082AA88D95E2F9D");
+ return new X9ECParameters(curve, G, n, h);
+}
+
+function secp192r1() {
+ // p = 2^192 - 2^64 - 1
+ var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFF");
+ var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFC");
+ var b = fromHex("64210519E59C80E70FA7E9AB72243049FEB8DEECC146B9B1");
+ //byte[] S = Hex.decode("3045AE6FC8422F64ED579528D38120EAE12196D5");
+ var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFF99DEF836146BC9B1B4D22831");
+ var h = BigInteger.ONE;
+ var curve = new ECCurveFp(p, a, b);
+ var G = curve.decodePointHex("04"
+ + "188DA80EB03090F67CBF20EB43A18800F4FF0AFD82FF1012"
+ + "07192B95FFC8DA78631011ED6B24CDD573F977A11E794811");
+ return new X9ECParameters(curve, G, n, h);
+}
+
+function secp224r1() {
+ // p = 2^224 - 2^96 + 1
+ var p = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFF000000000000000000000001");
+ var a = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFFFFFEFFFFFFFFFFFFFFFFFFFFFFFE");
+ var b = fromHex("B4050A850C04B3ABF54132565044B0B7D7BFD8BA270B39432355FFB4");
+ //byte[] S = Hex.decode("BD71344799D5C7FCDC45B59FA3B9AB8F6A948BC5");
+ var n = fromHex("FFFFFFFFFFFFFFFFFFFFFFFFFFFF16A2E0B8F03E13DD29455C5C2A3D");
+ var h = BigInteger.ONE;
+ var curve = new ECCurveFp(p, a, b);
+ var G = curve.decodePointHex("04"
+ + "B70E0CBD6BB4BF7F321390B94A03C1D356C21122343280D6115C1D21"
+ + "BD376388B5F723FB4C22DFE6CD4375A05A07476444D5819985007E34");
+ return new X9ECParameters(curve, G, n, h);
+}
+
+function secp256r1() {
+ // p = 2^224 (2^32 - 1) + 2^192 + 2^96 - 1
+ var p = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFF");
+ var a = fromHex("FFFFFFFF00000001000000000000000000000000FFFFFFFFFFFFFFFFFFFFFFFC");
+ var b = fromHex("5AC635D8AA3A93E7B3EBBD55769886BC651D06B0CC53B0F63BCE3C3E27D2604B");
+ //byte[] S = Hex.decode("C49D360886E704936A6678E1139D26B7819F7E90");
+ var n = fromHex("FFFFFFFF00000000FFFFFFFFFFFFFFFFBCE6FAADA7179E84F3B9CAC2FC632551");
+ var h = BigInteger.ONE;
+ var curve = new ECCurveFp(p, a, b);
+ var G = curve.decodePointHex("04"
+ + "6B17D1F2E12C4247F8BCE6E563A440F277037D812DEB33A0F4A13945D898C296"
+ + "4FE342E2FE1A7F9B8EE7EB4A7C0F9E162BCE33576B315ECECBB6406837BF51F5");
+ return new X9ECParameters(curve, G, n, h);
+}
+
+// TODO: make this into a proper hashtable
+function getSECCurveByName(name) {
+ if(name == "secp128r1") return secp128r1();
+ if(name == "secp160k1") return secp160k1();
+ if(name == "secp160r1") return secp160r1();
+ if(name == "secp192k1") return secp192k1();
+ if(name == "secp192r1") return secp192r1();
+ if(name == "secp224r1") return secp224r1();
+ if(name == "secp256r1") return secp256r1();
+ return null;
+}
+
+module.exports = {
+ "secp128r1":secp128r1,
+ "secp160k1":secp160k1,
+ "secp160r1":secp160r1,
+ "secp192k1":secp192k1,
+ "secp192r1":secp192r1,
+ "secp224r1":secp224r1,
+ "secp256r1":secp256r1
+}
diff --git a/website_quotation_template/node_modules/ecc-jsbn/package.json b/website_quotation_template/node_modules/ecc-jsbn/package.json
new file mode 100755
index 000000000..05834f73c
--- /dev/null
+++ b/website_quotation_template/node_modules/ecc-jsbn/package.json
@@ -0,0 +1,65 @@
+{
+ "_from": "ecc-jsbn@~0.1.1",
+ "_id": "ecc-jsbn@0.1.2",
+ "_inBundle": false,
+ "_integrity": "sha512-eh9O+hwRHNbG4BLTjEl3nw044CkGm5X6LoaCf7LPp7UU8Qrt47JYNi6nPX8xjW97TKGKm1ouctg0QSpZe9qrnw==",
+ "_location": "/ecc-jsbn",
+ "_phantomChildren": {},
+ "_requested": {
+ "type": "range",
+ "registry": true,
+ "raw": "ecc-jsbn@~0.1.1",
+ "name": "ecc-jsbn",
+ "escapedName": "ecc-jsbn",
+ "rawSpec": "~0.1.1",
+ "saveSpec": null,
+ "fetchSpec": "~0.1.1"
+ },
+ "_requiredBy": [
+ "/sshpk"
+ ],
+ "_resolved": "https://registry.npmjs.org/ecc-jsbn/-/ecc-jsbn-0.1.2.tgz",
+ "_shasum": "3a83a904e54353287874c564b7549386849a98c9",
+ "_spec": "ecc-jsbn@~0.1.1",
+ "_where": "/home/cybrosys/16odoo/custom/website_quotation_template_cybrosys/node_modules/sshpk",
+ "author": {
+ "name": "Jeremie Miller",
+ "email": "jeremie@jabber.org",
+ "url": "http://jeremie.com/"
+ },
+ "bugs": {
+ "url": "https://github.com/quartzjer/ecc-jsbn/issues"
+ },
+ "bundleDependencies": false,
+ "dependencies": {
+ "jsbn": "~0.1.0",
+ "safer-buffer": "^2.1.0"
+ },
+ "deprecated": false,
+ "description": "ECC JS code based on JSBN",
+ "homepage": "https://github.com/quartzjer/ecc-jsbn",
+ "keywords": [
+ "jsbn",
+ "ecc",
+ "browserify"
+ ],
+ "license": "MIT",
+ "main": "index.js",
+ "maintainers": [
+ {
+ "name": "Jeremie Miller",
+ "email": "jeremie@jabber.org",
+ "url": "http://jeremie.com/"
+ },
+ {
+ "name": "Ryan Bennett",
+ "url": "https://github.com/rynomad"
+ }
+ ],
+ "name": "ecc-jsbn",
+ "repository": {
+ "type": "git",
+ "url": "git+https://github.com/quartzjer/ecc-jsbn.git"
+ },
+ "version": "0.1.2"
+}
diff --git a/website_quotation_template/node_modules/ecc-jsbn/test.js b/website_quotation_template/node_modules/ecc-jsbn/test.js
new file mode 100755
index 000000000..bd52abfd9
--- /dev/null
+++ b/website_quotation_template/node_modules/ecc-jsbn/test.js
@@ -0,0 +1,14 @@
+var ecc = require("./index.js");
+var key1 = new ecc.ECKey(ecc.ECCurves.secp160r1);
+var key2 = new ecc.ECKey(ecc.ECCurves.secp160r1);
+console.log(key1.deriveSharedSecret(key2));
+var key3 = new ecc.ECKey(ecc.ECCurves.secp160r1,key1.PrivateKey);
+var key4 = new ecc.ECKey(ecc.ECCurves.secp160r1,key2.PublicKey,true);
+console.log(key3.deriveSharedSecret(key4));
+
+var key1 = new ecc.ECKey(ecc.ECCurves.secp256r1);
+var key2 = new ecc.ECKey(ecc.ECCurves.secp256r1);
+console.log(key1.deriveSharedSecret(key2));
+var key3 = new ecc.ECKey(ecc.ECCurves.secp256r1,key1.PrivateKey);
+var key4 = new ecc.ECKey(ecc.ECCurves.secp256r1,key2.PublicKey,true);
+console.log(key3.deriveSharedSecret(key4));
diff --git a/website_quotation_template/node_modules/es6-promise/CHANGELOG.md b/website_quotation_template/node_modules/es6-promise/CHANGELOG.md
new file mode 100644
index 000000000..d630cc0dc
--- /dev/null
+++ b/website_quotation_template/node_modules/es6-promise/CHANGELOG.md
@@ -0,0 +1,155 @@
+# Master
+
+# 4.2.5
+
+* remove old try/catch performance hacks, modern runtimes do not require these tricks
+
+# 4.2.4
+
+* [Fixes #305] Confuse webpack
+
+# 4.2.3
+
+* Cleanup testem related build configuration
+* Use `prepublishOnly` instead of `prepublish` (thanks @rhysd)
+* Add Node.js 9, 8 to testing matrix
+* drop now unused s3 deployment files
+* internal cleanup (thanks to @bekzod, @mariusschulz)
+* Fixup Changelog
+
+# 4.2.2
+
+* Ensure PROMISE_ID works correctly
+* internal cleanup (thanks yo @mariusschulz)
+
+# 4.2.1
+
+* drop bower support
+
+# 4.2.0
+
+* drop `dist` from git repo
+* add `Promise.prototype.finally`
+* update various build related dependencies
+* add CDN links
+
+# 4.1.0
+
+* [BUGFIX] Fix memory leak [#269]
+* [BUGFIX] Auto Bundles within an AMD Environment [#263]
+
+# 4.0.5
+
+* fix require('es6-promise/auto') for Node < 4
+
+# 4.0.4
+
+* fix asap when using https://github.com/Kinvey/titanium-sdk
+
+# 4.0.3
+
+* fix Readme links
+
+# 4.0.2
+
+* fix require('es6-promise/auto');
+
+# 4.0.0
+
+* no longer polyfill automatically, if needed one can still invoke
+ `require('es6-promise/auto')` directly.
+
+# 3.3.1
+
+* fix links in readme
+
+# 3.3.0
+
+* support polyfil on WebMAF (playstation env)
+* fix tampering related bug global `constructor` was referenced by mistake.
+* provide TS Typings
+* increase compatibliity with sinon.useFakeTimers();
+* update build tools (use rollup)
+* directly export promise;
+
+# 3.2.2
+
+* IE8: use isArray
+* update build dependencies
+
+# 3.2.1
+
+* fix race tampering issue
+* use eslint
+* fix Promise.all tampering
+* remove unused code
+* fix issues with NWJS/electron
+
+# 3.2.0
+
+* improve tamper resistence of Promise.all Promise.race and
+ Promise.prototype.then (note, this isn't complete, but addresses an exception
+ when used \w core-js, follow up work will address entirely)
+* remove spec incompatible then chaining fast-path
+* add eslint
+* update build deps
+
+# 3.1.2
+
+* fix node detection issues with NWJS/electron
+
+# 3.1.0
+
+* improve performance of Promise.all when it encounters a non-promise input object input
+* then/resolve tamper protection
+* reduce AST size of promise constructor, to facilitate more inlining
+* Update README.md with details about PhantomJS requirement for running tests
+* Mangle and compress the minified version
+
+# 3.0.2
+
+* correctly bump both bower and package.json versions
+
+# 3.0.1
+
+* no longer include dist/test in npm releases
+
+# 3.0.0
+
+* use nextTick() instead of setImmediate() to schedule microtasks with node 0.10. Later versions of
+ nodes are not affected as they were already using nextTick(). Note that using nextTick() might
+ trigger a depreciation warning on 0.10 as described at https://github.com/cujojs/when/issues/410.
+ The reason why nextTick() is preferred is that is setImmediate() would schedule a macrotask
+ instead of a microtask and might result in a different scheduling.
+ If needed you can revert to the former behavior as follow:
+
+ var Promise = require('es6-promise').Promise;
+ Promise._setScheduler(setImmediate);
+
+# 2.3.0
+
+* #121: Ability to override the internal asap implementation
+* #120: Use an ascii character for an apostrophe, for source maps
+
+# 2.2.0
+
+* #116: Expose asap() and a way to override the scheduling mechanism on Promise
+* Lock to v0.2.3 of ember-cli
+
+# 2.1.1
+
+* Fix #100 via #105: tell browserify to ignore vertx require
+* Fix #101 via #102: "follow thenable state, not own state"
+
+# 2.1.0
+
+* #59: Automatic polyfill. No need to invoke `ES6Promise.polyfill()` anymore.
+* ... (see the commit log)
+
+# 2.0.0
+
+* re-sync with RSVP. Many large performance improvements and bugfixes.
+
+# 1.0.0
+
+* first subset of RSVP
diff --git a/website_quotation_template/node_modules/es6-promise/LICENSE b/website_quotation_template/node_modules/es6-promise/LICENSE
new file mode 100644
index 000000000..954ec5992
--- /dev/null
+++ b/website_quotation_template/node_modules/es6-promise/LICENSE
@@ -0,0 +1,19 @@
+Copyright (c) 2014 Yehuda Katz, Tom Dale, Stefan Penner and contributors
+
+Permission is hereby granted, free of charge, to any person obtaining a copy of
+this software and associated documentation files (the "Software"), to deal in
+the Software without restriction, including without limitation the rights to
+use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies
+of the Software, and to permit persons to whom the Software is furnished to do
+so, subject to the following conditions:
+
+The above copyright notice and this permission notice shall be included in all
+copies or substantial portions of the Software.
+
+THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE
+SOFTWARE.
diff --git a/website_quotation_template/node_modules/es6-promise/README.md b/website_quotation_template/node_modules/es6-promise/README.md
new file mode 100644
index 000000000..951db75fa
--- /dev/null
+++ b/website_quotation_template/node_modules/es6-promise/README.md
@@ -0,0 +1,97 @@
+# ES6-Promise (subset of [rsvp.js](https://github.com/tildeio/rsvp.js)) [](https://travis-ci.org/stefanpenner/es6-promise)
+
+This is a polyfill of the [ES6 Promise](http://www.ecma-international.org/ecma-262/6.0/#sec-promise-constructor). The implementation is a subset of [rsvp.js](https://github.com/tildeio/rsvp.js) extracted by @jakearchibald, if you're wanting extra features and more debugging options, check out the [full library](https://github.com/tildeio/rsvp.js).
+
+For API details and how to use promises, see the JavaScript Promises HTML5Rocks article .
+
+## Downloads
+
+* [es6-promise 27.86 KB (7.33 KB gzipped)](https://cdn.jsdelivr.net/npm/es6-promise/dist/es6-promise.js)
+* [es6-promise-auto 27.78 KB (7.3 KB gzipped)](https://cdn.jsdelivr.net/npm/es6-promise/dist/es6-promise.auto.js) - Automatically provides/replaces `Promise` if missing or broken.
+* [es6-promise-min 6.17 KB (2.4 KB gzipped)](https://cdn.jsdelivr.net/npm/es6-promise/dist/es6-promise.min.js)
+* [es6-promise-auto-min 6.19 KB (2.4 KB gzipped)](https://cdn.jsdelivr.net/npm/es6-promise/dist/es6-promise.auto.min.js) - Minified version of `es6-promise-auto` above.
+
+## CDN
+
+To use via a CDN include this in your html:
+
+```html
+
+
+
+
+
+
+
+
+```
+
+## Node.js
+
+To install:
+
+```sh
+yarn add es6-promise
+```
+
+or
+
+```sh
+npm install es6-promise
+```
+
+To use:
+
+```js
+var Promise = require('es6-promise').Promise;
+```
+
+
+## Usage in IE<9
+
+`catch` and `finally` are reserved keywords in IE<9, meaning
+`promise.catch(func)` or `promise.finally(func)` throw a syntax error. To work
+around this, you can use a string to access the property as shown in the
+following example.
+
+However most minifiers will automatically fix this for you, making the
+resulting code safe for old browsers and production:
+
+```js
+promise['catch'](function(err) {
+ // ...
+});
+```
+
+```js
+promise['finally'](function() {
+ // ...
+});
+```
+
+## Auto-polyfill
+
+To polyfill the global environment (either in Node or in the browser via CommonJS) use the following code snippet:
+
+```js
+require('es6-promise').polyfill();
+```
+
+Alternatively
+
+```js
+require('es6-promise/auto');
+```
+
+Notice that we don't assign the result of `polyfill()` to any variable. The `polyfill()` method will patch the global environment (in this case to the `Promise` name) when called.
+
+## Building & Testing
+
+You will need to have PhantomJS installed globally in order to run the tests.
+
+`npm install -g phantomjs`
+
+* `npm run build` to build
+* `npm test` to run tests
+* `npm start` to run a build watcher, and webserver to test
+* `npm run test:server` for a testem test runner and watching builder
diff --git a/website_quotation_template/node_modules/es6-promise/auto.js b/website_quotation_template/node_modules/es6-promise/auto.js
new file mode 100644
index 000000000..92bbf36e5
--- /dev/null
+++ b/website_quotation_template/node_modules/es6-promise/auto.js
@@ -0,0 +1,4 @@
+// This file can be required in Browserify and Node.js for automatic polyfill
+// To use it: require('es6-promise/auto');
+'use strict';
+module.exports = require('./').polyfill();
diff --git a/website_quotation_template/node_modules/es6-promise/es6-promise.d.ts b/website_quotation_template/node_modules/es6-promise/es6-promise.d.ts
new file mode 100644
index 000000000..e4200dfd0
--- /dev/null
+++ b/website_quotation_template/node_modules/es6-promise/es6-promise.d.ts
@@ -0,0 +1,85 @@
+export interface Thenable {
+ then (onFulfilled?: (value: R) => U | Thenable, onRejected?: (error: any) => U | Thenable): Thenable;
+ then (onFulfilled?: (value: R) => U | Thenable, onRejected?: (error: any) => void): Thenable;
+}
+
+export class Promise implements Thenable {
+ /**
+ * If you call resolve in the body of the callback passed to the constructor,
+ * your promise is fulfilled with result object passed to resolve.
+ * If you call reject your promise is rejected with the object passed to resolve.
+ * For consistency and debugging (eg stack traces), obj should be an instanceof Error.
+ * Any errors thrown in the constructor callback will be implicitly passed to reject().
+ */
+ constructor (callback: (resolve : (value?: R | Thenable) => void, reject: (error?: any) => void) => void);
+
+ /**
+ * onFulfilled is called when/if "promise" resolves. onRejected is called when/if "promise" rejects.
+ * Both are optional, if either/both are omitted the next onFulfilled/onRejected in the chain is called.
+ * Both callbacks have a single parameter , the fulfillment value or rejection reason.
+ * "then" returns a new promise equivalent to the value you return from onFulfilled/onRejected after being passed through Promise.resolve.
+ * If an error is thrown in the callback, the returned promise rejects with that error.
+ *
+ * @param onFulfilled called when/if "promise" resolves
+ * @param onRejected called when/if "promise" rejects
+ */
+ then (onFulfilled?: (value: R) => U | Thenable, onRejected?: (error: any) => U | Thenable): Promise;
+ then (onFulfilled?: (value: R) => U | Thenable, onRejected?: (error: any) => void): Promise;
+
+ /**
+ * Sugar for promise.then(undefined, onRejected)
+ *
+ * @param onRejected called when/if "promise" rejects
+ */
+ catch (onRejected?: (error: any) => U | Thenable): Promise;
+
+ /**
+ * onSettled is invoked when/if the "promise" settles (either rejects or fulfills).
+ * The returned promise is settled when the `Thenable` returned by `onFinally` settles;
+ * it is rejected if `onFinally` throws or rejects; otherwise it assumes the state of the
+ * original Promise.
+ *
+ * @param onFinally called when/if "promise" settles
+
+ */
+ finally (onFinally?: () => any | Thenable): Promise;
+
+ /**
+ * Make a new promise from the thenable.
+ * A thenable is promise-like in as far as it has a "then" method.
+ */
+ static resolve (): Promise;
+ static resolve (value: R | Thenable): Promise;
+
+ /**
+ * Make a promise that rejects to obj. For consistency and debugging (eg stack traces), obj should be an instanceof Error
+ */
+ static reject (error: any): Promise;
+
+ /**
+ * Make a promise that fulfills when every item in the array fulfills, and rejects if (and when) any item rejects.
+ * the array passed to all can be a mixture of promise-like objects and other objects.
+ * The fulfillment value is an array (in order) of fulfillment values. The rejection value is the first rejection value.
+ */
+ static all(values: [T1 | Thenable, T2 | Thenable, T3 | Thenable, T4 | Thenable , T5 | Thenable, T6 | Thenable, T7 | Thenable, T8 | Thenable, T9 | Thenable, T10 | Thenable]): Promise<[T1, T2, T3, T4, T5, T6, T7, T8, T9, T10]>;
+ static all(values: [T1 | Thenable, T2 | Thenable, T3 | Thenable, T4 | Thenable , T5 | Thenable, T6 | Thenable, T7 | Thenable, T8 | Thenable, T9 | Thenable]): Promise<[T1, T2, T3, T4, T5, T6, T7, T8, T9]>;
+ static all(values: [T1 | Thenable, T2 | Thenable, T3 | Thenable, T4 | Thenable , T5 | Thenable, T6 | Thenable, T7 | Thenable, T8 | Thenable]): Promise<[T1, T2, T3, T4, T5, T6, T7, T8]>;
+ static all(values: [T1 | Thenable, T2 | Thenable, T3 | Thenable, T4 | Thenable , T5 | Thenable, T6 | Thenable, T7 | Thenable]): Promise<[T1, T2, T3, T4, T5, T6, T7]>;
+ static all(values: [T1 | Thenable, T2 | Thenable, T3 | Thenable, T4 | Thenable , T5 | Thenable, T6 | Thenable]): Promise<[T1, T2, T3, T4, T5, T6]>;
+ static all(values: [T1 | Thenable, T2 | Thenable, T3 | Thenable, T4 | Thenable , T5 | Thenable 
+
+# Ajv: Another JSON Schema Validator
+
+The fastest JSON Schema validator for Node.js and browser. Supports draft-04/06/07.
+
+[](https://travis-ci.org/ajv-validator/ajv)
+[](https://www.npmjs.com/package/ajv)
+[](https://www.npmjs.com/package/ajv/v/7.0.0-beta.0)
+[](https://www.npmjs.com/package/ajv)
+[](https://coveralls.io/github/ajv-validator/ajv?branch=master)
+[](https://gitter.im/ajv-validator/ajv)
+[](https://github.com/sponsors/epoberezkin)
+
+
+## Ajv v7 beta is released
+
+[Ajv version 7.0.0-beta.0](https://github.com/ajv-validator/ajv/tree/v7-beta) is released with these changes:
+
+- to reduce the mistakes in JSON schemas and unexpected validation results, [strict mode](./docs/strict-mode.md) is added - it prohibits ignored or ambiguous JSON Schema elements.
+- to make code injection from untrusted schemas impossible, [code generation](./docs/codegen.md) is fully re-written to be safe.
+- to simplify Ajv extensions, the new keyword API that is used by pre-defined keywords is available to user-defined keywords - it is much easier to define any keywords now, especially with subschemas.
+- schemas are compiled to ES6 code (ES5 code generation is supported with an option).
+- to improve reliability and maintainability the code is migrated to TypeScript.
+
+**Please note**:
+
+- the support for JSON-Schema draft-04 is removed - if you have schemas using "id" attributes you have to replace them with "\$id" (or continue using version 6 that will be supported until 02/28/2021).
+- all formats are separated to ajv-formats package - they have to be explicitely added if you use them.
+
+See [release notes](https://github.com/ajv-validator/ajv/releases/tag/v7.0.0-beta.0) for the details.
+
+To install the new version:
+
+```bash
+npm install ajv@beta
+```
+
+See [Getting started with v7](https://github.com/ajv-validator/ajv/tree/v7-beta#usage) for code example.
+
+
+## Mozilla MOSS grant and OpenJS Foundation
+
+[
](https://www.mozilla.org/en-US/moss/) [
](https://openjsf.org/blog/2020/08/14/ajv-joins-openjs-foundation-as-an-incubation-project/)
+
+Ajv has been awarded a grant from Mozilla’s [Open Source Support (MOSS) program](https://www.mozilla.org/en-US/moss/) in the “Foundational Technology” track! It will sponsor the development of Ajv support of [JSON Schema version 2019-09](https://tools.ietf.org/html/draft-handrews-json-schema-02) and of [JSON Type Definition](https://tools.ietf.org/html/draft-ucarion-json-type-definition-04).
+
+Ajv also joined [OpenJS Foundation](https://openjsf.org/) – having this support will help ensure the longevity and stability of Ajv for all its users.
+
+This [blog post](https://www.poberezkin.com/posts/2020-08-14-ajv-json-validator-mozilla-open-source-grant-openjs-foundation.html) has more details.
+
+I am looking for the long term maintainers of Ajv – working with [ReadySet](https://www.thereadyset.co/), also sponsored by Mozilla, to establish clear guidelines for the role of a "maintainer" and the contribution standards, and to encourage a wider, more inclusive, contribution from the community.
+
+
+## Please [sponsor Ajv development](https://github.com/sponsors/epoberezkin)
+
+Since I asked to support Ajv development 40 people and 6 organizations contributed via GitHub and OpenCollective - this support helped receiving the MOSS grant!
+
+Your continuing support is very important - the funds will be used to develop and maintain Ajv once the next major version is released.
+
+Please sponsor Ajv via:
+- [GitHub sponsors page](https://github.com/sponsors/epoberezkin) (GitHub will match it)
+- [Ajv Open Collective️](https://opencollective.com/ajv)
+
+Thank you.
+
+
+#### Open Collective sponsors
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+## Using version 6
+
+[JSON Schema draft-07](http://json-schema.org/latest/json-schema-validation.html) is published.
+
+[Ajv version 6.0.0](https://github.com/ajv-validator/ajv/releases/tag/v6.0.0) that supports draft-07 is released. It may require either migrating your schemas or updating your code (to continue using draft-04 and v5 schemas, draft-06 schemas will be supported without changes).
+
+__Please note__: To use Ajv with draft-06 schemas you need to explicitly add the meta-schema to the validator instance:
+
+```javascript
+ajv.addMetaSchema(require('ajv/lib/refs/json-schema-draft-06.json'));
+```
+
+To use Ajv with draft-04 schemas in addition to explicitly adding meta-schema you also need to use option schemaId:
+
+```javascript
+var ajv = new Ajv({schemaId: 'id'});
+// If you want to use both draft-04 and draft-06/07 schemas:
+// var ajv = new Ajv({schemaId: 'auto'});
+ajv.addMetaSchema(require('ajv/lib/refs/json-schema-draft-04.json'));
+```
+
+
+## Contents
+
+- [Performance](#performance)
+- [Features](#features)
+- [Getting started](#getting-started)
+- [Frequently Asked Questions](https://github.com/ajv-validator/ajv/blob/master/FAQ.md)
+- [Using in browser](#using-in-browser)
+ - [Ajv and Content Security Policies (CSP)](#ajv-and-content-security-policies-csp)
+- [Command line interface](#command-line-interface)
+- Validation
+ - [Keywords](#validation-keywords)
+ - [Annotation keywords](#annotation-keywords)
+ - [Formats](#formats)
+ - [Combining schemas with $ref](#ref)
+ - [$data reference](#data-reference)
+ - NEW: [$merge and $patch keywords](#merge-and-patch-keywords)
+ - [Defining custom keywords](#defining-custom-keywords)
+ - [Asynchronous schema compilation](#asynchronous-schema-compilation)
+ - [Asynchronous validation](#asynchronous-validation)
+- [Security considerations](#security-considerations)
+ - [Security contact](#security-contact)
+ - [Untrusted schemas](#untrusted-schemas)
+ - [Circular references in objects](#circular-references-in-javascript-objects)
+ - [Trusted schemas](#security-risks-of-trusted-schemas)
+ - [ReDoS attack](#redos-attack)
+- Modifying data during validation
+ - [Filtering data](#filtering-data)
+ - [Assigning defaults](#assigning-defaults)
+ - [Coercing data types](#coercing-data-types)
+- API
+ - [Methods](#api)
+ - [Options](#options)
+ - [Validation errors](#validation-errors)
+- [Plugins](#plugins)
+- [Related packages](#related-packages)
+- [Some packages using Ajv](#some-packages-using-ajv)
+- [Tests, Contributing, Changes history](#tests)
+- [Support, Code of conduct, License](#open-source-software-support)
+
+
+## Performance
+
+Ajv generates code using [doT templates](https://github.com/olado/doT) to turn JSON Schemas into super-fast validation functions that are efficient for v8 optimization.
+
+Currently Ajv is the fastest and the most standard compliant validator according to these benchmarks:
+
+- [json-schema-benchmark](https://github.com/ebdrup/json-schema-benchmark) - 50% faster than the second place
+- [jsck benchmark](https://github.com/pandastrike/jsck#benchmarks) - 20-190% faster
+- [z-schema benchmark](https://rawgit.com/zaggino/z-schema/master/benchmark/results.html)
+- [themis benchmark](https://cdn.rawgit.com/playlyfe/themis/master/benchmark/results.html)
+
+
+Performance of different validators by [json-schema-benchmark](https://github.com/ebdrup/json-schema-benchmark):
+
+[](https://github.com/ebdrup/json-schema-benchmark/blob/master/README.md#performance)
+
+
+## Features
+
+- Ajv implements full JSON Schema [draft-06/07](http://json-schema.org/) and draft-04 standards:
+ - all validation keywords (see [JSON Schema validation keywords](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md))
+ - full support of remote refs (remote schemas have to be added with `addSchema` or compiled to be available)
+ - support of circular references between schemas
+ - correct string lengths for strings with unicode pairs (can be turned off)
+ - [formats](#formats) defined by JSON Schema draft-07 standard and custom formats (can be turned off)
+ - [validates schemas against meta-schema](#api-validateschema)
+- supports [browsers](#using-in-browser) and Node.js 0.10-14.x
+- [asynchronous loading](#asynchronous-schema-compilation) of referenced schemas during compilation
+- "All errors" validation mode with [option allErrors](#options)
+- [error messages with parameters](#validation-errors) describing error reasons to allow creating custom error messages
+- i18n error messages support with [ajv-i18n](https://github.com/ajv-validator/ajv-i18n) package
+- [filtering data](#filtering-data) from additional properties
+- [assigning defaults](#assigning-defaults) to missing properties and items
+- [coercing data](#coercing-data-types) to the types specified in `type` keywords
+- [custom keywords](#defining-custom-keywords)
+- draft-06/07 keywords `const`, `contains`, `propertyNames` and `if/then/else`
+- draft-06 boolean schemas (`true`/`false` as a schema to always pass/fail).
+- keywords `switch`, `patternRequired`, `formatMaximum` / `formatMinimum` and `formatExclusiveMaximum` / `formatExclusiveMinimum` from [JSON Schema extension proposals](https://github.com/json-schema/json-schema/wiki/v5-Proposals) with [ajv-keywords](https://github.com/ajv-validator/ajv-keywords) package
+- [$data reference](#data-reference) to use values from the validated data as values for the schema keywords
+- [asynchronous validation](#asynchronous-validation) of custom formats and keywords
+
+
+## Install
+
+```
+npm install ajv
+```
+
+
+## Getting started
+
+Try it in the Node.js REPL: https://tonicdev.com/npm/ajv
+
+
+The fastest validation call:
+
+```javascript
+// Node.js require:
+var Ajv = require('ajv');
+// or ESM/TypeScript import
+import Ajv from 'ajv';
+
+var ajv = new Ajv(); // options can be passed, e.g. {allErrors: true}
+var validate = ajv.compile(schema);
+var valid = validate(data);
+if (!valid) console.log(validate.errors);
+```
+
+or with less code
+
+```javascript
+// ...
+var valid = ajv.validate(schema, data);
+if (!valid) console.log(ajv.errors);
+// ...
+```
+
+or
+
+```javascript
+// ...
+var valid = ajv.addSchema(schema, 'mySchema')
+ .validate('mySchema', data);
+if (!valid) console.log(ajv.errorsText());
+// ...
+```
+
+See [API](#api) and [Options](#options) for more details.
+
+Ajv compiles schemas to functions and caches them in all cases (using schema serialized with [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) or a custom function as a key), so that the next time the same schema is used (not necessarily the same object instance) it won't be compiled again.
+
+The best performance is achieved when using compiled functions returned by `compile` or `getSchema` methods (there is no additional function call).
+
+__Please note__: every time a validation function or `ajv.validate` are called `errors` property is overwritten. You need to copy `errors` array reference to another variable if you want to use it later (e.g., in the callback). See [Validation errors](#validation-errors)
+
+__Note for TypeScript users__: `ajv` provides its own TypeScript declarations
+out of the box, so you don't need to install the deprecated `@types/ajv`
+module.
+
+
+## Using in browser
+
+You can require Ajv directly from the code you browserify - in this case Ajv will be a part of your bundle.
+
+If you need to use Ajv in several bundles you can create a separate UMD bundle using `npm run bundle` script (thanks to [siddo420](https://github.com/siddo420)).
+
+Then you need to load Ajv in the browser:
+```html
+
+```
+
+This bundle can be used with different module systems; it creates global `Ajv` if no module system is found.
+
+The browser bundle is available on [cdnjs](https://cdnjs.com/libraries/ajv).
+
+Ajv is tested with these browsers:
+
+[](https://saucelabs.com/u/epoberezkin)
+
+__Please note__: some frameworks, e.g. Dojo, may redefine global require in such way that is not compatible with CommonJS module format. In such case Ajv bundle has to be loaded before the framework and then you can use global Ajv (see issue [#234](https://github.com/ajv-validator/ajv/issues/234)).
+
+
+### Ajv and Content Security Policies (CSP)
+
+If you're using Ajv to compile a schema (the typical use) in a browser document that is loaded with a Content Security Policy (CSP), that policy will require a `script-src` directive that includes the value `'unsafe-eval'`.
+:warning: NOTE, however, that `unsafe-eval` is NOT recommended in a secure CSP[[1]](https://developer.chrome.com/extensions/contentSecurityPolicy#relaxing-eval), as it has the potential to open the document to cross-site scripting (XSS) attacks.
+
+In order to make use of Ajv without easing your CSP, you can [pre-compile a schema using the CLI](https://github.com/ajv-validator/ajv-cli#compile-schemas). This will transpile the schema JSON into a JavaScript file that exports a `validate` function that works simlarly to a schema compiled at runtime.
+
+Note that pre-compilation of schemas is performed using [ajv-pack](https://github.com/ajv-validator/ajv-pack) and there are [some limitations to the schema features it can compile](https://github.com/ajv-validator/ajv-pack#limitations). A successfully pre-compiled schema is equivalent to the same schema compiled at runtime.
+
+
+## Command line interface
+
+CLI is available as a separate npm package [ajv-cli](https://github.com/ajv-validator/ajv-cli). It supports:
+
+- compiling JSON Schemas to test their validity
+- BETA: generating standalone module exporting a validation function to be used without Ajv (using [ajv-pack](https://github.com/ajv-validator/ajv-pack))
+- migrate schemas to draft-07 (using [json-schema-migrate](https://github.com/epoberezkin/json-schema-migrate))
+- validating data file(s) against JSON Schema
+- testing expected validity of data against JSON Schema
+- referenced schemas
+- custom meta-schemas
+- files in JSON, JSON5, YAML, and JavaScript format
+- all Ajv options
+- reporting changes in data after validation in [JSON-patch](https://tools.ietf.org/html/rfc6902) format
+
+
+## Validation keywords
+
+Ajv supports all validation keywords from draft-07 of JSON Schema standard:
+
+- [type](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#type)
+- [for numbers](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#keywords-for-numbers) - maximum, minimum, exclusiveMaximum, exclusiveMinimum, multipleOf
+- [for strings](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#keywords-for-strings) - maxLength, minLength, pattern, format
+- [for arrays](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#keywords-for-arrays) - maxItems, minItems, uniqueItems, items, additionalItems, [contains](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#contains)
+- [for objects](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#keywords-for-objects) - maxProperties, minProperties, required, properties, patternProperties, additionalProperties, dependencies, [propertyNames](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#propertynames)
+- [for all types](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#keywords-for-all-types) - enum, [const](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#const)
+- [compound keywords](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#compound-keywords) - not, oneOf, anyOf, allOf, [if/then/else](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#ifthenelse)
+
+With [ajv-keywords](https://github.com/ajv-validator/ajv-keywords) package Ajv also supports validation keywords from [JSON Schema extension proposals](https://github.com/json-schema/json-schema/wiki/v5-Proposals) for JSON Schema standard:
+
+- [patternRequired](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#patternrequired-proposed) - like `required` but with patterns that some property should match.
+- [formatMaximum, formatMinimum, formatExclusiveMaximum, formatExclusiveMinimum](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md#formatmaximum--formatminimum-and-exclusiveformatmaximum--exclusiveformatminimum-proposed) - setting limits for date, time, etc.
+
+See [JSON Schema validation keywords](https://github.com/ajv-validator/ajv/blob/master/KEYWORDS.md) for more details.
+
+
+## Annotation keywords
+
+JSON Schema specification defines several annotation keywords that describe schema itself but do not perform any validation.
+
+- `title` and `description`: information about the data represented by that schema
+- `$comment` (NEW in draft-07): information for developers. With option `$comment` Ajv logs or passes the comment string to the user-supplied function. See [Options](#options).
+- `default`: a default value of the data instance, see [Assigning defaults](#assigning-defaults).
+- `examples` (NEW in draft-06): an array of data instances. Ajv does not check the validity of these instances against the schema.
+- `readOnly` and `writeOnly` (NEW in draft-07): marks data-instance as read-only or write-only in relation to the source of the data (database, api, etc.).
+- `contentEncoding`: [RFC 2045](https://tools.ietf.org/html/rfc2045#section-6.1 ), e.g., "base64".
+- `contentMediaType`: [RFC 2046](https://tools.ietf.org/html/rfc2046), e.g., "image/png".
+
+__Please note__: Ajv does not implement validation of the keywords `examples`, `contentEncoding` and `contentMediaType` but it reserves them. If you want to create a plugin that implements some of them, it should remove these keywords from the instance.
+
+
+## Formats
+
+Ajv implements formats defined by JSON Schema specification and several other formats. It is recommended NOT to use "format" keyword implementations with untrusted data, as they use potentially unsafe regular expressions - see [ReDoS attack](#redos-attack).
+
+__Please note__: if you need to use "format" keyword to validate untrusted data, you MUST assess their suitability and safety for your validation scenarios.
+
+The following formats are implemented for string validation with "format" keyword:
+
+- _date_: full-date according to [RFC3339](http://tools.ietf.org/html/rfc3339#section-5.6).
+- _time_: time with optional time-zone.
+- _date-time_: date-time from the same source (time-zone is mandatory). `date`, `time` and `date-time` validate ranges in `full` mode and only regexp in `fast` mode (see [options](#options)).
+- _uri_: full URI.
+- _uri-reference_: URI reference, including full and relative URIs.
+- _uri-template_: URI template according to [RFC6570](https://tools.ietf.org/html/rfc6570)
+- _url_ (deprecated): [URL record](https://url.spec.whatwg.org/#concept-url).
+- _email_: email address.
+- _hostname_: host name according to [RFC1034](http://tools.ietf.org/html/rfc1034#section-3.5).
+- _ipv4_: IP address v4.
+- _ipv6_: IP address v6.
+- _regex_: tests whether a string is a valid regular expression by passing it to RegExp constructor.
+- _uuid_: Universally Unique IDentifier according to [RFC4122](http://tools.ietf.org/html/rfc4122).
+- _json-pointer_: JSON-pointer according to [RFC6901](https://tools.ietf.org/html/rfc6901).
+- _relative-json-pointer_: relative JSON-pointer according to [this draft](http://tools.ietf.org/html/draft-luff-relative-json-pointer-00).
+
+__Please note__: JSON Schema draft-07 also defines formats `iri`, `iri-reference`, `idn-hostname` and `idn-email` for URLs, hostnames and emails with international characters. Ajv does not implement these formats. If you create Ajv plugin that implements them please make a PR to mention this plugin here.
+
+There are two modes of format validation: `fast` and `full`. This mode affects formats `date`, `time`, `date-time`, `uri`, `uri-reference`, and `email`. See [Options](#options) for details.
+
+You can add additional formats and replace any of the formats above using [addFormat](#api-addformat) method.
+
+The option `unknownFormats` allows changing the default behaviour when an unknown format is encountered. In this case Ajv can either fail schema compilation (default) or ignore it (default in versions before 5.0.0). You also can allow specific format(s) that will be ignored. See [Options](#options) for details.
+
+You can find regular expressions used for format validation and the sources that were used in [formats.js](https://github.com/ajv-validator/ajv/blob/master/lib/compile/formats.js).
+
+
+## Combining schemas with $ref
+
+You can structure your validation logic across multiple schema files and have schemas reference each other using `$ref` keyword.
+
+Example:
+
+```javascript
+var schema = {
+ "$id": "http://example.com/schemas/schema.json",
+ "type": "object",
+ "properties": {
+ "foo": { "$ref": "defs.json#/definitions/int" },
+ "bar": { "$ref": "defs.json#/definitions/str" }
+ }
+};
+
+var defsSchema = {
+ "$id": "http://example.com/schemas/defs.json",
+ "definitions": {
+ "int": { "type": "integer" },
+ "str": { "type": "string" }
+ }
+};
+```
+
+Now to compile your schema you can either pass all schemas to Ajv instance:
+
+```javascript
+var ajv = new Ajv({schemas: [schema, defsSchema]});
+var validate = ajv.getSchema('http://example.com/schemas/schema.json');
+```
+
+or use `addSchema` method:
+
+```javascript
+var ajv = new Ajv;
+var validate = ajv.addSchema(defsSchema)
+ .compile(schema);
+```
+
+See [Options](#options) and [addSchema](#api) method.
+
+__Please note__:
+- `$ref` is resolved as the uri-reference using schema $id as the base URI (see the example).
+- References can be recursive (and mutually recursive) to implement the schemas for different data structures (such as linked lists, trees, graphs, etc.).
+- You don't have to host your schema files at the URIs that you use as schema $id. These URIs are only used to identify the schemas, and according to JSON Schema specification validators should not expect to be able to download the schemas from these URIs.
+- The actual location of the schema file in the file system is not used.
+- You can pass the identifier of the schema as the second parameter of `addSchema` method or as a property name in `schemas` option. This identifier can be used instead of (or in addition to) schema $id.
+- You cannot have the same $id (or the schema identifier) used for more than one schema - the exception will be thrown.
+- You can implement dynamic resolution of the referenced schemas using `compileAsync` method. In this way you can store schemas in any system (files, web, database, etc.) and reference them without explicitly adding to Ajv instance. See [Asynchronous schema compilation](#asynchronous-schema-compilation).
+
+
+## $data reference
+
+With `$data` option you can use values from the validated data as the values for the schema keywords. See [proposal](https://github.com/json-schema-org/json-schema-spec/issues/51) for more information about how it works.
+
+`$data` reference is supported in the keywords: const, enum, format, maximum/minimum, exclusiveMaximum / exclusiveMinimum, maxLength / minLength, maxItems / minItems, maxProperties / minProperties, formatMaximum / formatMinimum, formatExclusiveMaximum / formatExclusiveMinimum, multipleOf, pattern, required, uniqueItems.
+
+The value of "$data" should be a [JSON-pointer](https://tools.ietf.org/html/rfc6901) to the data (the root is always the top level data object, even if the $data reference is inside a referenced subschema) or a [relative JSON-pointer](http://tools.ietf.org/html/draft-luff-relative-json-pointer-00) (it is relative to the current point in data; if the $data reference is inside a referenced subschema it cannot point to the data outside of the root level for this subschema).
+
+Examples.
+
+This schema requires that the value in property `smaller` is less or equal than the value in the property larger:
+
+```javascript
+var ajv = new Ajv({$data: true});
+
+var schema = {
+ "properties": {
+ "smaller": {
+ "type": "number",
+ "maximum": { "$data": "1/larger" }
+ },
+ "larger": { "type": "number" }
+ }
+};
+
+var validData = {
+ smaller: 5,
+ larger: 7
+};
+
+ajv.validate(schema, validData); // true
+```
+
+This schema requires that the properties have the same format as their field names:
+
+```javascript
+var schema = {
+ "additionalProperties": {
+ "type": "string",
+ "format": { "$data": "0#" }
+ }
+};
+
+var validData = {
+ 'date-time': '1963-06-19T08:30:06.283185Z',
+ email: 'joe.bloggs@example.com'
+}
+```
+
+`$data` reference is resolved safely - it won't throw even if some property is undefined. If `$data` resolves to `undefined` the validation succeeds (with the exclusion of `const` keyword). If `$data` resolves to incorrect type (e.g. not "number" for maximum keyword) the validation fails.
+
+
+## $merge and $patch keywords
+
+With the package [ajv-merge-patch](https://github.com/ajv-validator/ajv-merge-patch) you can use the keywords `$merge` and `$patch` that allow extending JSON Schemas with patches using formats [JSON Merge Patch (RFC 7396)](https://tools.ietf.org/html/rfc7396) and [JSON Patch (RFC 6902)](https://tools.ietf.org/html/rfc6902).
+
+To add keywords `$merge` and `$patch` to Ajv instance use this code:
+
+```javascript
+require('ajv-merge-patch')(ajv);
+```
+
+Examples.
+
+Using `$merge`:
+
+```json
+{
+ "$merge": {
+ "source": {
+ "type": "object",
+ "properties": { "p": { "type": "string" } },
+ "additionalProperties": false
+ },
+ "with": {
+ "properties": { "q": { "type": "number" } }
+ }
+ }
+}
+```
+
+Using `$patch`:
+
+```json
+{
+ "$patch": {
+ "source": {
+ "type": "object",
+ "properties": { "p": { "type": "string" } },
+ "additionalProperties": false
+ },
+ "with": [
+ { "op": "add", "path": "/properties/q", "value": { "type": "number" } }
+ ]
+ }
+}
+```
+
+The schemas above are equivalent to this schema:
+
+```json
+{
+ "type": "object",
+ "properties": {
+ "p": { "type": "string" },
+ "q": { "type": "number" }
+ },
+ "additionalProperties": false
+}
+```
+
+The properties `source` and `with` in the keywords `$merge` and `$patch` can use absolute or relative `$ref` to point to other schemas previously added to the Ajv instance or to the fragments of the current schema.
+
+See the package [ajv-merge-patch](https://github.com/ajv-validator/ajv-merge-patch) for more information.
+
+
+## Defining custom keywords
+
+The advantages of using custom keywords are:
+
+- allow creating validation scenarios that cannot be expressed using JSON Schema
+- simplify your schemas
+- help bringing a bigger part of the validation logic to your schemas
+- make your schemas more expressive, less verbose and closer to your application domain
+- implement custom data processors that modify your data (`modifying` option MUST be used in keyword definition) and/or create side effects while the data is being validated
+
+If a keyword is used only for side-effects and its validation result is pre-defined, use option `valid: true/false` in keyword definition to simplify both generated code (no error handling in case of `valid: true`) and your keyword functions (no need to return any validation result).
+
+The concerns you have to be aware of when extending JSON Schema standard with custom keywords are the portability and understanding of your schemas. You will have to support these custom keywords on other platforms and to properly document these keywords so that everybody can understand them in your schemas.
+
+You can define custom keywords with [addKeyword](#api-addkeyword) method. Keywords are defined on the `ajv` instance level - new instances will not have previously defined keywords.
+
+Ajv allows defining keywords with:
+- validation function
+- compilation function
+- macro function
+- inline compilation function that should return code (as string) that will be inlined in the currently compiled schema.
+
+Example. `range` and `exclusiveRange` keywords using compiled schema:
+
+```javascript
+ajv.addKeyword('range', {
+ type: 'number',
+ compile: function (sch, parentSchema) {
+ var min = sch[0];
+ var max = sch[1];
+
+ return parentSchema.exclusiveRange === true
+ ? function (data) { return data > min && data < max; }
+ : function (data) { return data >= min && data <= max; }
+ }
+});
+
+var schema = { "range": [2, 4], "exclusiveRange": true };
+var validate = ajv.compile(schema);
+console.log(validate(2.01)); // true
+console.log(validate(3.99)); // true
+console.log(validate(2)); // false
+console.log(validate(4)); // false
+```
+
+Several custom keywords (typeof, instanceof, range and propertyNames) are defined in [ajv-keywords](https://github.com/ajv-validator/ajv-keywords) package - they can be used for your schemas and as a starting point for your own custom keywords.
+
+See [Defining custom keywords](https://github.com/ajv-validator/ajv/blob/master/CUSTOM.md) for more details.
+
+
+## Asynchronous schema compilation
+
+During asynchronous compilation remote references are loaded using supplied function. See `compileAsync` [method](#api-compileAsync) and `loadSchema` [option](#options).
+
+Example:
+
+```javascript
+var ajv = new Ajv({ loadSchema: loadSchema });
+
+ajv.compileAsync(schema).then(function (validate) {
+ var valid = validate(data);
+ // ...
+});
+
+function loadSchema(uri) {
+ return request.json(uri).then(function (res) {
+ if (res.statusCode >= 400)
+ throw new Error('Loading error: ' + res.statusCode);
+ return res.body;
+ });
+}
+```
+
+__Please note__: [Option](#options) `missingRefs` should NOT be set to `"ignore"` or `"fail"` for asynchronous compilation to work.
+
+
+## Asynchronous validation
+
+Example in Node.js REPL: https://tonicdev.com/esp/ajv-asynchronous-validation
+
+You can define custom formats and keywords that perform validation asynchronously by accessing database or some other service. You should add `async: true` in the keyword or format definition (see [addFormat](#api-addformat), [addKeyword](#api-addkeyword) and [Defining custom keywords](#defining-custom-keywords)).
+
+If your schema uses asynchronous formats/keywords or refers to some schema that contains them it should have `"$async": true` keyword so that Ajv can compile it correctly. If asynchronous format/keyword or reference to asynchronous schema is used in the schema without `$async` keyword Ajv will throw an exception during schema compilation.
+
+__Please note__: all asynchronous subschemas that are referenced from the current or other schemas should have `"$async": true` keyword as well, otherwise the schema compilation will fail.
+
+Validation function for an asynchronous custom format/keyword should return a promise that resolves with `true` or `false` (or rejects with `new Ajv.ValidationError(errors)` if you want to return custom errors from the keyword function).
+
+Ajv compiles asynchronous schemas to [es7 async functions](http://tc39.github.io/ecmascript-asyncawait/) that can optionally be transpiled with [nodent](https://github.com/MatAtBread/nodent). Async functions are supported in Node.js 7+ and all modern browsers. You can also supply any other transpiler as a function via `processCode` option. See [Options](#options).
+
+The compiled validation function has `$async: true` property (if the schema is asynchronous), so you can differentiate these functions if you are using both synchronous and asynchronous schemas.
+
+Validation result will be a promise that resolves with validated data or rejects with an exception `Ajv.ValidationError` that contains the array of validation errors in `errors` property.
+
+
+Example:
+
+```javascript
+var ajv = new Ajv;
+// require('ajv-async')(ajv);
+
+ajv.addKeyword('idExists', {
+ async: true,
+ type: 'number',
+ validate: checkIdExists
+});
+
+
+function checkIdExists(schema, data) {
+ return knex(schema.table)
+ .select('id')
+ .where('id', data)
+ .then(function (rows) {
+ return !!rows.length; // true if record is found
+ });
+}
+
+var schema = {
+ "$async": true,
+ "properties": {
+ "userId": {
+ "type": "integer",
+ "idExists": { "table": "users" }
+ },
+ "postId": {
+ "type": "integer",
+ "idExists": { "table": "posts" }
+ }
+ }
+};
+
+var validate = ajv.compile(schema);
+
+validate({ userId: 1, postId: 19 })
+.then(function (data) {
+ console.log('Data is valid', data); // { userId: 1, postId: 19 }
+})
+.catch(function (err) {
+ if (!(err instanceof Ajv.ValidationError)) throw err;
+ // data is invalid
+ console.log('Validation errors:', err.errors);
+});
+```
+
+### Using transpilers with asynchronous validation functions.
+
+[ajv-async](https://github.com/ajv-validator/ajv-async) uses [nodent](https://github.com/MatAtBread/nodent) to transpile async functions. To use another transpiler you should separately install it (or load its bundle in the browser).
+
+
+#### Using nodent
+
+```javascript
+var ajv = new Ajv;
+require('ajv-async')(ajv);
+// in the browser if you want to load ajv-async bundle separately you can:
+// window.ajvAsync(ajv);
+var validate = ajv.compile(schema); // transpiled es7 async function
+validate(data).then(successFunc).catch(errorFunc);
+```
+
+
+#### Using other transpilers
+
+```javascript
+var ajv = new Ajv({ processCode: transpileFunc });
+var validate = ajv.compile(schema); // transpiled es7 async function
+validate(data).then(successFunc).catch(errorFunc);
+```
+
+See [Options](#options).
+
+
+## Security considerations
+
+JSON Schema, if properly used, can replace data sanitisation. It doesn't replace other API security considerations. It also introduces additional security aspects to consider.
+
+
+##### Security contact
+
+To report a security vulnerability, please use the
+[Tidelift security contact](https://tidelift.com/security).
+Tidelift will coordinate the fix and disclosure. Please do NOT report security vulnerabilities via GitHub issues.
+
+
+##### Untrusted schemas
+
+Ajv treats JSON schemas as trusted as your application code. This security model is based on the most common use case, when the schemas are static and bundled together with the application.
+
+If your schemas are received from untrusted sources (or generated from untrusted data) there are several scenarios you need to prevent:
+- compiling schemas can cause stack overflow (if they are too deep)
+- compiling schemas can be slow (e.g. [#557](https://github.com/ajv-validator/ajv/issues/557))
+- validating certain data can be slow
+
+It is difficult to predict all the scenarios, but at the very least it may help to limit the size of untrusted schemas (e.g. limit JSON string length) and also the maximum schema object depth (that can be high for relatively small JSON strings). You also may want to mitigate slow regular expressions in `pattern` and `patternProperties` keywords.
+
+Regardless the measures you take, using untrusted schemas increases security risks.
+
+
+##### Circular references in JavaScript objects
+
+Ajv does not support schemas and validated data that have circular references in objects. See [issue #802](https://github.com/ajv-validator/ajv/issues/802).
+
+An attempt to compile such schemas or validate such data would cause stack overflow (or will not complete in case of asynchronous validation). Depending on the parser you use, untrusted data can lead to circular references.
+
+
+##### Security risks of trusted schemas
+
+Some keywords in JSON Schemas can lead to very slow validation for certain data. These keywords include (but may be not limited to):
+
+- `pattern` and `format` for large strings - in some cases using `maxLength` can help mitigate it, but certain regular expressions can lead to exponential validation time even with relatively short strings (see [ReDoS attack](#redos-attack)).
+- `patternProperties` for large property names - use `propertyNames` to mitigate, but some regular expressions can have exponential evaluation time as well.
+- `uniqueItems` for large non-scalar arrays - use `maxItems` to mitigate
+
+__Please note__: The suggestions above to prevent slow validation would only work if you do NOT use `allErrors: true` in production code (using it would continue validation after validation errors).
+
+You can validate your JSON schemas against [this meta-schema](https://github.com/ajv-validator/ajv/blob/master/lib/refs/json-schema-secure.json) to check that these recommendations are followed:
+
+```javascript
+const isSchemaSecure = ajv.compile(require('ajv/lib/refs/json-schema-secure.json'));
+
+const schema1 = {format: 'email'};
+isSchemaSecure(schema1); // false
+
+const schema2 = {format: 'email', maxLength: MAX_LENGTH};
+isSchemaSecure(schema2); // true
+```
+
+__Please note__: following all these recommendation is not a guarantee that validation of untrusted data is safe - it can still lead to some undesirable results.
+
+
+##### Content Security Policies (CSP)
+See [Ajv and Content Security Policies (CSP)](#ajv-and-content-security-policies-csp)
+
+
+## ReDoS attack
+
+Certain regular expressions can lead to the exponential evaluation time even with relatively short strings.
+
+Please assess the regular expressions you use in the schemas on their vulnerability to this attack - see [safe-regex](https://github.com/substack/safe-regex), for example.
+
+__Please note__: some formats that Ajv implements use [regular expressions](https://github.com/ajv-validator/ajv/blob/master/lib/compile/formats.js) that can be vulnerable to ReDoS attack, so if you use Ajv to validate data from untrusted sources __it is strongly recommended__ to consider the following:
+
+- making assessment of "format" implementations in Ajv.
+- using `format: 'fast'` option that simplifies some of the regular expressions (although it does not guarantee that they are safe).
+- replacing format implementations provided by Ajv with your own implementations of "format" keyword that either uses different regular expressions or another approach to format validation. Please see [addFormat](#api-addformat) method.
+- disabling format validation by ignoring "format" keyword with option `format: false`
+
+Whatever mitigation you choose, please assume all formats provided by Ajv as potentially unsafe and make your own assessment of their suitability for your validation scenarios.
+
+
+## Filtering data
+
+With [option `removeAdditional`](#options) (added by [andyscott](https://github.com/andyscott)) you can filter data during the validation.
+
+This option modifies original data.
+
+Example:
+
+```javascript
+var ajv = new Ajv({ removeAdditional: true });
+var schema = {
+ "additionalProperties": false,
+ "properties": {
+ "foo": { "type": "number" },
+ "bar": {
+ "additionalProperties": { "type": "number" },
+ "properties": {
+ "baz": { "type": "string" }
+ }
+ }
+ }
+}
+
+var data = {
+ "foo": 0,
+ "additional1": 1, // will be removed; `additionalProperties` == false
+ "bar": {
+ "baz": "abc",
+ "additional2": 2 // will NOT be removed; `additionalProperties` != false
+ },
+}
+
+var validate = ajv.compile(schema);
+
+console.log(validate(data)); // true
+console.log(data); // { "foo": 0, "bar": { "baz": "abc", "additional2": 2 }
+```
+
+If `removeAdditional` option in the example above were `"all"` then both `additional1` and `additional2` properties would have been removed.
+
+If the option were `"failing"` then property `additional1` would have been removed regardless of its value and property `additional2` would have been removed only if its value were failing the schema in the inner `additionalProperties` (so in the example above it would have stayed because it passes the schema, but any non-number would have been removed).
+
+__Please note__: If you use `removeAdditional` option with `additionalProperties` keyword inside `anyOf`/`oneOf` keywords your validation can fail with this schema, for example:
+
+```json
+{
+ "type": "object",
+ "oneOf": [
+ {
+ "properties": {
+ "foo": { "type": "string" }
+ },
+ "required": [ "foo" ],
+ "additionalProperties": false
+ },
+ {
+ "properties": {
+ "bar": { "type": "integer" }
+ },
+ "required": [ "bar" ],
+ "additionalProperties": false
+ }
+ ]
+}
+```
+
+The intention of the schema above is to allow objects with either the string property "foo" or the integer property "bar", but not with both and not with any other properties.
+
+With the option `removeAdditional: true` the validation will pass for the object `{ "foo": "abc"}` but will fail for the object `{"bar": 1}`. It happens because while the first subschema in `oneOf` is validated, the property `bar` is removed because it is an additional property according to the standard (because it is not included in `properties` keyword in the same schema).
+
+While this behaviour is unexpected (issues [#129](https://github.com/ajv-validator/ajv/issues/129), [#134](https://github.com/ajv-validator/ajv/issues/134)), it is correct. To have the expected behaviour (both objects are allowed and additional properties are removed) the schema has to be refactored in this way:
+
+```json
+{
+ "type": "object",
+ "properties": {
+ "foo": { "type": "string" },
+ "bar": { "type": "integer" }
+ },
+ "additionalProperties": false,
+ "oneOf": [
+ { "required": [ "foo" ] },
+ { "required": [ "bar" ] }
+ ]
+}
+```
+
+The schema above is also more efficient - it will compile into a faster function.
+
+
+## Assigning defaults
+
+With [option `useDefaults`](#options) Ajv will assign values from `default` keyword in the schemas of `properties` and `items` (when it is the array of schemas) to the missing properties and items.
+
+With the option value `"empty"` properties and items equal to `null` or `""` (empty string) will be considered missing and assigned defaults.
+
+This option modifies original data.
+
+__Please note__: the default value is inserted in the generated validation code as a literal, so the value inserted in the data will be the deep clone of the default in the schema.
+
+
+Example 1 (`default` in `properties`):
+
+```javascript
+var ajv = new Ajv({ useDefaults: true });
+var schema = {
+ "type": "object",
+ "properties": {
+ "foo": { "type": "number" },
+ "bar": { "type": "string", "default": "baz" }
+ },
+ "required": [ "foo", "bar" ]
+};
+
+var data = { "foo": 1 };
+
+var validate = ajv.compile(schema);
+
+console.log(validate(data)); // true
+console.log(data); // { "foo": 1, "bar": "baz" }
+```
+
+Example 2 (`default` in `items`):
+
+```javascript
+var schema = {
+ "type": "array",
+ "items": [
+ { "type": "number" },
+ { "type": "string", "default": "foo" }
+ ]
+}
+
+var data = [ 1 ];
+
+var validate = ajv.compile(schema);
+
+console.log(validate(data)); // true
+console.log(data); // [ 1, "foo" ]
+```
+
+`default` keywords in other cases are ignored:
+
+- not in `properties` or `items` subschemas
+- in schemas inside `anyOf`, `oneOf` and `not` (see [#42](https://github.com/ajv-validator/ajv/issues/42))
+- in `if` subschema of `switch` keyword
+- in schemas generated by custom macro keywords
+
+The [`strictDefaults` option](#options) customizes Ajv's behavior for the defaults that Ajv ignores (`true` raises an error, and `"log"` outputs a warning).
+
+
+## Coercing data types
+
+When you are validating user inputs all your data properties are usually strings. The option `coerceTypes` allows you to have your data types coerced to the types specified in your schema `type` keywords, both to pass the validation and to use the correctly typed data afterwards.
+
+This option modifies original data.
+
+__Please note__: if you pass a scalar value to the validating function its type will be coerced and it will pass the validation, but the value of the variable you pass won't be updated because scalars are passed by value.
+
+
+Example 1:
+
+```javascript
+var ajv = new Ajv({ coerceTypes: true });
+var schema = {
+ "type": "object",
+ "properties": {
+ "foo": { "type": "number" },
+ "bar": { "type": "boolean" }
+ },
+ "required": [ "foo", "bar" ]
+};
+
+var data = { "foo": "1", "bar": "false" };
+
+var validate = ajv.compile(schema);
+
+console.log(validate(data)); // true
+console.log(data); // { "foo": 1, "bar": false }
+```
+
+Example 2 (array coercions):
+
+```javascript
+var ajv = new Ajv({ coerceTypes: 'array' });
+var schema = {
+ "properties": {
+ "foo": { "type": "array", "items": { "type": "number" } },
+ "bar": { "type": "boolean" }
+ }
+};
+
+var data = { "foo": "1", "bar": ["false"] };
+
+var validate = ajv.compile(schema);
+
+console.log(validate(data)); // true
+console.log(data); // { "foo": [1], "bar": false }
+```
+
+The coercion rules, as you can see from the example, are different from JavaScript both to validate user input as expected and to have the coercion reversible (to correctly validate cases where different types are defined in subschemas of "anyOf" and other compound keywords).
+
+See [Coercion rules](https://github.com/ajv-validator/ajv/blob/master/COERCION.md) for details.
+
+
+## API
+
+##### new Ajv(Object options) -> Object
+
+Create Ajv instance.
+
+
+##### .compile(Object schema) -> Function<Object data>
+
+Generate validating function and cache the compiled schema for future use.
+
+Validating function returns a boolean value. This function has properties `errors` and `schema`. Errors encountered during the last validation are assigned to `errors` property (it is assigned `null` if there was no errors). `schema` property contains the reference to the original schema.
+
+The schema passed to this method will be validated against meta-schema unless `validateSchema` option is false. If schema is invalid, an error will be thrown. See [options](#options).
+
+
+##### .compileAsync(Object schema [, Boolean meta] [, Function callback]) -> Promise
+
+Asynchronous version of `compile` method that loads missing remote schemas using asynchronous function in `options.loadSchema`. This function returns a Promise that resolves to a validation function. An optional callback passed to `compileAsync` will be called with 2 parameters: error (or null) and validating function. The returned promise will reject (and the callback will be called with an error) when:
+
+- missing schema can't be loaded (`loadSchema` returns a Promise that rejects).
+- a schema containing a missing reference is loaded, but the reference cannot be resolved.
+- schema (or some loaded/referenced schema) is invalid.
+
+The function compiles schema and loads the first missing schema (or meta-schema) until all missing schemas are loaded.
+
+You can asynchronously compile meta-schema by passing `true` as the second parameter.
+
+See example in [Asynchronous compilation](#asynchronous-schema-compilation).
+
+
+##### .validate(Object schema|String key|String ref, data) -> Boolean
+
+Validate data using passed schema (it will be compiled and cached).
+
+Instead of the schema you can use the key that was previously passed to `addSchema`, the schema id if it was present in the schema or any previously resolved reference.
+
+Validation errors will be available in the `errors` property of Ajv instance (`null` if there were no errors).
+
+__Please note__: every time this method is called the errors are overwritten so you need to copy them to another variable if you want to use them later.
+
+If the schema is asynchronous (has `$async` keyword on the top level) this method returns a Promise. See [Asynchronous validation](#asynchronous-validation).
+
+
+##### .addSchema(Array<Object>|Object schema [, String key]) -> Ajv
+
+Add schema(s) to validator instance. This method does not compile schemas (but it still validates them). Because of that dependencies can be added in any order and circular dependencies are supported. It also prevents unnecessary compilation of schemas that are containers for other schemas but not used as a whole.
+
+Array of schemas can be passed (schemas should have ids), the second parameter will be ignored.
+
+Key can be passed that can be used to reference the schema and will be used as the schema id if there is no id inside the schema. If the key is not passed, the schema id will be used as the key.
+
+
+Once the schema is added, it (and all the references inside it) can be referenced in other schemas and used to validate data.
+
+Although `addSchema` does not compile schemas, explicit compilation is not required - the schema will be compiled when it is used first time.
+
+By default the schema is validated against meta-schema before it is added, and if the schema does not pass validation the exception is thrown. This behaviour is controlled by `validateSchema` option.
+
+__Please note__: Ajv uses the [method chaining syntax](https://en.wikipedia.org/wiki/Method_chaining) for all methods with the prefix `add*` and `remove*`.
+This allows you to do nice things like the following.
+
+```javascript
+var validate = new Ajv().addSchema(schema).addFormat(name, regex).getSchema(uri);
+```
+
+##### .addMetaSchema(Array<Object>|Object schema [, String key]) -> Ajv
+
+Adds meta schema(s) that can be used to validate other schemas. That function should be used instead of `addSchema` because there may be instance options that would compile a meta schema incorrectly (at the moment it is `removeAdditional` option).
+
+There is no need to explicitly add draft-07 meta schema (http://json-schema.org/draft-07/schema) - it is added by default, unless option `meta` is set to `false`. You only need to use it if you have a changed meta-schema that you want to use to validate your schemas. See `validateSchema`.
+
+
+##### .validateSchema(Object schema) -> Boolean
+
+Validates schema. This method should be used to validate schemas rather than `validate` due to the inconsistency of `uri` format in JSON Schema standard.
+
+By default this method is called automatically when the schema is added, so you rarely need to use it directly.
+
+If schema doesn't have `$schema` property, it is validated against draft 6 meta-schema (option `meta` should not be false).
+
+If schema has `$schema` property, then the schema with this id (that should be previously added) is used to validate passed schema.
+
+Errors will be available at `ajv.errors`.
+
+
+##### .getSchema(String key) -> Function<Object data>
+
+Retrieve compiled schema previously added with `addSchema` by the key passed to `addSchema` or by its full reference (id). The returned validating function has `schema` property with the reference to the original schema.
+
+
+##### .removeSchema([Object schema|String key|String ref|RegExp pattern]) -> Ajv
+
+Remove added/cached schema. Even if schema is referenced by other schemas it can be safely removed as dependent schemas have local references.
+
+Schema can be removed using:
+- key passed to `addSchema`
+- it's full reference (id)
+- RegExp that should match schema id or key (meta-schemas won't be removed)
+- actual schema object that will be stable-stringified to remove schema from cache
+
+If no parameter is passed all schemas but meta-schemas will be removed and the cache will be cleared.
+
+
+##### .addFormat(String name, String|RegExp|Function|Object format) -> Ajv
+
+Add custom format to validate strings or numbers. It can also be used to replace pre-defined formats for Ajv instance.
+
+Strings are converted to RegExp.
+
+Function should return validation result as `true` or `false`.
+
+If object is passed it should have properties `validate`, `compare` and `async`:
+
+- _validate_: a string, RegExp or a function as described above.
+- _compare_: an optional comparison function that accepts two strings and compares them according to the format meaning. This function is used with keywords `formatMaximum`/`formatMinimum` (defined in [ajv-keywords](https://github.com/ajv-validator/ajv-keywords) package). It should return `1` if the first value is bigger than the second value, `-1` if it is smaller and `0` if it is equal.
+- _async_: an optional `true` value if `validate` is an asynchronous function; in this case it should return a promise that resolves with a value `true` or `false`.
+- _type_: an optional type of data that the format applies to. It can be `"string"` (default) or `"number"` (see https://github.com/ajv-validator/ajv/issues/291#issuecomment-259923858). If the type of data is different, the validation will pass.
+
+Custom formats can be also added via `formats` option.
+
+
+##### .addKeyword(String keyword, Object definition) -> Ajv
+
+Add custom validation keyword to Ajv instance.
+
+Keyword should be different from all standard JSON Schema keywords and different from previously defined keywords. There is no way to redefine keywords or to remove keyword definition from the instance.
+
+Keyword must start with a letter, `_` or `$`, and may continue with letters, numbers, `_`, `$`, or `-`.
+It is recommended to use an application-specific prefix for keywords to avoid current and future name collisions.
+
+Example Keywords:
+- `"xyz-example"`: valid, and uses prefix for the xyz project to avoid name collisions.
+- `"example"`: valid, but not recommended as it could collide with future versions of JSON Schema etc.
+- `"3-example"`: invalid as numbers are not allowed to be the first character in a keyword
+
+Keyword definition is an object with the following properties:
+
+- _type_: optional string or array of strings with data type(s) that the keyword applies to. If not present, the keyword will apply to all types.
+- _validate_: validating function
+- _compile_: compiling function
+- _macro_: macro function
+- _inline_: compiling function that returns code (as string)
+- _schema_: an optional `false` value used with "validate" keyword to not pass schema
+- _metaSchema_: an optional meta-schema for keyword schema
+- _dependencies_: an optional list of properties that must be present in the parent schema - it will be checked during schema compilation
+- _modifying_: `true` MUST be passed if keyword modifies data
+- _statements_: `true` can be passed in case inline keyword generates statements (as opposed to expression)
+- _valid_: pass `true`/`false` to pre-define validation result, the result returned from validation function will be ignored. This option cannot be used with macro keywords.
+- _$data_: an optional `true` value to support [$data reference](#data-reference) as the value of custom keyword. The reference will be resolved at validation time. If the keyword has meta-schema it would be extended to allow $data and it will be used to validate the resolved value. Supporting $data reference requires that keyword has validating function (as the only option or in addition to compile, macro or inline function).
+- _async_: an optional `true` value if the validation function is asynchronous (whether it is compiled or passed in _validate_ property); in this case it should return a promise that resolves with a value `true` or `false`. This option is ignored in case of "macro" and "inline" keywords.
+- _errors_: an optional boolean or string `"full"` indicating whether keyword returns errors. If this property is not set Ajv will determine if the errors were set in case of failed validation.
+
+_compile_, _macro_ and _inline_ are mutually exclusive, only one should be used at a time. _validate_ can be used separately or in addition to them to support $data reference.
+
+__Please note__: If the keyword is validating data type that is different from the type(s) in its definition, the validation function will not be called (and expanded macro will not be used), so there is no need to check for data type inside validation function or inside schema returned by macro function (unless you want to enforce a specific type and for some reason do not want to use a separate `type` keyword for that). In the same way as standard keywords work, if the keyword does not apply to the data type being validated, the validation of this keyword will succeed.
+
+See [Defining custom keywords](#defining-custom-keywords) for more details.
+
+
+##### .getKeyword(String keyword) -> Object|Boolean
+
+Returns custom keyword definition, `true` for pre-defined keywords and `false` if the keyword is unknown.
+
+
+##### .removeKeyword(String keyword) -> Ajv
+
+Removes custom or pre-defined keyword so you can redefine them.
+
+While this method can be used to extend pre-defined keywords, it can also be used to completely change their meaning - it may lead to unexpected results.
+
+__Please note__: schemas compiled before the keyword is removed will continue to work without changes. To recompile schemas use `removeSchema` method and compile them again.
+
+
+##### .errorsText([Array<Object> errors [, Object options]]) -> String
+
+Returns the text with all errors in a String.
+
+Options can have properties `separator` (string used to separate errors, ", " by default) and `dataVar` (the variable name that dataPaths are prefixed with, "data" by default).
+
+
+## Options
+
+Defaults:
+
+```javascript
+{
+ // validation and reporting options:
+ $data: false,
+ allErrors: false,
+ verbose: false,
+ $comment: false, // NEW in Ajv version 6.0
+ jsonPointers: false,
+ uniqueItems: true,
+ unicode: true,
+ nullable: false,
+ format: 'fast',
+ formats: {},
+ unknownFormats: true,
+ schemas: {},
+ logger: undefined,
+ // referenced schema options:
+ schemaId: '$id',
+ missingRefs: true,
+ extendRefs: 'ignore', // recommended 'fail'
+ loadSchema: undefined, // function(uri: string): Promise {}
+ // options to modify validated data:
+ removeAdditional: false,
+ useDefaults: false,
+ coerceTypes: false,
+ // strict mode options
+ strictDefaults: false,
+ strictKeywords: false,
+ strictNumbers: false,
+ // asynchronous validation options:
+ transpile: undefined, // requires ajv-async package
+ // advanced options:
+ meta: true,
+ validateSchema: true,
+ addUsedSchema: true,
+ inlineRefs: true,
+ passContext: false,
+ loopRequired: Infinity,
+ ownProperties: false,
+ multipleOfPrecision: false,
+ errorDataPath: 'object', // deprecated
+ messages: true,
+ sourceCode: false,
+ processCode: undefined, // function (str: string, schema: object): string {}
+ cache: new Cache,
+ serialize: undefined
+}
+```
+
+##### Validation and reporting options
+
+- _$data_: support [$data references](#data-reference). Draft 6 meta-schema that is added by default will be extended to allow them. If you want to use another meta-schema you need to use $dataMetaSchema method to add support for $data reference. See [API](#api).
+- _allErrors_: check all rules collecting all errors. Default is to return after the first error.
+- _verbose_: include the reference to the part of the schema (`schema` and `parentSchema`) and validated data in errors (false by default).
+- _$comment_ (NEW in Ajv version 6.0): log or pass the value of `$comment` keyword to a function. Option values:
+ - `false` (default): ignore $comment keyword.
+ - `true`: log the keyword value to console.
+ - function: pass the keyword value, its schema path and root schema to the specified function
+- _jsonPointers_: set `dataPath` property of errors using [JSON Pointers](https://tools.ietf.org/html/rfc6901) instead of JavaScript property access notation.
+- _uniqueItems_: validate `uniqueItems` keyword (true by default).
+- _unicode_: calculate correct length of strings with unicode pairs (true by default). Pass `false` to use `.length` of strings that is faster, but gives "incorrect" lengths of strings with unicode pairs - each unicode pair is counted as two characters.
+- _nullable_: support keyword "nullable" from [Open API 3 specification](https://swagger.io/docs/specification/data-models/data-types/).
+- _format_: formats validation mode. Option values:
+ - `"fast"` (default) - simplified and fast validation (see [Formats](#formats) for details of which formats are available and affected by this option).
+ - `"full"` - more restrictive and slow validation. E.g., 25:00:00 and 2015/14/33 will be invalid time and date in 'full' mode but it will be valid in 'fast' mode.
+ - `false` - ignore all format keywords.
+- _formats_: an object with custom formats. Keys and values will be passed to `addFormat` method.
+- _keywords_: an object with custom keywords. Keys and values will be passed to `addKeyword` method.
+- _unknownFormats_: handling of unknown formats. Option values:
+ - `true` (default) - if an unknown format is encountered the exception is thrown during schema compilation. If `format` keyword value is [$data reference](#data-reference) and it is unknown the validation will fail.
+ - `[String]` - an array of unknown format names that will be ignored. This option can be used to allow usage of third party schemas with format(s) for which you don't have definitions, but still fail if another unknown format is used. If `format` keyword value is [$data reference](#data-reference) and it is not in this array the validation will fail.
+ - `"ignore"` - to log warning during schema compilation and always pass validation (the default behaviour in versions before 5.0.0). This option is not recommended, as it allows to mistype format name and it won't be validated without any error message. This behaviour is required by JSON Schema specification.
+- _schemas_: an array or object of schemas that will be added to the instance. In case you pass the array the schemas must have IDs in them. When the object is passed the method `addSchema(value, key)` will be called for each schema in this object.
+- _logger_: sets the logging method. Default is the global `console` object that should have methods `log`, `warn` and `error`. See [Error logging](#error-logging). Option values:
+ - custom logger - it should have methods `log`, `warn` and `error`. If any of these methods is missing an exception will be thrown.
+ - `false` - logging is disabled.
+
+
+##### Referenced schema options
+
+- _schemaId_: this option defines which keywords are used as schema URI. Option value:
+ - `"$id"` (default) - only use `$id` keyword as schema URI (as specified in JSON Schema draft-06/07), ignore `id` keyword (if it is present a warning will be logged).
+ - `"id"` - only use `id` keyword as schema URI (as specified in JSON Schema draft-04), ignore `$id` keyword (if it is present a warning will be logged).
+ - `"auto"` - use both `$id` and `id` keywords as schema URI. If both are present (in the same schema object) and different the exception will be thrown during schema compilation.
+- _missingRefs_: handling of missing referenced schemas. Option values:
+ - `true` (default) - if the reference cannot be resolved during compilation the exception is thrown. The thrown error has properties `missingRef` (with hash fragment) and `missingSchema` (without it). Both properties are resolved relative to the current base id (usually schema id, unless it was substituted).
+ - `"ignore"` - to log error during compilation and always pass validation.
+ - `"fail"` - to log error and successfully compile schema but fail validation if this rule is checked.
+- _extendRefs_: validation of other keywords when `$ref` is present in the schema. Option values:
+ - `"ignore"` (default) - when `$ref` is used other keywords are ignored (as per [JSON Reference](https://tools.ietf.org/html/draft-pbryan-zyp-json-ref-03#section-3) standard). A warning will be logged during the schema compilation.
+ - `"fail"` (recommended) - if other validation keywords are used together with `$ref` the exception will be thrown when the schema is compiled. This option is recommended to make sure schema has no keywords that are ignored, which can be confusing.
+ - `true` - validate all keywords in the schemas with `$ref` (the default behaviour in versions before 5.0.0).
+- _loadSchema_: asynchronous function that will be used to load remote schemas when `compileAsync` [method](#api-compileAsync) is used and some reference is missing (option `missingRefs` should NOT be 'fail' or 'ignore'). This function should accept remote schema uri as a parameter and return a Promise that resolves to a schema. See example in [Asynchronous compilation](#asynchronous-schema-compilation).
+
+
+##### Options to modify validated data
+
+- _removeAdditional_: remove additional properties - see example in [Filtering data](#filtering-data). This option is not used if schema is added with `addMetaSchema` method. Option values:
+ - `false` (default) - not to remove additional properties
+ - `"all"` - all additional properties are removed, regardless of `additionalProperties` keyword in schema (and no validation is made for them).
+ - `true` - only additional properties with `additionalProperties` keyword equal to `false` are removed.
+ - `"failing"` - additional properties that fail schema validation will be removed (where `additionalProperties` keyword is `false` or schema).
+- _useDefaults_: replace missing or undefined properties and items with the values from corresponding `default` keywords. Default behaviour is to ignore `default` keywords. This option is not used if schema is added with `addMetaSchema` method. See examples in [Assigning defaults](#assigning-defaults). Option values:
+ - `false` (default) - do not use defaults
+ - `true` - insert defaults by value (object literal is used).
+ - `"empty"` - in addition to missing or undefined, use defaults for properties and items that are equal to `null` or `""` (an empty string).
+ - `"shared"` (deprecated) - insert defaults by reference. If the default is an object, it will be shared by all instances of validated data. If you modify the inserted default in the validated data, it will be modified in the schema as well.
+- _coerceTypes_: change data type of data to match `type` keyword. See the example in [Coercing data types](#coercing-data-types) and [coercion rules](https://github.com/ajv-validator/ajv/blob/master/COERCION.md). Option values:
+ - `false` (default) - no type coercion.
+ - `true` - coerce scalar data types.
+ - `"array"` - in addition to coercions between scalar types, coerce scalar data to an array with one element and vice versa (as required by the schema).
+
+
+##### Strict mode options
+
+- _strictDefaults_: report ignored `default` keywords in schemas. Option values:
+ - `false` (default) - ignored defaults are not reported
+ - `true` - if an ignored default is present, throw an error
+ - `"log"` - if an ignored default is present, log warning
+- _strictKeywords_: report unknown keywords in schemas. Option values:
+ - `false` (default) - unknown keywords are not reported
+ - `true` - if an unknown keyword is present, throw an error
+ - `"log"` - if an unknown keyword is present, log warning
+- _strictNumbers_: validate numbers strictly, failing validation for NaN and Infinity. Option values:
+ - `false` (default) - NaN or Infinity will pass validation for numeric types
+ - `true` - NaN or Infinity will not pass validation for numeric types
+
+##### Asynchronous validation options
+
+- _transpile_: Requires [ajv-async](https://github.com/ajv-validator/ajv-async) package. It determines whether Ajv transpiles compiled asynchronous validation function. Option values:
+ - `undefined` (default) - transpile with [nodent](https://github.com/MatAtBread/nodent) if async functions are not supported.
+ - `true` - always transpile with nodent.
+ - `false` - do not transpile; if async functions are not supported an exception will be thrown.
+
+
+##### Advanced options
+
+- _meta_: add [meta-schema](http://json-schema.org/documentation.html) so it can be used by other schemas (true by default). If an object is passed, it will be used as the default meta-schema for schemas that have no `$schema` keyword. This default meta-schema MUST have `$schema` keyword.
+- _validateSchema_: validate added/compiled schemas against meta-schema (true by default). `$schema` property in the schema can be http://json-schema.org/draft-07/schema or absent (draft-07 meta-schema will be used) or can be a reference to the schema previously added with `addMetaSchema` method. Option values:
+ - `true` (default) - if the validation fails, throw the exception.
+ - `"log"` - if the validation fails, log error.
+ - `false` - skip schema validation.
+- _addUsedSchema_: by default methods `compile` and `validate` add schemas to the instance if they have `$id` (or `id`) property that doesn't start with "#". If `$id` is present and it is not unique the exception will be thrown. Set this option to `false` to skip adding schemas to the instance and the `$id` uniqueness check when these methods are used. This option does not affect `addSchema` method.
+- _inlineRefs_: Affects compilation of referenced schemas. Option values:
+ - `true` (default) - the referenced schemas that don't have refs in them are inlined, regardless of their size - that substantially improves performance at the cost of the bigger size of compiled schema functions.
+ - `false` - to not inline referenced schemas (they will be compiled as separate functions).
+ - integer number - to limit the maximum number of keywords of the schema that will be inlined.
+- _passContext_: pass validation context to custom keyword functions. If this option is `true` and you pass some context to the compiled validation function with `validate.call(context, data)`, the `context` will be available as `this` in your custom keywords. By default `this` is Ajv instance.
+- _loopRequired_: by default `required` keyword is compiled into a single expression (or a sequence of statements in `allErrors` mode). In case of a very large number of properties in this keyword it may result in a very big validation function. Pass integer to set the number of properties above which `required` keyword will be validated in a loop - smaller validation function size but also worse performance.
+- _ownProperties_: by default Ajv iterates over all enumerable object properties; when this option is `true` only own enumerable object properties (i.e. found directly on the object rather than on its prototype) are iterated. Contributed by @mbroadst.
+- _multipleOfPrecision_: by default `multipleOf` keyword is validated by comparing the result of division with parseInt() of that result. It works for dividers that are bigger than 1. For small dividers such as 0.01 the result of the division is usually not integer (even when it should be integer, see issue [#84](https://github.com/ajv-validator/ajv/issues/84)). If you need to use fractional dividers set this option to some positive integer N to have `multipleOf` validated using this formula: `Math.abs(Math.round(division) - division) < 1e-N` (it is slower but allows for float arithmetics deviations).
+- _errorDataPath_ (deprecated): set `dataPath` to point to 'object' (default) or to 'property' when validating keywords `required`, `additionalProperties` and `dependencies`.
+- _messages_: Include human-readable messages in errors. `true` by default. `false` can be passed when custom messages are used (e.g. with [ajv-i18n](https://github.com/ajv-validator/ajv-i18n)).
+- _sourceCode_: add `sourceCode` property to validating function (for debugging; this code can be different from the result of toString call).
+- _processCode_: an optional function to process generated code before it is passed to Function constructor. It can be used to either beautify (the validating function is generated without line-breaks) or to transpile code. Starting from version 5.0.0 this option replaced options:
+ - `beautify` that formatted the generated function using [js-beautify](https://github.com/beautify-web/js-beautify). If you want to beautify the generated code pass a function calling `require('js-beautify').js_beautify` as `processCode: code => js_beautify(code)`.
+ - `transpile` that transpiled asynchronous validation function. You can still use `transpile` option with [ajv-async](https://github.com/ajv-validator/ajv-async) package. See [Asynchronous validation](#asynchronous-validation) for more information.
+- _cache_: an optional instance of cache to store compiled schemas using stable-stringified schema as a key. For example, set-associative cache [sacjs](https://github.com/epoberezkin/sacjs) can be used. If not passed then a simple hash is used which is good enough for the common use case (a limited number of statically defined schemas). Cache should have methods `put(key, value)`, `get(key)`, `del(key)` and `clear()`.
+- _serialize_: an optional function to serialize schema to cache key. Pass `false` to use schema itself as a key (e.g., if WeakMap used as a cache). By default [fast-json-stable-stringify](https://github.com/epoberezkin/fast-json-stable-stringify) is used.
+
+
+## Validation errors
+
+In case of validation failure, Ajv assigns the array of errors to `errors` property of validation function (or to `errors` property of Ajv instance when `validate` or `validateSchema` methods were called). In case of [asynchronous validation](#asynchronous-validation), the returned promise is rejected with exception `Ajv.ValidationError` that has `errors` property.
+
+
+### Error objects
+
+Each error is an object with the following properties:
+
+- _keyword_: validation keyword.
+- _dataPath_: the path to the part of the data that was validated. By default `dataPath` uses JavaScript property access notation (e.g., `".prop[1].subProp"`). When the option `jsonPointers` is true (see [Options](#options)) `dataPath` will be set using JSON pointer standard (e.g., `"/prop/1/subProp"`).
+- _schemaPath_: the path (JSON-pointer as a URI fragment) to the schema of the keyword that failed validation.
+- _params_: the object with the additional information about error that can be used to create custom error messages (e.g., using [ajv-i18n](https://github.com/ajv-validator/ajv-i18n) package). See below for parameters set by all keywords.
+- _message_: the standard error message (can be excluded with option `messages` set to false).
+- _schema_: the schema of the keyword (added with `verbose` option).
+- _parentSchema_: the schema containing the keyword (added with `verbose` option)
+- _data_: the data validated by the keyword (added with `verbose` option).
+
+__Please note__: `propertyNames` keyword schema validation errors have an additional property `propertyName`, `dataPath` points to the object. After schema validation for each property name, if it is invalid an additional error is added with the property `keyword` equal to `"propertyNames"`.
+
+
+### Error parameters
+
+Properties of `params` object in errors depend on the keyword that failed validation.
+
+- `maxItems`, `minItems`, `maxLength`, `minLength`, `maxProperties`, `minProperties` - property `limit` (number, the schema of the keyword).
+- `additionalItems` - property `limit` (the maximum number of allowed items in case when `items` keyword is an array of schemas and `additionalItems` is false).
+- `additionalProperties` - property `additionalProperty` (the property not used in `properties` and `patternProperties` keywords).
+- `dependencies` - properties:
+ - `property` (dependent property),
+ - `missingProperty` (required missing dependency - only the first one is reported currently)
+ - `deps` (required dependencies, comma separated list as a string),
+ - `depsCount` (the number of required dependencies).
+- `format` - property `format` (the schema of the keyword).
+- `maximum`, `minimum` - properties:
+ - `limit` (number, the schema of the keyword),
+ - `exclusive` (boolean, the schema of `exclusiveMaximum` or `exclusiveMinimum`),
+ - `comparison` (string, comparison operation to compare the data to the limit, with the data on the left and the limit on the right; can be "<", "<=", ">", ">=")
+- `multipleOf` - property `multipleOf` (the schema of the keyword)
+- `pattern` - property `pattern` (the schema of the keyword)
+- `required` - property `missingProperty` (required property that is missing).
+- `propertyNames` - property `propertyName` (an invalid property name).
+- `patternRequired` (in ajv-keywords) - property `missingPattern` (required pattern that did not match any property).
+- `type` - property `type` (required type(s), a string, can be a comma-separated list)
+- `uniqueItems` - properties `i` and `j` (indices of duplicate items).
+- `const` - property `allowedValue` pointing to the value (the schema of the keyword).
+- `enum` - property `allowedValues` pointing to the array of values (the schema of the keyword).
+- `$ref` - property `ref` with the referenced schema URI.
+- `oneOf` - property `passingSchemas` (array of indices of passing schemas, null if no schema passes).
+- custom keywords (in case keyword definition doesn't create errors) - property `keyword` (the keyword name).
+
+
+### Error logging
+
+Using the `logger` option when initiallizing Ajv will allow you to define custom logging. Here you can build upon the exisiting logging. The use of other logging packages is supported as long as the package or its associated wrapper exposes the required methods. If any of the required methods are missing an exception will be thrown.
+- **Required Methods**: `log`, `warn`, `error`
+
+```javascript
+var otherLogger = new OtherLogger();
+var ajv = new Ajv({
+ logger: {
+ log: console.log.bind(console),
+ warn: function warn() {
+ otherLogger.logWarn.apply(otherLogger, arguments);
+ },
+ error: function error() {
+ otherLogger.logError.apply(otherLogger, arguments);
+ console.error.apply(console, arguments);
+ }
+ }
+});
+```
+
+
+## Plugins
+
+Ajv can be extended with plugins that add custom keywords, formats or functions to process generated code. When such plugin is published as npm package it is recommended that it follows these conventions:
+
+- it exports a function
+- this function accepts ajv instance as the first parameter and returns the same instance to allow chaining
+- this function can accept an optional configuration as the second parameter
+
+If you have published a useful plugin please submit a PR to add it to the next section.
+
+
+## Related packages
+
+- [ajv-async](https://github.com/ajv-validator/ajv-async) - plugin to configure async validation mode
+- [ajv-bsontype](https://github.com/BoLaMN/ajv-bsontype) - plugin to validate mongodb's bsonType formats
+- [ajv-cli](https://github.com/jessedc/ajv-cli) - command line interface
+- [ajv-errors](https://github.com/ajv-validator/ajv-errors) - plugin for custom error messages
+- [ajv-i18n](https://github.com/ajv-validator/ajv-i18n) - internationalised error messages
+- [ajv-istanbul](https://github.com/ajv-validator/ajv-istanbul) - plugin to instrument generated validation code to measure test coverage of your schemas
+- [ajv-keywords](https://github.com/ajv-validator/ajv-keywords) - plugin with custom validation keywords (select, typeof, etc.)
+- [ajv-merge-patch](https://github.com/ajv-validator/ajv-merge-patch) - plugin with keywords $merge and $patch
+- [ajv-pack](https://github.com/ajv-validator/ajv-pack) - produces a compact module exporting validation functions
+- [ajv-formats-draft2019](https://github.com/luzlab/ajv-formats-draft2019) - format validators for draft2019 that aren't already included in ajv (ie. `idn-hostname`, `idn-email`, `iri`, `iri-reference` and `duration`).
+
+## Some packages using Ajv
+
+- [webpack](https://github.com/webpack/webpack) - a module bundler. Its main purpose is to bundle JavaScript files for usage in a browser
+- [jsonscript-js](https://github.com/JSONScript/jsonscript-js) - the interpreter for [JSONScript](http://www.jsonscript.org) - scripted processing of existing endpoints and services
+- [osprey-method-handler](https://github.com/mulesoft-labs/osprey-method-handler) - Express middleware for validating requests and responses based on a RAML method object, used in [osprey](https://github.com/mulesoft/osprey) - validating API proxy generated from a RAML definition
+- [har-validator](https://github.com/ahmadnassri/har-validator) - HTTP Archive (HAR) validator
+- [jsoneditor](https://github.com/josdejong/jsoneditor) - a web-based tool to view, edit, format, and validate JSON http://jsoneditoronline.org
+- [JSON Schema Lint](https://github.com/nickcmaynard/jsonschemalint) - a web tool to validate JSON/YAML document against a single JSON Schema http://jsonschemalint.com
+- [objection](https://github.com/vincit/objection.js) - SQL-friendly ORM for Node.js
+- [table](https://github.com/gajus/table) - formats data into a string table
+- [ripple-lib](https://github.com/ripple/ripple-lib) - a JavaScript API for interacting with [Ripple](https://ripple.com) in Node.js and the browser
+- [restbase](https://github.com/wikimedia/restbase) - distributed storage with REST API & dispatcher for backend services built to provide a low-latency & high-throughput API for Wikipedia / Wikimedia content
+- [hippie-swagger](https://github.com/CacheControl/hippie-swagger) - [Hippie](https://github.com/vesln/hippie) wrapper that provides end to end API testing with swagger validation
+- [react-form-controlled](https://github.com/seeden/react-form-controlled) - React controlled form components with validation
+- [rabbitmq-schema](https://github.com/tjmehta/rabbitmq-schema) - a schema definition module for RabbitMQ graphs and messages
+- [@query/schema](https://www.npmjs.com/package/@query/schema) - stream filtering with a URI-safe query syntax parsing to JSON Schema
+- [chai-ajv-json-schema](https://github.com/peon374/chai-ajv-json-schema) - chai plugin to us JSON Schema with expect in mocha tests
+- [grunt-jsonschema-ajv](https://github.com/SignpostMarv/grunt-jsonschema-ajv) - Grunt plugin for validating files against JSON Schema
+- [extract-text-webpack-plugin](https://github.com/webpack-contrib/extract-text-webpack-plugin) - extract text from bundle into a file
+- [electron-builder](https://github.com/electron-userland/electron-builder) - a solution to package and build a ready for distribution Electron app
+- [addons-linter](https://github.com/mozilla/addons-linter) - Mozilla Add-ons Linter
+- [gh-pages-generator](https://github.com/epoberezkin/gh-pages-generator) - multi-page site generator converting markdown files to GitHub pages
+- [ESLint](https://github.com/eslint/eslint) - the pluggable linting utility for JavaScript and JSX
+
+
+## Tests
+
+```
+npm install
+git submodule update --init
+npm test
+```
+
+## Contributing
+
+All validation functions are generated using doT templates in [dot](https://github.com/ajv-validator/ajv/tree/master/lib/dot) folder. Templates are precompiled so doT is not a run-time dependency.
+
+`npm run build` - compiles templates to [dotjs](https://github.com/ajv-validator/ajv/tree/master/lib/dotjs) folder.
+
+`npm run watch` - automatically compiles templates when files in dot folder change
+
+Please see [Contributing guidelines](https://github.com/ajv-validator/ajv/blob/master/CONTRIBUTING.md)
+
+
+## Changes history
+
+See https://github.com/ajv-validator/ajv/releases
+
+__Please note__: [Changes in version 7.0.0-beta](https://github.com/ajv-validator/ajv/releases/tag/v7.0.0-beta.0)
+
+[Version 6.0.0](https://github.com/ajv-validator/ajv/releases/tag/v6.0.0).
+
+## Code of conduct
+
+Please review and follow the [Code of conduct](https://github.com/ajv-validator/ajv/blob/master/CODE_OF_CONDUCT.md).
+
+Please report any unacceptable behaviour to ajv.validator@gmail.com - it will be reviewed by the project team.
+
+
+## Open-source software support
+
+Ajv is a part of [Tidelift subscription](https://tidelift.com/subscription/pkg/npm-ajv?utm_source=npm-ajv&utm_medium=referral&utm_campaign=readme) - it provides a centralised support to open-source software users, in addition to the support provided by software maintainers.
+
+
+## License
+
+[MIT](https://github.com/ajv-validator/ajv/blob/master/LICENSE)
diff --git a/website_quotation_template/node_modules/ajv/lib/ajv.d.ts b/website_quotation_template/node_modules/ajv/lib/ajv.d.ts
new file mode 100644
index 000000000..078364d8c
--- /dev/null
+++ b/website_quotation_template/node_modules/ajv/lib/ajv.d.ts
@@ -0,0 +1,397 @@
+declare var ajv: {
+ (options?: ajv.Options): ajv.Ajv;
+ new(options?: ajv.Options): ajv.Ajv;
+ ValidationError: typeof AjvErrors.ValidationError;
+ MissingRefError: typeof AjvErrors.MissingRefError;
+ $dataMetaSchema: object;
+}
+
+declare namespace AjvErrors {
+ class ValidationError extends Error {
+ constructor(errors: Array